IL35885A - 5-(2-fluorophenyl)-1,3-dihydro-7-iodo-2h-1,4-benzodiazepin-2-one derivatives and their preparation - Google Patents
5-(2-fluorophenyl)-1,3-dihydro-7-iodo-2h-1,4-benzodiazepin-2-one derivatives and their preparationInfo
- Publication number
- IL35885A IL35885A IL35885A IL3588570A IL35885A IL 35885 A IL35885 A IL 35885A IL 35885 A IL35885 A IL 35885A IL 3588570 A IL3588570 A IL 3588570A IL 35885 A IL35885 A IL 35885A
- Authority
- IL
- Israel
- Prior art keywords
- benzodiazepin
- iodo
- fluorophenyl
- dihydro
- derivatives
- Prior art date
Links
- UBSKLVILVGEEON-UHFFFAOYSA-N 5-(2-fluorophenyl)-7-iodo-1,3-dihydro-1,4-benzodiazepin-2-one Chemical class FC1=CC=CC=C1C1=NCC(=O)NC2=CC=C(I)C=C12 UBSKLVILVGEEON-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/22—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
- C07D243/16—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals
- C07D243/18—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals substituted in position 2 by nitrogen, oxygen or sulfur atoms
- C07D243/24—Oxygen atoms
- C07D243/28—Preparation including building-up the benzodiazepine skeleton from compounds containing no hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US4253370A | 1970-06-01 | 1970-06-01 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL35885A0 IL35885A0 (en) | 1971-04-28 |
| IL35885A true IL35885A (en) | 1974-05-16 |
Family
ID=21922438
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL35885A IL35885A (en) | 1970-06-01 | 1970-12-21 | 5-(2-fluorophenyl)-1,3-dihydro-7-iodo-2h-1,4-benzodiazepin-2-one derivatives and their preparation |
Country Status (15)
| Country | Link |
|---|---|
| AR (1) | AR193050A1 (cs) |
| BE (1) | BE760510A (cs) |
| BG (3) | BG18187A3 (cs) |
| CH (2) | CH549586A (cs) |
| DE (1) | DE2062927A1 (cs) |
| DK (1) | DK136647B (cs) |
| ES (1) | ES386685A1 (cs) |
| FR (1) | FR2093923B1 (cs) |
| GB (1) | GB1332699A (cs) |
| IE (1) | IE35428B1 (cs) |
| IL (1) | IL35885A (cs) |
| NL (1) | NL7018577A (cs) |
| NO (1) | NO130681C (cs) |
| PH (1) | PH9829A (cs) |
| SE (2) | SE385298B (cs) |
-
1970
- 1970-12-11 CH CH1838170A patent/CH549586A/xx not_active IP Right Cessation
- 1970-12-11 CH CH1745473A patent/CH561684A5/xx not_active IP Right Cessation
- 1970-12-18 BE BE760510A patent/BE760510A/xx unknown
- 1970-12-21 BG BG019455A patent/BG18187A3/xx unknown
- 1970-12-21 IL IL35885A patent/IL35885A/xx unknown
- 1970-12-21 FR FR7046020A patent/FR2093923B1/fr not_active Expired
- 1970-12-21 IE IE1624/70A patent/IE35428B1/xx unknown
- 1970-12-21 ES ES386685A patent/ES386685A1/es not_active Expired
- 1970-12-21 GB GB1229172A patent/GB1332699A/en not_active Expired
- 1970-12-21 BG BG019457A patent/BG18188A3/xx unknown
- 1970-12-21 BG BG019454A patent/BG18186A3/xx unknown
- 1970-12-21 SE SE7017330A patent/SE385298B/xx unknown
- 1970-12-21 NL NL7018577A patent/NL7018577A/xx not_active Application Discontinuation
- 1970-12-21 DE DE19702062927 patent/DE2062927A1/de not_active Ceased
- 1970-12-21 PH PH12060A patent/PH9829A/en unknown
- 1970-12-21 DK DK649370AA patent/DK136647B/da unknown
- 1970-12-21 NO NO4888/70A patent/NO130681C/no unknown
-
1971
- 1971-10-04 AR AR238272A patent/AR193050A1/es active
-
1975
- 1975-11-26 SE SE7513327A patent/SE7513327L/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK136647C (cs) | 1978-04-17 |
| AR193050A1 (es) | 1973-03-30 |
| IL35885A0 (en) | 1971-04-28 |
| IE35428B1 (en) | 1976-02-18 |
| PH9829A (en) | 1976-04-02 |
| NL7018577A (cs) | 1971-12-03 |
| ES386685A1 (es) | 1973-03-16 |
| CH549586A (de) | 1974-05-31 |
| DK136647B (da) | 1977-11-07 |
| IE35428L (en) | 1971-12-01 |
| FR2093923A1 (cs) | 1972-02-04 |
| SE385298B (sv) | 1976-06-21 |
| CH561684A5 (cs) | 1975-05-15 |
| GB1332699A (en) | 1973-10-03 |
| SE7513327L (sv) | 1975-11-26 |
| BE760510A (fr) | 1971-06-18 |
| FR2093923B1 (cs) | 1974-05-24 |
| BG18188A3 (bg) | 1974-09-02 |
| DE2062927A1 (de) | 1971-12-16 |
| NO130681C (cs) | 1975-01-22 |
| NO130681B (cs) | 1974-10-14 |
| BG18187A3 (bg) | 1974-09-02 |
| BG18186A3 (bg) | 1974-09-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE33286L (en) | Pyrimidyl-1, 4-benzodiazepines | |
| IL34876A (en) | Thiazolidine-2,5-dione compounds and their preparation | |
| IL37645A0 (en) | Benzodiazepine derivatives,their manufacture and pharmaceutical compositions containing them | |
| CY830A (en) | New penicillins, their preparation and their use | |
| PH9214A (en) | 2-hydrazino or 2-acylhydrazino-5-phenyl-3h-1,4-benzodiazepine derivatives and production thereof | |
| MY7400128A (en) | Benzodiazepine derivatives | |
| IL38361A0 (en) | 3-sulphoalkyl-6-hydroxypyrid-(2)-ones,their manufacture and use | |
| IL35885A (en) | 5-(2-fluorophenyl)-1,3-dihydro-7-iodo-2h-1,4-benzodiazepin-2-one derivatives and their preparation | |
| ZA714391B (en) | Benzodiazepine derivatives | |
| IL33103A0 (en) | Benzodiazepine derivatives,their preparation and pharmaceutical compositions containing them | |
| ZA71840B (en) | Benzodiazepine derivatives | |
| IL34271A (en) | 4-alkyl-3h-1,4-benzodiazepine-2,5-(1h,4h)dione derivatives,their preparation and pharmaceutical compositions containing them | |
| ZA721060B (en) | Benzodiazepine derivatives | |
| IL33119A (en) | 4,5-epoxy-1,3,4,5-tetrahydro-5-phenyl-2h-1,4-benzodiazepin-2-one derivatives,their preparation and pharmaceutical compositions containing them | |
| ZA71335B (en) | Benzodiazepine derivatives | |
| ZA715733B (en) | Benzodiazepine derivatives | |
| ZA717413B (en) | Heterocyclic compounds and their preparation | |
| IL38234A0 (en) | Benzodiazepine derivatives,their manufacture and pharmaceutical compositions containing them | |
| ZA713932B (en) | New nitrofuran derivatives and the preparation thereof | |
| IL38420A0 (en) | Benzodiazepine derivatives,their preparation and pharmaceutical compositions containing them | |
| PH10045A (en) | 1-substituted-5-(0-alkylphenyl-7-halogeno-1,3-dihydro-2h-1,4-benzodiazepin-2-one and pharmaceutical compositions | |
| ZA718529B (en) | Benzodiazepine derivatives | |
| ZA717837B (en) | Benzodiazepine derivatives | |
| ZA708348B (en) | Benzodiazepine derivatives | |
| ZA711819B (en) | Benzodiazepine derivatives |