DK136647B - Analogifremgangsmåde til fremstilling af 5-(2-fluorphenyl)-7-iod-1,3-dihydro-1-methyl-2H-1,4-benzodiazepin-2-on eller syreadditionssalte deraf. - Google Patents
Analogifremgangsmåde til fremstilling af 5-(2-fluorphenyl)-7-iod-1,3-dihydro-1-methyl-2H-1,4-benzodiazepin-2-on eller syreadditionssalte deraf.Info
- Publication number
- DK136647B DK136647B DK649370AA DK649370A DK136647B DK 136647 B DK136647 B DK 136647B DK 649370A A DK649370A A DK 649370AA DK 649370 A DK649370 A DK 649370A DK 136647 B DK136647 B DK 136647B
- Authority
- DK
- Denmark
- Prior art keywords
- benzodiazepin
- iodo
- fluorophenyl
- dihydro
- methyl
- Prior art date
Links
- WKDHPXLDPOYJMH-UHFFFAOYSA-N 5-(2-fluorophenyl)-7-iodo-1-methyl-3h-1,4-benzodiazepin-2-one Chemical compound N=1CC(=O)N(C)C2=CC=C(I)C=C2C=1C1=CC=CC=C1F WKDHPXLDPOYJMH-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/22—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
- C07D243/16—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals
- C07D243/18—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals substituted in position 2 by nitrogen, oxygen or sulfur atoms
- C07D243/24—Oxygen atoms
- C07D243/28—Preparation including building-up the benzodiazepine skeleton from compounds containing no hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK86676A DK86676A (da) | 1970-06-01 | 1976-03-01 | Iodsubstituerede benzodiazepinderivater og salte deraf samt preparater indeholdende sadanne derivater |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US4253370A | 1970-06-01 | 1970-06-01 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK136647B true DK136647B (da) | 1977-11-07 |
| DK136647C DK136647C (da) | 1978-04-17 |
Family
ID=21922438
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK649370AA DK136647B (da) | 1970-06-01 | 1970-12-21 | Analogifremgangsmåde til fremstilling af 5-(2-fluorphenyl)-7-iod-1,3-dihydro-1-methyl-2H-1,4-benzodiazepin-2-on eller syreadditionssalte deraf. |
Country Status (15)
| Country | Link |
|---|---|
| AR (1) | AR193050A1 (da) |
| BE (1) | BE760510A (da) |
| BG (3) | BG18188A3 (da) |
| CH (2) | CH549586A (da) |
| DE (1) | DE2062927A1 (da) |
| DK (1) | DK136647B (da) |
| ES (1) | ES386685A1 (da) |
| FR (1) | FR2093923B1 (da) |
| GB (1) | GB1332699A (da) |
| IE (1) | IE35428B1 (da) |
| IL (1) | IL35885A (da) |
| NL (1) | NL7018577A (da) |
| NO (1) | NO130681C (da) |
| PH (1) | PH9829A (da) |
| SE (2) | SE385298B (da) |
-
1970
- 1970-12-11 CH CH1838170A patent/CH549586A/xx not_active IP Right Cessation
- 1970-12-11 CH CH1745473A patent/CH561684A5/xx not_active IP Right Cessation
- 1970-12-18 BE BE760510A patent/BE760510A/xx unknown
- 1970-12-21 FR FR7046020A patent/FR2093923B1/fr not_active Expired
- 1970-12-21 SE SE7017330A patent/SE385298B/xx unknown
- 1970-12-21 GB GB1229172A patent/GB1332699A/en not_active Expired
- 1970-12-21 BG BG019457A patent/BG18188A3/xx unknown
- 1970-12-21 BG BG019454A patent/BG18186A3/xx unknown
- 1970-12-21 BG BG019455A patent/BG18187A3/xx unknown
- 1970-12-21 PH PH12060A patent/PH9829A/en unknown
- 1970-12-21 DE DE19702062927 patent/DE2062927A1/de not_active Ceased
- 1970-12-21 ES ES386685A patent/ES386685A1/es not_active Expired
- 1970-12-21 NL NL7018577A patent/NL7018577A/xx not_active Application Discontinuation
- 1970-12-21 IE IE1624/70A patent/IE35428B1/xx unknown
- 1970-12-21 DK DK649370AA patent/DK136647B/da unknown
- 1970-12-21 IL IL35885A patent/IL35885A/xx unknown
- 1970-12-21 NO NO4888/70A patent/NO130681C/no unknown
-
1971
- 1971-10-04 AR AR238272A patent/AR193050A1/es active
-
1975
- 1975-11-26 SE SE7513327A patent/SE7513327L/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BG18187A3 (bg) | 1974-09-02 |
| SE385298B (sv) | 1976-06-21 |
| NL7018577A (da) | 1971-12-03 |
| NO130681B (da) | 1974-10-14 |
| CH561684A5 (da) | 1975-05-15 |
| BG18188A3 (bg) | 1974-09-02 |
| IL35885A (en) | 1974-05-16 |
| PH9829A (en) | 1976-04-02 |
| BE760510A (fr) | 1971-06-18 |
| FR2093923A1 (da) | 1972-02-04 |
| IL35885A0 (en) | 1971-04-28 |
| GB1332699A (en) | 1973-10-03 |
| DE2062927A1 (de) | 1971-12-16 |
| SE7513327L (sv) | 1975-11-26 |
| IE35428L (en) | 1971-12-01 |
| FR2093923B1 (da) | 1974-05-24 |
| DK136647C (da) | 1978-04-17 |
| BG18186A3 (bg) | 1974-09-02 |
| NO130681C (da) | 1975-01-22 |
| AR193050A1 (es) | 1973-03-30 |
| CH549586A (de) | 1974-05-31 |
| ES386685A1 (es) | 1973-03-16 |
| IE35428B1 (en) | 1976-02-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK125554B (da) | Analogifremgangsmåde til fremstilling af 1,5,7-trisubstituerede 1,3-dihydro-2H-1,4-benzodiazepin-2-oner eller syreadditionssalte deraf. | |
| DK132174B (da) | Analogifremgangsmåde til fremstilling af 2,4-diamino-5-benzylpyrimider. | |
| DK137382B (da) | Analogifremgangsmåde til fremstilling af 2,2-diaryl-4-(4'-aryl-4'-hydroxy-piperidin)butyramider eller syreadditionssalte deraf. | |
| DK140842B (da) | Fremgangsmåde til fremstilling af 8,9-didebydro-10alfa-alkoxy-ergolener. | |
| DK120548B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater eller 4-oxider eller syreadditionssalte deraf. | |
| DK131567B (da) | Analogifremgangsmåde til fremstilling af 3H-1,4-benzodiazepiner eller syreadditionssalte deraf. | |
| DK128496B (da) | Fremgangsmåde til fremstilling af 5-fluoruracilderivater. | |
| DK127778B (da) | Fremgangsmåde til fremstilling af 3',4'-dideoxy-kenamycin B. | |
| DK131374B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater eller salte deraf. | |
| DK127812B (da) | Analogifremgangsmåde til fremstilling af 3,5-dibrom-zearalan. | |
| DK137754B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. | |
| DK136647B (da) | Analogifremgangsmåde til fremstilling af 5-(2-fluorphenyl)-7-iod-1,3-dihydro-1-methyl-2H-1,4-benzodiazepin-2-on eller syreadditionssalte deraf. | |
| DK137237B (da) | Analogifremgangsmåde til fremstilling af 1,4-benzodiazepinforbindelser eller 4-N-oxider eller salte heraf. | |
| DK127115B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. | |
| DK129658B (da) | Fremgangsmåde til fremstilling af 3-substituerede thienylforbindelser. | |
| DK125790B (da) | Fremgangsmåde til fremstilling af L-β-3,4-dihydroxyphenyl-α-alanin. | |
| DK126186B (da) | Fremgangsmåde til fremstilling af 13β-alkylgona-4,9-diener. | |
| DK138741B (da) | Fremgangsmåde til fremstilling af 1-hydroxyalkyl-1,4-benzodiazepin-2-on-derivater eller syreadditionssalte deraf. | |
| DK133874B (da) | Analogifremgangsmåde til fremstilling af 4beta-methoxy-4alfa-phenyl-1-phenethyl-3alfa,5alfa-propano-piperidin eller syreadditionssalte heraf. | |
| DK129711B (da) | Fremgangsmåde til fremstilling af 1-hydroxyalkyl-1,4-benzodiazepinderivater eller syreadditionssalte deraf. | |
| DK137855B (da) | Analogifremgangsmåde til fremstilling af optisk aktive 1,3,4,5-tetrahydro-2H-1,4-benzodiazepin-2-on-derivater. | |
| DK129456B (da) | Analogifremgangsmåde til fremstilling af 1,4-benzodiazepinderivater eller syreadditionssalte deraf. | |
| DK131860B (da) | Analogifremgangsmåde til fremstilling af 1,4-benzodiazepinderivater eller syreadditionssalte deraf. | |
| DK129288B (da) | Analogifremgangsmåde til fremstilling af 2-alkoxy-5-phenyl-4H-3,5-dihydro-1,5-benzodiazepin-4-oner. | |
| DK125466B (da) | Fremgangsmåde til fremstilling af 4-klor-N-furfuryl-5-sulfamoylantranilsyre. |