IL33775A - Method of producing thiono-or dithio-phosphonic acid esters - Google Patents
Method of producing thiono-or dithio-phosphonic acid estersInfo
- Publication number
- IL33775A IL33775A IL33775A IL3377570A IL33775A IL 33775 A IL33775 A IL 33775A IL 33775 A IL33775 A IL 33775A IL 3377570 A IL3377570 A IL 3377570A IL 33775 A IL33775 A IL 33775A
- Authority
- IL
- Israel
- Prior art keywords
- reaction
- reactor
- phosphonic acid
- dithio
- thiono
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 16
- FLQUDUCNBDGCRI-UHFFFAOYSA-N hydroxy-sulfanyl-sulfidophosphanium Chemical class SP(S)=O FLQUDUCNBDGCRI-UHFFFAOYSA-N 0.000 title description 6
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 claims description 7
- 229910000388 diammonium phosphate Inorganic materials 0.000 claims description 5
- 235000019838 diammonium phosphate Nutrition 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 32
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 21
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 238000009833 condensation Methods 0.000 description 10
- 230000005494 condensation Effects 0.000 description 10
- AATNZNJRDOVKDD-UHFFFAOYSA-N 1-[ethoxy(ethyl)phosphoryl]oxyethane Chemical compound CCOP(=O)(CC)OCC AATNZNJRDOVKDD-UHFFFAOYSA-N 0.000 description 8
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 8
- 239000012071 phase Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- -1 alkali metal salt Chemical class 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 5
- 239000007789 gas Substances 0.000 description 5
- 238000006317 isomerization reaction Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 150000003008 phosphonic acid esters Chemical class 0.000 description 5
- 238000007280 thionation reaction Methods 0.000 description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 125000005600 alkyl phosphonate group Chemical group 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 229910052740 iodine Inorganic materials 0.000 description 4
- 239000011630 iodine Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 239000003518 caustics Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 229910000619 316 stainless steel Inorganic materials 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000000269 nucleophilic effect Effects 0.000 description 2
- 230000000361 pesticidal effect Effects 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- LKYIPGJOXSVWPX-UHFFFAOYSA-M sodium;thiophene-2-carboxylate Chemical compound [Na+].[O-]C(=O)C1=CC=CS1 LKYIPGJOXSVWPX-UHFFFAOYSA-M 0.000 description 2
- OSUKSSHOHKZSJC-UHFFFAOYSA-N 12591-02-5 Chemical compound ClP(=O)=O OSUKSSHOHKZSJC-UHFFFAOYSA-N 0.000 description 1
- 150000001340 alkali metals Chemical group 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- HGELWZQRZUOEOJ-UHFFFAOYSA-N ethyl-dihydroxy-sulfanylidene-$l^{5}-phosphane Chemical compound CCP(O)(O)=S HGELWZQRZUOEOJ-UHFFFAOYSA-N 0.000 description 1
- KVGLBTYUCJYMND-UHFFFAOYSA-N fonofos Chemical compound CCOP(=S)(CC)SC1=CC=CC=C1 KVGLBTYUCJYMND-UHFFFAOYSA-N 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- CYTQBVOFDCPGCX-UHFFFAOYSA-N trimethyl phosphite Chemical compound COP(OC)OC CYTQBVOFDCPGCX-UHFFFAOYSA-N 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/40—Esters thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US79438769A | 1969-01-27 | 1969-01-27 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL33775A0 IL33775A0 (en) | 1970-03-22 |
| IL33775A true IL33775A (en) | 1973-06-29 |
Family
ID=25162503
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL33775A IL33775A (en) | 1969-01-27 | 1970-01-26 | Method of producing thiono-or dithio-phosphonic acid esters |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3642960A (da) |
| JP (1) | JPS5220474B1 (da) |
| BE (1) | BE744917A (da) |
| BR (1) | BR7016285D0 (da) |
| CH (1) | CH531542A (da) |
| DE (1) | DE2002629C3 (da) |
| DK (1) | DK136265B (da) |
| FR (1) | FR2029472A1 (da) |
| GB (1) | GB1303841A (da) |
| IL (1) | IL33775A (da) |
| NL (1) | NL162392C (da) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3862276A (en) * | 1971-07-03 | 1975-01-21 | Bayer Ag | Preparation of 0-(2,2-dichlorovinyl)-thionophosphoric acid ester dichloride |
| US4268508A (en) * | 1979-12-28 | 1981-05-19 | Mobil Oil Corporation | 0-Alkyl-s-branched alkyl-alkylphosphonodithioate |
| US4284626A (en) * | 1979-12-31 | 1981-08-18 | Mobil Oil Corporation | O-aryl S-branched alkyl alkylphosphonodithioate insecticides and nematocides |
| US4948787A (en) * | 1989-01-04 | 1990-08-14 | Imperial Chemical Industries Plc | Inhibition of mercaptan odor in organothiophosphate biocides |
| US5295690A (en) * | 1992-07-30 | 1994-03-22 | John Johnson | Apparatus and method for improving a golf swing |
| US7300906B2 (en) * | 2005-04-07 | 2007-11-27 | Gowan Company, L.L.C. | Control of sulfhydryl compound odor in organothiophosphate formulations |
-
1969
- 1969-01-27 US US794387*A patent/US3642960A/en not_active Expired - Lifetime
-
1970
- 1970-01-15 GB GB202470A patent/GB1303841A/en not_active Expired
- 1970-01-22 DE DE2002629A patent/DE2002629C3/de not_active Expired
- 1970-01-24 JP JP45006041A patent/JPS5220474B1/ja active Pending
- 1970-01-26 BE BE744917D patent/BE744917A/xx not_active IP Right Cessation
- 1970-01-26 FR FR7002691A patent/FR2029472A1/fr not_active Withdrawn
- 1970-01-26 CH CH105970A patent/CH531542A/de not_active IP Right Cessation
- 1970-01-26 IL IL33775A patent/IL33775A/en unknown
- 1970-01-27 NL NL7001117.A patent/NL162392C/xx not_active IP Right Cessation
- 1970-01-27 DK DK36870AA patent/DK136265B/da not_active IP Right Cessation
- 1970-01-28 BR BR21628570A patent/BR7016285D0/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK136265B (da) | 1977-09-19 |
| NL162392B (nl) | 1979-12-17 |
| DK136265C (da) | 1978-02-20 |
| FR2029472A1 (da) | 1970-10-23 |
| DE2002629A1 (de) | 1970-07-30 |
| US3642960A (en) | 1972-02-15 |
| DE2002629B2 (de) | 1980-05-08 |
| NL162392C (nl) | 1980-05-16 |
| JPS5220474B1 (da) | 1977-06-03 |
| GB1303841A (da) | 1973-01-24 |
| IL33775A0 (en) | 1970-03-22 |
| NL7001117A (da) | 1970-07-29 |
| BE744917A (fr) | 1970-07-27 |
| CH531542A (de) | 1972-12-15 |
| DE2002629C3 (de) | 1981-01-22 |
| BR7016285D0 (pt) | 1973-01-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Maier | Organic Phosphorus Compounds 90. l A Convenient, One-Step Synthesis of Alkyl-and Arylphosphonyl Dichlorides | |
| US3502750A (en) | Process for the preparation of dialkyl phosphorochloridothioates | |
| IL33775A (en) | Method of producing thiono-or dithio-phosphonic acid esters | |
| CN1064689C (zh) | 制备二硫代磷酸酯酰二氯的方法 | |
| Capson et al. | Synthesis of ammonium analogs of carbocationic intermediates in the conversion of presqualene diphosphate to squalene | |
| US4371509A (en) | Oxidizing phosphorus compounds with chlorosulfonic acid | |
| US4521347A (en) | Process for preparing chlorophenylphosphanes | |
| EP0010799B1 (en) | A process for the preparation of 3-azabicyclo(3.1.0)hexane derivatives and modifications thereof | |
| US5177238A (en) | Preparation of dialkyl allylphosphonic acid diesters | |
| US4470933A (en) | Preparation of S-brom-dithiophosphoric, dithiophosphonic and dithiophosphinic acid derivatives | |
| EP0044558B1 (en) | Method for the preparation of alkyne-1 compounds | |
| EP0227918B1 (de) | Verfahren zur Herstellung von Phosphonsäuredichloriden | |
| US4633005A (en) | Method for the preparation of allyl phosphonate diesters | |
| US4096182A (en) | Process for the simultaneous preparation of 2,5-dioxo-1,2-oxa-phospholanes and β-halogenpropionic acid halide | |
| Aksnes et al. | Investigation of the reaction between dialkylphosphine oxides and carbontetrachloride | |
| US4368162A (en) | Process for producing aminomethylphosphonic acid | |
| US4740608A (en) | (Phosphonomethyl)trifluoromethyl sulfonates | |
| US4020129A (en) | Production of dithiophosphoric acid-O,O-diesters | |
| CA1067910A (en) | Process for the production of s-alkyl phosphoro dihalogenidodithioate | |
| EP0130439B1 (de) | Verfahren zur Herstellung von Derivaten der Vinylphosphon-, oder Vinylpyrophosphonsäure | |
| JPS5949233B2 (ja) | O,o−ジアルキルチオノ燐酸クロリドの製造法 | |
| JP2645101B2 (ja) | アリファチルホスフィン酸誘導体の製造方法 | |
| US4855087A (en) | Process for the preparation of 2-chloroethanephosphonyl dichloride | |
| US2495799A (en) | Chloroalkyl phosphorous oxy and sulfodichlorides | |
| CA2134633A1 (en) | Process for preparing alkanephosphonic anhydrides |