IL31228A - Pyrrolidino-alkylguanidine compounds and their preparation - Google Patents
Pyrrolidino-alkylguanidine compounds and their preparationInfo
- Publication number
- IL31228A IL31228A IL31228A IL3122868A IL31228A IL 31228 A IL31228 A IL 31228A IL 31228 A IL31228 A IL 31228A IL 3122868 A IL3122868 A IL 3122868A IL 31228 A IL31228 A IL 31228A
- Authority
- IL
- Israel
- Prior art keywords
- addition salts
- acid addition
- guanidinoethyl
- toxic
- dimethylpyrrolidine
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 11
- 150000003839 salts Chemical class 0.000 claims description 31
- 231100000252 nontoxic Toxicity 0.000 claims description 21
- 230000003000 nontoxic effect Effects 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 19
- -1 N-Methyl-N- -(2,4-dimethyl-l-pyrrolidinyl)ethylguanidine Chemical compound 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- KTDKAQFODMVOLP-UHFFFAOYSA-N 2-pyrrolidin-1-ylguanidine Chemical class NC(=N)NN1CCCC1 KTDKAQFODMVOLP-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001912 cyanamides Chemical class 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- BWMDMTSNSXYYSP-UHFFFAOYSA-N 2-propylguanidine Chemical compound CCCNC(N)=N BWMDMTSNSXYYSP-UHFFFAOYSA-N 0.000 claims 1
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims 1
- ZRALSGWEFCBTJO-UHFFFAOYSA-N anhydrous guanidine Natural products NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims 1
- ZIPLUEXSCPLCEI-UHFFFAOYSA-N cyanamide group Chemical group C(#N)[NH-] ZIPLUEXSCPLCEI-UHFFFAOYSA-N 0.000 claims 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 105
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 45
- 238000010992 reflux Methods 0.000 description 32
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 31
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 31
- 238000010626 work up procedure Methods 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- 239000000203 mixture Substances 0.000 description 22
- 229910021653 sulphate ion Inorganic materials 0.000 description 22
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 21
- SDDKIZNHOCEXTF-UHFFFAOYSA-N methyl carbamimidothioate Chemical compound CSC(N)=N SDDKIZNHOCEXTF-UHFFFAOYSA-N 0.000 description 14
- 238000005984 hydrogenation reaction Methods 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- BZZXQZOBAUXLHZ-UHFFFAOYSA-N (c-methylsulfanylcarbonimidoyl)azanium;sulfate Chemical compound CSC(N)=N.CSC(N)=N.OS(O)(=O)=O BZZXQZOBAUXLHZ-UHFFFAOYSA-N 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 6
- 239000001117 sulphuric acid Substances 0.000 description 6
- 235000011149 sulphuric acid Nutrition 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 5
- XEBHIUPTXHNYOD-UHFFFAOYSA-N 1-chloro-2-methylpent-4-yn-2-ol Chemical compound ClCC(O)(C)CC#C XEBHIUPTXHNYOD-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- KDKYADYSIPSCCQ-UHFFFAOYSA-N but-1-yne Chemical compound CCC#C KDKYADYSIPSCCQ-UHFFFAOYSA-N 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 150000003233 pyrroles Chemical class 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- CXZJOMXTSWZMBZ-UHFFFAOYSA-N 2-tert-butyl-2-prop-2-ynyloxirane Chemical compound C#CCC1(C(C)(C)C)CO1 CXZJOMXTSWZMBZ-UHFFFAOYSA-N 0.000 description 2
- UOSRYHYUPWRJEK-UHFFFAOYSA-N 3-(chloromethyl)-2,2-dimethylhex-5-yn-3-ol Chemical compound CC(C)(C)C(O)(CCl)CC#C UOSRYHYUPWRJEK-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000010779 crude oil Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- XZUAPPXGIFNDRA-UHFFFAOYSA-N ethane-1,2-diamine;hydrate Chemical compound O.NCCN XZUAPPXGIFNDRA-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000005194 fractionation Methods 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- PWGJDPKCLMLPJW-UHFFFAOYSA-N 1,8-diaminooctane Chemical compound NCCCCCCCCN PWGJDPKCLMLPJW-UHFFFAOYSA-N 0.000 description 1
- OXHNLMTVIGZXSG-UHFFFAOYSA-N 1-Methylpyrrole Chemical compound CN1C=CC=C1 OXHNLMTVIGZXSG-UHFFFAOYSA-N 0.000 description 1
- LYNZEKNNFSOEST-UHFFFAOYSA-N 1-chloro-2-phenylbut-3-yn-2-ol Chemical compound ClCC(O)(C#C)C1=CC=CC=C1 LYNZEKNNFSOEST-UHFFFAOYSA-N 0.000 description 1
- WBTZYHJKPKGJDV-UHFFFAOYSA-N 1-chloropentan-3-ol Chemical compound CCC(O)CCCl WBTZYHJKPKGJDV-UHFFFAOYSA-N 0.000 description 1
- DUOJVRWFIHNZTJ-UHFFFAOYSA-N 2,4-dimethylpyrrolidine Chemical compound CC1CNC(C)C1 DUOJVRWFIHNZTJ-UHFFFAOYSA-N 0.000 description 1
- XBVPIPOORLGFGK-UHFFFAOYSA-N 2-(1h-pyrrol-2-yl)ethanol Chemical compound OCCC1=CC=CN1 XBVPIPOORLGFGK-UHFFFAOYSA-N 0.000 description 1
- ISNDLTAVWAJSGJ-UHFFFAOYSA-N 2-(2,3-dimethylpyrrolidin-1-yl)ethanamine Chemical compound CC1CCN(CCN)C1C ISNDLTAVWAJSGJ-UHFFFAOYSA-N 0.000 description 1
- NPHULPIAPWNOOH-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-3-(2,3-dihydroindol-1-ylmethyl)pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)CN1CCC2=CC=CC=C12 NPHULPIAPWNOOH-UHFFFAOYSA-N 0.000 description 1
- YAFKKDALCCJKSY-UHFFFAOYSA-N 2-ethylguanidine;sulfuric acid Chemical compound OS(O)(=O)=O.CCN=C(N)N YAFKKDALCCJKSY-UHFFFAOYSA-N 0.000 description 1
- CAQFTFGWNKAGCI-UHFFFAOYSA-N 2-n-(2-methylphenyl)-6-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1,3,5-triazine-2,4-diamine Chemical compound CC1=CC=CC=C1NC1=NC(N)=NC(CN2CCN(CC2)C=2N=CC=CC=2)=N1 CAQFTFGWNKAGCI-UHFFFAOYSA-N 0.000 description 1
- WTLKTXIHIHFSGU-UHFFFAOYSA-N 2-nitrosoguanidine Chemical compound NC(N)=NN=O WTLKTXIHIHFSGU-UHFFFAOYSA-N 0.000 description 1
- WRXNJTBODVGDRY-UHFFFAOYSA-N 2-pyrrolidin-1-ylethanamine Chemical compound NCCN1CCCC1 WRXNJTBODVGDRY-UHFFFAOYSA-N 0.000 description 1
- CMGFSOAWZMKIEI-UHFFFAOYSA-N 3-(2,4-dimethylpyrrol-1-yl)propan-1-amine Chemical compound Cc1cc(C)n(CCCN)c1 CMGFSOAWZMKIEI-UHFFFAOYSA-N 0.000 description 1
- ZBPJPJNOUSGZJN-UHFFFAOYSA-N 3-(chloromethyl)hex-5-yn-3-ol Chemical compound CCC(O)(CCl)CC#C ZBPJPJNOUSGZJN-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- SMJYKQCVYOFCBF-UHFFFAOYSA-N CC1CN(CCCNC(N)=N)C(C)C1 Chemical compound CC1CN(CCCNC(N)=N)C(C)C1 SMJYKQCVYOFCBF-UHFFFAOYSA-N 0.000 description 1
- NJYOENYANQQIAS-UHFFFAOYSA-N ClC(C#CCCC)(C)O Chemical compound ClC(C#CCCC)(C)O NJYOENYANQQIAS-UHFFFAOYSA-N 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- WWYWDSTZMHODOG-UHFFFAOYSA-N O.O.O.S(=O)(=O)(O)O.S(=O)(=O)(O)O Chemical compound O.O.O.S(=O)(=O)(O)O.S(=O)(=O)(O)O WWYWDSTZMHODOG-UHFFFAOYSA-N 0.000 description 1
- 241001474977 Palla Species 0.000 description 1
- PQUGCKBLVKJMNT-UHFFFAOYSA-N SC560 Chemical compound C1=CC(OC)=CC=C1N1C(C=2C=CC(Cl)=CC=2)=CC(C(F)(F)F)=N1 PQUGCKBLVKJMNT-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Substances CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 239000012159 carrier gas Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- BCUPGIHTCQJCSI-UHFFFAOYSA-N chloromethanol Chemical compound OCCl BCUPGIHTCQJCSI-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000001030 gas--liquid chromatography Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- YLERVAXAQFOFRI-UHFFFAOYSA-M magnesium;propa-1,2-diene;bromide Chemical compound [Mg+2].[Br-].[CH2-]C#C YLERVAXAQFOFRI-UHFFFAOYSA-M 0.000 description 1
- RMAHPRNLQIRHIJ-UHFFFAOYSA-N methyl carbamimidate Chemical compound COC(N)=N RMAHPRNLQIRHIJ-UHFFFAOYSA-N 0.000 description 1
- DJZWNSRUEJSEEB-UHFFFAOYSA-N n-(4,5-dihydro-1h-imidazol-2-yl)nitramide Chemical compound [O-][N+](=O)NC1=NCCN1 DJZWNSRUEJSEEB-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- UCQFSGCWHRTMGG-UHFFFAOYSA-N pyrazole-1-carboximidamide Chemical class NC(=N)N1C=CC=N1 UCQFSGCWHRTMGG-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003235 pyrrolidines Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- MBEGFNBBAVRKLK-UHFFFAOYSA-N sodium;iminomethylideneazanide Chemical compound [Na+].[NH-]C#N MBEGFNBBAVRKLK-UHFFFAOYSA-N 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/325—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/06—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with radicals, containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/04—Compounds containing oxirane rings containing only hydrogen and carbon atoms in addition to the ring oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB55708/67A GB1185080A (en) | 1967-12-07 | 1967-12-07 | Pyrrolidines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL31228A0 IL31228A0 (en) | 1969-02-27 |
| IL31228A true IL31228A (en) | 1972-04-27 |
Family
ID=10474656
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL31228A IL31228A (en) | 1967-12-07 | 1968-12-05 | Pyrrolidino-alkylguanidine compounds and their preparation |
Country Status (16)
| Country | Link |
|---|---|
| AT (1) | AT301569B (enExample) |
| BE (1) | BE725104A (enExample) |
| BR (1) | BR6804654D0 (enExample) |
| CH (1) | CH534679A (enExample) |
| DE (1) | DE1811832A1 (enExample) |
| DK (1) | DK126781B (enExample) |
| ES (1) | ES361114A1 (enExample) |
| FR (1) | FR7874M (enExample) |
| GB (1) | GB1185080A (enExample) |
| IE (1) | IE32781B1 (enExample) |
| IL (1) | IL31228A (enExample) |
| IS (1) | IS1807A7 (enExample) |
| NL (1) | NL6817322A (enExample) |
| NO (1) | NO126368B (enExample) |
| SE (1) | SE346785B (enExample) |
| ZM (1) | ZM17068A1 (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3527791A1 (de) * | 1985-08-02 | 1987-02-12 | Cassella Ag | 2,5-dimethylpyrrolderivate, ihre herstellung und ihre verwendung |
| TW224974B (enExample) * | 1991-07-02 | 1994-06-11 | Hoffmann La Roche | |
| GB9803536D0 (en) | 1998-02-19 | 1998-04-15 | Black James Foundation | Histamine H,receptor ligands |
-
1967
- 1967-12-07 GB GB55708/67A patent/GB1185080A/en not_active Expired
-
1968
- 1968-11-28 IE IE1454/68A patent/IE32781B1/xx unknown
- 1968-11-29 DE DE19681811832 patent/DE1811832A1/de active Pending
- 1968-12-02 IS IS1807A patent/IS1807A7/is unknown
- 1968-12-03 NL NL6817322A patent/NL6817322A/xx unknown
- 1968-12-04 ZM ZM170/68A patent/ZM17068A1/xx unknown
- 1968-12-04 AT AT1180468A patent/AT301569B/de not_active IP Right Cessation
- 1968-12-05 ES ES361114A patent/ES361114A1/es not_active Expired
- 1968-12-05 DK DK594468AA patent/DK126781B/da unknown
- 1968-12-05 IL IL31228A patent/IL31228A/en unknown
- 1968-12-06 BR BR204654/68A patent/BR6804654D0/pt unknown
- 1968-12-06 NO NO04900/68A patent/NO126368B/no unknown
- 1968-12-06 SE SE16737/68A patent/SE346785B/xx unknown
- 1968-12-06 BE BE725104D patent/BE725104A/xx unknown
- 1968-12-06 FR FR176948A patent/FR7874M/fr not_active Expired
- 1968-12-09 CH CH1833468A patent/CH534679A/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ZM17068A1 (en) | 1969-06-17 |
| SE346785B (enExample) | 1972-07-17 |
| FR7874M (enExample) | 1970-04-27 |
| CH534679A (de) | 1973-03-15 |
| IS1807A7 (is) | 1969-01-22 |
| IE32781B1 (en) | 1973-11-28 |
| BR6804654D0 (pt) | 1973-02-13 |
| IE32781L (en) | 1969-06-07 |
| ES361114A1 (es) | 1970-08-01 |
| DK126781B (da) | 1973-08-20 |
| IL31228A0 (en) | 1969-02-27 |
| NO126368B (enExample) | 1973-01-29 |
| AT301569B (de) | 1972-09-11 |
| NL6817322A (enExample) | 1969-06-10 |
| DE1811832A1 (de) | 1969-07-03 |
| GB1185080A (en) | 1970-03-18 |
| BE725104A (enExample) | 1969-06-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI113264B (fi) | Trisyklisiä pyratsolijohdannaisia | |
| DE60208568T2 (de) | Prostaglandinanaloga als ep4-rezeptoragonisten | |
| EP0338331A1 (de) | 1,3-Disubstituierte Pyrrolidine | |
| KR101569261B1 (ko) | 암을 치료하기 위한 hdac 억제제로서 4-아미노-n-하이드록시-벤즈아미드 | |
| US4785119A (en) | 3-aminopyrrolidine compound and process for preparation thereof | |
| CA1242439A (en) | 1-¬(AMINOALKYL AND AMINOALKYLAMINO)CARBONYL AND THIOCARBONYL|-.alpha.,.alpha.-DIARYLPYRROLIDINE, PIPERIDINE AND HOMOPIPERIDINEACETAMIDES AND ACETONITRILES | |
| IE62703B1 (en) | N-substituted lactams useful as cholecystokinin antagonists | |
| SU1093245A3 (ru) | Способ получени амидов лактам- @ -уксусных кислот | |
| DE69925721T2 (de) | Verfahren zur herstellung eines geschützten 4-aminomethyl-pyrrolidin-3-ons | |
| CA2450271A1 (en) | Novel phenylalkyl diamine and amide analogs | |
| IL31228A (en) | Pyrrolidino-alkylguanidine compounds and their preparation | |
| US4094987A (en) | 2-(3-m-hydroxy-phenyl-1-substituted-3-pyrrolidinyl)-ethanols | |
| EP0552386A1 (en) | 2-Amino-3 or 6-methoxycyclohexyl amide derivatives | |
| CA2081147A1 (en) | Naphthamide derivatives, process for preparing them and their application in the therapeutic field | |
| EP0049049B1 (en) | 5-amino-tetrazole derivatives, processes for their preparation and pharmaceutical compositions containing them | |
| DE3836021A1 (de) | Arzneimittel enthaltend nitroxyalkylamine mit amidfunktion und verfahren zur herstellung dieser verbindungen | |
| DE2322779A1 (de) | Benzophenon-derivate und verfahren zu ihrer herstellung | |
| US3312716A (en) | 4-hydroxy-3-pyrrolidinemethanols | |
| DE68909757T2 (de) | Indanderivate, Verfahren zu ihrer Herstellung und erhaltene Zwischenprodukte, ihre Verwendung als Arzneimittel und diese enthaltende pharmazeutische Zusammensetzungen. | |
| DE1620016A1 (de) | 3-(Piperazinoalkyl)-pyrazole und Verfahren zu ihrer Herstellung | |
| US2681931A (en) | Basic amides of bicyclo [2. 2.1]-5-heptene-2-carboxylic acid and 2-norcamphanecarboxylic acid and derivatives thereof | |
| FI77443C (fi) | Foerfarande foer framstaellning av farmaceutiskt anvaendbara 1-aroyl-5-oxo-2-pyrrolidinpropansyror och deras estrar. | |
| DE69521295T2 (de) | Triazolderivate | |
| EP0071950B1 (de) | Neue Heteroaryloxypropanolamine, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| AU2004283903A1 (en) | 1H-imidazole derivatives as cannabinoid receptor modulators |