IL28042A - 1,1-dimethylindanyl n-methylcarbamic acid esters and insecticidal and acaricidal compositions containing them - Google Patents
1,1-dimethylindanyl n-methylcarbamic acid esters and insecticidal and acaricidal compositions containing themInfo
- Publication number
- IL28042A IL28042A IL28042A IL2804267A IL28042A IL 28042 A IL28042 A IL 28042A IL 28042 A IL28042 A IL 28042A IL 2804267 A IL2804267 A IL 2804267A IL 28042 A IL28042 A IL 28042A
- Authority
- IL
- Israel
- Prior art keywords
- dimethylindanyl
- insecticidal
- acid esters
- compositions containing
- methylcarbamic acid
- Prior art date
Links
- NNOUZIYNTBSINA-UHFFFAOYSA-N (3,3-dimethyl-1,2-dihydroinden-2-yl)-methylcarbamic acid Chemical class CC1(C(CC2=CC=CC=C12)N(C(O)=O)C)C NNOUZIYNTBSINA-UHFFFAOYSA-N 0.000 title 1
- 230000000895 acaricidal effect Effects 0.000 title 1
- 230000000749 insecticidal effect Effects 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0049503 | 1966-06-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL28042A true IL28042A (en) | 1971-06-23 |
Family
ID=7103075
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL28042A IL28042A (en) | 1966-06-18 | 1967-05-26 | 1,1-dimethylindanyl n-methylcarbamic acid esters and insecticidal and acaricidal compositions containing them |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3597472A (nl) |
| BE (1) | BE700039A (nl) |
| CH (1) | CH489478A (nl) |
| DE (1) | DE1249261B (nl) |
| DK (1) | DK121509B (nl) |
| ES (1) | ES341874A1 (nl) |
| GB (1) | GB1135892A (nl) |
| IL (1) | IL28042A (nl) |
| NL (1) | NL154209B (nl) |
| SE (1) | SE328281B (nl) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3958006A (en) * | 1972-05-10 | 1976-05-18 | Union Carbide Corporation | Carbamate pesticidal compositions |
| DE2603835A1 (de) * | 1976-02-02 | 1977-08-04 | Bayer Ag | Indan-5-yl-n-methylcarbaminsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als insektizide |
| DE2739192A1 (de) * | 1977-08-31 | 1979-03-08 | Bayer Ag | Indan-4-yl-n-alkyl-carbaminsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als pflanzenschutzmittel |
| US4291061A (en) * | 1978-11-06 | 1981-09-22 | Ciba-Geigy Corporation | 1H-inden-1-one derivatives, processes for producing them, their use in microbicidal compositions, and for combating microorganisms |
| US4278807A (en) * | 1979-09-28 | 1981-07-14 | Union Carbide Corporation | Process for production of 1-naphthyl methylcarbamate |
| DE3002202A1 (de) * | 1980-01-22 | 1981-08-06 | Bayer Ag, 5090 Leverkusen | Indan-4-yl-n-alkyl-carbaminsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| US4390710A (en) * | 1981-10-19 | 1983-06-28 | Ppg Industries, Inc. | Catalyst system for manufacturing p-chlorophenyl-N-methyl carbamate |
| US4510337A (en) * | 1984-01-31 | 1985-04-09 | Phillips Petroleum Company | Process for production of 1,1-dimethyl-6-hydroxyindans |
-
0
- DE DENDAT1249261D patent/DE1249261B/de active Pending
-
1967
- 1967-05-24 CH CH731067A patent/CH489478A/de not_active IP Right Cessation
- 1967-05-26 IL IL28042A patent/IL28042A/xx unknown
- 1967-05-31 US US642301A patent/US3597472A/en not_active Expired - Lifetime
- 1967-05-31 GB GB25131/67A patent/GB1135892A/en not_active Expired
- 1967-06-09 SE SE08169/67A patent/SE328281B/xx unknown
- 1967-06-15 NL NL676708334A patent/NL154209B/nl unknown
- 1967-06-16 ES ES341874A patent/ES341874A1/es not_active Expired
- 1967-06-16 DK DK314867AA patent/DK121509B/da unknown
- 1967-06-16 BE BE700039D patent/BE700039A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL154209B (nl) | 1977-08-15 |
| SE328281B (nl) | 1970-09-14 |
| DE1249261B (de) | 1967-09-07 |
| NL6708334A (nl) | 1967-12-19 |
| BE700039A (nl) | 1967-12-18 |
| GB1135892A (en) | 1968-12-04 |
| DK121509B (da) | 1971-10-25 |
| ES341874A1 (es) | 1968-07-16 |
| US3597472A (en) | 1971-08-03 |
| CH489478A (de) | 1970-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL30882A0 (en) | Cyclopropanecarboxylic acid anilides and pesticidal compositions containing them | |
| IL28042A (en) | 1,1-dimethylindanyl n-methylcarbamic acid esters and insecticidal and acaricidal compositions containing them | |
| MY7100081A (en) | I-halogen-1-formylcarbonylphenylhrazones and insecticidal and acaricidal compositions containing the same | |
| IL37667A (en) | Pesticidal compositions containing phosphoric acid esters and stabilisers | |
| IL34154A (en) | Cyanoalkylaldoxime carbamates and insecticidal and acaricidal compositions containing them | |
| IL35193A0 (en) | The preparation of substituted carbanilic acid esters and synergistic insecticidal and acaricidal compositions containing them | |
| IL25475A (en) | Phosphoric acid esters and their use as insecticides | |
| MY7100155A (en) | Substituted-phenyl thiophosphorus acid esters and pesticidal compositions containing them | |
| IL35023A0 (en) | New phosphoric acid amide esters,their preparation and pesticidal compositions containing them | |
| MY7300315A (en) | 4,4-dibromo-benzilic acid and esters and acaricidal and insecticidal composition containing them | |
| ZA702687B (en) | Insecticidal and acaricidal preparations | |
| MY7300040A (en) | Insecticidal and acaricidal phosphorinane | |
| IL36611A0 (en) | Cyclopropane-carboxylic acid esters,their manufacture and insecticidal compositions containing them | |
| IL28122A (en) | Carbonic acid esters and fungicidal compositions containing them | |
| IL34204A0 (en) | Insecticidal and acaricidal compositions containing an oxime-ether as a synergist | |
| CA935089A (en) | Insecticidal and acaricidal composition | |
| CY628A (en) | Insecticidal and acaricidal formulations | |
| IL24078A (en) | 2,6-dinitro-4-alkyl phenol esters and pesticidal compositions containing same | |
| IL36151A (en) | Chrysanthemic acid esters,their manufacture and insecticidal compositions containing them | |
| AU406431B2 (en) | Insecticidal and acaricidal compositions | |
| IL34222A0 (en) | Synergistic insecticidal and acaricidal compositions containing phosphoric acid esters | |
| IL35173A0 (en) | Insecticidal and fungicidal compositions containing phosphoric acid esters | |
| AU102666A (en) | Insecticidal and acaricidal compositions | |
| AU433993B2 (en) | 1 halogen-1 formylcarbonylphenylhydrazones and insecticidal and acaricidal compositions containing thesame | |
| IL35427A0 (en) | Insecticidal and fungicidal compositions containing organic phosphoric acid esters |