DK121509B - Insecticidt og acaricidt virksomme indanyl-N-methylcarbamater. - Google Patents
Insecticidt og acaricidt virksomme indanyl-N-methylcarbamater.Info
- Publication number
- DK121509B DK121509B DK314867AA DK314867A DK121509B DK 121509 B DK121509 B DK 121509B DK 314867A A DK314867A A DK 314867AA DK 314867 A DK314867 A DK 314867A DK 121509 B DK121509 B DK 121509B
- Authority
- DK
- Denmark
- Prior art keywords
- methylcarbamates
- indanyl
- insecticidal
- acaricidally active
- acaricidally
- Prior art date
Links
- BONCHIQFCFRFAL-UHFFFAOYSA-N 2,3-dihydro-1h-inden-1-yl n-methylcarbamate Chemical class C1=CC=C2C(OC(=O)NC)CCC2=C1 BONCHIQFCFRFAL-UHFFFAOYSA-N 0.000 title 1
- 230000000749 insecticidal effect Effects 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0049503 | 1966-06-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK121509B true DK121509B (da) | 1971-10-25 |
Family
ID=7103075
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK314867AA DK121509B (da) | 1966-06-18 | 1967-06-16 | Insecticidt og acaricidt virksomme indanyl-N-methylcarbamater. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3597472A (da) |
| BE (1) | BE700039A (da) |
| CH (1) | CH489478A (da) |
| DE (1) | DE1249261B (da) |
| DK (1) | DK121509B (da) |
| ES (1) | ES341874A1 (da) |
| GB (1) | GB1135892A (da) |
| IL (1) | IL28042A (da) |
| NL (1) | NL154209B (da) |
| SE (1) | SE328281B (da) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3958006A (en) * | 1972-05-10 | 1976-05-18 | Union Carbide Corporation | Carbamate pesticidal compositions |
| DE2603835A1 (de) * | 1976-02-02 | 1977-08-04 | Bayer Ag | Indan-5-yl-n-methylcarbaminsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als insektizide |
| DE2739192A1 (de) * | 1977-08-31 | 1979-03-08 | Bayer Ag | Indan-4-yl-n-alkyl-carbaminsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als pflanzenschutzmittel |
| US4291061A (en) * | 1978-11-06 | 1981-09-22 | Ciba-Geigy Corporation | 1H-inden-1-one derivatives, processes for producing them, their use in microbicidal compositions, and for combating microorganisms |
| US4278807A (en) * | 1979-09-28 | 1981-07-14 | Union Carbide Corporation | Process for production of 1-naphthyl methylcarbamate |
| DE3002202A1 (de) * | 1980-01-22 | 1981-08-06 | Bayer Ag, 5090 Leverkusen | Indan-4-yl-n-alkyl-carbaminsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| US4390710A (en) * | 1981-10-19 | 1983-06-28 | Ppg Industries, Inc. | Catalyst system for manufacturing p-chlorophenyl-N-methyl carbamate |
| US4510337A (en) * | 1984-01-31 | 1985-04-09 | Phillips Petroleum Company | Process for production of 1,1-dimethyl-6-hydroxyindans |
-
0
- DE DENDAT1249261D patent/DE1249261B/de active Pending
-
1967
- 1967-05-24 CH CH731067A patent/CH489478A/de not_active IP Right Cessation
- 1967-05-26 IL IL28042A patent/IL28042A/xx unknown
- 1967-05-31 GB GB25131/67A patent/GB1135892A/en not_active Expired
- 1967-05-31 US US642301A patent/US3597472A/en not_active Expired - Lifetime
- 1967-06-09 SE SE08169/67A patent/SE328281B/xx unknown
- 1967-06-15 NL NL676708334A patent/NL154209B/xx unknown
- 1967-06-16 ES ES341874A patent/ES341874A1/es not_active Expired
- 1967-06-16 BE BE700039D patent/BE700039A/xx unknown
- 1967-06-16 DK DK314867AA patent/DK121509B/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1135892A (en) | 1968-12-04 |
| US3597472A (en) | 1971-08-03 |
| BE700039A (da) | 1967-12-18 |
| CH489478A (de) | 1970-04-30 |
| NL6708334A (da) | 1967-12-19 |
| IL28042A (en) | 1971-06-23 |
| NL154209B (nl) | 1977-08-15 |
| ES341874A1 (es) | 1968-07-16 |
| SE328281B (da) | 1970-09-14 |
| DE1249261B (de) | 1967-09-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK128607B (da) | Insekticidt aktive pyrethrinoider. | |
| DK117538B (da) | Insecticid og acaricid. | |
| DK114382B (da) | Insecticid og acaricid. | |
| DK133579B (da) | Insekticid. | |
| DK114456B (da) | Insecticid og nematodicid. | |
| DK120186B (da) | Oximer med insecticid og acaricid virkning. | |
| DK114519B (da) | Insecticid og acaricid. | |
| DK121509B (da) | Insecticidt og acaricidt virksomme indanyl-N-methylcarbamater. | |
| DK123592B (da) | Insecticidt og acaricidt virksomme phenylhydrazoner. | |
| DK114871B (da) | Insecticidt og acaricidt middel. | |
| DK118633B (da) | Insekticid og akaricid. | |
| DK121154B (da) | Herbicidt og fungicidt middel. | |
| DK121051B (da) | Insecticidt og acaricidt virksomme indanyl-N-methylcarbamidsyreestere. | |
| DK115365B (da) | Insecticid og acaricid. | |
| DK131987C (da) | Insecticidt og acaricidt virksomme forbindelser | |
| DK118747B (da) | Insecticid og acaricid. | |
| DK123604B (da) | Insecticidt og acaricidt virksomme O-alkyl-O-aryl-thiolphosphorsyreestere. | |
| DK123827B (da) | Insecticidt og acaricidt virksomme phosphorylerede 1,2,4-oxadiazoler. | |
| DK120110B (da) | Insekticid og acaricid. | |
| DK119326B (da) | Mideovicidt og fungicidt middel. | |
| DK115671B (da) | Insecticide og acaricide midler. | |
| DK113962B (da) | Insecticid og acaricid. | |
| DK118434B (da) | Insecticid og acaricid. | |
| DK126940B (da) | Arthropocidt og acaricidt virksomme epoxyforbindelser. | |
| DK115738B (da) | Insecticid og acaricid. |