IL27396A - Imidazo(1,5-a)quinolin-1-one (or thione) derivatives and process for their preparation - Google Patents
Imidazo(1,5-a)quinolin-1-one (or thione) derivatives and process for their preparationInfo
- Publication number
- IL27396A IL27396A IL2739667A IL2739667A IL27396A IL 27396 A IL27396 A IL 27396A IL 2739667 A IL2739667 A IL 2739667A IL 2739667 A IL2739667 A IL 2739667A IL 27396 A IL27396 A IL 27396A
- Authority
- IL
- Israel
- Prior art keywords
- lower alkyl
- piperazinyl
- pyrrolidinyl
- quinolin
- tetrahydro
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 52
- 238000002360 preparation method Methods 0.000 title claims description 45
- 241001061127 Thione Species 0.000 title description 3
- WYBCBZKYJHQHCU-UHFFFAOYSA-N 2h-imidazo[1,5-a]quinolin-1-one Chemical compound C1=CC=C2N3C(=O)NC=C3C=CC2=C1 WYBCBZKYJHQHCU-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 60
- 125000000217 alkyl group Chemical group 0.000 claims description 50
- -1 hexamethyleneimino, 1-piperazinyl Chemical group 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 11
- 125000003386 piperidinyl group Chemical group 0.000 claims description 10
- 150000002431 hydrogen Chemical class 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 6
- 125000006177 alkyl benzyl group Chemical group 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 125000006307 alkoxy benzyl group Chemical group 0.000 claims description 5
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 5
- 229910052717 sulfur Chemical group 0.000 claims description 5
- 239000011593 sulfur Chemical group 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 claims description 3
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 3
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical group ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 claims description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 claims description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 claims 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 42
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 14
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 14
- RMGFLMXDCGQKPS-UHFFFAOYSA-N 1-(2-chloroethyl)pyrrolidine Chemical compound ClCCN1CCCC1 RMGFLMXDCGQKPS-UHFFFAOYSA-N 0.000 description 13
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Natural products OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 10
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000010410 layer Substances 0.000 description 9
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical compound C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 description 7
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 6
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 230000002936 tranquilizing effect Effects 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- QWGYCLIMHHUXSL-UHFFFAOYSA-N 1-benzyl-3-(chloromethyl)pyrrolidine Chemical compound C1C(CCl)CCN1CC1=CC=CC=C1 QWGYCLIMHHUXSL-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000001530 fumaric acid Substances 0.000 description 3
- 239000002480 mineral oil Substances 0.000 description 3
- 235000010446 mineral oil Nutrition 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 239000003204 tranquilizing agent Substances 0.000 description 3
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 239000003874 central nervous system depressant Substances 0.000 description 2
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229960003750 ethyl chloride Drugs 0.000 description 2
- 229960000443 hydrochloric acid Drugs 0.000 description 2
- 235000011167 hydrochloric acid Nutrition 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 230000037023 motor activity Effects 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 238000004810 partition chromatography Methods 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical group C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 1
- FEYPQVSNSBUPFL-UHFFFAOYSA-N 1-(2-chloroethyl)-2-methylpyrrolidine Chemical compound CC1CCCN1CCCl FEYPQVSNSBUPFL-UHFFFAOYSA-N 0.000 description 1
- BCMLPRKOEKRSOL-UHFFFAOYSA-N 1-(2-chloroethyl)-4-methylpiperidine Chemical compound CC1CCN(CCCl)CC1 BCMLPRKOEKRSOL-UHFFFAOYSA-N 0.000 description 1
- NTIAVUBMOJPJPM-UHFFFAOYSA-N 1-(2-chloroethyl)-4-phenylpiperazine Chemical compound C1CN(CCCl)CCN1C1=CC=CC=C1 NTIAVUBMOJPJPM-UHFFFAOYSA-N 0.000 description 1
- FEZWHSLWYVTEDN-UHFFFAOYSA-N 1-(2-chloroethyl)azepane Chemical compound ClCCN1CCCCCC1 FEZWHSLWYVTEDN-UHFFFAOYSA-N 0.000 description 1
- SGVDQWWOUTVAMK-UHFFFAOYSA-N 1-(4-chlorobutyl)piperidine Chemical compound ClCCCCN1CCCCC1 SGVDQWWOUTVAMK-UHFFFAOYSA-N 0.000 description 1
- CWZRNLJWIAWTSN-UHFFFAOYSA-N 1-benzyl-2-(2-chloroethyl)pyrrolidine Chemical compound ClCCC1CCCN1CC1=CC=CC=C1 CWZRNLJWIAWTSN-UHFFFAOYSA-N 0.000 description 1
- NAMDIHYPBYVYAP-UHFFFAOYSA-N 1-methoxy-2-(2-methoxyethoxy)ethane Chemical compound COCCOCCOC.COCCOCCOC NAMDIHYPBYVYAP-UHFFFAOYSA-N 0.000 description 1
- IKJTZJYOLLEQOI-UHFFFAOYSA-N 2-(2-chloroethyl)-1-methylpiperazine Chemical compound CN1CCNCC1CCCl IKJTZJYOLLEQOI-UHFFFAOYSA-N 0.000 description 1
- YMDNODNLFSHHCV-UHFFFAOYSA-N 2-chloro-n,n-diethylethanamine Chemical compound CCN(CC)CCCl YMDNODNLFSHHCV-UHFFFAOYSA-N 0.000 description 1
- KCSAHRXDRLVMJU-UHFFFAOYSA-N 2-chloro-n-(cyclopropylmethyl)-n-methylethanamine Chemical compound ClCCN(C)CC1CC1 KCSAHRXDRLVMJU-UHFFFAOYSA-N 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical compound C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 description 1
- JHHRQVTUROCUDM-UHFFFAOYSA-N 3-(chloromethyl)-1-methylpyrrolidine Chemical compound CN1CCC(CCl)C1 JHHRQVTUROCUDM-UHFFFAOYSA-N 0.000 description 1
- NYYRRBOMNHUCLB-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCCl NYYRRBOMNHUCLB-UHFFFAOYSA-N 0.000 description 1
- GSCDLDXSKMWJMV-UHFFFAOYSA-N 4-(2-chloroethyl)-2,6-dimethylmorpholine Chemical compound CC1CN(CCCl)CC(C)O1 GSCDLDXSKMWJMV-UHFFFAOYSA-N 0.000 description 1
- ZAPMTSHEXFEPSD-UHFFFAOYSA-N 4-(2-chloroethyl)morpholine Chemical compound ClCCN1CCOCC1 ZAPMTSHEXFEPSD-UHFFFAOYSA-N 0.000 description 1
- HIZOTHLNNPXFHY-UHFFFAOYSA-N 4-(2-fluorophenyl)-1,2,3,6-tetrahydropyridine Chemical compound FC1=CC=CC=C1C1=CCNCC1 HIZOTHLNNPXFHY-UHFFFAOYSA-N 0.000 description 1
- LQKLPHASNRSNQV-UHFFFAOYSA-N 4-(3-bromophenyl)-1,2,3,6-tetrahydropyridine Chemical compound BrC1=CC=CC(C=2CCNCC=2)=C1 LQKLPHASNRSNQV-UHFFFAOYSA-N 0.000 description 1
- QISOBCMNUJQOJU-UHFFFAOYSA-N 4-bromo-1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1NN=CC=1Br QISOBCMNUJQOJU-UHFFFAOYSA-N 0.000 description 1
- ZYKVRFMMRAPHAZ-UHFFFAOYSA-N 7-fluoro-3 Chemical compound C1S(=O)(=O)CC(C=2)=CC(F)=CC=2CS(=O)(=O)CC2=CC=C1C=C2 ZYKVRFMMRAPHAZ-UHFFFAOYSA-N 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 206010033799 Paralysis Diseases 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 206010070863 Toxicity to various agents Diseases 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 1
- 125000005233 alkylalcohol group Chemical group 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000012729 immediate-release (IR) formulation Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229940060367 inert ingredients Drugs 0.000 description 1
- 231100000225 lethality Toxicity 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000006742 locomotor activity Effects 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- MCVHNCIHXMQWGY-UHFFFAOYSA-N n-(2-chloroethyl)-n-methylcyclohexanamine Chemical compound ClCCN(C)C1CCCCC1 MCVHNCIHXMQWGY-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 229940125725 tranquilizer Drugs 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US52835466A | 1966-02-18 | 1966-02-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL27396A true IL27396A (en) | 1971-03-24 |
Family
ID=24105342
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL2739667A IL27396A (en) | 1966-02-18 | 1967-02-06 | Imidazo(1,5-a)quinolin-1-one (or thione) derivatives and process for their preparation |
Country Status (9)
| Country | Link |
|---|---|
| BE (1) | BE694205A (oth) |
| CH (1) | CH521366A (oth) |
| DE (1) | DE1645955A1 (oth) |
| ES (1) | ES336999A1 (oth) |
| FR (2) | FR1511914A (oth) |
| GB (1) | GB1172426A (oth) |
| IL (1) | IL27396A (oth) |
| NL (1) | NL6702347A (oth) |
| SE (1) | SE335345B (oth) |
-
1967
- 1967-02-06 IL IL2739667A patent/IL27396A/en unknown
- 1967-02-08 GB GB613067A patent/GB1172426A/en not_active Expired
- 1967-02-15 DE DE19671645955 patent/DE1645955A1/de active Pending
- 1967-02-16 CH CH222167A patent/CH521366A/de not_active IP Right Cessation
- 1967-02-16 NL NL6702347A patent/NL6702347A/xx unknown
- 1967-02-17 FR FR95485A patent/FR1511914A/fr not_active Expired
- 1967-02-17 BE BE694205D patent/BE694205A/xx unknown
- 1967-02-17 FR FR95484A patent/FR6101M/fr not_active Expired
- 1967-02-17 SE SE223867A patent/SE335345B/xx unknown
- 1967-02-18 ES ES336999A patent/ES336999A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE1645955A1 (de) | 1970-07-16 |
| BE694205A (oth) | 1967-08-17 |
| FR6101M (oth) | 1968-06-10 |
| NL6702347A (oth) | 1967-08-21 |
| SE335345B (oth) | 1971-05-24 |
| CH521366A (de) | 1972-04-15 |
| GB1172426A (en) | 1969-11-26 |
| ES336999A1 (es) | 1968-06-01 |
| FR1511914A (fr) | 1968-02-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3813384A (en) | Basically substituted benzyl phthalazone derivatives,acid salts thereof and process for the production thereof | |
| HUT70195A (en) | Process for producing benzimidazolone derivatives and pharmaceutical preparations containing them | |
| WO1998006717A9 (en) | Fused indolecarboxamides: dopamine receptor subtype specific ligands | |
| US3758479A (en) | Nitro and sulphamoyl substituted dibenzodiazepines | |
| EP1255736A2 (de) | Substituierte piperazinderivate und ihre verwendung als inhibitoren des mikrosomalen triglyzerid-transferproteins (mtp) | |
| WO1998006717A1 (en) | Fused indolecarboxamides: dopamine receptor subtype specific ligands | |
| US3466274A (en) | Fluoreno-(1,9-ef)-1,4-diazepine-1-oxides and 1,3-diazafluoranthene-1-oxides | |
| US3444169A (en) | Process for 11 - aminodibenz(b,f)(1,4)oxazepines and analogous thiazepines | |
| US3458516A (en) | 11-(piperazinyl)dibenz(b,f)(1,4)oxazepines and analogous thiazepines | |
| US3317524A (en) | Substituted 1, 2, 3, 4-tetrahydro-pyrazino[1, 2-a]indoles | |
| GB1581500A (en) | Pyridobenzodiazepines | |
| NO880352L (no) | Fremgangsmaate for fremstilling av 4-aryl-n-(2-(dialkylamino og heterocyklisk amino)alkyl)-1-piperazincarboxamider. | |
| US3983239A (en) | Hexahydro-γ-carboline derivatives and their salts | |
| US4213984A (en) | 11-(Piperazino-acetyl)-5,11-dihydro-6H-pyrido[2,3-b][1,4]benzodiazepin-6-ones and salts thereof | |
| US4284555A (en) | 7-Chloro-8(substituted amino carbonyloxy)-1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepines | |
| US3474090A (en) | 3-aminoalkyl-1,3-benzodiazepin-2-ones | |
| HU187340B (en) | Process for the preparation of new 5-substituted-5,10-dihydro-11h-bibenzo-bracket-b,e-bracket closed-bracket-1,4-bracket closed-diazepin-11-ones | |
| US3454579A (en) | Imidazo(1,5-a)quinolin-1-one and thione derivatives | |
| EP0107930A2 (en) | Fused aromatic oxazepinones and sulphur analogues thereof and their preparation and use in counteracting histamine | |
| EP0123962B1 (en) | Benzimidazole derivative, process for the preparation thereof and pharmaceutical composition | |
| US3884920A (en) | 11-Basically substituted dibenz {8 b,f{9 {0 {8 1,4{9 {0 oxazepines | |
| US3634408A (en) | 5-substituted 54)diazepin-11-ones | |
| US2979502A (en) | Phenthiazine derivatives | |
| IL27396A (en) | Imidazo(1,5-a)quinolin-1-one (or thione) derivatives and process for their preparation | |
| NZ195079A (en) | 10-(piperid-4-yl)-10,11-dihydro-(dibenzo(b,f)(1,4)(oxa or thia)zepines or 5h-dibenzo(b,c)(1,4)diazepines) |