IL23999A - History of benzodiazepines and the process for their production - Google Patents
History of benzodiazepines and the process for their productionInfo
- Publication number
- IL23999A IL23999A IL23999A IL2399965A IL23999A IL 23999 A IL23999 A IL 23999A IL 23999 A IL23999 A IL 23999A IL 2399965 A IL2399965 A IL 2399965A IL 23999 A IL23999 A IL 23999A
- Authority
- IL
- Israel
- Prior art keywords
- phenyl
- acid
- dihydro
- benzodiazepin
- chloro
- Prior art date
Links
- 229940053197 benzodiazepine derivative antiepileptics Drugs 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- 238000000034 method Methods 0.000 title claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 125000003310 benzodiazepinyl group Chemical class N1N=C(C=CC2=C1C=CC=C2)* 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- -1 ethylene , propylene, trimethylene, ethylethylene Chemical group 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 4
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 229940073584 methylene chloride Drugs 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Substances CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Natural products OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 125000000174 L-prolyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229940125681 anticonvulsant agent Drugs 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229960004132 diethyl ether Drugs 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- TYQCGQRIZGCHNB-JLAZNSOCSA-N l-ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(O)=C(O)C1=O TYQCGQRIZGCHNB-JLAZNSOCSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229940035363 muscle relaxants Drugs 0.000 description 1
- 239000003158 myorelaxant agent Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- LIGACIXOYTUXAW-UHFFFAOYSA-N phenacyl bromide Chemical compound BrCC(=O)C1=CC=CC=C1 LIGACIXOYTUXAW-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 229940125723 sedative agent Drugs 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- UMFCIIBZHQXRCJ-NSCUHMNNSA-N trans-anol Chemical compound C\C=C\C1=CC=C(O)C=C1 UMFCIIBZHQXRCJ-NSCUHMNNSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US38946964A | 1964-08-13 | 1964-08-13 | |
| US474159A US3391138A (en) | 1964-08-13 | 1965-07-22 | Certain 1-substituted-benzodiazepin-2-one compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL23999A true IL23999A (en) | 1969-05-28 |
Family
ID=27012718
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL23999A IL23999A (en) | 1964-08-13 | 1965-07-21 | History of benzodiazepines and the process for their production |
| IL23998A IL23998A (en) | 1964-08-13 | 1965-07-21 | Benzodiazepine derivatives and process for the manufacture thereof |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL23998A IL23998A (en) | 1964-08-13 | 1965-07-21 | Benzodiazepine derivatives and process for the manufacture thereof |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3391138A (,) |
| BE (2) | BE668189A (,) |
| BR (2) | BR6571654D0 (,) |
| CH (1) | CH462831A (,) |
| DE (2) | DE1545952C3 (,) |
| DK (2) | DK125554B (,) |
| FR (1) | FR135F (,) |
| GB (2) | GB1106040A (,) |
| IL (2) | IL23999A (,) |
| NL (2) | NL6510538A (,) |
| NO (2) | NO119588B (,) |
| SE (2) | SE310687B (,) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL33961A (en) * | 1969-03-13 | 1973-03-30 | Sparamedica Ag | Benzodiazepine aminoalkyl carboxylates,their preparation and pharmaceutical compositions containing them |
| US3989829A (en) * | 1969-04-18 | 1976-11-02 | Sumitomo Chemical Company, Limited | 1,4-Benzodiazepines |
| USRE28972E (en) * | 1969-07-10 | 1976-09-21 | Boehringer Ingelheim Gmbh | 5-Aryl-1H-1,5-benzodiazepine-2,4-diones |
| US3867372A (en) * | 1970-02-03 | 1975-02-18 | Sumitomo Chemical Co | Benzodiazepine process |
| US3691157A (en) * | 1970-08-12 | 1972-09-12 | Rodney Ian Fryer | Preparation of 7-substituted-1-(2-diethylaminoethyl)-5-(2-halophenyl)-1,3-dihydro-2h-1,4-benzodiazepin-2-ones |
| US3910889A (en) * | 1970-08-31 | 1975-10-07 | Sumitomo Chemical Co | Novel benzodiazepine derivatives and preparation thereof |
| AT314541B (de) * | 1970-10-19 | 1974-04-10 | Sumitomo Chemical Co | Verfahren zur Herstellung von neuen Benzodiazepinen und ihren Salzen |
| US4065451A (en) * | 1971-03-30 | 1977-12-27 | American Home Products | 1,3-Dihydro-3-hydroxy-5-phenyl-2H-1,4-benzodiazepin-2-one, substituted diamino acetate esters and their acid salts |
| US3886276A (en) * | 1971-03-30 | 1975-05-27 | American Home Prod | 1,3-Dihydro-3 -hydroxy-5-phenyl-2H-1,4-benzodiazepin-2-one, substituted diamino acetate esters and their acid salts in compositions and methods for inducing a calming effect |
| US3872089A (en) * | 1971-05-14 | 1975-03-18 | Hoffmann La Roche | Substituted thienodiazepines |
| US3966943A (en) * | 1971-09-13 | 1976-06-29 | The Upjohn Company | 6-Pyridyl benzodiazepines antidepressants |
| US3926952A (en) * | 1972-10-03 | 1975-12-16 | American Home Prod | 1,4-Benzodiazepin-2-ones and their synthesis |
| US4012413A (en) * | 1973-05-17 | 1977-03-15 | The Upjohn Company | Organic compounds and process |
| US3865815A (en) * | 1973-11-29 | 1975-02-11 | Hoffmann La Roche | 7-Hydroxyamino-1,4-benzodiazepines |
| US4006135A (en) * | 1974-06-19 | 1977-02-01 | Ddsa Pharmaceuticals | Hydroxymethyl benzodiazepine derivatives |
| US3969504A (en) * | 1975-02-14 | 1976-07-13 | The Upjohn Co. | 6-Phenyl benzodiazepine antidepressants |
| FI783743A7 (fi) * | 1977-12-14 | 1979-06-15 | Gerot Pharmazeutika | Foerfarande foer framstaellning av 3-di-n-propyl-acetoxi-benzodiazepin-2-oner |
| AT361492B (de) * | 1978-12-18 | 1981-03-10 | Gerot Pharmazeutika | Verfahren zur herstellung von neuen 3-hydroxy- 1,4-benzodiazepin-2-onen |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3236838A (en) * | 1964-06-09 | 1966-02-22 | Hoffmann La Roche | Certain 1-substituted-benzodiazepin-2-one compounds |
-
0
- FR FR135D patent/FR135F/fr active Active
-
1965
- 1965-07-21 IL IL23999A patent/IL23999A/en unknown
- 1965-07-21 IL IL23998A patent/IL23998A/xx unknown
- 1965-07-22 US US474159A patent/US3391138A/en not_active Expired - Lifetime
- 1965-07-23 CH CH1036865A patent/CH462831A/de unknown
- 1965-07-27 DE DE1545952A patent/DE1545952C3/de not_active Expired
- 1965-07-29 BR BR171654/65A patent/BR6571654D0/pt unknown
- 1965-07-29 BR BR171653/65A patent/BR6571653D0/pt unknown
- 1965-07-29 DE DE19651545953 patent/DE1545953A1/de active Pending
- 1965-08-09 GB GB44504/67A patent/GB1106040A/en not_active Expired
- 1965-08-09 GB GB33994/65A patent/GB1102934A/en not_active Expired
- 1965-08-11 DK DK411365AA patent/DK125554B/da unknown
- 1965-08-11 DK DK411265AA patent/DK120848B/da unknown
- 1965-08-12 BE BE668189D patent/BE668189A/xx unknown
- 1965-08-12 BE BE668188D patent/BE668188A/xx unknown
- 1965-08-12 NL NL6510538A patent/NL6510538A/xx unknown
- 1965-08-12 NO NO159321A patent/NO119588B/no unknown
- 1965-08-12 NO NO159320A patent/NO118914B/no unknown
- 1965-08-12 NL NL6510539A patent/NL6510539A/xx unknown
- 1965-08-13 SE SE10628/65A patent/SE310687B/xx unknown
- 1965-08-13 SE SE10629/65A patent/SE312558B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH462831A (de) | 1968-09-30 |
| DK120848B (da) | 1971-07-26 |
| FR135F (,) | |
| NL6510538A (,) | 1966-02-14 |
| DE1545953A1 (de) | 1969-11-20 |
| BE668189A (,) | 1965-12-01 |
| NL6510539A (,) | 1966-02-14 |
| BE668188A (,) | 1966-02-14 |
| NO118914B (,) | 1970-03-02 |
| SE310687B (,) | 1969-05-12 |
| US3391138A (en) | 1968-07-02 |
| IL23998A (en) | 1969-02-27 |
| BR6571654D0 (pt) | 1973-08-14 |
| GB1106040A (en) | 1968-03-13 |
| DE1545952B2 (de) | 1974-07-04 |
| GB1102934A (en) | 1968-02-14 |
| DK125554B (da) | 1973-03-05 |
| NO119588B (,) | 1970-06-08 |
| SE312558B (,) | 1969-07-21 |
| DE1545952C3 (de) | 1975-03-06 |
| BR6571653D0 (pt) | 1973-08-14 |
| DE1545952A1 (de) | 1969-12-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL23999A (en) | History of benzodiazepines and the process for their production | |
| IL22869A (en) | A benzodiazepine derivative and process for the manufacture thereof | |
| US4427590A (en) | Triazolobenzodiazepine derivatives | |
| IL22721A (en) | Benzodiazepine derivatives and process for the manufacture thereof | |
| US3442946A (en) | 2-aminomercapto- and 2-aminoalkylcaptobenzophenone oximes | |
| US3925358A (en) | 1-Lower alkyl-2-substituted-1,4-benzodiazepines | |
| US3703510A (en) | 1-carboxyalkyl or 1-carboxyalkenyl-1,4-benzodiazepin-2-ones | |
| US3852300A (en) | CERTAIN 6-PHENYL-4H-S-TRIAZOLO{8 1,5-a{9 {8 1,4-BENZODIAZEPINES{9 | |
| IL29772A (en) | Benzodiazepine derivatives and process for the manufacture thereof | |
| US3686308A (en) | 5-lower alkanoyl-2-glycylamino-benzophenones | |
| US3825533A (en) | N-carboxymethyl-n-substituted glycinate esters of 3-hydroxy-1,4-benzo-diazepin-2-ones | |
| US3801569A (en) | 7-(1,1-difluoroalkyl)-1,4-benzodiazepines | |
| US3812103A (en) | 2,3-dihydro-1,4-benzodiazepines | |
| US3869448A (en) | 2-Lower alkylsulfinyl-1H-1,4-benzodiazepines | |
| US3850948A (en) | Certain 3a,4-dihydro-8-chloro-6-phenyl-thiazolo(3,2-h)-1,4-benzodiazepin-1(2h)-ones | |
| US3644334A (en) | 7-azido-benzodiazepines | |
| US3989681A (en) | 7-Azoxy substituted-1,4-benzodiazepin-2-ones | |
| US3374225A (en) | Aminobenzodiazepine compounds and methods | |
| US3553206A (en) | 7-lower alkanoyl benzodiazepines | |
| US3932399A (en) | 2,5-Epithio-1,4-benzodiazepines | |
| US3410844A (en) | 2, 3, 4, 5-tetrahydro-2-oxo-1h-1, 4-benzodiazepine-3-carboxylic acid, esters and related compounds | |
| US3901879A (en) | 2-(2-hydroxyethylthio)-2,3-dihydro-5-phenyl-1h-1,4-benzodiazepines | |
| US3845039A (en) | 1-polyfluoroalkyl-1,4-benzodiazepin-2-thiones | |
| US3846410A (en) | 3-substituted-7-hydroxy lower alkyl benzodiazepines | |
| US3880840A (en) | Pyrazino-1,4-diazepines |