IE54396B1 - Process for the preparation of meta-halogenoanilines - Google Patents
Process for the preparation of meta-halogenoanilinesInfo
- Publication number
- IE54396B1 IE54396B1 IE214/83A IE21483A IE54396B1 IE 54396 B1 IE54396 B1 IE 54396B1 IE 214/83 A IE214/83 A IE 214/83A IE 21483 A IE21483 A IE 21483A IE 54396 B1 IE54396 B1 IE 54396B1
- Authority
- IE
- Ireland
- Prior art keywords
- process according
- general formula
- depicted
- aniline derivative
- halogen
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 45
- 238000002360 preparation method Methods 0.000 title claims abstract description 7
- 150000001448 anilines Chemical group 0.000 claims abstract description 29
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 16
- 150000002367 halogens Chemical class 0.000 claims abstract description 16
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 claims abstract description 14
- 125000005843 halogen group Chemical group 0.000 claims abstract description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 11
- 229910000510 noble metal Inorganic materials 0.000 claims abstract description 11
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims abstract description 7
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims abstract description 6
- 230000000737 periodic effect Effects 0.000 claims abstract description 5
- 239000007791 liquid phase Substances 0.000 claims abstract description 4
- 238000006243 chemical reaction Methods 0.000 claims description 27
- 239000003054 catalyst Substances 0.000 claims description 24
- 229910052801 chlorine Inorganic materials 0.000 claims description 23
- 239000002904 solvent Substances 0.000 claims description 19
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 18
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 17
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical group ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 claims description 16
- XOGYQVITULCUGU-UHFFFAOYSA-N 3,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C(Cl)=C1 XOGYQVITULCUGU-UHFFFAOYSA-N 0.000 claims description 13
- UQRLKWGPEVNVHT-UHFFFAOYSA-N 3,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC(Cl)=C1 UQRLKWGPEVNVHT-UHFFFAOYSA-N 0.000 claims description 12
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 claims description 12
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 229910052763 palladium Inorganic materials 0.000 claims description 7
- BRPSAOUFIJSKOT-UHFFFAOYSA-N 2,3-dichloroaniline Chemical group NC1=CC=CC(Cl)=C1Cl BRPSAOUFIJSKOT-UHFFFAOYSA-N 0.000 claims description 6
- SDYWXFYBZPNOFX-UHFFFAOYSA-N 3,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C(Cl)=C1 SDYWXFYBZPNOFX-UHFFFAOYSA-N 0.000 claims description 6
- 125000004429 atom Chemical group 0.000 claims description 6
- YTDHEFNWWHSXSU-UHFFFAOYSA-N 2,3,5,6-tetrachloroaniline Chemical compound NC1=C(Cl)C(Cl)=CC(Cl)=C1Cl YTDHEFNWWHSXSU-UHFFFAOYSA-N 0.000 claims description 5
- GBKZRUCVLTWAML-UHFFFAOYSA-N 2,3,4,5-tetrachloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C(Cl)=C1Cl GBKZRUCVLTWAML-UHFFFAOYSA-N 0.000 claims description 4
- GUMCAKKKNKYFEB-UHFFFAOYSA-N 2,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C=C1Cl GUMCAKKKNKYFEB-UHFFFAOYSA-N 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 239000011630 iodine Substances 0.000 claims description 4
- ZPQOPVIELGIULI-UHFFFAOYSA-N 1,3-dichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1 ZPQOPVIELGIULI-UHFFFAOYSA-N 0.000 claims description 2
- KHCZSJXTDDHLGJ-UHFFFAOYSA-N 2,3,4,5,6-pentachloroaniline Chemical compound NC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl KHCZSJXTDDHLGJ-UHFFFAOYSA-N 0.000 claims description 2
- LXCLPHJRGDTDDB-UHFFFAOYSA-N 2,3,4,6-tetrachloroaniline Chemical compound NC1=C(Cl)C=C(Cl)C(Cl)=C1Cl LXCLPHJRGDTDDB-UHFFFAOYSA-N 0.000 claims description 2
- RRJUYQOFOMFVQS-UHFFFAOYSA-N 2,3,4-trichloroaniline Chemical compound NC1=CC=C(Cl)C(Cl)=C1Cl RRJUYQOFOMFVQS-UHFFFAOYSA-N 0.000 claims description 2
- MOTBXEPLFOLWHZ-UHFFFAOYSA-N 2,3,5-trichloroaniline Chemical compound NC1=CC(Cl)=CC(Cl)=C1Cl MOTBXEPLFOLWHZ-UHFFFAOYSA-N 0.000 claims description 2
- ZJMMPUVJZQBMEM-UHFFFAOYSA-N 2,3,6-trichloroaniline Chemical compound NC1=C(Cl)C=CC(Cl)=C1Cl ZJMMPUVJZQBMEM-UHFFFAOYSA-N 0.000 claims description 2
- AVYGCQXNNJPXSS-UHFFFAOYSA-N 2,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC=C1Cl AVYGCQXNNJPXSS-UHFFFAOYSA-N 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims 1
- 150000001555 benzenes Chemical class 0.000 claims 1
- 239000012071 phase Substances 0.000 abstract description 3
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 description 9
- 229910052739 hydrogen Inorganic materials 0.000 description 9
- 230000035484 reaction time Effects 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- 229910001220 stainless steel Inorganic materials 0.000 description 4
- 239000010935 stainless steel Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 3
- 238000005260 corrosion Methods 0.000 description 3
- 230000007797 corrosion Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 150000008422 chlorobenzenes Chemical class 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- -1 quaternary ammonium halide Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- ONRFSTKRXHVKTI-UHFFFAOYSA-N 2,3,4,5-tetrachloro-6-methoxyaniline Chemical compound COC1=C(N)C(Cl)=C(Cl)C(Cl)=C1Cl ONRFSTKRXHVKTI-UHFFFAOYSA-N 0.000 description 1
- ZUMRAASOHVUGRC-UHFFFAOYSA-N 2,3,4,5-tetrachloro-6-phenoxyaniline Chemical compound NC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1OC1=CC=CC=C1 ZUMRAASOHVUGRC-UHFFFAOYSA-N 0.000 description 1
- QDRIOLWGEOQJCP-UHFFFAOYSA-N 2,3,4,6-tetrachloro-5-methoxyaniline Chemical compound COC1=C(Cl)C(N)=C(Cl)C(Cl)=C1Cl QDRIOLWGEOQJCP-UHFFFAOYSA-N 0.000 description 1
- WUIMAOZZLPNIMF-UHFFFAOYSA-N 2,3,4-trichloro-5-methoxyaniline Chemical compound COC1=CC(N)=C(Cl)C(Cl)=C1Cl WUIMAOZZLPNIMF-UHFFFAOYSA-N 0.000 description 1
- WIFDZVYHLRPFSQ-UHFFFAOYSA-N 2,3,4-trichloro-6-methoxyaniline Chemical compound COC1=CC(Cl)=C(Cl)C(Cl)=C1N WIFDZVYHLRPFSQ-UHFFFAOYSA-N 0.000 description 1
- FBHJFDRYHRDILH-UHFFFAOYSA-N 2,3,4-trichloro-6-methylaniline Chemical compound CC1=CC(Cl)=C(Cl)C(Cl)=C1N FBHJFDRYHRDILH-UHFFFAOYSA-N 0.000 description 1
- MBYRIGCRDZOZTI-UHFFFAOYSA-N 2,3,5,6-tetrachloro-4-methoxyaniline Chemical compound COC1=C(Cl)C(Cl)=C(N)C(Cl)=C1Cl MBYRIGCRDZOZTI-UHFFFAOYSA-N 0.000 description 1
- RULFHSKLRHHUBZ-UHFFFAOYSA-N 2,3,5,6-tetrachloro-4-phenoxyaniline Chemical compound ClC1=C(Cl)C(N)=C(Cl)C(Cl)=C1OC1=CC=CC=C1 RULFHSKLRHHUBZ-UHFFFAOYSA-N 0.000 description 1
- GMXFJTFHFYKUQF-UHFFFAOYSA-N 2,3,6-trichloro-4-methoxyaniline Chemical compound COC1=CC(Cl)=C(N)C(Cl)=C1Cl GMXFJTFHFYKUQF-UHFFFAOYSA-N 0.000 description 1
- LZYMHTVWOMZPEO-UHFFFAOYSA-N 2,3-dichloro-4-methoxyaniline Chemical compound COC1=CC=C(N)C(Cl)=C1Cl LZYMHTVWOMZPEO-UHFFFAOYSA-N 0.000 description 1
- CNMBMHIFTUIKLJ-UHFFFAOYSA-N 2,3-dichloro-5-methoxyaniline Chemical compound COC1=CC(N)=C(Cl)C(Cl)=C1 CNMBMHIFTUIKLJ-UHFFFAOYSA-N 0.000 description 1
- NGQZFSHSIJZJNX-UHFFFAOYSA-N 2,3-dichloro-6-methoxyaniline Chemical compound COC1=CC=C(Cl)C(Cl)=C1N NGQZFSHSIJZJNX-UHFFFAOYSA-N 0.000 description 1
- JHZWCHORDSEJQD-UHFFFAOYSA-N 2,5-dichloro-3-methoxyaniline Chemical compound COC1=CC(Cl)=CC(N)=C1Cl JHZWCHORDSEJQD-UHFFFAOYSA-N 0.000 description 1
- DKLUBYIAONUMRE-UHFFFAOYSA-N 2,5-dichloro-4-ethylaniline Chemical compound CCC1=CC(Cl)=C(N)C=C1Cl DKLUBYIAONUMRE-UHFFFAOYSA-N 0.000 description 1
- VCMXIPGKIUDONN-UHFFFAOYSA-N 2,5-dichloro-4-methoxyaniline Chemical compound COC1=CC(Cl)=C(N)C=C1Cl VCMXIPGKIUDONN-UHFFFAOYSA-N 0.000 description 1
- PLVBBUUBVVJOIB-UHFFFAOYSA-N 2,5-dichloro-4-methylaniline Chemical compound CC1=CC(Cl)=C(N)C=C1Cl PLVBBUUBVVJOIB-UHFFFAOYSA-N 0.000 description 1
- QXDILMJTDWNTAV-UHFFFAOYSA-N 2,5-dichloro-4-phenoxyaniline Chemical compound C1=C(Cl)C(N)=CC(Cl)=C1OC1=CC=CC=C1 QXDILMJTDWNTAV-UHFFFAOYSA-N 0.000 description 1
- YCJWTHYCBOTYAL-UHFFFAOYSA-N 2,5-dichloro-4-propylaniline Chemical compound CCCC1=CC(Cl)=C(N)C=C1Cl YCJWTHYCBOTYAL-UHFFFAOYSA-N 0.000 description 1
- ZDDBBMFYYJXISB-UHFFFAOYSA-N 3,4,5-trichloro-2-methoxyaniline Chemical compound COC1=C(N)C=C(Cl)C(Cl)=C1Cl ZDDBBMFYYJXISB-UHFFFAOYSA-N 0.000 description 1
- FBKQCRAVAOUMHN-UHFFFAOYSA-N 3,4,6-trichloro-2-methoxyaniline Chemical compound COC1=C(N)C(Cl)=CC(Cl)=C1Cl FBKQCRAVAOUMHN-UHFFFAOYSA-N 0.000 description 1
- YNMZQQXVRYHMKT-UHFFFAOYSA-N 3,4-dichloro-2-methoxyaniline Chemical compound COC1=C(N)C=CC(Cl)=C1Cl YNMZQQXVRYHMKT-UHFFFAOYSA-N 0.000 description 1
- RLTUJGIRWIFRLO-UHFFFAOYSA-N 3,4-dichloro-5-methoxyaniline Chemical compound COC1=CC(N)=CC(Cl)=C1Cl RLTUJGIRWIFRLO-UHFFFAOYSA-N 0.000 description 1
- FCNJFFUXQXCKFS-UHFFFAOYSA-N 3,5-dichloro-2-methoxyaniline Chemical compound COC1=C(N)C=C(Cl)C=C1Cl FCNJFFUXQXCKFS-UHFFFAOYSA-N 0.000 description 1
- RLECPRVZOAXLMK-UHFFFAOYSA-N 3,5-dichloro-2-phenoxyaniline Chemical compound NC1=CC(Cl)=CC(Cl)=C1OC1=CC=CC=C1 RLECPRVZOAXLMK-UHFFFAOYSA-N 0.000 description 1
- GNFMBCBDTFAEHM-UHFFFAOYSA-N 3,5-dichloro-4-methoxyaniline Chemical compound COC1=C(Cl)C=C(N)C=C1Cl GNFMBCBDTFAEHM-UHFFFAOYSA-N 0.000 description 1
- GTEUMCIATAHZFK-UHFFFAOYSA-N 3,5-dichloro-4-methylaniline Chemical compound CC1=C(Cl)C=C(N)C=C1Cl GTEUMCIATAHZFK-UHFFFAOYSA-N 0.000 description 1
- KFAAKHZTICEVTO-UHFFFAOYSA-N 3,5-dichloro-4-phenoxyaniline Chemical compound ClC1=CC(N)=CC(Cl)=C1OC1=CC=CC=C1 KFAAKHZTICEVTO-UHFFFAOYSA-N 0.000 description 1
- DSTYKCDGDXOVOZ-UHFFFAOYSA-N 3,6-dichloro-2-methoxyaniline Chemical compound COC1=C(N)C(Cl)=CC=C1Cl DSTYKCDGDXOVOZ-UHFFFAOYSA-N 0.000 description 1
- VPZJHTWLWKFPQW-UHFFFAOYSA-N 3-chloro-2-methoxyaniline Chemical compound COC1=C(N)C=CC=C1Cl VPZJHTWLWKFPQW-UHFFFAOYSA-N 0.000 description 1
- LVFXXXPXOSABGF-UHFFFAOYSA-N 3-chloro-2-phenoxyaniline Chemical compound NC1=CC=CC(Cl)=C1OC1=CC=CC=C1 LVFXXXPXOSABGF-UHFFFAOYSA-N 0.000 description 1
- KWTAEBKYISVYFB-UHFFFAOYSA-N 3-chloro-4,5-dimethylaniline Chemical compound CC1=CC(N)=CC(Cl)=C1C KWTAEBKYISVYFB-UHFFFAOYSA-N 0.000 description 1
- LBGGMEGRRIBANG-UHFFFAOYSA-N 3-chloro-4-ethylaniline Chemical compound CCC1=CC=C(N)C=C1Cl LBGGMEGRRIBANG-UHFFFAOYSA-N 0.000 description 1
- XQVCBOLNTSUFGD-UHFFFAOYSA-N 3-chloro-4-methoxyaniline Chemical compound COC1=CC=C(N)C=C1Cl XQVCBOLNTSUFGD-UHFFFAOYSA-N 0.000 description 1
- XUZCJDBXXYJXDD-UHFFFAOYSA-N 3-chloro-5-methylaniline Chemical compound CC1=CC(N)=CC(Cl)=C1 XUZCJDBXXYJXDD-UHFFFAOYSA-N 0.000 description 1
- OMUPQCXITFAUCB-UHFFFAOYSA-N 4,5-dichloro-2-methoxyaniline Chemical compound COC1=CC(Cl)=C(Cl)C=C1N OMUPQCXITFAUCB-UHFFFAOYSA-N 0.000 description 1
- PDOWROQDIXWGIV-UHFFFAOYSA-N 4,5-dichloro-2-phenoxyaniline Chemical compound NC1=CC(Cl)=C(Cl)C=C1OC1=CC=CC=C1 PDOWROQDIXWGIV-UHFFFAOYSA-N 0.000 description 1
- PTQLPRQTQOOTRL-UHFFFAOYSA-N 4-(4-amino-2,6-dichlorophenyl)-3,5-dichloroaniline Chemical group ClC1=CC(N)=CC(Cl)=C1C1=C(Cl)C=C(N)C=C1Cl PTQLPRQTQOOTRL-UHFFFAOYSA-N 0.000 description 1
- LNKBDFVSILQKSI-UHFFFAOYSA-N 4-Chloro-3-methoxyaniline Chemical compound COC1=CC(N)=CC=C1Cl LNKBDFVSILQKSI-UHFFFAOYSA-N 0.000 description 1
- WRZOMWDJOLIVQP-UHFFFAOYSA-N 5-Chloro-ortho-toluidine Chemical compound CC1=CC=C(Cl)C=C1N WRZOMWDJOLIVQP-UHFFFAOYSA-N 0.000 description 1
- WBSMIPLNPSCJFS-UHFFFAOYSA-N 5-chloro-2-methoxyaniline Chemical compound COC1=CC=C(Cl)C=C1N WBSMIPLNPSCJFS-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- VEFXTGTZJOWDOF-UHFFFAOYSA-N benzene;hydrate Chemical compound O.C1=CC=CC=C1 VEFXTGTZJOWDOF-UHFFFAOYSA-N 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 238000006298 dechlorination reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- GTWJETSWSUWSEJ-UHFFFAOYSA-N n-benzylaniline Chemical compound C=1C=CC=CC=1CNC1=CC=CC=C1 GTWJETSWSUWSEJ-UHFFFAOYSA-N 0.000 description 1
- KUDPGZONDFORKU-UHFFFAOYSA-N n-chloroaniline Chemical group ClNC1=CC=CC=C1 KUDPGZONDFORKU-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- CEOCDNVZRAIOQZ-UHFFFAOYSA-N pentachlorobenzene Chemical class ClC1=CC(Cl)=C(Cl)C(Cl)=C1Cl CEOCDNVZRAIOQZ-UHFFFAOYSA-N 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 239000004476 plant protection product Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/43—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C211/44—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring
- C07C211/45—Monoamines
- C07C211/46—Aniline
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/68—Preparation of compounds containing amino groups bound to a carbon skeleton from amines, by reactions not involving amino groups, e.g. reduction of unsaturated amines, aromatisation, or substitution of the carbon skeleton
- C07C209/74—Preparation of compounds containing amino groups bound to a carbon skeleton from amines, by reactions not involving amino groups, e.g. reduction of unsaturated amines, aromatisation, or substitution of the carbon skeleton by halogenation, hydrohalogenation, dehalogenation, or dehydrohalogenation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8202021A FR2521132A1 (fr) | 1982-02-05 | 1982-02-05 | Procede de preparation de metahalogeno-anilines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE830214L IE830214L (en) | 1983-08-05 |
| IE54396B1 true IE54396B1 (en) | 1989-09-27 |
Family
ID=9270774
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE214/83A IE54396B1 (en) | 1982-02-05 | 1983-02-03 | Process for the preparation of meta-halogenoanilines |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4495368A (enExample) |
| EP (1) | EP0086726B1 (enExample) |
| JP (1) | JPS58146533A (enExample) |
| KR (1) | KR840003603A (enExample) |
| AT (1) | ATE14012T1 (enExample) |
| BR (1) | BR8300548A (enExample) |
| CA (1) | CA1207798A (enExample) |
| DD (1) | DD207197A5 (enExample) |
| DE (1) | DE3360311D1 (enExample) |
| DK (1) | DK47883A (enExample) |
| ES (1) | ES8401010A1 (enExample) |
| FR (1) | FR2521132A1 (enExample) |
| HU (1) | HU190709B (enExample) |
| IE (1) | IE54396B1 (enExample) |
| IL (1) | IL67701A (enExample) |
| SU (1) | SU1261560A3 (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5051030A (en) * | 1990-06-05 | 1991-09-24 | Roy F. Weston, Inc. | Chemical detoxification process for treatment of soils contaminated with halogenated organic compounds |
| US5089653A (en) * | 1991-04-04 | 1992-02-18 | Dow Elanco | Process for the selective reduction of the 4-halogen in 2,4-dihaloanilines |
| CN112457199B (zh) * | 2020-10-27 | 2022-04-15 | 厦门大学 | 一种间氯苯胺的制备方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2503187C3 (de) * | 1975-01-27 | 1979-05-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung durch Chlor meta-substituierte Aniline |
| FR2403991A1 (fr) * | 1977-09-22 | 1979-04-20 | Philagro Sa | Procede de deshalogenation d'amines aromatiques halogenees |
| FR2403990A1 (fr) * | 1977-09-22 | 1979-04-20 | Philagro Sa | Procede de deshalogenation d'amines aromatiques halogenees |
| FR2449077A2 (fr) * | 1979-02-15 | 1980-09-12 | Rhone Poulenc Agrochimie | Procede de preparation d'anilines metachlorees |
| FR2449076A2 (fr) * | 1979-02-15 | 1980-09-12 | Rhone Poulenc Agrochimie | Procede de preparation d'anilines metachlorees |
| FR2449075A1 (fr) * | 1979-02-15 | 1980-09-12 | Rhone Poulenc Agrochimie | Procede de preparation d'anilines metachlorees |
-
1982
- 1982-02-05 FR FR8202021A patent/FR2521132A1/fr active Granted
-
1983
- 1983-01-17 IL IL67701A patent/IL67701A/xx unknown
- 1983-01-20 EP EP83420010A patent/EP0086726B1/fr not_active Expired
- 1983-01-20 DE DE8383420010T patent/DE3360311D1/de not_active Expired
- 1983-01-20 AT AT83420010T patent/ATE14012T1/de not_active IP Right Cessation
- 1983-01-31 US US06/462,327 patent/US4495368A/en not_active Expired - Fee Related
- 1983-02-03 JP JP58016861A patent/JPS58146533A/ja active Pending
- 1983-02-03 IE IE214/83A patent/IE54396B1/en unknown
- 1983-02-03 CA CA000420851A patent/CA1207798A/en not_active Expired
- 1983-02-04 BR BR8300548A patent/BR8300548A/pt unknown
- 1983-02-04 SU SU3549190A patent/SU1261560A3/ru active
- 1983-02-04 HU HU83399A patent/HU190709B/hu not_active IP Right Cessation
- 1983-02-04 DD DD83247729A patent/DD207197A5/de not_active IP Right Cessation
- 1983-02-04 DK DK47883A patent/DK47883A/da not_active Application Discontinuation
- 1983-02-04 ES ES519538A patent/ES8401010A1/es not_active Expired
- 1983-02-04 KR KR1019830000426A patent/KR840003603A/ko not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| ATE14012T1 (de) | 1985-07-15 |
| IL67701A (en) | 1986-12-31 |
| KR840003603A (ko) | 1984-09-15 |
| SU1261560A3 (ru) | 1986-09-30 |
| IL67701A0 (en) | 1983-05-15 |
| ES519538A0 (es) | 1983-11-16 |
| FR2521132A1 (fr) | 1983-08-12 |
| CA1207798A (en) | 1986-07-15 |
| EP0086726B1 (fr) | 1985-06-26 |
| JPS58146533A (ja) | 1983-09-01 |
| ES8401010A1 (es) | 1983-11-16 |
| US4495368A (en) | 1985-01-22 |
| DE3360311D1 (en) | 1985-08-01 |
| BR8300548A (pt) | 1983-11-08 |
| DK47883A (da) | 1983-08-06 |
| DK47883D0 (da) | 1983-02-04 |
| IE830214L (en) | 1983-08-05 |
| HU190709B (en) | 1986-10-28 |
| DD207197A5 (de) | 1984-02-22 |
| FR2521132B1 (enExample) | 1984-03-16 |
| EP0086726A1 (fr) | 1983-08-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3989756A (en) | Process for the production of halogenated aromatic primary amines | |
| US7098371B2 (en) | Method of hydrodechlorinating nuclear-chlorinated ortho-xylenes | |
| JPS5848540B2 (ja) | 塩素でメタ置換されたアニリンの製造方法 | |
| CA1139313A (en) | Process for the preparation of meta-chloro-anilines | |
| US4447647A (en) | Process for the preparation of 2,4,6-trichloroaniline | |
| IE54396B1 (en) | Process for the preparation of meta-halogenoanilines | |
| US5498807A (en) | Process for the preparation of aromatic fluoro compounds | |
| CA1139314A (en) | Preparation of anilines substituted in the meta-position (s) by chlorine | |
| US4418213A (en) | Process for the selective preparation of meta-chloroanilines | |
| CA1211127A (en) | Process for the selective preparation of anilines substituted in the meta-position(s) by chlorine | |
| CA1139315A (en) | Process for the preparation of anilines substituted in the meta-position (s) by chlorine | |
| US3639482A (en) | Preparation of fluoroanilines | |
| CA1209588A (en) | Process for the preparation of meta-chloroanilines | |
| US5616810A (en) | Process for the preparation of deactivated anilines | |
| KR830002430B1 (ko) | 염소 치환아닐린류의 제조방법 | |
| US6362372B2 (en) | Process for producing trifluoromethylbenzylamines | |
| KR840001961B1 (ko) | 염소 치환 아닐린의 제조방법 | |
| JP3017005B2 (ja) | 失活されたアニリン類の合成法 | |
| JPH1112233A (ja) | 失活されたアニリン類の脱アルキル方法 |