IE49916B1 - Process for the preparation of 3-thienylmalonic acid - Google Patents
Process for the preparation of 3-thienylmalonic acidInfo
- Publication number
- IE49916B1 IE49916B1 IE1261/80A IE126180A IE49916B1 IE 49916 B1 IE49916 B1 IE 49916B1 IE 1261/80 A IE1261/80 A IE 1261/80A IE 126180 A IE126180 A IE 126180A IE 49916 B1 IE49916 B1 IE 49916B1
- Authority
- IE
- Ireland
- Prior art keywords
- formula
- acid
- preparation
- iii
- thienylmalonic
- Prior art date
Links
- GCOOGCQWQFRJEK-UHFFFAOYSA-N 2-thiophen-3-ylpropanedioic acid Chemical compound OC(=O)C(C(O)=O)C=1C=CSC=1 GCOOGCQWQFRJEK-UHFFFAOYSA-N 0.000 title claims abstract description 12
- 238000000034 method Methods 0.000 title claims description 17
- 238000002360 preparation method Methods 0.000 title claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 7
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims abstract description 5
- 125000003118 aryl group Chemical group 0.000 claims abstract description 4
- CCLRXHIBLRXYGU-UHFFFAOYSA-N thiophen-3-yl 2-cyanoacetate Chemical compound N#CCC(=O)OC=1C=CSC=1 CCLRXHIBLRXYGU-UHFFFAOYSA-N 0.000 claims abstract description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical group [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 15
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 abstract description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 229930182555 Penicillin Natural products 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- RCNOGGGBSSVMAS-UHFFFAOYSA-N 2-thiophen-3-ylacetic acid Chemical compound OC(=O)CC=1C=CSC=1 RCNOGGGBSSVMAS-UHFFFAOYSA-N 0.000 description 2
- GWZCLMWEJWPFFA-UHFFFAOYSA-N 2-thiophen-3-ylacetonitrile Chemical compound N#CCC=1C=CSC=1 GWZCLMWEJWPFFA-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 229940049954 penicillin Drugs 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- RIRIYQUBKRLSHE-UHFFFAOYSA-N (2-ethylthiophen-3-yl) 2-cyanoacetate Chemical compound CCC=1SC=CC=1OC(=O)CC#N RIRIYQUBKRLSHE-UHFFFAOYSA-N 0.000 description 1
- MLIREBYILWEBDM-UHFFFAOYSA-M 2-cyanoacetate Chemical compound [O-]C(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-M 0.000 description 1
- -1 3thienyl cyanoacetate Chemical compound 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 241000004441 Sorites Species 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 230000003226 decolorizating effect Effects 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- OHKOGUYZJXTSFX-KZFFXBSXSA-N ticarcillin Chemical compound C=1([C@@H](C(O)=O)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)C=CSC=1 OHKOGUYZJXTSFX-KZFFXBSXSA-N 0.000 description 1
- 229960004659 ticarcillin Drugs 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7921385 | 1979-06-19 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE801261L IE801261L (en) | 1980-12-19 |
| IE49916B1 true IE49916B1 (en) | 1986-01-08 |
Family
ID=10505959
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1261/80A IE49916B1 (en) | 1979-06-19 | 1980-06-18 | Process for the preparation of 3-thienylmalonic acid |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4691029A (enExample) |
| EP (1) | EP0021645B1 (enExample) |
| JP (1) | JPS567778A (enExample) |
| AT (1) | ATE4457T1 (enExample) |
| AU (1) | AU531904B2 (enExample) |
| CA (1) | CA1148961A (enExample) |
| DE (1) | DE3064571D1 (enExample) |
| DK (1) | DK257380A (enExample) |
| ES (1) | ES8105312A1 (enExample) |
| GR (1) | GR69274B (enExample) |
| IE (1) | IE49916B1 (enExample) |
| IL (1) | IL60212A0 (enExample) |
| NZ (1) | NZ193888A (enExample) |
| ZA (1) | ZA803289B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR226431A1 (es) * | 1979-06-19 | 1982-07-15 | Beecham Group Ltd | Un procedimiento para la preparacion del acido 3-tienilmalonico y su sal y dicha sal |
| JPS6422446A (en) * | 1987-07-17 | 1989-01-25 | Hodogaya Ashiyurando Kk | Production of sand mold for casting |
| CN100402520C (zh) * | 2006-07-28 | 2008-07-16 | 马启明 | 2-取代丙二酸钙盐的制备方法及钙盐的用途 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2513140A (en) * | 1947-11-28 | 1950-06-27 | Indiana University Foundation | 3-thienylacetic acid |
| GB1139164A (en) * | 1966-12-05 | 1969-01-08 | Parke Davis & Co | New heterocyclic acetic acid compounds and methods for their production |
| GB2009158B (en) * | 1977-12-06 | 1982-05-06 | Oce Andeno Bv | Thienylmalonic acid and diesters thereof |
-
1980
- 1980-05-30 NZ NZ193888A patent/NZ193888A/xx unknown
- 1980-06-02 IL IL60212A patent/IL60212A0/xx unknown
- 1980-06-03 ZA ZA00803289A patent/ZA803289B/xx unknown
- 1980-06-03 GR GR62119A patent/GR69274B/el unknown
- 1980-06-04 EP EP80301855A patent/EP0021645B1/en not_active Expired
- 1980-06-04 DE DE8080301855T patent/DE3064571D1/de not_active Expired
- 1980-06-04 AT AT80301855T patent/ATE4457T1/de not_active IP Right Cessation
- 1980-06-16 DK DK257380A patent/DK257380A/da not_active Application Discontinuation
- 1980-06-17 AU AU59341/80A patent/AU531904B2/en not_active Ceased
- 1980-06-18 IE IE1261/80A patent/IE49916B1/en unknown
- 1980-06-18 ES ES492558A patent/ES8105312A1/es not_active Expired
- 1980-06-18 CA CA000354264A patent/CA1148961A/en not_active Expired
- 1980-06-19 JP JP8342280A patent/JPS567778A/ja active Granted
-
1984
- 1984-08-16 US US06/641,330 patent/US4691029A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US4691029A (en) | 1987-09-01 |
| EP0021645A1 (en) | 1981-01-07 |
| JPH0147475B2 (enExample) | 1989-10-13 |
| ES492558A0 (es) | 1981-06-01 |
| EP0021645B1 (en) | 1983-08-17 |
| AU5934180A (en) | 1981-01-08 |
| GR69274B (enExample) | 1982-05-13 |
| NZ193888A (en) | 1982-03-30 |
| ES8105312A1 (es) | 1981-06-01 |
| DE3064571D1 (en) | 1983-09-22 |
| IE801261L (en) | 1980-12-19 |
| JPS567778A (en) | 1981-01-27 |
| CA1148961A (en) | 1983-06-28 |
| ATE4457T1 (de) | 1983-09-15 |
| AU531904B2 (en) | 1983-09-08 |
| IL60212A0 (en) | 1980-09-16 |
| ZA803289B (en) | 1981-08-26 |
| DK257380A (da) | 1980-12-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100905139B1 (ko) | 4-페닐부티르산의 합성 | |
| US5124476A (en) | Process for the preparation of α-fluoroacryloyl derivatives | |
| SU1153828A3 (ru) | Способ получени 2,3-дигидро-2,2-диметил-7-оксибензофурана | |
| EP0270724B1 (en) | Preparation of alkyl trifluoroacetoacetate | |
| EP0021645B1 (en) | Process for the preparation of 3-thienylmalonic acid | |
| FR2470758A1 (fr) | Procede pour la fixation de groupes alkyles sur une chaine carbonee portant un groupe fonctionnel | |
| US6054613A (en) | Process for the production of sulphonamides | |
| RU2149874C1 (ru) | Способ получения диметиламинборана | |
| KR840000115B1 (ko) | 카바졸 유도체의 제조방법 | |
| JPH06340571A (ja) | シクロペンテノンの製造方法 | |
| CA2337620A1 (en) | Manufacture of a cyclic acid | |
| CA1135271A (en) | Process for the production of 3-thienylmalonic acid | |
| JPH0112740B2 (enExample) | ||
| CA1284153C (en) | Preparation of alkyl trifluroacetoacetate | |
| EP0738720B1 (en) | Process for producing 1-(2-chlorphenyl)-5(4H)-tetrazolinone | |
| EP1023283B1 (en) | Synthesis of 3-carbomethoxy-4,5-dimethylthiophene | |
| CA1066702A (en) | Process for preparing benzofuran derivatives | |
| US3813414A (en) | Preparation of coumarin | |
| US2976298A (en) | alpha-hydroxy-beta, beta-dimethyl-gamma-butyrolactone and a process for producing same | |
| JPS6120529B2 (enExample) | ||
| KR100201803B1 (ko) | 2,3,5,6-테트라클로로피리딘의 제조 방법 | |
| SU707907A1 (ru) | Способ получени гликолевых кислот | |
| EP0163506B1 (en) | Process for the preparation of a pyridil-propanoic acid | |
| SU1512966A1 (ru) | Способ получени 4-(метиламино)-бифенила | |
| SU1657503A1 (ru) | Способ получени @ , @ -дихлортетрагидрофурилового эфира этиленгликол |