IE48487B1 - New process for the stereo specific preparation of sexual pheromones - Google Patents
New process for the stereo specific preparation of sexual pheromonesInfo
- Publication number
- IE48487B1 IE48487B1 IE269/79A IE26979A IE48487B1 IE 48487 B1 IE48487 B1 IE 48487B1 IE 269/79 A IE269/79 A IE 269/79A IE 26979 A IE26979 A IE 26979A IE 48487 B1 IE48487 B1 IE 48487B1
- Authority
- IE
- Ireland
- Prior art keywords
- formula
- trans
- process according
- compound
- chloro
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 36
- 238000002360 preparation method Methods 0.000 title claims abstract description 19
- 239000000877 Sex Attractant Substances 0.000 title claims abstract description 16
- 230000000707 stereoselective effect Effects 0.000 title claims abstract description 6
- 150000001875 compounds Chemical class 0.000 claims abstract description 22
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 24
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 15
- 125000006239 protecting group Chemical group 0.000 claims description 13
- 238000006460 hydrolysis reaction Methods 0.000 claims description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 12
- 230000007062 hydrolysis Effects 0.000 claims description 11
- 239000003016 pheromone Substances 0.000 claims description 9
- 150000002680 magnesium Chemical class 0.000 claims description 8
- 239000003054 catalyst Substances 0.000 claims description 7
- 239000000376 reactant Substances 0.000 claims description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 5
- 239000010949 copper Substances 0.000 claims description 5
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 claims description 5
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 4
- 125000003158 alcohol group Chemical group 0.000 claims description 4
- 229910052802 copper Inorganic materials 0.000 claims description 4
- HCJWWBBBSCXJMS-UHFFFAOYSA-J copper;dilithium;tetrachloride Chemical compound [Li+].[Li+].[Cl-].[Cl-].[Cl-].[Cl-].[Cu+2] HCJWWBBBSCXJMS-UHFFFAOYSA-J 0.000 claims description 4
- -1 triethylsilyl Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000002897 diene group Chemical group 0.000 claims description 3
- 229910052698 phosphorus Inorganic materials 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 claims description 3
- SIJLYRDVTMMSIP-UHFFFAOYSA-N 4-Bromo-1-butanol Chemical compound OCCCCBr SIJLYRDVTMMSIP-UHFFFAOYSA-N 0.000 claims description 2
- FCMCSZXRVWDVAW-UHFFFAOYSA-N 6-bromo-1-hexanol Chemical compound OCCCCCCBr FCMCSZXRVWDVAW-UHFFFAOYSA-N 0.000 claims description 2
- MMXRRNUXCHUHOE-UHFFFAOYSA-N 7-bromoheptan-1-ol Chemical compound OCCCCCCCBr MMXRRNUXCHUHOE-UHFFFAOYSA-N 0.000 claims description 2
- 230000021736 acetylation Effects 0.000 claims description 2
- 238000006640 acetylation reaction Methods 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- ODWXUNBKCRECNW-UHFFFAOYSA-M bromocopper(1+) Chemical compound Br[Cu+] ODWXUNBKCRECNW-UHFFFAOYSA-M 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 230000001568 sexual effect Effects 0.000 claims description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- AZXCXSGMWHSTBZ-UHFFFAOYSA-N 3-bromopentan-1-ol Chemical compound CCC(Br)CCO AZXCXSGMWHSTBZ-UHFFFAOYSA-N 0.000 claims 1
- ASZHHDCXNJVBOG-UHFFFAOYSA-N 3-chloropentan-1-ol Chemical compound CCC(Cl)CCO ASZHHDCXNJVBOG-UHFFFAOYSA-N 0.000 claims 1
- HXHGULXINZUGJX-UHFFFAOYSA-N 4-chlorobutanol Chemical compound OCCCCCl HXHGULXINZUGJX-UHFFFAOYSA-N 0.000 claims 1
- WJVQJXVMLRGNGA-UHFFFAOYSA-N 5-bromopentan-1-ol Chemical compound OCCCCCBr WJVQJXVMLRGNGA-UHFFFAOYSA-N 0.000 claims 1
- DCBJCKDOZLTTDW-UHFFFAOYSA-N 5-chloropentan-1-ol Chemical compound OCCCCCCl DCBJCKDOZLTTDW-UHFFFAOYSA-N 0.000 claims 1
- JNTPTNNCGDAGEJ-UHFFFAOYSA-N 6-chlorohexan-1-ol Chemical compound OCCCCCCCl JNTPTNNCGDAGEJ-UHFFFAOYSA-N 0.000 claims 1
- DPNLUCKAZIFDLB-UHFFFAOYSA-N 7-chloroheptan-1-ol Chemical compound OCCCCCCCCl DPNLUCKAZIFDLB-UHFFFAOYSA-N 0.000 claims 1
- 230000001476 alcoholic effect Effects 0.000 claims 1
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical group I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 claims 1
- 238000003328 mesylation reaction Methods 0.000 claims 1
- 238000007070 tosylation reaction Methods 0.000 claims 1
- 150000001993 dienes Chemical class 0.000 abstract description 5
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 14
- 239000000243 solution Substances 0.000 description 14
- 238000005859 coupling reaction Methods 0.000 description 13
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 12
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 12
- 239000011777 magnesium Substances 0.000 description 12
- 229910052749 magnesium Inorganic materials 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 238000003786 synthesis reaction Methods 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 239000012047 saturated solution Substances 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 7
- 150000001298 alcohols Chemical class 0.000 description 7
- 230000008878 coupling Effects 0.000 description 7
- 238000010168 coupling process Methods 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- CSWBSLXBXRFNST-MQQKCMAXSA-N (8e,10e)-dodeca-8,10-dien-1-ol Chemical compound C\C=C\C=C\CCCCCCCO CSWBSLXBXRFNST-MQQKCMAXSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 238000001030 gas--liquid chromatography Methods 0.000 description 6
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 5
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 5
- CSWBSLXBXRFNST-UHFFFAOYSA-N Codlemone Natural products CC=CC=CCCCCCCCO CSWBSLXBXRFNST-UHFFFAOYSA-N 0.000 description 5
- 239000002420 orchard Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 235000013399 edible fruits Nutrition 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 150000002681 magnesium compounds Chemical class 0.000 description 4
- 230000014759 maintenance of location Effects 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- 241000786363 Rhampholeon spectrum Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 3
- 238000013019 agitation Methods 0.000 description 3
- GTZOYNFRVVHLDZ-UHFFFAOYSA-N dodecane-1,1-diol Chemical compound CCCCCCCCCCCC(O)O GTZOYNFRVVHLDZ-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000006317 isomerization reaction Methods 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 244000062645 predators Species 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical compound O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 2
- 241000238631 Hexapoda Species 0.000 description 2
- 241000255777 Lepidoptera Species 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 230000002194 synthesizing effect Effects 0.000 description 2
- VUIFFVOKIWOJBA-FNORWQNLSA-N (3e)-dodeca-1,3-diene Chemical compound CCCCCCCC\C=C\C=C VUIFFVOKIWOJBA-FNORWQNLSA-N 0.000 description 1
- APQIUTYORBAGEZ-UHFFFAOYSA-N 1,1-dibromoethane Chemical compound CC(Br)Br APQIUTYORBAGEZ-UHFFFAOYSA-N 0.000 description 1
- MLRVZFYXUZQSRU-UHFFFAOYSA-N 1-chlorohexane Chemical compound CCCCCCCl MLRVZFYXUZQSRU-UHFFFAOYSA-N 0.000 description 1
- JKTCBAGSMQIFNL-UHFFFAOYSA-N 2,3-dihydrofuran Chemical compound C1CC=CO1 JKTCBAGSMQIFNL-UHFFFAOYSA-N 0.000 description 1
- RQFUZUMFPRMVDX-UHFFFAOYSA-N 3-Bromo-1-propanol Chemical compound OCCCBr RQFUZUMFPRMVDX-UHFFFAOYSA-N 0.000 description 1
- CIVIWCVVOFNUST-VFABXPAXSA-N Bombycol Natural products C(CCCCCCCC\C=C\C=CCCC)O CIVIWCVVOFNUST-VFABXPAXSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 241001635274 Cydia pomonella Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 229910011049 Li2Cu Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000000746 allylic group Chemical group 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- CIVIWCVVOFNUST-SCFJQAPRSA-N bombykol Chemical compound CCC\C=C/C=C/CCCCCCCCCO CIVIWCVVOFNUST-SCFJQAPRSA-N 0.000 description 1
- 150000004648 butanoic acid derivatives Chemical class 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- CZZBXGOYISFHRY-UHFFFAOYSA-N copper;hydroiodide Chemical compound [Cu].I CZZBXGOYISFHRY-UHFFFAOYSA-N 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical class CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- JLKXXDAJGKKSNK-UHFFFAOYSA-N perchloric acid;pyridine Chemical compound OCl(=O)(=O)=O.C1=CC=NC=C1 JLKXXDAJGKKSNK-UHFFFAOYSA-N 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000010517 secondary reaction Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 230000017105 transposition Effects 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/09—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by hydrolysis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/09—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by hydrolysis
- C07C29/10—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by hydrolysis of ethers, including cyclic ethers, e.g. oxiranes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C33/00—Unsaturated compounds having hydroxy or O-metal groups bound to acyclic carbon atoms
- C07C33/02—Acyclic alcohols with carbon-to-carbon double bonds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7804257A FR2417487A1 (fr) | 1978-02-15 | 1978-02-15 | Nouveau procede de preparation stereoselectif de pheromones sexuelles |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE790269L IE790269L (en) | 1979-08-15 |
| IE48487B1 true IE48487B1 (en) | 1985-02-06 |
Family
ID=9204626
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE269/79A IE48487B1 (en) | 1978-02-15 | 1979-02-12 | New process for the stereo specific preparation of sexual pheromones |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4189614A (ref) |
| EP (1) | EP0003708B1 (ref) |
| JP (1) | JPS54119406A (ref) |
| AT (1) | AT370404B (ref) |
| BR (1) | BR7900920A (ref) |
| CA (1) | CA1121832A (ref) |
| DD (1) | DD142040A5 (ref) |
| DE (1) | DE2960652D1 (ref) |
| FR (1) | FR2417487A1 (ref) |
| IE (1) | IE48487B1 (ref) |
| IL (1) | IL56663A0 (ref) |
| SU (1) | SU944498A3 (ref) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4228093A (en) * | 1979-10-18 | 1980-10-14 | Zoecon Corporation | (11Z,13Z)-11,13-Hexadecadiyn-1-ol and (11Z,13Z)-11,13-hexadecadien-1-ol and trimethylsilyl ethers thereof |
| JPS5791932A (en) * | 1980-11-28 | 1982-06-08 | Kuraray Co Ltd | Polyprenyl compound |
| DE3729225A1 (de) * | 1987-09-02 | 1989-03-23 | Basf Ag | 9-hydroxydodec-10-enyl-1-t-butylether und seine verwendung als zwischenprodukt zur synthese von 8,10-dodecadienol |
| JPH07116075B2 (ja) * | 1988-06-06 | 1995-12-13 | 信越化学工業株式会社 | 不飽和アルコール化合物の製造方法 |
| DE3829979A1 (de) * | 1988-09-03 | 1990-03-15 | Basf Ag | Vinylsubstituierte alkohole und deren oh-geschuetzte derivate und ihre verwendung zur bekaempfung von insekten der ordnung lepidoptera |
| US5599848A (en) * | 1991-10-24 | 1997-02-04 | Basf Aktiengesellschaft | Preparation, intermediates for the preparation and the use of a mixture of dodecdienol isomers |
| DE4135064A1 (de) * | 1991-10-24 | 1993-04-29 | Basf Ag | Verfahren zur herstellung, zwischenprodukte zur herstellung und die verwendung eines gemisches aus den isomeren des dodecadienols |
| US5728376A (en) * | 1995-04-25 | 1998-03-17 | Cornell Research Foundation, Inc. | Tetradecatrienyl and tetradecadienyl acetates and their use as sex attractants for tomato pests |
| US5916983A (en) * | 1997-05-27 | 1999-06-29 | Bend Research, Inc. | Biologically active compounds by catalytic olefin metathesis |
| US6838576B1 (en) | 2003-10-23 | 2005-01-04 | 3M Innovative Properties Company | Process for preparing functional group-containing olefinic compounds |
| US20060275335A1 (en) * | 2005-05-09 | 2006-12-07 | Aberdeen Road Company | Pest control |
| US8349310B2 (en) * | 2007-05-29 | 2013-01-08 | Bedoukian Research, Inc. | Attractant compositions and method for attracting biting insects |
| US7932410B2 (en) * | 2008-10-31 | 2011-04-26 | Bedoukian Research, Inc. | Production of pheromones and fragrances from substituted and unsubstituted 1-alken-3yl alkylates |
| RU2582619C1 (ru) * | 2015-03-30 | 2016-04-27 | Федеральное государственное бюджетное образовательное учреждение высшего профессионального образования "Уфимский государственный нефтяной технический университет" | Способ получения (4e, 6z)-гексадека-4,6-диен-1-ола |
| FR3123356B1 (fr) * | 2021-05-28 | 2023-04-28 | Melchior Material & Life Science France | Nouveau procédé de fabrication de phéromone en continu |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA961862A (en) * | 1971-04-23 | 1975-01-28 | Andre Comeau | Trans-8-trans-10-dodecadien-1-o1 |
| US3818049A (en) * | 1971-07-26 | 1974-06-18 | Zoecon Corp | Synthesis of codling moth attractant |
| US3943157A (en) * | 1971-07-26 | 1976-03-09 | Zoecon Corporation | Synthesis of codling moth attractant |
| US3783135A (en) * | 1971-08-20 | 1974-01-01 | Zoecon Corp | Synthesis of codling moth attractant |
| US3856866A (en) * | 1971-08-20 | 1974-12-24 | Zoecon Corp | Synthesis of codling moth attactant |
| US3825607A (en) * | 1972-01-17 | 1974-07-23 | Zoecon Corp | Synthesis of 1-bromo-trans-3,trans-5-heptadiene |
| US3910897A (en) * | 1972-04-21 | 1975-10-07 | Hoffmann La Roche | Pest retardants |
| SU456516A1 (ru) * | 1973-06-06 | 1976-12-05 | Щелковский Филиал Всесоюзного Научно-Исследовательского Института Химических Средств Защиты Растений | Способ получени транс, транс=8,10=додекадиен=1=ола |
| US4061667A (en) * | 1974-01-09 | 1977-12-06 | Monsanto Company | Cis-2-methyl-oct-5-en-2-yl acetate |
| US3953532A (en) * | 1974-04-25 | 1976-04-27 | Zoecon Corporation | 4,8-Tridecadien-1-ol,4 cis,8 cis,trans |
| US3919329A (en) * | 1974-04-25 | 1975-11-11 | Zoecon Corp | Synthesis of the pink bollworm sex pheromone |
| DE2432232C2 (de) * | 1974-07-05 | 1982-09-16 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung γ,δ-ungesättigter Ketone |
-
1978
- 1978-02-15 FR FR7804257A patent/FR2417487A1/fr active Granted
-
1979
- 1979-02-12 IE IE269/79A patent/IE48487B1/en not_active IP Right Cessation
- 1979-02-13 DD DD79211031A patent/DD142040A5/de not_active IP Right Cessation
- 1979-02-13 DE DE7979400092T patent/DE2960652D1/de not_active Expired
- 1979-02-13 EP EP79400092A patent/EP0003708B1/fr not_active Expired
- 1979-02-14 SU SU792723298A patent/SU944498A3/ru active
- 1979-02-14 JP JP1514079A patent/JPS54119406A/ja active Granted
- 1979-02-14 CA CA000321480A patent/CA1121832A/fr not_active Expired
- 1979-02-14 US US06/012,132 patent/US4189614A/en not_active Expired - Lifetime
- 1979-02-14 BR BR7900920A patent/BR7900920A/pt unknown
- 1979-02-14 IL IL56663A patent/IL56663A0/xx not_active IP Right Cessation
- 1979-02-14 AT AT0112279A patent/AT370404B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| BR7900920A (pt) | 1979-09-11 |
| FR2417487B1 (ref) | 1981-02-06 |
| SU944498A3 (ru) | 1982-07-15 |
| EP0003708B1 (fr) | 1981-08-19 |
| IL56663A0 (en) | 1979-05-31 |
| US4189614A (en) | 1980-02-19 |
| CA1121832A (fr) | 1982-04-13 |
| JPS54119406A (en) | 1979-09-17 |
| ATA112279A (de) | 1982-08-15 |
| JPS6337773B2 (ref) | 1988-07-27 |
| AT370404B (de) | 1983-03-25 |
| EP0003708A1 (fr) | 1979-08-22 |
| IE790269L (en) | 1979-08-15 |
| DE2960652D1 (en) | 1981-11-12 |
| DD142040A5 (de) | 1980-06-04 |
| FR2417487A1 (fr) | 1979-09-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4189614A (en) | Process for the stereo specific preparation of sexual pheromones | |
| CH652385A5 (fr) | 5-(2-facultativement substitue-4-trifluoromethyl-6-facultativement substitue-phenoxy)-2-nitro, -halo ou -cyano-phenylcarbonyle alpha substitues-oximes et derives carbonyles correspondants. | |
| DE10145223A1 (de) | Verfahren zur Herstellung von meso-Zeaxanthin | |
| EP0004621B1 (de) | Verfahren zur mehrstufigen Synthese von Zeaxanthin und Alloxanthin über Cyclohexanon- und Cyclohexanolderivate; Cyclohexanon- und Cyclohexanolderivate | |
| EP3556743B1 (en) | Process for preparing (9e,11z)-9, 11-hexadecadienal | |
| US4633025A (en) | Method for preparing (+)R-2-methyl-hexane-1,2-diol | |
| CH636073A5 (en) | Process for the preparation of substituted cyclopropanecarboxylates | |
| DE2544150A1 (de) | Verfahren zur herstellung von substituierten cyclopropancarbonsaeuren und ihren estern | |
| Tanaka et al. | Synthesis of cubebane-type sesquiterpenoids and the stereochemistry of cubebol | |
| Horiike et al. | Synthesis of insect sex pheromones and their homologues;(Z)-6-Alkenyl acetates from the Wittig reaction | |
| CA2110748C (fr) | Procede de preparation de la vitamine a et composes intermediaires utiles pour ce procede | |
| US4551281A (en) | Process for the preparation of cyclopropane carboxylic acid esters | |
| US4543417A (en) | ω,ω-Diacyloxy-2,6-dimethyl-octatrienoates and -octatrienals, their preparation and their use for the synthesis of terpene compounds | |
| Richter et al. | Synthesis of muscalure and homologous hydrocarbons | |
| US4083855A (en) | Method for producing a γ-lactone | |
| Loew et al. | A short stereoselective synthesis of cecropia juvenile hormone. Experimental details | |
| EP0825168A2 (de) | Herstellung eines gamma-Halogentiglinaldehyds | |
| Matsui et al. | New attempt at the synthesis of lavandulol by a Claisen type rearrangement | |
| Nakahara et al. | A novel synthesis of 3-substituted furans: Synthesis of perillen and dendrolasin | |
| US3978135A (en) | Preparation of ethers from citronellal or homologues thereof | |
| Gardette et al. | Synthesis of (Z)-13-hexadecen-11-yn-1-yl acetate Major component of sex pheromone of the processionary moth | |
| CN114945547B (zh) | 使用锇酸盐(vi)使烯烃二羟基化 | |
| US3651104A (en) | Alpha beta-unsaturated quaternary alkylated fatty acids and esters useful for insect control | |
| Oritani et al. | Synthesis of (±)-4′-hydroxy-γ-ionylideneacetic acids, fungal biosynthetic intermediates of abscisic acid | |
| EP0038053B1 (en) | Method for the preparation of cis-nonen-6-yl chloride |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed |