IE45116B1 - Preparation of 3-methylene cephalosporins - Google Patents
Preparation of 3-methylene cephalosporinsInfo
- Publication number
- IE45116B1 IE45116B1 IE362/77A IE36277A IE45116B1 IE 45116 B1 IE45116 B1 IE 45116B1 IE 362/77 A IE362/77 A IE 362/77A IE 36277 A IE36277 A IE 36277A IE 45116 B1 IE45116 B1 IE 45116B1
- Authority
- IE
- Ireland
- Prior art keywords
- formula
- azetidin
- methylene
- tri
- aromatic heterocyclic
- Prior art date
Links
- 229930186147 Cephalosporin Natural products 0.000 title claims abstract description 13
- 229940124587 cephalosporin Drugs 0.000 title claims abstract description 13
- 238000002360 preparation method Methods 0.000 title description 2
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical class O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 claims abstract description 11
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims abstract description 6
- 239000001257 hydrogen Substances 0.000 claims abstract description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 6
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 5
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 claims abstract description 4
- 125000002252 acyl group Chemical group 0.000 claims abstract description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 4
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 claims abstract description 4
- 238000006303 photolysis reaction Methods 0.000 claims abstract description 3
- 230000015843 photosynthesis, light reaction Effects 0.000 claims abstract description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 8
- 150000001780 cephalosporins Chemical class 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 2
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 abstract 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 abstract 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 5
- 229910052786 argon Inorganic materials 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical class OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000005297 pyrex Substances 0.000 description 3
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 241000588747 Klebsiella pneumoniae Species 0.000 description 2
- 229930182555 Penicillin Natural products 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000004442 acylamino group Chemical group 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 230000005587 bubbling Effects 0.000 description 2
- 235000019439 ethyl acetate Nutrition 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- HTFTURZHXAWZPC-SSDOTTSWSA-N (6r)-3-methylidene-5-thia-1-azabicyclo[4.2.0]octan-8-one Chemical compound C1C(=C)CS[C@@H]2CC(=O)N21 HTFTURZHXAWZPC-SSDOTTSWSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 241000588772 Morganella morganii Species 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- 241000588770 Proteus mirabilis Species 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241000193998 Streptococcus pneumoniae Species 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000004190 benzothiazol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N=C(*)SC2=C1[H] 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- MMCOUVMKNAHQOY-UHFFFAOYSA-N carbonoperoxoic acid Chemical compound OOC(O)=O MMCOUVMKNAHQOY-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 125000001485 cycloalkadienyl group Chemical group 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000004992 fission Effects 0.000 description 1
- 238000005227 gel permeation chromatography Methods 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- VLAPMBHFAWRUQP-UHFFFAOYSA-L molybdic acid Chemical compound O[Mo](O)(=O)=O VLAPMBHFAWRUQP-UHFFFAOYSA-L 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- -1 perbenzoic acid Chemical class 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- CMPGARWFYBADJI-UHFFFAOYSA-L tungstic acid Chemical compound O[W](O)(=O)=O CMPGARWFYBADJI-UHFFFAOYSA-L 0.000 description 1
- WQEVDHBJGNOKKO-UHFFFAOYSA-K vanadic acid Chemical compound O[V](O)(O)=O WQEVDHBJGNOKKO-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/02—Preparation
- C07D501/08—Preparation by forming the ring or condensed ring systems
- C07D501/10—Preparation by forming the ring or condensed ring systems from compounds containing the penicillin ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biotechnology (AREA)
- Molecular Biology (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/666,989 US4375397A (en) | 1976-03-15 | 1976-03-15 | Process for preparing 3-methylene cephalosporins |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE45116L IE45116L (en) | 1977-09-15 |
| IE45116B1 true IE45116B1 (en) | 1982-06-30 |
Family
ID=24676364
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE362/77A IE45116B1 (en) | 1976-03-15 | 1977-02-18 | Preparation of 3-methylene cephalosporins |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4375397A (enExample) |
| JP (1) | JPS52111592A (enExample) |
| BE (1) | BE852469A (enExample) |
| CA (1) | CA1062654A (enExample) |
| CH (1) | CH597239A5 (enExample) |
| DE (1) | DE2709529C2 (enExample) |
| DK (1) | DK155008C (enExample) |
| FR (1) | FR2344561A1 (enExample) |
| GB (1) | GB1579296A (enExample) |
| HU (1) | HU172544B (enExample) |
| IE (1) | IE45116B1 (enExample) |
| NL (1) | NL7702342A (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4190724A (en) * | 1978-11-13 | 1980-02-26 | Eli Lilly And Company | Process for 3-exomethylenecepham sulfoxides |
| US4966443A (en) * | 1988-02-22 | 1990-10-30 | Fuji Photo Film Co., Ltd. | Light beam scanner |
| JPH023451U (enExample) * | 1988-06-16 | 1990-01-10 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2143211B1 (enExample) * | 1971-06-24 | 1975-10-31 | Fujisawa Pharmaceutical Co | |
| US3898142A (en) * | 1972-03-24 | 1975-08-05 | Schering Corp | Photolytic cyclization of an amino-keto acylate |
-
1976
- 1976-03-15 US US05/666,989 patent/US4375397A/en not_active Expired - Lifetime
-
1977
- 1977-02-14 CA CA271,660A patent/CA1062654A/en not_active Expired
- 1977-02-18 IE IE362/77A patent/IE45116B1/en not_active IP Right Cessation
- 1977-03-04 DE DE2709529A patent/DE2709529C2/de not_active Expired
- 1977-03-04 NL NL7702342A patent/NL7702342A/xx not_active Application Discontinuation
- 1977-03-04 GB GB9266/77A patent/GB1579296A/en not_active Expired
- 1977-03-08 FR FR7706779A patent/FR2344561A1/fr active Pending
- 1977-03-10 CH CH303577A patent/CH597239A5/xx not_active IP Right Cessation
- 1977-03-11 DK DK106677A patent/DK155008C/da not_active IP Right Cessation
- 1977-03-14 HU HU77SU00000942A patent/HU172544B/hu unknown
- 1977-03-15 JP JP2911877A patent/JPS52111592A/ja active Granted
- 1977-03-15 BE BE175798A patent/BE852469A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DK155008B (da) | 1989-01-23 |
| DK155008C (da) | 1989-06-12 |
| GB1579296A (en) | 1980-11-19 |
| HU172544B (hu) | 1978-09-28 |
| DK106677A (da) | 1977-09-16 |
| DE2709529A1 (de) | 1977-09-22 |
| JPS52111592A (en) | 1977-09-19 |
| CH597239A5 (enExample) | 1978-03-31 |
| FR2344561A1 (fr) | 1977-10-14 |
| CA1062654A (en) | 1979-09-18 |
| JPS6120554B2 (enExample) | 1986-05-22 |
| NL7702342A (nl) | 1977-09-19 |
| IE45116L (en) | 1977-09-15 |
| DE2709529C2 (de) | 1986-01-02 |
| BE852469A (fr) | 1977-09-15 |
| US4375397A (en) | 1983-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3840556A (en) | Penicillin conversion by halogen electrophiles and anti-bacterials derived thereby | |
| Baldwin et al. | Direct 6-methoxylation of penicillin derivatives. Convenient pathway to substituted. beta.-lactam antibiotics | |
| US5470972A (en) | Process for preparing examethylenecephem compounds | |
| US3705897A (en) | Method for converting delta**2 cephalosporin to delta**3 cephalosporin | |
| CS226010B2 (en) | Method of preparing new penemcarboxylic acid derivatives | |
| IE45116B1 (en) | Preparation of 3-methylene cephalosporins | |
| Applegate et al. | Synthesis of 2-, 4-, and 7-methylthio-substituted cephalosporins | |
| US3641014A (en) | Reduction of delta**3-cephalosporin sulfoxides | |
| Struck et al. | Cyclophosphamide. Complete inhibition of murine leukemia L1210 in vivo by a Fenton oxidation product | |
| US4296236A (en) | 7-(or 6-) Substituted-7-(or 6-)acylimino cephalosporin (or penicillin) compounds | |
| Tanaka et al. | A facile synthesis of C (3)-alkenyl substituted cephems through addition-cyclization of allenecarboxylates derived from penicillin | |
| ES8301237A1 (es) | Un procedimiento para la preparacion de un derivado 2-tiope-nem | |
| Koppel et al. | The conversion of 3-exo-methylenecephalosporin to 3-halomethylcephems; a convenient synthesis of 3'-substituted cephalosporins from penicillins | |
| US4132712A (en) | Antibacterial agents | |
| US4008230A (en) | Process for preparing 3-hydroxy cephalosporins | |
| US4048162A (en) | Process for preparing 3-hydroxy cephalosporins | |
| EP0031509B1 (en) | Penem derivatives | |
| Lammert et al. | Azetidinone antibiotics. XV. Synthesis of 2, 3-methylenecepham derivatives via intramolecular cyclization of diazosulfoxides | |
| GB1124829A (en) | A process for the manufacture of benzdiaz [1,4] epine derivatives | |
| PL108107B1 (pl) | Sposob wytwarzania nowych kwasow 7 beta-/d-2-aminomethod of producing new 7-beta-/d-2-amino-2-/alkylosulfonyloaminophenylo/-acetylamino/-3-r-3-cephemo-2-/niskoalkilosulfonyloaminofenylo/-acetyloamino/-3-r-3-cefemo-4-karboksylowych -4-carboxylic acids | |
| US4048157A (en) | 4(Formylthio)-azetidin-2-ones and ozonization process therefor | |
| AU531578B2 (en) | Silyl protected 3-bromomethyl-3-cephem-4-carboxylate 1-oxides | |
| KR910009290B1 (ko) | 플루오르 알킬레이티드 카르바 펜엠 유도체의 제조방법 | |
| Eglington | Syntheses based on 1, 2-secopenicillins; the synthesis of the 1-oxadethiapenem ring system | |
| GB2196340A (en) | Process for preparing 4-acyloxy azetidinones |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed |