IE43426B1 - Ureidoacetic acid derivatives - Google Patents
Ureidoacetic acid derivativesInfo
- Publication number
- IE43426B1 IE43426B1 IE2006/76A IE200676A IE43426B1 IE 43426 B1 IE43426 B1 IE 43426B1 IE 2006/76 A IE2006/76 A IE 2006/76A IE 200676 A IE200676 A IE 200676A IE 43426 B1 IE43426 B1 IE 43426B1
- Authority
- IE
- Ireland
- Prior art keywords
- fungicidal composition
- acid derivative
- ureidoacetic
- ureidoacetic acid
- general formula
- Prior art date
Links
- KZVRXPPUJQRGFN-UHFFFAOYSA-N N-carbamoylglycine Chemical class NC(=O)NCC(O)=O KZVRXPPUJQRGFN-UHFFFAOYSA-N 0.000 title claims abstract description 24
- 239000000203 mixture Substances 0.000 claims abstract description 33
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims abstract description 19
- 230000000855 fungicidal effect Effects 0.000 claims abstract description 15
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims abstract description 9
- 239000004094 surface-active agent Substances 0.000 claims abstract description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims abstract description 6
- 150000001469 hydantoins Chemical class 0.000 claims abstract description 6
- 238000002360 preparation method Methods 0.000 claims abstract description 6
- 208000031888 Mycoses Diseases 0.000 claims abstract description 5
- 229910021529 ammonia Inorganic materials 0.000 claims abstract description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 19
- 241000196324 Embryophyta Species 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- UEDJUPKFFDUWHX-UHFFFAOYSA-N 2-[(3,5-dichlorophenyl)carbamoyl-(propan-2-ylcarbamoyl)amino]acetic acid Chemical compound CC(C)NC(=O)N(CC(O)=O)C(=O)NC1=CC(Cl)=CC(Cl)=C1 UEDJUPKFFDUWHX-UHFFFAOYSA-N 0.000 claims description 5
- 240000009088 Fragaria x ananassa Species 0.000 claims description 2
- 235000013399 edible fruits Nutrition 0.000 claims description 2
- 239000004615 ingredient Substances 0.000 claims description 2
- 150000008040 ionic compounds Chemical class 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 23
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 abstract description 6
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 abstract description 5
- XEFUJGURFLOFAN-UHFFFAOYSA-N 1,3-dichloro-5-isocyanatobenzene Chemical compound ClC1=CC(Cl)=CC(N=C=O)=C1 XEFUJGURFLOFAN-UHFFFAOYSA-N 0.000 abstract description 3
- 229940091173 hydantoin Drugs 0.000 abstract description 3
- 239000012948 isocyanate Substances 0.000 abstract description 2
- 150000002513 isocyanates Chemical class 0.000 abstract description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 239000000969 carrier Substances 0.000 abstract 1
- 239000000725 suspension Substances 0.000 description 13
- 239000003795 chemical substances by application Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 241000233866 Fungi Species 0.000 description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 241000219094 Vitaceae Species 0.000 description 5
- 235000021021 grapes Nutrition 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 238000005507 spraying Methods 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000000853 adhesive Substances 0.000 description 4
- 230000001070 adhesive effect Effects 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 239000004495 emulsifiable concentrate Substances 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- JZQUNHVVWROPDZ-UHFFFAOYSA-N 2-(propan-2-ylcarbamoylamino)acetic acid Chemical compound CC(C)NC(=O)NCC(O)=O JZQUNHVVWROPDZ-UHFFFAOYSA-N 0.000 description 3
- MFLCXPQUDHYJLC-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)-2,5-dioxo-1-propan-2-ylimidazolidine-4-carboxamide Chemical compound O=C1N(C(C)C)C(=O)C(C(N)=O)N1C1=CC(Cl)=CC(Cl)=C1 MFLCXPQUDHYJLC-UHFFFAOYSA-N 0.000 description 3
- AWUINPKCHSKCIS-UHFFFAOYSA-N 3-propan-2-ylimidazolidine-2,4-dione Chemical compound CC(C)N1C(=O)CNC1=O AWUINPKCHSKCIS-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- -1 ION Sodium hydroxide Chemical class 0.000 description 3
- 206010061217 Infestation Diseases 0.000 description 3
- 244000046052 Phaseolus vulgaris Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 241000209140 Triticum Species 0.000 description 3
- 239000011149 active material Substances 0.000 description 3
- 235000012211 aluminium silicate Nutrition 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 239000000417 fungicide Substances 0.000 description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 3
- 230000000149 penetrating effect Effects 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 239000004563 wettable powder Substances 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- 241000123650 Botrytis cinerea Species 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229940053195 antiepileptics hydantoin derivative Drugs 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000004062 sedimentation Methods 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000001117 sulphuric acid Substances 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- 239000013008 thixotropic agent Substances 0.000 description 2
- MTQKMPGBALVEDL-ZPCKWCKBSA-N (z,12r)-12-hydroxy-2-sulfooctadec-9-enoic acid Chemical class CCCCCC[C@@H](O)C\C=C/CCCCCCC(C(O)=O)S(O)(=O)=O MTQKMPGBALVEDL-ZPCKWCKBSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 1
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 1
- 241000412366 Alternaria mali Species 0.000 description 1
- 241000228212 Aspergillus Species 0.000 description 1
- 241000228245 Aspergillus niger Species 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000222199 Colletotrichum Species 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 239000001692 EU approved anti-caking agent Substances 0.000 description 1
- 241000223218 Fusarium Species 0.000 description 1
- 241000223221 Fusarium oxysporum Species 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 241000221300 Puccinia Species 0.000 description 1
- 239000006159 Sabouraud's agar Substances 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 235000009754 Vitis X bourquina Nutrition 0.000 description 1
- 235000012333 Vitis X labruscana Nutrition 0.000 description 1
- 240000006365 Vitis vinifera Species 0.000 description 1
- 235000014787 Vitis vinifera Nutrition 0.000 description 1
- WERKSKAQRVDLDW-ANOHMWSOSA-N [(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl] (z)-octadec-9-enoate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO WERKSKAQRVDLDW-ANOHMWSOSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000007798 antifreeze agent Substances 0.000 description 1
- 239000002152 aqueous-organic solution Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 210000003692 ilium Anatomy 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000008268 mayonnaise Substances 0.000 description 1
- 235000010746 mayonnaise Nutrition 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229960002523 mercuric chloride Drugs 0.000 description 1
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 238000000053 physical method Methods 0.000 description 1
- ARENMZZMCSLORU-UHFFFAOYSA-N propan-2-yl naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)OC(C)C)=CC=CC2=C1 ARENMZZMCSLORU-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000012449 sabouraud dextrose agar Substances 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000004546 suspension concentrate Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/72—Two oxygen atoms, e.g. hydantoin
- C07D233/74—Two oxygen atoms, e.g. hydantoin with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to other ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/72—Two oxygen atoms, e.g. hydantoin
- C07D233/80—Two oxygen atoms, e.g. hydantoin with hetero atoms or acyl radicals directly attached to ring nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7527882A FR2323682A1 (fr) | 1975-09-11 | 1975-09-11 | Nouveaux derives de l'acide (dichloro-3,5 phenyl)-3 ureidoacetique, leur preparation et les compositions qui les contiennent |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE43426L IE43426L (en) | 1977-03-11 |
| IE43426B1 true IE43426B1 (en) | 1981-02-25 |
Family
ID=9159860
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE2006/76A IE43426B1 (en) | 1975-09-11 | 1976-09-08 | Ureidoacetic acid derivatives |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4080473A (OSRAM) |
| JP (1) | JPS5837310B2 (OSRAM) |
| AT (1) | AT350069B (OSRAM) |
| BE (1) | BE846106A (OSRAM) |
| BR (1) | BR7605964A (OSRAM) |
| CA (1) | CA1073924A (OSRAM) |
| CH (1) | CH614429A5 (OSRAM) |
| DD (1) | DD127398A5 (OSRAM) |
| DE (1) | DE2640872C2 (OSRAM) |
| FR (1) | FR2323682A1 (OSRAM) |
| GB (1) | GB1496100A (OSRAM) |
| IE (1) | IE43426B1 (OSRAM) |
| IL (1) | IL50467A (OSRAM) |
| IT (1) | IT1070927B (OSRAM) |
| LU (1) | LU75765A1 (OSRAM) |
| NL (1) | NL187238C (OSRAM) |
| SU (1) | SU1428176A3 (OSRAM) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS59192513U (ja) * | 1983-06-06 | 1984-12-20 | 株式会社日本アルミ | 格天井 |
| US5151524A (en) * | 1989-07-19 | 1992-09-29 | Otsuka Kagaku Kabushiki Kaisha | Process for preparing imidazolidine-2,5-dione derivative |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2005326A1 (de) * | 1970-02-06 | 1971-08-12 | Badische Anilin & Soda Fabrik AG, 6700 Ludwigshafen | Harnstoffderivate |
-
1975
- 1975-09-11 FR FR7527882A patent/FR2323682A1/fr active Granted
-
1976
- 1976-08-27 US US05/718,381 patent/US4080473A/en not_active Expired - Lifetime
- 1976-08-31 SU SU762392303A patent/SU1428176A3/ru active
- 1976-09-08 CA CA260,697A patent/CA1073924A/en not_active Expired
- 1976-09-08 NL NLAANVRAGE7609971,A patent/NL187238C/xx not_active IP Right Cessation
- 1976-09-08 IE IE2006/76A patent/IE43426B1/en not_active IP Right Cessation
- 1976-09-08 GB GB37228/76A patent/GB1496100A/en not_active Expired
- 1976-09-10 AT AT671676A patent/AT350069B/de not_active IP Right Cessation
- 1976-09-10 DE DE2640872A patent/DE2640872C2/de not_active Expired
- 1976-09-10 LU LU75765A patent/LU75765A1/xx unknown
- 1976-09-10 JP JP51109351A patent/JPS5837310B2/ja not_active Expired
- 1976-09-10 BE BE170557A patent/BE846106A/xx not_active IP Right Cessation
- 1976-09-10 DD DD194744A patent/DD127398A5/xx unknown
- 1976-09-10 BR BR7605964A patent/BR7605964A/pt unknown
- 1976-09-10 CH CH1153576A patent/CH614429A5/xx not_active IP Right Cessation
- 1976-09-10 IL IL50467A patent/IL50467A/xx unknown
- 1976-09-10 IT IT27128/76A patent/IT1070927B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| IT1070927B (it) | 1985-04-02 |
| IE43426L (en) | 1977-03-11 |
| US4080473A (en) | 1978-03-21 |
| DE2640872A1 (de) | 1977-04-14 |
| IL50467A0 (en) | 1976-11-30 |
| FR2323682A1 (fr) | 1977-04-08 |
| FR2323682B1 (OSRAM) | 1979-06-15 |
| BR7605964A (pt) | 1977-08-16 |
| IL50467A (en) | 1979-10-31 |
| SU1428176A3 (ru) | 1988-09-30 |
| DD127398A5 (OSRAM) | 1977-09-21 |
| NL187238C (nl) | 1991-07-16 |
| DE2640872C2 (de) | 1985-01-17 |
| CH614429A5 (OSRAM) | 1979-11-30 |
| AT350069B (de) | 1979-05-10 |
| CA1073924A (en) | 1980-03-18 |
| LU75765A1 (OSRAM) | 1978-05-12 |
| BE846106A (fr) | 1977-03-10 |
| ATA671676A (de) | 1978-10-15 |
| NL7609971A (nl) | 1977-03-15 |
| NL187238B (nl) | 1991-02-18 |
| JPS5837310B2 (ja) | 1983-08-15 |
| JPS52148042A (en) | 1977-12-08 |
| GB1496100A (en) | 1977-12-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4154945A (en) | Fungicidal substituted imidazoles | |
| US4440566A (en) | Herbicidal substituted 2-(1-(oxyamino)-alkylidene)-cyclohexane-1,3-diones | |
| US3725030A (en) | Limiting plant growth with heterocyclic alkylthiocyanate and isothiocyanate | |
| HK81192A (en) | Microbiocide compounds | |
| GB1582455A (en) | Compositions comprising methionine derivatives | |
| CA1080234A (en) | Derivatives of amidoximes | |
| IL44710A (en) | 1-phenyl-2-azolyl-formamidines their preparation and their use as herbicides | |
| HU194554B (en) | Fungicide and growth-controlling compositions containing tetrahydrofuran-2-yl-methyl-amine derivatives as active components and process for producing tetrahydrofuran-2-yl-methyl-amine derivatives | |
| CA1073924A (en) | Ureidoacetic acid derivatives | |
| US4677128A (en) | (Arylthio)-pyridylalkanols and their use as fungicides | |
| EP0008145B1 (en) | Use of phenyliminomethylpyridine derivatives as fungicides and plant growth regulants compositions containing such derivatives and phenyliminomethylpyridine derivatives and their preparation | |
| HU184822B (en) | Insecticide and nematocide compositions containing asymmetric thiophosphonates | |
| US4212868A (en) | Certain fungicidal pyridinecarbaldehyde phenylhydrazones | |
| JPS6247842B2 (OSRAM) | ||
| EP0300574B1 (en) | Phosphonium salts | |
| US3639608A (en) | Method of killing fungus on plants | |
| US4404213A (en) | Derivatives of certain pyridyliminomethyl-benzenes | |
| SU938742A3 (ru) | Способ получени производных 2-фенил-4-пирона | |
| CA1119827A (en) | Agents for regulating plant growth | |
| US3948942A (en) | N-phenyl maleic imides | |
| EP0127446B1 (en) | Esters of 2-bromo-4-methylimidazole-5-carboxylic acid | |
| US3844761A (en) | Heterocyclic alkylthiocyanate and isothiocyanate plant growth regulators | |
| US3956303A (en) | Certain dithiazolylidene ureas | |
| US4239889A (en) | 3-(N-Heterocyclyl)isoxazolidine fungicides | |
| US3055801A (en) | 1-substituted pyrenes as fungicides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK9A | Patent expired |