IE43224B1 - Improvements in or relating to tetrahydro thieno-pyridine derivatives, process for their preparation and therapeutic composition containing same - Google Patents
Improvements in or relating to tetrahydro thieno-pyridine derivatives, process for their preparation and therapeutic composition containing sameInfo
- Publication number
- IE43224B1 IE43224B1 IE763/76A IE76376A IE43224B1 IE 43224 B1 IE43224 B1 IE 43224B1 IE 763/76 A IE763/76 A IE 763/76A IE 76376 A IE76376 A IE 76376A IE 43224 B1 IE43224 B1 IE 43224B1
- Authority
- IE
- Ireland
- Prior art keywords
- group
- derivative
- formula
- alkyl
- derivatives
- Prior art date
Links
- WJFYLCXWEXZNHU-UHFFFAOYSA-N 2,3,3a,4-tetrahydrothieno[3,2-b]pyridine Chemical class N1C=CC=C2SCCC21 WJFYLCXWEXZNHU-UHFFFAOYSA-N 0.000 title claims abstract description 4
- 238000000034 method Methods 0.000 title claims description 20
- 239000000203 mixture Substances 0.000 title claims description 18
- 238000002360 preparation method Methods 0.000 title claims description 9
- 230000001225 therapeutic effect Effects 0.000 title claims description 5
- -1 R 2 is H Chemical group 0.000 claims abstract description 33
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 15
- 150000001875 compounds Chemical class 0.000 claims abstract description 12
- 125000005843 halogen group Chemical group 0.000 claims abstract description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 11
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 10
- 239000001257 hydrogen Substances 0.000 claims abstract description 10
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 9
- 150000002148 esters Chemical group 0.000 claims abstract description 8
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims abstract description 8
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 7
- 239000002253 acid Substances 0.000 claims abstract description 6
- 125000001589 carboacyl group Chemical group 0.000 claims abstract description 6
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 6
- 239000012948 isocyanate Substances 0.000 claims abstract description 6
- 150000002513 isocyanates Chemical class 0.000 claims abstract description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000004682 aminothiocarbonyl group Chemical group NC(=S)* 0.000 claims abstract description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims abstract description 5
- 150000002367 halogens Chemical group 0.000 claims abstract description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 5
- 125000004043 oxo group Chemical group O=* 0.000 claims abstract description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 5
- 150000002825 nitriles Chemical group 0.000 claims abstract description 4
- 150000002540 isothiocyanates Chemical class 0.000 claims abstract description 3
- 150000002576 ketones Chemical class 0.000 claims abstract description 3
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims abstract description 3
- 229910052799 carbon Inorganic materials 0.000 claims abstract 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims abstract 2
- 150000003839 salts Chemical class 0.000 claims description 7
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 6
- 239000004480 active ingredient Substances 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 125000002560 nitrile group Chemical group 0.000 claims description 4
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 2
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims description 2
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 150000005840 aryl radicals Chemical group 0.000 claims description 2
- 125000006502 nitrobenzyl group Chemical group 0.000 claims description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 2
- DBDCNCCRPKTRSD-UHFFFAOYSA-N thieno[3,2-b]pyridine Chemical class C1=CC=C2SC=CC2=N1 DBDCNCCRPKTRSD-UHFFFAOYSA-N 0.000 claims 2
- 150000001721 carbon Chemical group 0.000 claims 1
- 125000004803 chlorobenzyl group Chemical group 0.000 claims 1
- 239000002552 dosage form Substances 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 125000005147 toluenesulfonyl group Chemical group C=1(C(=CC=CC1)S(=O)(=O)*)C 0.000 claims 1
- 230000003110 anti-inflammatory effect Effects 0.000 abstract description 7
- 210000001772 blood platelet Anatomy 0.000 abstract description 5
- 208000010110 spontaneous platelet aggregation Diseases 0.000 abstract description 4
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 abstract 1
- 150000003222 pyridines Chemical class 0.000 abstract 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 21
- 239000013078 crystal Substances 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 10
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N EtOH Substances CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 210000004369 blood Anatomy 0.000 description 9
- 239000008280 blood Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 230000002776 aggregation Effects 0.000 description 8
- 238000004220 aggregation Methods 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 230000002401 inhibitory effect Effects 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 206010030113 Oedema Diseases 0.000 description 3
- 108010058846 Ovalbumin Proteins 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000011835 investigation Methods 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229940092253 ovalbumin Drugs 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridine hydrochloride Substances [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 3
- 230000002110 toxicologic effect Effects 0.000 description 3
- 231100000027 toxicology Toxicity 0.000 description 3
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 235000010418 carrageenan Nutrition 0.000 description 2
- 229920001525 carrageenan Polymers 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- QKFJKGMPGYROCL-UHFFFAOYSA-N phenyl isothiocyanate Chemical compound S=C=NC1=CC=CC=C1 QKFJKGMPGYROCL-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical class [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- DRTQHJPVMGBUCF-UCVXFZOQSA-N 1-[(2s,3s,4s,5s)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound O[C@H]1[C@H](O)[C@H](CO)O[C@@H]1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-UCVXFZOQSA-N 0.000 description 1
- OQURWGJAWSLGQG-UHFFFAOYSA-N 1-isocyanatopropane Chemical compound CCCN=C=O OQURWGJAWSLGQG-UHFFFAOYSA-N 0.000 description 1
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 1
- XTWYTFMLZFPYCI-KQYNXXCUSA-N 5'-adenylphosphoric acid Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O XTWYTFMLZFPYCI-KQYNXXCUSA-N 0.000 description 1
- FMXSYRBHGUMFBA-UHFFFAOYSA-N 6-amino-3-azaniumylidene-9-[2-carboxy-4-[6-[4-[4-[4-[4-[3-carboxy-6-[4-(trifluoromethyl)phenyl]naphthalen-1-yl]phenyl]piperidin-1-yl]butyl]triazol-1-yl]hexylcarbamoyl]phenyl]-5-sulfoxanthene-4-sulfonate Chemical compound Nc1ccc2c(-c3ccc(cc3C(O)=O)C(=O)NCCCCCCn3cc(CCCCN4CCC(CC4)c4ccc(cc4)-c4cc(cc5cc(ccc45)-c4ccc(cc4)C(F)(F)F)C(O)=O)nn3)c3ccc(=[NH2+])c(c3oc2c1S(O)(=O)=O)S([O-])(=O)=O FMXSYRBHGUMFBA-UHFFFAOYSA-N 0.000 description 1
- XTWYTFMLZFPYCI-UHFFFAOYSA-N Adenosine diphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(O)=O)C(O)C1O XTWYTFMLZFPYCI-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical group [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- AINBZKYUNWUTRE-UHFFFAOYSA-N ethanol;propan-2-ol Chemical compound CCO.CC(C)O AINBZKYUNWUTRE-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000000644 isotonic solution Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 210000003141 lower extremity Anatomy 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- VJMRKWPMFQGIPI-UHFFFAOYSA-N n-(2-hydroxyethyl)-5-(hydroxymethyl)-3-methyl-1-[2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzothiophen-7-yl]pyrazole-4-carboxamide Chemical compound OCC1=C(C(=O)NCCO)C(C)=NN1C1=CC=CC2=C1SC(CC=1C=C(C=CC=1)C(F)(F)F)=C2 VJMRKWPMFQGIPI-UHFFFAOYSA-N 0.000 description 1
- APVPOHHVBBYQAV-UHFFFAOYSA-N n-(4-aminophenyl)sulfonyloctadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 APVPOHHVBBYQAV-UHFFFAOYSA-N 0.000 description 1
- 229940048276 new coccine Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 201000008482 osteoarthritis Diseases 0.000 description 1
- KGCNHWXDPDPSBV-UHFFFAOYSA-N p-nitrobenzyl chloride Chemical compound [O-][N+](=O)C1=CC=C(CCl)C=C1 KGCNHWXDPDPSBV-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- 229940117953 phenylisothiocyanate Drugs 0.000 description 1
- 230000000793 phophlogistic effect Effects 0.000 description 1
- 235000012731 ponceau 4R Nutrition 0.000 description 1
- 230000002980 postoperative effect Effects 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 201000003068 rheumatic fever Diseases 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- SWGJCIMEBVHMTA-UHFFFAOYSA-K trisodium;6-oxido-4-sulfo-5-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate Chemical compound [Na+].[Na+].[Na+].C1=CC=C2C(N=NC3=C4C(=CC(=CC4=CC=C3O)S([O-])(=O)=O)S([O-])(=O)=O)=CC=C(S([O-])(=O)=O)C2=C1 SWGJCIMEBVHMTA-UHFFFAOYSA-K 0.000 description 1
- 238000007817 turbidimetric assay Methods 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
- 229940045860 white wax Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7517007A FR2312247A1 (fr) | 1975-05-30 | 1975-05-30 | Derives de la thieno-pyridine, leur procede de preparation et leurs applications |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE43224L IE43224L (en) | 1976-11-30 |
| IE43224B1 true IE43224B1 (en) | 1981-01-14 |
Family
ID=9155902
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE763/76A IE43224B1 (en) | 1975-05-30 | 1976-04-12 | Improvements in or relating to tetrahydro thieno-pyridine derivatives, process for their preparation and therapeutic composition containing same |
Country Status (27)
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2376860A1 (fr) * | 1977-01-07 | 1978-08-04 | Parcor | Tetrahydro-4,5,6,7 thieno (2,3-c) et (3,2-c) pyridines, leur procede de preparation et leur application therapeutique |
| FR2395271A1 (fr) * | 1977-06-21 | 1979-01-19 | Parcor | Procede de preparation de thieno (2,3-c) et thieno (3,2-c) pyridines |
| FR2397417A1 (fr) * | 1977-07-12 | 1979-02-09 | Parcor | Procede de preparation de derives de la thienopyridine |
| US4321266A (en) * | 1980-10-06 | 1982-03-23 | Sanofi | 5-o-Cyanobenzyl-4,5,6,7-tetrahydrothieno [3,2-C] pyridine |
| FR2597102B1 (fr) * | 1986-04-14 | 1988-08-26 | Sanofi Sa | Derives de l'acide a-(hydroxy-7 tetrahydro-4,5,6,7 thieno (3,2-c) pyridyl-5) phenyl acetique, leur procede de preparation, leur application comme medicament et les compositions les renfermant |
| US6090797A (en) * | 1998-09-02 | 2000-07-18 | Novo Nordisk A/S | 4,5,6,7-tetrahydro-thieno(2,3-C)pyridine derivatives |
| WO2000014090A1 (en) * | 1998-09-02 | 2000-03-16 | Novo Nordisk A/S | 4,5,6,7-tetrahydro-thieno[2,3-c]pyridine derivatives |
| AU2002217464B2 (en) | 2000-12-25 | 2004-12-16 | Daiichi Sankyo Company, Limited | Medicinal compositions containing aspirin |
| US7838026B2 (en) | 2001-09-28 | 2010-11-23 | Mcneil-Ppc, Inc. | Burst-release polymer composition and dosage forms comprising the same |
| US7122143B2 (en) * | 2001-09-28 | 2006-10-17 | Mcneil-Ppc, Inc. | Methods for manufacturing dosage forms |
| US7323192B2 (en) * | 2001-09-28 | 2008-01-29 | Mcneil-Ppc, Inc. | Immediate release tablet |
| US20040062804A1 (en) * | 2001-09-28 | 2004-04-01 | Der-Yang Lee | Modified release dosage forms |
| US7064211B2 (en) * | 2002-03-22 | 2006-06-20 | Eisai Co., Ltd. | Hemiasterlin derivatives and uses thereof |
| TWI350168B (en) * | 2004-05-07 | 2011-10-11 | Incyte Corp | Amido compounds and their use as pharmaceuticals |
| NZ551603A (en) * | 2004-06-24 | 2010-11-26 | Incyte Corp | N-substituted piperidines and their use as pharmaceuticals |
| JP2008504279A (ja) * | 2004-06-24 | 2008-02-14 | インサイト・コーポレイション | アミド化合物およびその医薬としての使用 |
| WO2006002349A1 (en) * | 2004-06-24 | 2006-01-05 | Incyte Corporation | Amido compounds and their use as pharmaceuticals |
| EP1768954A4 (en) * | 2004-06-24 | 2008-05-28 | Incyte Corp | 2-METHYLPROPANAMIDES AND THEIR USE AS PHARMACEUTICALS |
| EP1778229A4 (en) * | 2004-08-10 | 2009-06-17 | Incyte Corp | AMID COMPOUNDS AND THEIR USE AS MEDICAMENTS |
| JP2008520700A (ja) * | 2004-11-18 | 2008-06-19 | インサイト・コーポレイション | １１−βヒドロキシルステロイドデヒドロゲナーゼタイプＩの阻害剤およびその使用方法 |
| US8673352B2 (en) * | 2005-04-15 | 2014-03-18 | Mcneil-Ppc, Inc. | Modified release dosage form |
| CA2621255A1 (en) * | 2005-09-21 | 2007-04-05 | Incyte Corporation | Amido compounds and their use as pharmaceuticals |
| AU2006322060A1 (en) * | 2005-12-05 | 2007-06-14 | Incyte Corporation | Lactam compounds and methods of using the same |
| WO2007084314A2 (en) * | 2006-01-12 | 2007-07-26 | Incyte Corporation | MODULATORS OF 11-ß HYDROXYL STEROID DEHYDROGENASE TYPE 1, PHARMACEUTICAL COMPOSITIONS THEREOF, AND METHODS OF USING THE SAME |
| US20070197530A1 (en) * | 2006-01-31 | 2007-08-23 | Yun-Long Li | Amido compounds and their use as pharmaceuticals |
| TW200808807A (en) * | 2006-03-02 | 2008-02-16 | Incyte Corp | Modulators of 11-β hydroxyl steroid dehydrogenase type 1, pharmaceutical compositions thereof, and methods of using the same |
| US20070208001A1 (en) * | 2006-03-03 | 2007-09-06 | Jincong Zhuo | Modulators of 11- beta hydroxyl steroid dehydrogenase type 1, pharmaceutical compositions thereof, and methods of using the same |
| WO2007130898A1 (en) * | 2006-05-01 | 2007-11-15 | Incyte Corporation | TETRASUBSTITUTED UREAS AS MODULATORS OF 11-β HYDROXYL STEROID DEHYDROGENASE TYPE 1 |
| EP2018378A2 (en) * | 2006-05-17 | 2009-01-28 | Incyte Corporation | Heterocyclic inhibitors of 11-b hydroxyl steroid dehydrogenase type i and methods of using the same |
| JP5206669B2 (ja) * | 2007-03-30 | 2013-06-12 | 日本新薬株式会社 | ヘテロアリール誘導体 |
| CN102241690B (zh) | 2010-05-13 | 2015-08-12 | 天津药物研究院 | 一类含腈基的噻吩并吡啶酯类衍生物、其制备方法和用途 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2215948B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1973-02-01 | 1976-05-14 | Centre Etd Ind Pharma | |
| AR205040A1 (es) * | 1974-07-16 | 1976-03-31 | Parcor | Procedimiento de preparacion de derivados de la tetrahidro-4,5,6,7,-tieno(3,2-c)o(2,3-c)piridina |
-
1975
- 1975-05-30 FR FR7517007A patent/FR2312247A1/fr active Granted
-
1976
- 1976-03-19 CH CH345676A patent/CH613969A5/xx not_active IP Right Cessation
- 1976-03-22 LU LU74617A patent/LU74617A1/xx unknown
- 1976-03-23 GR GR50384A patent/GR59797B/el unknown
- 1976-04-05 YU YU856/76A patent/YU39479B/xx unknown
- 1976-04-12 IE IE763/76A patent/IE43224B1/en unknown
- 1976-04-13 IL IL49405A patent/IL49405A/xx unknown
- 1976-04-14 US US05/676,796 patent/US4076819A/en not_active Expired - Lifetime
- 1976-04-14 CA CA250,739A patent/CA1071633A/en not_active Expired
- 1976-04-14 ZA ZA762263A patent/ZA762263B/xx unknown
- 1976-05-04 ES ES447570A patent/ES447570A1/es not_active Expired
- 1976-05-05 AR AR263208A patent/AR211339A1/es active
- 1976-05-07 NL NL7604944A patent/NL7604944A/xx not_active Application Discontinuation
- 1976-05-13 MX MX000231U patent/MX3308E/es unknown
- 1976-05-17 SU SU762356004A patent/SU667138A3/ru active
- 1976-05-22 RO RO7686177A patent/RO68891A/ro unknown
- 1976-05-26 AT AT386576A patent/AT349471B/de not_active IP Right Cessation
- 1976-05-26 DE DE2623567A patent/DE2623567C2/de not_active Expired
- 1976-05-28 HU HU76PA00001248A patent/HU172176B/hu not_active IP Right Cessation
- 1976-05-28 AU AU14417/76A patent/AU498517B2/en not_active Expired
- 1976-05-28 SE SE7606062A patent/SE421623B/xx not_active IP Right Cessation
- 1976-05-28 GB GB22400/76A patent/GB1501797A/en not_active Expired
- 1976-05-28 DD DD193073A patent/DD125214A5/xx unknown
- 1976-05-28 DK DK235876A patent/DK235876A/da unknown
- 1976-05-28 BE BE167404A patent/BE842310A/xx not_active IP Right Cessation
- 1976-05-29 JP JP51062884A patent/JPS51149297A/ja active Pending
- 1976-05-29 PL PL1976189958A patent/PL100792B1/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE43224B1 (en) | Improvements in or relating to tetrahydro thieno-pyridine derivatives, process for their preparation and therapeutic composition containing same | |
| US4075340A (en) | Thieno [2,3-C] pyridine derivatives and therapeutic composition containing same | |
| IL49786A (en) | Furo(orthieno)(3,2-c)pyridinium derivatives their preparation and pharmaceutical compositions containing them | |
| IE831604L (en) | THIENO £3,2-c| PYRIDINE DERIVATIVES | |
| EP0164765A1 (en) | 3,5-Di-Tert-Butyl-4-hydroxyphenyl-substituted heterocyclic compounds | |
| US4816467A (en) | Heteroaryl 3-oxo-propanenitrile derivatives, pharmaceutical compositions and use | |
| US4104390A (en) | Thieno [2,3-c] and [3,2-c] pyridines | |
| EP0347773B1 (en) | Condensed pyrazole 3-oxo-propanenitrile derivatives and process for their preparation | |
| US4097482A (en) | 5-O-Cyanobenzyl-4,5,6,7-tetrahydro-thieno 3,2-c!pyridine maleate | |
| KR870001144B1 (ko) | 삼환 옥스인돌 카복스아미드 유도체의 제조방법 | |
| US4730003A (en) | Tricyclic compounds for treating heart and circulatory diseases | |
| US5527796A (en) | Thienothiazine derivatives and their use | |
| US3627766A (en) | 5,6,7,8-TETRAHYDRO-PYRIDO{8 4{40 ,3{40 :4,5{9 THIENO{8 2,3-d{9 PYRIMIDINES | |
| PT91787B (pt) | Processo para a preparacao de tienopiranos substituidos e de composicoes farmaceuticas que os contem | |
| US4626537A (en) | Guanidines, pharmaceutical compositions and use | |
| US3426017A (en) | Sulfonylurea compounds | |
| IE42672B1 (en) | Improvements in or relating to 4,5,6,7-tetrahydro-thieno (3,2-c)-pyridine derivatives | |
| US4136186A (en) | Thieno[3,2-c]pyridine derivatives | |
| US4443465A (en) | Aldose reductase inhibitory pyrrole derivatives | |
| US3991076A (en) | Aminoalkylthiopyranopyrroles | |
| US4431657A (en) | Analgesic compositions consisting of 2H-benzothieno[3,2-c]pyrazol-3-amine derivatives | |
| US4500708A (en) | Benzothiazine derivatives | |
| PT92494B (pt) | Processo para a preparacao de novos derivados do indol | |
| US4474786A (en) | Tricyclic lactams and derivatives useful in increasing cardiac contractility | |
| US4128648A (en) | Substituted pyrano[4,3-d]-thiazolo[3,2-a]pyrimidines |