IE41259B1 - Vincaminic acid esters - Google Patents
Vincaminic acid estersInfo
- Publication number
- IE41259B1 IE41259B1 IE1382/75A IE138275A IE41259B1 IE 41259 B1 IE41259 B1 IE 41259B1 IE 1382/75 A IE1382/75 A IE 1382/75A IE 138275 A IE138275 A IE 138275A IE 41259 B1 IE41259 B1 IE 41259B1
- Authority
- IE
- Ireland
- Prior art keywords
- acid esters
- june
- pharmaceutically acceptable
- compositions
- ascorbic acid
- Prior art date
Links
- UXMCFEBDJVHVNH-HOJAQTOUSA-N ac1l52id Chemical class C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C[C@](O)(C(O)=O)N5C2=C1 UXMCFEBDJVHVNH-HOJAQTOUSA-N 0.000 title abstract 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 abstract 4
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 abstract 2
- 229960005070 ascorbic acid Drugs 0.000 abstract 2
- 235000010323 ascorbic acid Nutrition 0.000 abstract 2
- 239000011668 ascorbic acid Substances 0.000 abstract 2
- 239000000203 mixture Substances 0.000 abstract 2
- LXNHXLLTXMVWPM-UHFFFAOYSA-N pyridoxine Chemical compound CC1=NC=C(CO)C(CO)=C1O LXNHXLLTXMVWPM-UHFFFAOYSA-N 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- 206010002660 Anoxia Diseases 0.000 abstract 1
- 206010021143 Hypoxia Diseases 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 239000003085 diluting agent Substances 0.000 abstract 1
- 230000000694 effects Effects 0.000 abstract 1
- 229960003966 nicotinamide Drugs 0.000 abstract 1
- 235000005152 nicotinamide Nutrition 0.000 abstract 1
- 239000011570 nicotinamide Substances 0.000 abstract 1
- 238000007911 parenteral administration Methods 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 235000008160 pyridoxine Nutrition 0.000 abstract 1
- 239000011677 pyridoxine Substances 0.000 abstract 1
- 230000000304 vasodilatating effect Effects 0.000 abstract 1
- 229940011671 vitamin b6 Drugs 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D461/00—Heterocyclic compounds containing indolo [3,2,1-d,e] pyrido [3,2,1,j] [1,5]-naphthyridine ring systems, e.g. vincamine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7422369A FR2276048A1 (fr) | 1974-06-27 | 1974-06-27 | Nouveaux esters du cyclohexanol, leurs sels, leur preparation et les medicaments qui les renferment |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE41259L IE41259L (en) | 1975-12-27 |
| IE41259B1 true IE41259B1 (en) | 1979-11-21 |
Family
ID=9140574
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1382/75A IE41259B1 (en) | 1974-06-27 | 1975-06-20 | Vincaminic acid esters |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3987177A (enExample) |
| JP (1) | JPS5116699A (enExample) |
| BE (1) | BE830493R (enExample) |
| CA (1) | CA1035775A (enExample) |
| CH (1) | CH599957A5 (enExample) |
| DE (1) | DE2527914C3 (enExample) |
| DK (1) | DK139387C (enExample) |
| ES (1) | ES438946A2 (enExample) |
| FR (1) | FR2276048A1 (enExample) |
| GB (1) | GB1476827A (enExample) |
| IE (1) | IE41259B1 (enExample) |
| LU (1) | LU72824A1 (enExample) |
| NL (1) | NL7507685A (enExample) |
| ZA (1) | ZA753952B (enExample) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5291897A (en) * | 1976-01-23 | 1977-08-02 | Synthelabo | Cyclohexyl ester of vincaminate derivative and pharmacy containing same |
| HU187733B (en) * | 1982-06-30 | 1986-02-28 | Richter Gedeon Vegyeszeti Gyar Rt,Hu | Process for preparing apovincaminic acid derivatives |
| US4710124A (en) * | 1985-11-13 | 1987-12-01 | James Harrison | Automatic part and runner separator |
| JP2678548B2 (ja) * | 1992-11-02 | 1997-11-17 | 株式会社テラックス | プレートヒータ |
| US6043259A (en) * | 1998-07-09 | 2000-03-28 | Medicure Inc. | Treatment of cardiovascular and related pathologies |
| ES2250112T3 (es) | 1999-03-08 | 2006-04-16 | Medicure Inc. | Analogos de piridoxal para el tratamiento de trastornos causados por carencia de vitamina b6. |
| US6489345B1 (en) | 1999-07-13 | 2002-12-03 | Medicure, Inc. | Treatment of diabetes and related pathologies |
| WO2001013900A2 (en) * | 1999-08-24 | 2001-03-01 | Medicure International Inc. | Compositions for the treatment of cardiovascular diseases containing pyridoxal compounds and cardiovascular compounds |
| US7442689B2 (en) * | 2000-02-29 | 2008-10-28 | Medicure International Inc. | Cardioprotective phosphonates and malonates |
| AU2001237185B2 (en) | 2000-02-29 | 2006-02-02 | Medicure International Inc. | Cardioprotective phosphonates and malonates |
| WO2001072309A2 (en) | 2000-03-28 | 2001-10-04 | Medicure International Inc. | Treatment of cerebrovascular disease |
| US6548519B1 (en) | 2001-07-06 | 2003-04-15 | Medicure International Inc. | Pyridoxine and pyridoxal analogues: novel uses |
| WO2002004421A2 (en) | 2000-07-07 | 2002-01-17 | Medicure International Inc. | Pyridoxine and pyridoxal analogues: cardiovascular therapeutics |
| US6897228B2 (en) * | 2000-07-07 | 2005-05-24 | Medicure International Inc. | Pyridoxine and pyridoxal analogues: new uses |
| US20040121988A1 (en) * | 2001-03-28 | 2004-06-24 | Medicure International Inc. | Treatment of cerebrovascular disease |
| US20040186077A1 (en) * | 2003-03-17 | 2004-09-23 | Medicure International Inc. | Novel heteroaryl phosphonates as cardioprotective agents |
| US20060019929A1 (en) * | 2004-07-07 | 2006-01-26 | Albert Friesen | Combination therapies employing platelet aggregation drugs |
| US20070060549A1 (en) * | 2004-08-10 | 2007-03-15 | Friesen Albert D | Combination therapies employing ace inhibitors and uses thereof for the treatment of diabetic disorders |
| US20060094749A1 (en) * | 2004-10-28 | 2006-05-04 | Medicure International Inc. | Substituted pyridoxines as anti-platelet agents |
| US7459468B2 (en) * | 2004-10-28 | 2008-12-02 | Medicure International, Inc. | Aryl sulfonic pyridoxines as antiplatelet agents |
| CA2585165A1 (en) * | 2004-10-28 | 2006-05-18 | Medicure International Inc. | Dual antiplatelet/anticoagulant pyridoxine analogs |
| CN101928286A (zh) * | 2009-06-18 | 2010-12-29 | 谢开智 | 长春胺衍生物及制备方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3454583A (en) * | 1965-07-19 | 1969-07-08 | Us Health Education & Welfare | Synthesis of vincamine |
| HU163143B (enExample) * | 1971-05-07 | 1973-06-28 | ||
| FR2176516B1 (enExample) * | 1972-03-22 | 1975-03-14 | Synthelabo | |
| FR2179620B1 (enExample) * | 1972-04-14 | 1975-12-26 | Roussel Uclaf |
-
1974
- 1974-06-27 FR FR7422369A patent/FR2276048A1/fr active Granted
-
1975
- 1975-06-19 ZA ZA00753952A patent/ZA753952B/xx unknown
- 1975-06-20 BE BE157555A patent/BE830493R/xx active
- 1975-06-20 US US05/588,593 patent/US3987177A/en not_active Expired - Lifetime
- 1975-06-20 IE IE1382/75A patent/IE41259B1/xx unknown
- 1975-06-23 DE DE2527914A patent/DE2527914C3/de not_active Expired
- 1975-06-24 GB GB2680775A patent/GB1476827A/en not_active Expired
- 1975-06-24 JP JP50077050A patent/JPS5116699A/ja active Pending
- 1975-06-24 CH CH817975A patent/CH599957A5/xx not_active IP Right Cessation
- 1975-06-25 DK DK289175A patent/DK139387C/da active
- 1975-06-25 LU LU72824A patent/LU72824A1/xx unknown
- 1975-06-26 CA CA230,241A patent/CA1035775A/en not_active Expired
- 1975-06-27 NL NL7507685A patent/NL7507685A/xx not_active Application Discontinuation
- 1975-06-27 ES ES438946A patent/ES438946A2/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH599957A5 (enExample) | 1978-06-15 |
| DK139387C (da) | 1979-07-23 |
| DK139387B (da) | 1979-02-12 |
| FR2276048A1 (fr) | 1976-01-23 |
| DE2527914A1 (de) | 1976-01-02 |
| NL7507685A (nl) | 1975-12-30 |
| DE2527914C3 (de) | 1978-05-24 |
| BE830493R (fr) | 1975-12-22 |
| FR2276048B1 (enExample) | 1978-07-28 |
| IE41259L (en) | 1975-12-27 |
| DE2527914B2 (de) | 1977-09-22 |
| ES438946A2 (es) | 1977-02-16 |
| LU72824A1 (enExample) | 1976-04-13 |
| JPS5116699A (enExample) | 1976-02-10 |
| DK289175A (da) | 1975-12-28 |
| GB1476827A (en) | 1977-06-16 |
| AU8242275A (en) | 1977-01-06 |
| US3987177A (en) | 1976-10-19 |
| CA1035775A (en) | 1978-08-01 |
| ZA753952B (en) | 1976-07-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE41259L (en) | Vincaminic acid esters | |
| IE41224B1 (en) | Derivatives of pyrrolidine and piperidine | |
| IE34583B1 (en) | Carboxylic esters of hydroxyphenylalkanolamines | |
| GB1247976A (en) | Pharmaceutical compositions, amino acid ester compounds, and methods for their production | |
| IE41260L (en) | Vincaminic acid amides | |
| GB1526354A (en) | Eburnamenine derivatives and a process for the preparation thereof | |
| IE41822L (en) | Hydroxyalkyl xanthine derivatives | |
| GB1439724A (en) | Berbine derivatives and pharmaceutical compositions containing them | |
| IE38979L (en) | Tetrazolyl - quinoxalinecarboxamide derivatives | |
| GB1506822A (en) | Prostaglandins | |
| IL61261A (en) | Pyridine and pyrimidine derivatives and pharmaceutical compositions containing them | |
| GB1378068A (en) | Citric acid derivatives | |
| GB1252329A (enExample) | ||
| GB1530074A (en) | Rho-acetamidophenol derivatives the preparation thereof and the use of such derivatives as therapeutic agents | |
| IE39239L (en) | Cycloalkyl-alkyl esters. | |
| GB1361863A (en) | Piperazine derivatives their preparation and pharmaceutical compositions containing them | |
| GB1394791A (en) | Diphenylalkyllactamimide derivatives | |
| GB1473574A (en) | Sitosterol esters | |
| IE39770L (en) | Thiazole derivatives | |
| GB1394757A (en) | Lysino-calcium chloride | |
| IE811626L (en) | Anthracycline glycosides | |
| GB1531781A (en) | N-propargyl-piperonylamine and its preparation and use | |
| GB1246117A (en) | Pharmaceutical preparations containing glucose compounds, glucose derivatives and process for their manufacture | |
| IE45096L (en) | Thiadiazole derivatives | |
| IE37932L (en) | Xylidides |