IE41209B1 - Substituded chalcones - Google Patents
Substituded chalconesInfo
- Publication number
- IE41209B1 IE41209B1 IE36/75A IE3675A IE41209B1 IE 41209 B1 IE41209 B1 IE 41209B1 IE 36/75 A IE36/75 A IE 36/75A IE 3675 A IE3675 A IE 3675A IE 41209 B1 IE41209 B1 IE 41209B1
- Authority
- IE
- Ireland
- Prior art keywords
- chalcones
- substituded
- us3931152a
- diazacycloalkenyl
- hydrazones
- Prior art date
Links
- DQFBYFPFKXHELB-UHFFFAOYSA-N Chalcone Natural products C=1C=CC=CC=1C(=O)C=CC1=CC=CC=C1 DQFBYFPFKXHELB-UHFFFAOYSA-N 0.000 title abstract 2
- 150000001789 chalcones Chemical class 0.000 title abstract 2
- 235000005513 chalcones Nutrition 0.000 title abstract 2
- 241001465754 Metazoa Species 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 239000000814 tuberculostatic agent Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/44—Nitrogen atoms not forming part of a nitro radical
- C07D233/52—Nitrogen atoms not forming part of a nitro radical with hetero atoms directly attached to said nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/437,549 US3931152A (en) | 1974-01-29 | 1974-01-29 | 2-(1,3-Diazacycloalkenyl)-2-hydrazones of substituted chalcones |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE41209L IE41209L (en) | 1975-07-29 |
| IE41209B1 true IE41209B1 (en) | 1979-11-07 |
Family
ID=23736898
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE36/75A IE41209B1 (en) | 1974-01-29 | 1975-01-07 | Substituded chalcones |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3931152A (en:Method) |
| JP (1) | JPS50106960A (en:Method) |
| AR (1) | AR206703A1 (en:Method) |
| AT (1) | AT342056B (en:Method) |
| BE (1) | BE824854A (en:Method) |
| CA (1) | CA1044243A (en:Method) |
| CH (1) | CH595354A5 (en:Method) |
| CS (1) | CS195280B2 (en:Method) |
| DD (1) | DD117218A5 (en:Method) |
| DE (1) | DE2502490A1 (en:Method) |
| DK (1) | DK22975A (en:Method) |
| ES (1) | ES434248A1 (en:Method) |
| FR (1) | FR2258852B1 (en:Method) |
| GB (1) | GB1477750A (en:Method) |
| HU (1) | HU168476B (en:Method) |
| IE (1) | IE41209B1 (en:Method) |
| IN (1) | IN140834B (en:Method) |
| NL (1) | NL7501032A (en:Method) |
| PL (1) | PL93704B1 (en:Method) |
| RO (1) | RO65454A (en:Method) |
| SE (1) | SE404023B (en:Method) |
| SU (1) | SU559649A3 (en:Method) |
| ZA (1) | ZA7540B (en:Method) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL57655A (en) * | 1978-08-17 | 1983-11-30 | American Cyanamid Co | Di-styrylketone hydrazone derivatives,method for preparing the same,and use as fire and control agent |
| US4152436A (en) * | 1978-08-17 | 1979-05-01 | American Cyanamid Company | Acylated pentadienone hydrazone, method for preparing the same, and use as fire ant control agents |
| US4258181A (en) * | 1978-09-05 | 1981-03-24 | American Cyanamid Company | Substituted 9,10-anthracenebishydrazones |
| FR2446285A1 (fr) * | 1978-09-05 | 1980-08-08 | American Cyanamid Co | Anthracene bis-(carbonyl-9,10-hydrazones) utiles comme agents antitumoraux |
| US4262122A (en) * | 1980-02-19 | 1981-04-14 | American Cyanamid Company | Preparation of 5,5-dimethyl-2-hydrazino-1,4,5,6-tetrahydro-pyrimidine hydrohalide |
| US4374135A (en) * | 1980-12-05 | 1983-02-15 | American Cyanamid Company | Compositions containing anorexigenic compounds and methods for regulating the feed intake of homothermic animals |
| IT1159074B (it) * | 1982-06-24 | 1987-02-25 | Stoppani Luigi Spa | Composto di addizione fra menadione e tiamina a reciproca stabilizzazione |
| US4574155A (en) * | 1984-03-08 | 1986-03-04 | American Cyanamid Company | Process for preparing 2-hydrazino-1,3-diazacycloalk-2-ene hydrohalides |
| US5258381A (en) * | 1984-03-19 | 1993-11-02 | The Rockefeller University | 2-substituted-2-imidazolines |
| EP0328668B1 (en) * | 1987-07-23 | 1994-05-25 | Nippon Oil And Fats Company, Limited | Nonlinear optical material |
| EP0328669A4 (en) * | 1987-07-25 | 1989-10-12 | Nippon Oils & Fats Co Ltd | CONNECTIONS DERIVED FROM CHALCONES. |
| DE19629817A1 (de) * | 1996-07-24 | 1998-01-29 | Hoechst Ag | Neue Imino-Derivate als Inhibitoren der Knochenresorption und Vitronectinrezeptor-Antagonisten |
| US20040033986A1 (en) * | 2002-05-17 | 2004-02-19 | Protopopova Marina Nikolaevna | Anti tubercular drug: compositions and methods |
| US7456222B2 (en) * | 2002-05-17 | 2008-11-25 | Sequella, Inc. | Anti tubercular drug: compositions and methods |
| CN101404986B (zh) * | 2002-05-17 | 2011-09-28 | 赛奎拉公司 | 用于诊断和治疗感染性疾病的组合物和制药方法 |
| WO2005034857A2 (en) * | 2003-09-05 | 2005-04-21 | Sequella, Inc. | Methods and compositions comprising diamines as new anti-tubercular therapeutics |
| EP1975149B1 (en) * | 2005-12-26 | 2012-02-15 | Nissan Chemical Industries, Ltd. | 1,3-bis(substituted phenyl)-3-hydroxypropan-1-one or 2-propen-1-one compound, and salt thereof |
| US20090281054A1 (en) * | 2008-05-06 | 2009-11-12 | Venkata Reddy | Compositions and methods comprising capuramycin analogues |
| EP2513064B1 (en) | 2009-12-17 | 2018-07-04 | Katholieke Universiteit Leuven K.U. Leuven R&D | Compounds, compositions and methods for controlling biofilms |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2369817A (en) * | 1940-06-27 | 1945-02-20 | Petrolite Corp | Basic acylated cyclic diamine |
| DE1670274A1 (de) * | 1966-10-31 | 1970-07-16 | Boehringer Sohn Ingelheim | Neues Verfahren zur Herstellung von 2-Arylamino-1,3-diazacycloalkenen-(2) |
-
1974
- 1974-01-29 US US05/437,549 patent/US3931152A/en not_active Expired - Lifetime
- 1974-12-30 CA CA217,044A patent/CA1044243A/en not_active Expired
-
1975
- 1975-01-01 AR AR257335A patent/AR206703A1/es active
- 1975-01-02 ZA ZA00750040A patent/ZA7540B/xx unknown
- 1975-01-02 IN IN19/CAL/1975A patent/IN140834B/en unknown
- 1975-01-07 IE IE36/75A patent/IE41209B1/xx unknown
- 1975-01-14 GB GB159375A patent/GB1477750A/en not_active Expired
- 1975-01-22 DE DE19752502490 patent/DE2502490A1/de not_active Withdrawn
- 1975-01-24 DK DK22975*#A patent/DK22975A/da not_active Application Discontinuation
- 1975-01-27 AT AT58775A patent/AT342056B/de not_active IP Right Cessation
- 1975-01-28 PL PL1975177648A patent/PL93704B1/pl unknown
- 1975-01-28 SE SE7500902A patent/SE404023B/xx unknown
- 1975-01-28 SU SU2101403A patent/SU559649A3/ru active
- 1975-01-28 RO RO7581269A patent/RO65454A/ro unknown
- 1975-01-28 BE BE152769A patent/BE824854A/xx unknown
- 1975-01-28 CS CS75561A patent/CS195280B2/cs unknown
- 1975-01-28 FR FR7502615A patent/FR2258852B1/fr not_active Expired
- 1975-01-28 CH CH98875A patent/CH595354A5/xx not_active IP Right Cessation
- 1975-01-28 HU HUAE437A patent/HU168476B/hu unknown
- 1975-01-29 ES ES434248A patent/ES434248A1/es not_active Expired
- 1975-01-29 JP JP50011460A patent/JPS50106960A/ja active Pending
- 1975-01-29 DD DD183893A patent/DD117218A5/xx unknown
- 1975-01-29 NL NL7501032A patent/NL7501032A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| BE824854A (fr) | 1975-07-28 |
| AR206703A1 (es) | 1976-08-13 |
| AU7711475A (en) | 1976-07-08 |
| JPS50106960A (en:Method) | 1975-08-22 |
| SE7500902L (sv) | 1975-10-17 |
| RO65454A (ro) | 1980-01-15 |
| IE41209L (en) | 1975-07-29 |
| PL93704B1 (en:Method) | 1977-06-30 |
| NL7501032A (nl) | 1975-07-31 |
| HU168476B (en:Method) | 1976-05-28 |
| DD117218A5 (en:Method) | 1976-01-05 |
| ES434248A1 (es) | 1977-04-01 |
| FR2258852A1 (en:Method) | 1975-08-22 |
| ATA58775A (de) | 1977-07-15 |
| IN140834B (en:Method) | 1976-12-25 |
| US3931152A (en) | 1976-01-06 |
| SE404023B (sv) | 1978-09-18 |
| SU559649A3 (ru) | 1977-05-25 |
| ZA7540B (en) | 1976-01-28 |
| GB1477750A (en) | 1977-06-22 |
| CH595354A5 (en:Method) | 1978-02-15 |
| CS195280B2 (en) | 1980-01-31 |
| AT342056B (de) | 1978-03-10 |
| DE2502490A1 (de) | 1975-07-31 |
| CA1044243A (en) | 1978-12-12 |
| DK22975A (en:Method) | 1975-09-29 |
| FR2258852B1 (en:Method) | 1978-07-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE41209B1 (en) | Substituded chalcones | |
| NL7412578A (nl) | Antistatisch werkende verbindingen, en werkwijze de bereiding daarvan. | |
| AU513281B2 (en) | 3,7-disubstituted -3- cephem -4-carboxylic acid compounds | |
| IT7926935A0 (it) | Procedimento eterogeneo per lapreparazione di 1,1-diesteri. | |
| NO148959C (no) | Fremgangsmaate ved fremstilling av tumor-motvirkende antracyklinglykosidantibiotika, betegnet ma 144 | |
| AR224095A1 (es) | Procedimiento de preparacion de nuevos derivados de ditiol-1,2 tiona-3 | |
| AU517020B2 (en) | 10, 19-dihydro-vitamin d compounds | |
| IE40217L (en) | Preparation of chlorinated phenyl-hydroxylamines. | |
| FI793367A7 (fi) | Menetelmä 1,2,3-tiadiatsol-5-yyli-virtsa-aineiden valmistamiseksi. | |
| AU511643B2 (en) | Preparation of 3, 4-dihydro-2-methyl-4-oxo-2h-1, 2-benzothiazine-3-carboxylic acid-1, 1-dioxide | |
| AU506052B2 (en) | Preparation of 2-(2, 2-dicyclohexylethyl) piperidine | |
| CA1034573A (en) | Preparation of 1-n-substituted 4,6-di-(aminoglycosyl)-1,3-diaminocyclitols | |
| AU513812B2 (en) | Substituted 2, 1, 3-benzothiadiazine compounds | |
| AU529927B2 (en) | 2,5-inter-o-phenylene-3,4-dinor-pgf and pgi compounds | |
| IE38561B1 (en) | 1,4-dithiino 2,3-cpyrrole derivatives | |
| AU502268B2 (en) | 2, 1, 3-benzothiadiazine compounds | |
| IE40805B1 (en) | Sulphonylurea derivatives | |
| AU501019B2 (en) | 3, -5, - dispiro 1, 2, 4- tritholan compounds | |
| CA1022941A (en) | Process for the preparation of 2,5-disubstituted benzamides | |
| AU515571B2 (en) | Preparation of cyclo-1,3,2-oxazaphosphoryl derivatives | |
| SU521676A1 (ru) | Антимольный препарат | |
| SU588405A2 (ru) | Т-образный болт г.г.лунева | |
| AU526540B2 (en) | Oximes of substituted phenyl, thiazolyl - glyoxylic acids | |
| IE39813L (en) | 7-H-INDOLIZINO [5,6,7-ij] ISOQUINOLINE DERIVATIVES. | |
| SU569578A1 (ru) | -Аминокетоны 2,3-дигидробензо/в/-тиофенового р да,про вл ющие анестезирующую активность |