IE37700B1 - Novel pleuromutilin - Google Patents
Novel pleuromutilinInfo
- Publication number
- IE37700B1 IE37700B1 IE218872A IE218872A IE37700B1 IE 37700 B1 IE37700 B1 IE 37700B1 IE 218872 A IE218872 A IE 218872A IE 218872 A IE218872 A IE 218872A IE 37700 B1 IE37700 B1 IE 37700B1
- Authority
- IE
- Ireland
- Prior art keywords
- novel pleuromutilin
- pleuromutilin
- novel
- Prior art date
Links
- ZRZNJUXESFHSIO-UHFFFAOYSA-N Pleuromutilin Natural products CC1C(O)C(C)(C=C)CC(OC(=O)CO)C2(C)C(C)CCC31C2C(=O)CC3 ZRZNJUXESFHSIO-UHFFFAOYSA-N 0.000 title 1
- ZRZNJUXESFHSIO-VYTKZBNOSA-N pleuromutilin Chemical compound C([C@H]([C@]1(C)[C@@H](C[C@@](C)(C=C)[C@@H](O)[C@@H]2C)OC(=O)CO)C)C[C@]32[C@H]1C(=O)CC3 ZRZNJUXESFHSIO-VYTKZBNOSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/51—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/57—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups
- C07C323/58—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups with amino groups bound to the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1445071A CH560180A5 (en) | 1971-10-05 | 1971-10-05 | Pleuromutilin derivs - with antibacterial activity |
| CH773872A CH572893A5 (en) | 1972-05-25 | 1972-05-25 | Pleuromutilin derivs - with antibacterial activity |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IE37700B1 true IE37700B1 (en) | 1977-09-28 |
Family
ID=25702060
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE218872A IE37700B1 (en) | 1971-10-05 | 1972-10-03 | Novel pleuromutilin |
Country Status (10)
| Country | Link |
|---|---|
| AT (1) | AT335054B (cs) |
| CS (1) | CS219306B2 (cs) |
| CY (1) | CY987A (cs) |
| GB (1) | GB1410506A (cs) |
| HK (1) | HK25379A (cs) |
| IE (1) | IE37700B1 (cs) |
| IL (1) | IL47262A (cs) |
| MY (1) | MY7900103A (cs) |
| PL (1) | PL85200B1 (cs) |
| YU (1) | YU37125B (cs) |
-
1972
- 1972-10-02 CY CY98772A patent/CY987A/xx unknown
- 1972-10-02 GB GB1633875A patent/GB1410506A/en not_active Expired
- 1972-10-03 IE IE218872A patent/IE37700B1/xx unknown
- 1972-10-03 PL PL15805172A patent/PL85200B1/pl unknown
- 1972-10-03 AT AT845872A patent/AT335054B/de not_active IP Right Cessation
- 1972-10-04 YU YU249772A patent/YU37125B/xx unknown
- 1972-10-04 IL IL4726272A patent/IL47262A/en unknown
- 1972-10-04 CS CS670172A patent/CS219306B2/cs unknown
-
1979
- 1979-04-19 HK HK25379A patent/HK25379A/xx unknown
- 1979-12-30 MY MY7900103A patent/MY7900103A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CY987A (en) | 1979-08-02 |
| MY7900103A (en) | 1979-12-31 |
| AT335054B (de) | 1977-02-25 |
| YU37125B (en) | 1984-08-31 |
| ATA845872A (de) | 1976-06-15 |
| HK25379A (en) | 1979-04-27 |
| PL85200B1 (en) | 1976-04-30 |
| GB1410506A (en) | 1975-10-15 |
| IL47262A (en) | 1976-01-30 |
| YU249772A (en) | 1983-04-27 |
| CS219306B2 (en) | 1983-03-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EG10723A (en) | Substituted para-menthanes | |
| EG10585A (en) | Phenoxycarboxamides | |
| ZA725000B (en) | Substituted benzamides | |
| ZA721446B (en) | Substituted 3-benzylpyridines | |
| AU4916772A (en) | Benzimidazolyl-2-aminoimidazolines | |
| ZA721359B (en) | Substituted thiadiazolidine-diones | |
| CY988A (en) | Thienobenzazepines | |
| IL39336A0 (en) | Substituted 2-anilinobenzoxazoles | |
| IL40790A0 (en) | Novel pregnadiones | |
| ZA722089B (en) | Substituted chlorocarbonylureas | |
| GB1389829A (en) | Clawrings | |
| AU4209872A (en) | Container-agitator | |
| ZA717375B (en) | Novel products | |
| ZA722789B (en) | Novel products | |
| GB1400755A (en) | Benzodizepines | |
| IL38792A0 (en) | New aminoisoquinolines | |
| GB1400602A (en) | 2-5-nitro-2-thazolyl-benzimidazoles | |
| ZA723076B (en) | Substituted benzimidazolecarbamates | |
| ZA72714B (en) | Substituted phenylthiocarbamates | |
| YU282572A (en) | Kuciste i poklopac kucista | |
| IE37700B1 (en) | Novel pleuromutilin | |
| ZA72669B (en) | Substituted 1-phenyl-6-azacytosines | |
| ZA727692B (en) | Novel benzylpyrimidines | |
| CA34075S (en) | Sauceboat | |
| CA34069S (en) | Frypan |