CY987A - Pleuromutilin derivative - Google Patents
Pleuromutilin derivativeInfo
- Publication number
- CY987A CY987A CY98772A CY98772A CY987A CY 987 A CY987 A CY 987A CY 98772 A CY98772 A CY 98772A CY 98772 A CY98772 A CY 98772A CY 987 A CY987 A CY 987A
- Authority
- CY
- Cyprus
- Prior art keywords
- pleuromutilin derivative
- pleuromutilin
- derivative
- Prior art date
Links
- ZRZNJUXESFHSIO-VYTKZBNOSA-N pleuromutilin Chemical class C([C@H]([C@]1(C)[C@@H](C[C@@](C)(C=C)[C@@H](O)[C@@H]2C)OC(=O)CO)C)C[C@]32[C@H]1C(=O)CC3 ZRZNJUXESFHSIO-VYTKZBNOSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/51—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/57—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups
- C07C323/58—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups with amino groups bound to the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1445071A CH560180A5 (en) | 1971-10-05 | 1971-10-05 | Pleuromutilin derivs - with antibacterial activity |
| CH773872A CH572893A5 (en) | 1972-05-25 | 1972-05-25 | Pleuromutilin derivs - with antibacterial activity |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CY987A true CY987A (en) | 1979-08-02 |
Family
ID=25702060
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CY98772A CY987A (en) | 1971-10-05 | 1972-10-02 | Pleuromutilin derivative |
Country Status (10)
| Country | Link |
|---|---|
| AT (1) | AT335054B (cs) |
| CS (1) | CS219306B2 (cs) |
| CY (1) | CY987A (cs) |
| GB (1) | GB1410506A (cs) |
| HK (1) | HK25379A (cs) |
| IE (1) | IE37700B1 (cs) |
| IL (1) | IL47262A (cs) |
| MY (1) | MY7900103A (cs) |
| PL (1) | PL85200B1 (cs) |
| YU (1) | YU37125B (cs) |
-
1972
- 1972-10-02 CY CY98772A patent/CY987A/xx unknown
- 1972-10-02 GB GB1633875A patent/GB1410506A/en not_active Expired
- 1972-10-03 IE IE218872A patent/IE37700B1/xx unknown
- 1972-10-03 PL PL15805172A patent/PL85200B1/pl unknown
- 1972-10-03 AT AT845872A patent/AT335054B/de not_active IP Right Cessation
- 1972-10-04 YU YU249772A patent/YU37125B/xx unknown
- 1972-10-04 IL IL4726272A patent/IL47262A/en unknown
- 1972-10-04 CS CS670172A patent/CS219306B2/cs unknown
-
1979
- 1979-04-19 HK HK25379A patent/HK25379A/xx unknown
- 1979-12-30 MY MY7900103A patent/MY7900103A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| MY7900103A (en) | 1979-12-31 |
| AT335054B (de) | 1977-02-25 |
| YU37125B (en) | 1984-08-31 |
| ATA845872A (de) | 1976-06-15 |
| HK25379A (en) | 1979-04-27 |
| PL85200B1 (en) | 1976-04-30 |
| GB1410506A (en) | 1975-10-15 |
| IL47262A (en) | 1976-01-30 |
| YU249772A (en) | 1983-04-27 |
| CS219306B2 (en) | 1983-03-25 |
| IE37700B1 (en) | 1977-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EG10723A (en) | Substituted para-menthanes | |
| IE36079L (en) | Benzazine derivatives | |
| CY980A (en) | 3-substituted-morphinan derivatives | |
| HK22577A (en) | Oxidiazolone derivatives | |
| ZA721446B (en) | Substituted 3-benzylpyridines | |
| ZA721334B (en) | Novel imidazo-pyridine derivatives | |
| ZA721359B (en) | Substituted thiadiazolidine-diones | |
| IL38936A0 (en) | Lumilysergol derivatives | |
| IL39336A0 (en) | Substituted 2-anilinobenzoxazoles | |
| ZA72165B (en) | Substituted m-trifluormethylphenylurea derivatives | |
| ZA722089B (en) | Substituted chlorocarbonylureas | |
| IL40790A0 (en) | Novel pregnadiones | |
| CY908A (en) | Triazolyl-ethenyl-phenylene derivatives | |
| GB1408201A (en) | Adenosine-5-carboxylate derivatives | |
| GB1402325A (en) | Dibenzoxirenoazepine derivatives | |
| IL39834A (en) | Beta-phenyl-beta-fluoroethane derivatives | |
| IE37196L (en) | Diphenylpyrazolium derivatives | |
| ZA722426B (en) | Novel aminophenylketone derivatives | |
| IL38799A0 (en) | Substituted phenylthiocarbamates | |
| IL39333A0 (en) | Substituted benzimidazolecarbamates | |
| YU282572A (en) | Kuciste i poklopac kucista | |
| GB1401806A (en) | Methylene-dioxyquinazoline derivatives | |
| CY987A (en) | Pleuromutilin derivative | |
| ZA72669B (en) | Substituted 1-phenyl-6-azacytosines | |
| AU4740572A (en) | Pleuromutilin derivatives |