IE36742B1 - Isoxazolo pyrimidine derivatives - Google Patents
Isoxazolo pyrimidine derivativesInfo
- Publication number
- IE36742B1 IE36742B1 IE1356/72A IE135672A IE36742B1 IE 36742 B1 IE36742 B1 IE 36742B1 IE 1356/72 A IE1356/72 A IE 1356/72A IE 135672 A IE135672 A IE 135672A IE 36742 B1 IE36742 B1 IE 36742B1
- Authority
- IE
- Ireland
- Prior art keywords
- acid
- alkenenitrile
- cyano
- give
- reacting
- Prior art date
Links
- COGLFIODYRINPZ-UHFFFAOYSA-N [1,2]oxazolo[4,3-d]pyrimidine Chemical class C1=NC=NC2=CON=C21 COGLFIODYRINPZ-UHFFFAOYSA-N 0.000 title abstract 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 abstract 3
- 239000002253 acid Substances 0.000 abstract 2
- 239000003795 chemical substances by application Substances 0.000 abstract 2
- CUONGYYJJVDODC-UHFFFAOYSA-N malononitrile Chemical compound N#CCC#N CUONGYYJJVDODC-UHFFFAOYSA-N 0.000 abstract 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 abstract 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 abstract 1
- FICQFRCPSFCFBY-UHFFFAOYSA-N 2-[bis(methylsulfanyl)methylidene]propanedinitrile Chemical compound CSC(SC)=C(C#N)C#N FICQFRCPSFCFBY-UHFFFAOYSA-N 0.000 abstract 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 abstract 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 abstract 1
- VSNHCAURESNICA-UHFFFAOYSA-N Hydroxyurea Chemical compound NC(=O)NO VSNHCAURESNICA-UHFFFAOYSA-N 0.000 abstract 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 abstract 1
- 150000008065 acid anhydrides Chemical class 0.000 abstract 1
- 150000008064 anhydrides Chemical class 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 230000002363 herbicidal effect Effects 0.000 abstract 1
- 230000003301 hydrolyzing effect Effects 0.000 abstract 1
- 150000002440 hydroxy compounds Chemical class 0.000 abstract 1
- 229910000027 potassium carbonate Inorganic materials 0.000 abstract 1
- 239000007858 starting material Substances 0.000 abstract 1
- 239000001117 sulphuric acid Substances 0.000 abstract 1
- 235000011149 sulphuric acid Nutrition 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00189779A US3803148A (en) | 1971-10-15 | 1971-10-15 | Isoxazolopyrimidine herbicides and method of controlling plant growth |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE36742L IE36742L (en) | 1973-04-15 |
| IE36742B1 true IE36742B1 (en) | 1977-02-16 |
Family
ID=22698738
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1356/72A IE36742B1 (en) | 1971-10-15 | 1972-10-06 | Isoxazolo pyrimidine derivatives |
Country Status (29)
| Country | Link |
|---|---|
| US (1) | US3803148A (enExample) |
| JP (1) | JPS4848637A (enExample) |
| AR (1) | AR195799A1 (enExample) |
| AT (2) | AT321309B (enExample) |
| AU (1) | AU465488B2 (enExample) |
| BE (1) | BE790008A (enExample) |
| BG (1) | BG20072A3 (enExample) |
| BR (1) | BR7206967D0 (enExample) |
| CA (1) | CA969947A (enExample) |
| CH (1) | CH576229A5 (enExample) |
| CS (1) | CS176209B2 (enExample) |
| DE (1) | DE2249163A1 (enExample) |
| DK (1) | DK134256B (enExample) |
| EG (1) | EG10721A (enExample) |
| ES (1) | ES407387A1 (enExample) |
| FR (1) | FR2157503A5 (enExample) |
| GB (1) | GB1374374A (enExample) |
| HU (1) | HU165806B (enExample) |
| IE (1) | IE36742B1 (enExample) |
| IL (1) | IL40381A (enExample) |
| IT (1) | IT968731B (enExample) |
| NL (1) | NL7213591A (enExample) |
| OA (1) | OA04197A (enExample) |
| PH (1) | PH9945A (enExample) |
| PL (1) | PL90212B1 (enExample) |
| RO (1) | RO68939A (enExample) |
| SU (1) | SU543331A3 (enExample) |
| TR (1) | TR17023A (enExample) |
| ZA (1) | ZA727158B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6029398B2 (ja) * | 1976-04-05 | 1985-07-10 | 武田薬品工業株式会社 | イソオキサゾロ〔3,4−d〕ピリミジン誘導体 |
| US4202975A (en) * | 1976-04-05 | 1980-05-13 | Takeda Chemical Industries, Ltd. | Isoxazolo[3,4-d]pyrimidines |
| CH638215A5 (de) * | 1977-02-04 | 1983-09-15 | Hoffmann La Roche | Oxadiazolopyrimidin-derivate. |
| CH638216A5 (de) * | 1977-02-04 | 1983-09-15 | Hoffmann La Roche | Oxadiazolopyrimidin-deriate. |
| EP0696588A1 (en) * | 1992-07-17 | 1996-02-14 | Rohm And Haas Company | 2-Arylpyrimidines and herbicidal use thereof |
-
0
- BE BE790008D patent/BE790008A/xx unknown
-
1971
- 1971-10-15 US US00189779A patent/US3803148A/en not_active Expired - Lifetime
-
1972
- 1972-09-13 CA CA151,609A patent/CA969947A/en not_active Expired
- 1972-09-14 AU AU46706/72A patent/AU465488B2/en not_active Expired
- 1972-09-17 IL IL40381A patent/IL40381A/xx unknown
- 1972-10-05 PH PH13979A patent/PH9945A/en unknown
- 1972-10-05 RO RO7272424A patent/RO68939A/ro unknown
- 1972-10-05 CS CS6737A patent/CS176209B2/cs unknown
- 1972-10-06 JP JP47099934A patent/JPS4848637A/ja active Pending
- 1972-10-06 DK DK494372AA patent/DK134256B/da unknown
- 1972-10-06 IE IE1356/72A patent/IE36742B1/xx unknown
- 1972-10-06 HU HUFA926A patent/HU165806B/hu unknown
- 1972-10-06 AT AT860572A patent/AT321309B/de not_active IP Right Cessation
- 1972-10-06 TR TR17023A patent/TR17023A/xx unknown
- 1972-10-06 BG BG021557A patent/BG20072A3/xx unknown
- 1972-10-06 NL NL7213591A patent/NL7213591A/xx unknown
- 1972-10-06 IT IT30214/72A patent/IT968731B/it active
- 1972-10-06 ES ES407387A patent/ES407387A1/es not_active Expired
- 1972-10-06 ZA ZA727158A patent/ZA727158B/xx unknown
- 1972-10-06 BR BR006967/72A patent/BR7206967D0/pt unknown
- 1972-10-06 DE DE2249163A patent/DE2249163A1/de active Pending
- 1972-10-06 PL PL1972158115A patent/PL90212B1/pl unknown
- 1972-10-07 EG EG409/72A patent/EG10721A/xx active
- 1972-10-09 SU SU1833934A patent/SU543331A3/ru active
- 1972-10-11 AR AR244589A patent/AR195799A1/es active
- 1972-10-11 CH CH1482572A patent/CH576229A5/xx not_active IP Right Cessation
- 1972-10-12 OA OA54718A patent/OA04197A/xx unknown
- 1972-10-13 GB GB4724072A patent/GB1374374A/en not_active Expired
- 1972-10-13 FR FR7236458A patent/FR2157503A5/fr not_active Expired
-
1974
- 1974-02-11 AT AT106074*7A patent/AT328219B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| PH9945A (en) | 1976-06-14 |
| DE2249163A1 (de) | 1973-04-19 |
| AT328219B (de) | 1976-03-10 |
| DK134256B (da) | 1976-10-11 |
| IL40381A (en) | 1975-11-25 |
| GB1374374A (en) | 1974-11-20 |
| AU465488B2 (en) | 1975-10-02 |
| HU165806B (enExample) | 1974-11-28 |
| BR7206967D0 (pt) | 1973-08-21 |
| AT321309B (de) | 1975-03-25 |
| TR17023A (tr) | 1974-04-25 |
| CS176209B2 (enExample) | 1977-06-30 |
| ES407387A1 (es) | 1975-11-01 |
| CA969947A (en) | 1975-06-24 |
| JPS4848637A (enExample) | 1973-07-10 |
| SU543331A3 (ru) | 1977-01-15 |
| AR195799A1 (es) | 1973-11-09 |
| ZA727158B (en) | 1973-06-27 |
| AU4670672A (en) | 1974-03-21 |
| IT968731B (it) | 1974-03-20 |
| FR2157503A5 (enExample) | 1973-06-01 |
| ATA106074A (de) | 1975-05-15 |
| IL40381A0 (en) | 1972-11-28 |
| CH576229A5 (enExample) | 1976-06-15 |
| EG10721A (en) | 1976-03-31 |
| DK134256C (enExample) | 1977-03-07 |
| PL90212B1 (enExample) | 1977-01-31 |
| NL7213591A (enExample) | 1973-04-17 |
| OA04197A (fr) | 1979-12-31 |
| IE36742L (en) | 1973-04-15 |
| BG20072A3 (bg) | 1975-10-30 |
| BE790008A (fr) | 1973-04-12 |
| US3803148A (en) | 1974-04-09 |
| RO68939A (ro) | 1982-05-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1348985A (en) | Esters of cephalosporin compounds | |
| GB1247370A (en) | Glyoxals and production thereof | |
| IE36742B1 (en) | Isoxazolo pyrimidine derivatives | |
| GB822947A (en) | Improvements in and relating to sulphonamides | |
| GB1429166A (enExample) | ||
| GB1502519A (en) | Process for the preparation of acyltaurides | |
| IE36743B1 (en) | Isothiazolo pyrimidine derivatives | |
| GB1360354A (en) | Chenodeoxycholic acid | |
| GB1515614A (en) | Preparation of m-benzoylhydratropic acid and an intermediate therefor | |
| GB1351932A (en) | Chromone-3-carboxylic acids | |
| GB1093113A (en) | 6-substituted penicillanyl alcohols | |
| GB1345645A (en) | Diamido amino sulphonates and preparation thereof | |
| GB1384855A (en) | 7-ypsilon-substituted propyl-theophylline derivatives and a process for producing the same | |
| GB1380368A (en) | Preparation of penicillamine or its homologues | |
| GB1346379A (en) | Process for the preparation of 5-alkylpyridine derivatives having a tetrazole radical | |
| IE44230L (en) | 1, 3-diaza-bicyclo [3,2, 0] heptane derivatives | |
| GB1359523A (en) | Benzalacetone amidinohydrazone derivatives and the production thereof | |
| GB1429861A (en) | Vincamine derivatives | |
| GB1483684A (en) | Benzothiazole derivatives | |
| GB1415338A (en) | Amino acids and derivatives thereof | |
| GB1368233A (en) | Penicillin 1-oxides | |
| GB1137654A (en) | 5-halosalicylic acid derivatives | |
| IE38215B1 (en) | Process for the preparation of oximinonitriles | |
| GB1494939A (en) | 3,7-dimethyl-3-hydroxy-6-octenenitrile and process for its preparation | |
| GB1392554A (en) | Cephalosporins |