IE36485B1 - Benzothiophene derivatives and process for preparing same - Google Patents
Benzothiophene derivatives and process for preparing sameInfo
- Publication number
- IE36485B1 IE36485B1 IE790/72A IE79072A IE36485B1 IE 36485 B1 IE36485 B1 IE 36485B1 IE 790/72 A IE790/72 A IE 790/72A IE 79072 A IE79072 A IE 79072A IE 36485 B1 IE36485 B1 IE 36485B1
- Authority
- IE
- Ireland
- Prior art keywords
- formula
- reaction
- compound
- june
- prepared
- Prior art date
Links
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical class C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000006243 chemical reaction Methods 0.000 abstract 3
- 150000001875 compounds Chemical class 0.000 abstract 3
- 229910052739 hydrogen Inorganic materials 0.000 abstract 2
- 239000001257 hydrogen Substances 0.000 abstract 2
- 239000000543 intermediate Substances 0.000 abstract 2
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 abstract 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 abstract 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 abstract 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 abstract 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 125000004429 atom Chemical group 0.000 abstract 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 abstract 1
- 229910052794 bromium Inorganic materials 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 229910052801 chlorine Inorganic materials 0.000 abstract 1
- 239000000460 chlorine Substances 0.000 abstract 1
- 230000017858 demethylation Effects 0.000 abstract 1
- 238000010520 demethylation reaction Methods 0.000 abstract 1
- 239000003085 diluting agent Substances 0.000 abstract 1
- -1 dimethylamino, diethylamino, di - n - propylamino, di - n - butylamino, pyrrolidino, piperidino Chemical group 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 230000026030 halogenation Effects 0.000 abstract 1
- 238000005658 halogenation reaction Methods 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 abstract 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 239000007858 starting material Substances 0.000 abstract 1
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D333/56—Radicals substituted by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3003271A GB1357212A (en) | 1971-06-25 | 1971-06-25 | Benzothiophene derivatives and process for preparing the same |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE36485L IE36485L (en) | 1972-12-25 |
| IE36485B1 true IE36485B1 (en) | 1976-11-10 |
Family
ID=10301169
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE790/72A IE36485B1 (en) | 1971-06-25 | 1972-06-07 | Benzothiophene derivatives and process for preparing same |
Country Status (18)
| Country | Link |
|---|---|
| JP (1) | JPS4844248A (enExample) |
| AT (1) | AT312597B (enExample) |
| AU (1) | AU462617B2 (enExample) |
| BE (1) | BE784260A (enExample) |
| CA (1) | CA959492A (enExample) |
| CH (2) | CH548409A (enExample) |
| DE (1) | DE2230669A1 (enExample) |
| ES (1) | ES404252A1 (enExample) |
| FI (1) | FI54477C (enExample) |
| FR (1) | FR2143250B1 (enExample) |
| GB (1) | GB1357212A (enExample) |
| HU (1) | HU166255B (enExample) |
| IE (1) | IE36485B1 (enExample) |
| NL (1) | NL7208703A (enExample) |
| OA (1) | OA04117A (enExample) |
| SE (1) | SE385482B (enExample) |
| SU (2) | SU453844A3 (enExample) |
| ZA (1) | ZA723868B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3947470A (en) * | 1974-06-20 | 1976-03-30 | Smithkline Corporation | Substituted benzofurans and benzothiophenes |
| JPS5973579A (ja) * | 1982-10-19 | 1984-04-25 | Kotobuki Seiyaku Kk | ベンゾフラン又はベンゾチオフェン誘導体,この化合物を有効成分とする尿酸排泄剤及びその製造方法 |
| NZ213986A (en) * | 1984-10-30 | 1989-07-27 | Usv Pharma Corp | Heterocyclic or aromatic compounds, and pharmaceutical compositions containing such |
| CA2145614A1 (en) * | 1994-03-31 | 1995-10-01 | Jeffrey A. Dodge | Intermediates and processes for preparing benzothiophene compounds |
| CA2231013A1 (en) * | 1997-04-30 | 1998-10-30 | Eli Lilly And Company | Process for preparing benzoic acid derivative intermediates and benzothiophene pharmaceuticals |
-
1971
- 1971-06-25 GB GB3003271A patent/GB1357212A/en not_active Expired
-
1972
- 1972-06-01 BE BE784260A patent/BE784260A/xx unknown
- 1972-06-05 FI FI1578/72A patent/FI54477C/fi active
- 1972-06-06 ZA ZA723868A patent/ZA723868B/xx unknown
- 1972-06-07 IE IE790/72A patent/IE36485B1/xx unknown
- 1972-06-13 AU AU43338/72A patent/AU462617B2/en not_active Expired
- 1972-06-13 HU HULA799A patent/HU166255B/hu unknown
- 1972-06-21 CH CH1795273A patent/CH548409A/fr not_active IP Right Cessation
- 1972-06-21 SE SE7208187A patent/SE385482B/xx unknown
- 1972-06-21 CH CH930272A patent/CH549042A/fr not_active IP Right Cessation
- 1972-06-22 FR FR7222480A patent/FR2143250B1/fr not_active Expired
- 1972-06-23 CA CA145,600A patent/CA959492A/en not_active Expired
- 1972-06-23 SU SU1800666A patent/SU453844A3/ru active
- 1972-06-23 DE DE19722230669 patent/DE2230669A1/de active Pending
- 1972-06-23 SU SU721959344A patent/SU486510A3/ru active
- 1972-06-23 NL NL7208703A patent/NL7208703A/xx not_active Application Discontinuation
- 1972-06-24 ES ES404252A patent/ES404252A1/es not_active Expired
- 1972-06-24 JP JP47063621A patent/JPS4844248A/ja active Pending
- 1972-06-26 AT AT545972A patent/AT312597B/de not_active IP Right Cessation
- 1972-06-26 OA OA54619A patent/OA04117A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI54477C (fi) | 1978-12-11 |
| HU166255B (enExample) | 1975-02-28 |
| IE36485L (en) | 1972-12-25 |
| OA04117A (fr) | 1979-11-30 |
| CH549042A (fr) | 1974-05-15 |
| SE385482B (sv) | 1976-07-05 |
| SU453844A3 (enExample) | 1974-12-15 |
| FR2143250B1 (enExample) | 1975-06-20 |
| NL7208703A (enExample) | 1972-12-28 |
| ES404252A1 (es) | 1975-06-01 |
| ZA723868B (en) | 1973-03-28 |
| GB1357212A (en) | 1974-06-19 |
| CH548409A (fr) | 1974-04-30 |
| AU4333872A (en) | 1973-12-20 |
| FI54477B (fi) | 1978-08-31 |
| AU462617B2 (en) | 1975-06-10 |
| FR2143250A1 (enExample) | 1973-02-02 |
| BE784260A (fr) | 1972-12-01 |
| JPS4844248A (enExample) | 1973-06-26 |
| AT312597B (de) | 1974-01-10 |
| DE2230669A1 (de) | 1972-12-28 |
| CA959492A (en) | 1974-12-17 |
| SU486510A3 (ru) | 1975-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1526331A (en) | Phthalanes | |
| GB1325192A (en) | Phloroglucinol derivatives | |
| GB1456323A (en) | Benzothiophenes process for preparing them and pharmaceutical compositions containing the same | |
| GB1129116A (en) | Lactam derivatives | |
| GB1514870A (en) | Imidazolyloxime ethers having antimycotic and bactericidal activity | |
| GB1318291A (en) | Carboxamide derivatives and fungicidal compositions containing them | |
| IE36485B1 (en) | Benzothiophene derivatives and process for preparing same | |
| GB1357633A (en) | Chromanone basic ether derivatives | |
| GB1330966A (en) | N-substituted piperidine compounds methods for their production and pharmaceutical compositions containing them | |
| GB1513320A (en) | N-propargyl-2-phenylamino-2-imidazolines | |
| GB1436533A (en) | Aryl piperazine derivatives of adenine | |
| GB1467467A (en) | Tricyclic fused imidazole derivatives and a process for the preparation thereof | |
| GB1436307A (en) | Diaromatic o-aminoalkyl-oximes | |
| ES8103065A1 (es) | Procedimiento para la preparacion de derivados de tiazolina | |
| GB1186495A (en) | 0-[3-(4-Fluorobenzoyl) Proplyl]-4-Substituted Piperazines, their Acid Addition Salts and their method of preparation | |
| GB1299247A (en) | Benzofuran derivatives and process for preparing the same | |
| GB1461667A (en) | Amphetamine derivatives | |
| GB1473971A (en) | 3-hydroxy-5,6-benzomorphinan derivatives | |
| GB1242096A (en) | Benzobenzofuranooxepine compounds and process for preparing the same | |
| GB1340637A (en) | Dibenzocycloheptadioxolan derivatives | |
| GB1431279A (en) | Thiazole derivatives and their use as cardiovascular agents | |
| GB1445127A (en) | Benzocycloheptathiophene derivatives | |
| GB1324676A (en) | Derivatives of 1,7,7-trimethyl-2-norbornane-2-spiro-1,3-dioxolane their process of preparation and their therapeutic application | |
| US3803236A (en) | Para-aminopropyl-2-hydroxy-ethers of phenylaminotropones and the salts thereof | |
| GB1467761A (en) | Phenoxypropylamine derivatives and preparation thereof |