IE35571B1 - Substituted dinitroanilines - Google Patents
Substituted dinitroanilinesInfo
- Publication number
- IE35571B1 IE35571B1 IE1089/71A IE108971A IE35571B1 IE 35571 B1 IE35571 B1 IE 35571B1 IE 1089/71 A IE1089/71 A IE 1089/71A IE 108971 A IE108971 A IE 108971A IE 35571 B1 IE35571 B1 IE 35571B1
- Authority
- IE
- Ireland
- Prior art keywords
- chloroethyl
- hydroxyethyl
- appropriate
- hydroxypropyl
- dinitroanilines
- Prior art date
Links
- CGNBQYFXGQHUQP-UHFFFAOYSA-N 2,3-dinitroaniline Chemical class NC1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O CGNBQYFXGQHUQP-UHFFFAOYSA-N 0.000 title abstract 2
- -1 2- hydroxypropyl Chemical group 0.000 abstract 4
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 abstract 2
- 150000001412 amines Chemical class 0.000 abstract 2
- 239000003795 chemical substances by application Substances 0.000 abstract 2
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 abstract 2
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- 150000001340 alkali metals Chemical class 0.000 abstract 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 125000006350 alkyl thio alkyl group Chemical group 0.000 abstract 1
- 125000000304 alkynyl group Chemical group 0.000 abstract 1
- 125000005335 azido alkyl group Chemical group 0.000 abstract 1
- 125000005998 bromoethyl group Chemical group 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 239000003337 fertilizer Substances 0.000 abstract 1
- 230000002140 halogenating effect Effects 0.000 abstract 1
- 230000002363 herbicidal effect Effects 0.000 abstract 1
- 239000007788 liquid Substances 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 239000000575 pesticide Substances 0.000 abstract 1
- 239000005648 plant growth regulator Substances 0.000 abstract 1
- 239000007787 solid Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/24—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/25—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C247/00—Compounds containing azido groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702043442 DE2043442A1 (de) | 1970-09-02 | 1970-09-02 | Substituierte Dinitroaniline |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE35571L IE35571L (en) | 1972-03-02 |
| IE35571B1 true IE35571B1 (en) | 1976-03-18 |
Family
ID=5781330
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1089/71A IE35571B1 (en) | 1970-09-02 | 1971-08-27 | Substituted dinitroanilines |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3770779A (enExample) |
| AT (1) | AT310496B (enExample) |
| AU (1) | AU458051B2 (enExample) |
| BE (1) | BE771931A (enExample) |
| BR (1) | BR7105545D0 (enExample) |
| CA (1) | CA1014969A (enExample) |
| CH (1) | CH548159A (enExample) |
| CS (1) | CS167325B2 (enExample) |
| DE (1) | DE2043442A1 (enExample) |
| FR (1) | FR2107094A5 (enExample) |
| GB (1) | GB1351785A (enExample) |
| IE (1) | IE35571B1 (enExample) |
| IL (1) | IL37484A (enExample) |
| NL (1) | NL7111853A (enExample) |
| PH (1) | PH9861A (enExample) |
| ZA (1) | ZA715814B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3948957A (en) * | 1975-06-23 | 1976-04-06 | Eli Lilly And Company | 3-Azido-2,6-dinitroanilines |
| USH234H (en) | 1985-08-21 | 1987-03-03 | The United States Of America As Represented By The Secretary Of The Army | Energetic derivatives of a novel diol and methods for their syntheses |
-
1970
- 1970-09-02 DE DE19702043442 patent/DE2043442A1/de active Pending
-
1971
- 1971-07-26 CH CH1097171A patent/CH548159A/xx not_active IP Right Cessation
- 1971-08-09 US US00170278A patent/US3770779A/en not_active Expired - Lifetime
- 1971-08-10 IL IL37484A patent/IL37484A/xx unknown
- 1971-08-11 CA CA120,339A patent/CA1014969A/en not_active Expired
- 1971-08-13 PH PH12748A patent/PH9861A/en unknown
- 1971-08-17 AU AU32418/71A patent/AU458051B2/en not_active Expired
- 1971-08-25 BR BR5545/71A patent/BR7105545D0/pt unknown
- 1971-08-25 GB GB3978571A patent/GB1351785A/en not_active Expired
- 1971-08-27 NL NL7111853A patent/NL7111853A/xx unknown
- 1971-08-27 IE IE1089/71A patent/IE35571B1/xx unknown
- 1971-08-30 BE BE771931A patent/BE771931A/xx unknown
- 1971-08-31 ZA ZA715814A patent/ZA715814B/xx unknown
- 1971-08-31 CS CS6230A patent/CS167325B2/cs unknown
- 1971-09-01 FR FR7131585A patent/FR2107094A5/fr not_active Expired
- 1971-09-01 AT AT761171A patent/AT310496B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| PH9861A (en) | 1976-05-11 |
| BR7105545D0 (pt) | 1973-02-15 |
| GB1351785A (en) | 1974-05-01 |
| AT310496B (de) | 1973-10-10 |
| DE2043442A1 (de) | 1972-03-09 |
| CH548159A (de) | 1974-04-30 |
| CA1014969A (en) | 1977-08-02 |
| AU458051B2 (en) | 1975-02-20 |
| SU377986A3 (enExample) | 1973-04-17 |
| IL37484A (en) | 1974-12-31 |
| CS167325B2 (enExample) | 1976-04-29 |
| AU3241871A (en) | 1973-02-22 |
| US3770779A (en) | 1973-11-06 |
| NL7111853A (enExample) | 1972-03-06 |
| FR2107094A5 (enExample) | 1972-05-05 |
| IL37484A0 (en) | 1971-11-29 |
| IE35571L (en) | 1972-03-02 |
| ZA715814B (en) | 1972-06-28 |
| BE771931A (fr) | 1972-02-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1421112A (en) | Benzanilide compounds and agricultural germicidal compositions thereof vavle | |
| CH399823A (de) | Mittel zur Beeinflussung des Wachstums von Pflanzen | |
| GB1270315A (en) | Substituted chrysanthemumates and pesticides containing them | |
| GB1395802A (en) | Substituted benzamides and herbicidal uses thereof | |
| IE35571B1 (en) | Substituted dinitroanilines | |
| GB1341895A (en) | Oximino malonitrile compounds | |
| GB1424784A (en) | Oxime ethers | |
| GB1263125A (en) | Substituted furan carboxylic anilides | |
| GB1388394A (en) | Substituted cinnamanilides and biocidal uses thereof | |
| GB1384609A (en) | Substituted n- 3-aminocarbonyloxyphenyl-n,-methylureas | |
| IE33640B1 (en) | Substituted hydrazine derivatives and agents containing them for retarding the growth of plants | |
| GB1386493A (en) | S-triazines in combating insects | |
| IE32623L (en) | Nitro-azacycloalkan-2-ones | |
| GB1378322A (en) | Substituted chlorocarbonylureas and herbicidal compositions containi ng them | |
| GB910378A (en) | Schiff base carbamates and parasiticidal compositions containing them | |
| GB1269692A (en) | Substituted carboxylic acid anilides | |
| GB1339244A (en) | N-1,1 substituted acetonitrilo-a-3,5-substituted phenoxy alkyl amides and their use as herbicides | |
| GB1392479A (en) | O-substituted thiophene oxime carbamates and their use as pesticides | |
| GB1455471A (en) | Haloacetanilides for influencing plant growth | |
| GB1410725A (en) | Azidoformates and their application to polymeric substrates | |
| GB1342432A (en) | Substituted benzanilides | |
| GB1475163A (en) | Unsaturated nitriles | |
| GB1326824A (en) | Process for the production of 1-n-cyanoethylamino-benzene | |
| GB1307262A (en) | Beta-cyanoethyl thiolcarbamates | |
| GB1253486A (en) | Dihydrobenzazepine derivatives |