IE34427B1 - Substituted alkenoic acids and their preparation - Google Patents
Substituted alkenoic acids and their preparationInfo
- Publication number
- IE34427B1 IE34427B1 IE984/70A IE98470A IE34427B1 IE 34427 B1 IE34427 B1 IE 34427B1 IE 984/70 A IE984/70 A IE 984/70A IE 98470 A IE98470 A IE 98470A IE 34427 B1 IE34427 B1 IE 34427B1
- Authority
- IE
- Ireland
- Prior art keywords
- formula
- diphenyl
- acid
- ene
- methyl
- Prior art date
Links
- 239000002253 acid Substances 0.000 title abstract 7
- 150000007513 acids Chemical class 0.000 title abstract 5
- 150000001875 compounds Chemical class 0.000 abstract 5
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 150000001408 amides Chemical class 0.000 abstract 2
- 150000002148 esters Chemical class 0.000 abstract 2
- ARFLASKVLJTEJD-UHFFFAOYSA-N ethyl 2-bromopropanoate Chemical compound CCOC(=O)C(C)Br ARFLASKVLJTEJD-UHFFFAOYSA-N 0.000 abstract 2
- 125000004494 ethyl ester group Chemical group 0.000 abstract 2
- 229910052736 halogen Inorganic materials 0.000 abstract 2
- 150000002367 halogens Chemical class 0.000 abstract 2
- 229910052739 hydrogen Inorganic materials 0.000 abstract 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 2
- 230000003301 hydrolyzing effect Effects 0.000 abstract 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 abstract 2
- FOJILUGUSLGZEP-UHFFFAOYSA-N (3-bromo-1-phenylprop-1-enyl)benzene Chemical compound C=1C=CC=CC=1C(=CCBr)C1=CC=CC=C1 FOJILUGUSLGZEP-UHFFFAOYSA-N 0.000 abstract 1
- QGCPSHFCQNUANM-UHFFFAOYSA-N (3-bromo-2-methyl-1-phenylprop-1-enyl)benzene Chemical compound C=1C=CC=CC=1C(=C(CBr)C)C1=CC=CC=C1 QGCPSHFCQNUANM-UHFFFAOYSA-N 0.000 abstract 1
- OZDCBKYPNBVRSA-UHFFFAOYSA-N (4,4-dimethoxycyclohexa-1,5-dien-1-yl)-phenylmethanone Chemical compound C1=CC(OC)(OC)CC=C1C(=O)C1=CC=CC=C1 OZDCBKYPNBVRSA-UHFFFAOYSA-N 0.000 abstract 1
- SWFHGTMLYIBPPA-UHFFFAOYSA-N (4-methoxyphenyl)-phenylmethanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1 SWFHGTMLYIBPPA-UHFFFAOYSA-N 0.000 abstract 1
- CHGQIGPIKSMELY-UHFFFAOYSA-N 1-diazo-3,5-dimethyl-6,6-diphenylhex-5-en-2-one Chemical compound [N+](=[N-])=CC(C(CC(=C(C1=CC=CC=C1)C1=CC=CC=C1)C)C)=O CHGQIGPIKSMELY-UHFFFAOYSA-N 0.000 abstract 1
- WIISKBDAFYZSOP-UHFFFAOYSA-N 2,4-dimethyl-5,5-diphenylpent-4-enoyl chloride Chemical compound CC(C(=O)Cl)CC(=C(C1=CC=CC=C1)C1=CC=CC=C1)C WIISKBDAFYZSOP-UHFFFAOYSA-N 0.000 abstract 1
- VAQSYDDIAIZUGC-UHFFFAOYSA-N 2-benzhydrylidenebutan-1-ol Chemical compound C1(=CC=CC=C1)C(=C(CC)CO)C1=CC=CC=C1 VAQSYDDIAIZUGC-UHFFFAOYSA-N 0.000 abstract 1
- WHCZBJAGVPLFRJ-UHFFFAOYSA-N 2-benzhydrylpent-2-en-1-ol Chemical compound C1(=CC=CC=C1)C(C(=CCC)CO)C1=CC=CC=C1 WHCZBJAGVPLFRJ-UHFFFAOYSA-N 0.000 abstract 1
- JNZNAOBRCHJMLW-UHFFFAOYSA-N 2-methyl-5,5-diphenylpent-4-enoic acid Chemical compound CC(C(=O)O)CC=C(C1=CC=CC=C1)C1=CC=CC=C1 JNZNAOBRCHJMLW-UHFFFAOYSA-N 0.000 abstract 1
- NZRDAYVRTXKVMO-UHFFFAOYSA-N 3,3-bis(4-methoxyphenyl)-2-methylprop-2-enoic acid Chemical compound C1=CC(OC)=CC=C1C(=C(C)C(O)=O)C1=CC=C(OC)C=C1 NZRDAYVRTXKVMO-UHFFFAOYSA-N 0.000 abstract 1
- VDZJHCQPPWSRFX-UHFFFAOYSA-N 3,3-diphenylprop-2-en-1-ol Chemical compound C=1C=CC=CC=1C(=CCO)C1=CC=CC=C1 VDZJHCQPPWSRFX-UHFFFAOYSA-N 0.000 abstract 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 abstract 1
- VWOUPZBGOINSAP-UHFFFAOYSA-N 4,5-dibromo-2-methyl-5,5-diphenylpentanoic acid Chemical compound BrC(CC(C(=O)O)C)C(C1=CC=CC=C1)(C1=CC=CC=C1)Br VWOUPZBGOINSAP-UHFFFAOYSA-N 0.000 abstract 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 abstract 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 abstract 1
- TVNOJSOOOHBLMR-UHFFFAOYSA-N [2-(bromomethyl)-1-phenylbut-1-enyl]benzene Chemical compound C1(=CC=CC=C1)C(=C(CC)CBr)C1=CC=CC=C1 TVNOJSOOOHBLMR-UHFFFAOYSA-N 0.000 abstract 1
- 150000001298 alcohols Chemical class 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- 150000001340 alkali metals Chemical class 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 abstract 1
- 239000012965 benzophenone Substances 0.000 abstract 1
- 235000010290 biphenyl Nutrition 0.000 abstract 1
- 239000004305 biphenyl Substances 0.000 abstract 1
- 150000001805 chlorine compounds Chemical class 0.000 abstract 1
- 230000005494 condensation Effects 0.000 abstract 1
- 238000009833 condensation Methods 0.000 abstract 1
- 230000000911 decarboxylating effect Effects 0.000 abstract 1
- 239000003937 drug carrier Substances 0.000 abstract 1
- 230000001076 estrogenic effect Effects 0.000 abstract 1
- RMGJCSHZTFKPNO-UHFFFAOYSA-M magnesium;ethene;bromide Chemical compound [Mg+2].[Br-].[CH-]=C RMGJCSHZTFKPNO-UHFFFAOYSA-M 0.000 abstract 1
- 150000002690 malonic acid derivatives Chemical class 0.000 abstract 1
- 231100000252 nontoxic Toxicity 0.000 abstract 1
- 230000003000 nontoxic effect Effects 0.000 abstract 1
- 238000007911 parenteral administration Methods 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/147—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of carboxylic acids or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/30—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings
- C07C57/42—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings having unsaturation outside the rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3912369 | 1969-08-05 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE34427L IE34427L (en) | 1971-02-05 |
| IE34427B1 true IE34427B1 (en) | 1975-05-14 |
Family
ID=10407759
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE984/70A IE34427B1 (en) | 1969-08-05 | 1970-07-30 | Substituted alkenoic acids and their preparation |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3736347A (enExample) |
| JP (1) | JPS4948316B1 (enExample) |
| AT (1) | AT303709B (enExample) |
| BE (1) | BE754469A (enExample) |
| CH (1) | CH550131A (enExample) |
| DE (1) | DE2038793A1 (enExample) |
| DK (2) | DK135835B (enExample) |
| ES (1) | ES382485A1 (enExample) |
| FI (1) | FI52458C (enExample) |
| FR (1) | FR2068462B1 (enExample) |
| GB (1) | GB1257266A (enExample) |
| IE (1) | IE34427B1 (enExample) |
| IL (1) | IL35043A (enExample) |
| NL (1) | NL7011407A (enExample) |
| NO (1) | NO135748C (enExample) |
| OA (1) | OA03669A (enExample) |
| SE (1) | SE363091B (enExample) |
| SU (1) | SU367596A3 (enExample) |
| ZA (1) | ZA705370B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8311678D0 (en) * | 1983-04-28 | 1983-06-02 | Ici Plc | Phenol derivatives |
| US4603145A (en) * | 1983-05-06 | 1986-07-29 | American Cyanamid Company | Antiatherosclerotic diphenyl alkanamides |
| FI92189C (fi) * | 1986-03-17 | 1994-10-10 | Eisai Co Ltd | Menetelmä lääkeaineina käyttökelpoisen difenyylimetaanijohdannaisen valmistamiseksi |
| US5206403A (en) * | 1986-03-17 | 1993-04-27 | Eisai Co., Ltd. | Diphenylethylene derivatives, pharmaceutical compositions containing same and treatment methods |
| US5182301A (en) * | 1986-03-17 | 1993-01-26 | Eisai Co., Ltd. | Diphenylethylene derivatives pharmaceutical compositions containing same and treatment methods |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH415625A (de) * | 1960-05-16 | 1966-06-30 | Bayer Ag | Ultraviolett-Schutzfilter |
-
0
- BE BE754469D patent/BE754469A/xx unknown
-
1969
- 1969-08-05 GB GB3912369A patent/GB1257266A/en not_active Expired
-
1970
- 1970-07-30 IE IE984/70A patent/IE34427B1/xx unknown
- 1970-07-30 FI FI702105A patent/FI52458C/fi active
- 1970-07-31 NL NL7011407A patent/NL7011407A/xx unknown
- 1970-08-03 IL IL35043A patent/IL35043A/xx unknown
- 1970-08-03 NO NO2993/70A patent/NO135748C/no unknown
- 1970-08-03 US US00060729A patent/US3736347A/en not_active Expired - Lifetime
- 1970-08-04 DE DE19702038793 patent/DE2038793A1/de active Pending
- 1970-08-04 FR FR7028710A patent/FR2068462B1/fr not_active Expired
- 1970-08-04 ZA ZA705370A patent/ZA705370B/xx unknown
- 1970-08-04 AT AT707070A patent/AT303709B/de not_active IP Right Cessation
- 1970-08-05 SU SU1473940A patent/SU367596A3/ru active
- 1970-08-05 CH CH1178570A patent/CH550131A/xx not_active IP Right Cessation
- 1970-08-05 DK DK403370AA patent/DK135835B/da unknown
- 1970-08-05 JP JP45068606A patent/JPS4948316B1/ja active Pending
- 1970-08-05 SE SE10784/70A patent/SE363091B/xx unknown
- 1970-08-05 ES ES382485A patent/ES382485A1/es not_active Expired
- 1970-12-04 OA OA54109A patent/OA03669A/xx unknown
-
1971
- 1971-12-23 DK DK631471AA patent/DK128414B/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK135835C (enExample) | 1977-12-05 |
| FR2068462A1 (enExample) | 1971-08-27 |
| DK128414B (da) | 1974-04-29 |
| JPS4948316B1 (enExample) | 1974-12-20 |
| US3736347A (en) | 1973-05-29 |
| OA03669A (fr) | 1971-12-24 |
| NL7011407A (enExample) | 1971-02-09 |
| ZA705370B (en) | 1971-04-28 |
| GB1257266A (enExample) | 1971-12-15 |
| NO135748C (enExample) | 1977-05-25 |
| IL35043A0 (en) | 1970-10-30 |
| SE363091B (enExample) | 1974-01-07 |
| ES382485A1 (es) | 1972-12-01 |
| FI52458B (enExample) | 1977-05-31 |
| DK135835B (da) | 1977-07-04 |
| IL35043A (en) | 1974-01-14 |
| CH550131A (de) | 1974-06-14 |
| FR2068462B1 (enExample) | 1974-02-01 |
| FI52458C (fi) | 1977-09-12 |
| BE754469A (fr) | 1971-02-05 |
| SU367596A3 (enExample) | 1973-01-23 |
| AT303709B (de) | 1972-12-11 |
| IE34427L (en) | 1971-02-05 |
| NO135748B (enExample) | 1977-02-14 |
| DE2038793A1 (de) | 1971-02-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1481866A (en) | Oxepin derivatives | |
| IE35424L (en) | Cyclopropyl-p-tolyl-acetic acid derivatives. | |
| IE34427B1 (en) | Substituted alkenoic acids and their preparation | |
| GB1230630A (enExample) | ||
| IE34314L (en) | Dibenzodioxocine derivatives | |
| GB1496491A (en) | Dihydroergopeptine derivatives | |
| GB1453643A (en) | Bis-benzyl-acetic acid derivatives | |
| GB1432503A (en) | Cycloalkylalkylesters and process for their preparation | |
| GB1291644A (en) | Substituted 1-indancarboxylic acids, their esters and salts | |
| GB1496307A (en) | Hypolipidemic agents | |
| GB1411700A (en) | Penicillins and production thereof | |
| GB894068A (en) | Improvements in or relating to color photography | |
| GB1382267A (en) | Phenylalkanoic acid derivatives | |
| GB1079726A (en) | Method of producing a new salicylic acid ester | |
| GB1394584A (en) | Heterocyclic substituted xanthone carboxylic acid compounds | |
| GB1219387A (en) | Bicyclo[2.2.2]oct-2-ene-amino acid compounds | |
| ES372927A1 (es) | Procedimiento de preparacion de nuevos derivados del acido ciclohexenil acetico. | |
| GB1498377A (en) | Alkyne derivatives and process for their preparation | |
| GB1512537A (en) | 2-(2'-aryl-6'-chromonyl) propionic acids and analgesic and anti-inflammatory derivatives thereof | |
| GB1504683A (en) | Pharmaceutical compositions containing substituted pyrimido-quinoline derivatives | |
| ES350639A1 (es) | Procedimiento para la preparacion de derivados del acido acetico. | |
| GB1302009A (enExample) | ||
| GB1430912A (en) | 8-beta-hydroxyethyl-ergoline derivatives | |
| GB1112601A (en) | 9,10-dihydro-4h-benzo[4,5] cyclohepta [1,2-b] thiophene derivatives and their production | |
| GB1341780A (en) | Cyclopenteneheptanoic acid derivatives |