HU197875B - Process for producing polycyclic aromatic amino-alcanol derivatives and pharmaceutical compositions containing themas active components - Google Patents
Process for producing polycyclic aromatic amino-alcanol derivatives and pharmaceutical compositions containing themas active components Download PDFInfo
- Publication number
- HU197875B HU197875B HU841886A HU188684A HU197875B HU 197875 B HU197875 B HU 197875B HU 841886 A HU841886 A HU 841886A HU 188684 A HU188684 A HU 188684A HU 197875 B HU197875 B HU 197875B
- Authority
- HU
- Hungary
- Prior art keywords
- methyl
- amino
- propanediol
- anthracenylmethyl
- formula
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 64
- 239000008194 pharmaceutical composition Substances 0.000 title claims abstract description 16
- 230000008569 process Effects 0.000 title claims description 15
- 241001255830 Thema Species 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 136
- -1 hydroxy, methyl Chemical group 0.000 claims abstract description 102
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 77
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 21
- 150000003839 salts Chemical class 0.000 claims abstract description 21
- 239000001257 hydrogen Substances 0.000 claims abstract description 20
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 17
- 150000002148 esters Chemical class 0.000 claims abstract description 17
- 238000002360 preparation method Methods 0.000 claims abstract description 16
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 13
- 125000001424 substituent group Chemical group 0.000 claims abstract description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 10
- 230000003115 biocidal effect Effects 0.000 claims abstract description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 3
- 239000000203 mixture Substances 0.000 claims description 104
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 69
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 60
- 239000000460 chlorine Substances 0.000 claims description 35
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 32
- 229910052801 chlorine Inorganic materials 0.000 claims description 23
- 239000007858 starting material Substances 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 18
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 claims description 9
- 229920000166 polytrimethylene carbonate Polymers 0.000 claims description 9
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 8
- 150000002431 hydrogen Chemical class 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- SBRXTSOCZITGQG-UHFFFAOYSA-N crisnatol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 SBRXTSOCZITGQG-UHFFFAOYSA-N 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 150000002367 halogens Chemical group 0.000 claims description 7
- 125000002883 imidazolyl group Chemical group 0.000 claims description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- JPCHHZXQVHSGGC-UHFFFAOYSA-N 2-[[10-(2-hydroxyethoxy)anthracen-9-yl]methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(OCCO)C2=C1 JPCHHZXQVHSGGC-UHFFFAOYSA-N 0.000 claims description 4
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 239000003937 drug carrier Substances 0.000 claims description 4
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 4
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 4
- 125000006239 protecting group Chemical group 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 3
- 238000002156 mixing Methods 0.000 claims description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 3
- JVAJUMFRQJXYFQ-UHFFFAOYSA-N 2-(anthracen-9-ylmethylamino)-2-(ethoxymethyl)propane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)COCC)=C(C=CC=C3)C3=CC2=C1 JVAJUMFRQJXYFQ-UHFFFAOYSA-N 0.000 claims description 2
- YLTDJZLNMZYFHJ-UHFFFAOYSA-N 2-(anthracen-9-ylmethylamino)-2-methylbutane-1,4-diol Chemical compound C1=CC=C2C(CNC(CO)(CCO)C)=C(C=CC=C3)C3=CC2=C1 YLTDJZLNMZYFHJ-UHFFFAOYSA-N 0.000 claims description 2
- WPHAPIVXSNDMCJ-UHFFFAOYSA-N 2-(anthracen-9-ylmethylamino)-2-propan-2-ylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C(C)C)=C(C=CC=C3)C3=CC2=C1 WPHAPIVXSNDMCJ-UHFFFAOYSA-N 0.000 claims description 2
- RSKQOKZNWYKUJW-UHFFFAOYSA-N 2-(chrysen-6-ylmethylamino)-2-(hydroxymethyl)propane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)CO)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 RSKQOKZNWYKUJW-UHFFFAOYSA-N 0.000 claims description 2
- JDIJCKDUNDZTNF-UHFFFAOYSA-N 2-(chrysen-6-ylmethylamino)-2-propan-2-ylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C(C)C)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 JDIJCKDUNDZTNF-UHFFFAOYSA-N 0.000 claims description 2
- LUTCLKFAAWZDJL-UHFFFAOYSA-N 2-(chrysen-6-ylmethylamino)-3-methoxy-2-methylpropan-1-ol Chemical compound C1=CC=C2C(CNC(C)(CO)COC)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 LUTCLKFAAWZDJL-UHFFFAOYSA-N 0.000 claims description 2
- CIQMBZLADJZUNL-UHFFFAOYSA-N 2-[(10-butoxyanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(OCCCC)=C(C=CC=C3)C3=C(CNC(C)(CO)CO)C2=C1 CIQMBZLADJZUNL-UHFFFAOYSA-N 0.000 claims description 2
- WCBQYMDRFKNYHN-UHFFFAOYSA-N 2-[(10-imidazol-1-ylanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C12=CC=CC=C2C(CNC(CO)(CO)C)=C2C=CC=CC2=C1N1C=CN=C1 WCBQYMDRFKNYHN-UHFFFAOYSA-N 0.000 claims description 2
- NHOYESBPDHDFTQ-UHFFFAOYSA-N 2-[(2-chloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=C(Cl)C=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=CC2=C1 NHOYESBPDHDFTQ-UHFFFAOYSA-N 0.000 claims description 2
- CXAMVLZXHNOZHR-UHFFFAOYSA-N 2-[[10-(2-chloroethyl)anthracen-9-yl]methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(CCCl)C2=C1 CXAMVLZXHNOZHR-UHFFFAOYSA-N 0.000 claims description 2
- SJFSASLYGFJMEJ-UHFFFAOYSA-N 2-[[10-(2-hydroxyethylsulfanyl)anthracen-9-yl]methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(SCCO)C2=C1 SJFSASLYGFJMEJ-UHFFFAOYSA-N 0.000 claims description 2
- OKJBWGMSPYNWLX-UHFFFAOYSA-N 2-[[10-(2-methoxyethoxy)anthracen-9-yl]methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(OCCOC)=C(C=CC=C3)C3=C(CNC(C)(CO)CO)C2=C1 OKJBWGMSPYNWLX-UHFFFAOYSA-N 0.000 claims description 2
- NSJOXPNDFVVZNF-UHFFFAOYSA-N 2-[[4-chloro-10-(2-hydroxyethoxy)anthracen-9-yl]methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(OCCO)C2=C1Cl NSJOXPNDFVVZNF-UHFFFAOYSA-N 0.000 claims description 2
- CGTCDEXNGPGCSQ-UHFFFAOYSA-N 4-[(10-chloroanthracen-1-yl)methylamino]-3-methylpentane-1,4-diol Chemical compound C1=CC=C2C=C3C(CNC(C)(O)C(CCO)C)=CC=CC3=C(Cl)C2=C1 CGTCDEXNGPGCSQ-UHFFFAOYSA-N 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- BFHVTPAGPNUYHR-UHFFFAOYSA-N 2-(anthracen-9-ylmethylamino)-3-methoxy-2-methylpropan-1-ol Chemical compound C1=CC=C2C(CNC(C)(CO)COC)=C(C=CC=C3)C3=CC2=C1 BFHVTPAGPNUYHR-UHFFFAOYSA-N 0.000 claims 1
- BEWDRWJKVVOIKZ-UHFFFAOYSA-N 2-(chrysen-6-ylmethylamino)-2-(ethoxymethyl)propane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)COCC)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 BEWDRWJKVVOIKZ-UHFFFAOYSA-N 0.000 claims 1
- RHVZHNWDLMQNSM-UHFFFAOYSA-N 2-(chrysen-6-ylmethylamino)-2-ethylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)CC)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 RHVZHNWDLMQNSM-UHFFFAOYSA-N 0.000 claims 1
- RXLAXYFAPBVQSC-UHFFFAOYSA-N 2-(chrysen-6-ylmethylamino)propane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)CO)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 RXLAXYFAPBVQSC-UHFFFAOYSA-N 0.000 claims 1
- QQVNUINMUAWQAS-UHFFFAOYSA-N 2-(ethoxymethyl)-2-(fluoranthen-3-ylmethylamino)propane-1,3-diol Chemical compound C12=CC=CC=C2C2=CC=CC3=C2C1=CC=C3CNC(CO)(CO)COCC QQVNUINMUAWQAS-UHFFFAOYSA-N 0.000 claims 1
- DWIFYUSSMATSQZ-UHFFFAOYSA-N 2-(fluoranthen-3-ylmethylamino)-2-(hydroxymethyl)propane-1,3-diol Chemical compound C12=CC=CC=C2C2=CC=CC3=C2C1=CC=C3CNC(CO)(CO)CO DWIFYUSSMATSQZ-UHFFFAOYSA-N 0.000 claims 1
- KEPXKGQTXLLFCA-UHFFFAOYSA-N 2-(fluoranthen-3-ylmethylamino)-2-methylbutane-1,4-diol Chemical compound C12=CC=CC=C2C2=CC=CC3=C2C1=CC=C3CNC(CO)(CCO)C KEPXKGQTXLLFCA-UHFFFAOYSA-N 0.000 claims 1
- JPJOFZWJNRPGBC-UHFFFAOYSA-N 2-(fluoranthen-3-ylmethylamino)-2-propan-2-ylpropane-1,3-diol Chemical compound C12=CC=CC=C2C2=CC=CC3=C2C1=CC=C3CNC(CO)(CO)C(C)C JPJOFZWJNRPGBC-UHFFFAOYSA-N 0.000 claims 1
- MLJNLTKZDVMQQC-UHFFFAOYSA-N 2-(fluoranthen-7-ylmethylamino)-2-methylpropane-1,3-diol Chemical compound C1=CC(C=2C=CC=C(C=22)CNC(CO)(CO)C)=C3C2=CC=CC3=C1 MLJNLTKZDVMQQC-UHFFFAOYSA-N 0.000 claims 1
- YRPIHRJWPZDYRJ-UHFFFAOYSA-N 2-[(10-bromoanthracen-1-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C=C3C(CNC(CO)(CO)C)=CC=CC3=C(Br)C2=C1 YRPIHRJWPZDYRJ-UHFFFAOYSA-N 0.000 claims 1
- GXVOYRCRFDCVSK-UHFFFAOYSA-N 2-[(10-butylanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CCCC)=C(C=CC=C3)C3=C(CNC(C)(CO)CO)C2=C1 GXVOYRCRFDCVSK-UHFFFAOYSA-N 0.000 claims 1
- CQPRMQYQXZOEQR-UHFFFAOYSA-N 2-[(10-chloroanthracen-1-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C=C3C(CNC(CO)(CO)C)=CC=CC3=C(Cl)C2=C1 CQPRMQYQXZOEQR-UHFFFAOYSA-N 0.000 claims 1
- OIACUDJDHKEPBT-UHFFFAOYSA-N 2-[(10-chloroanthracen-9-yl)methylamino]-2-(hydroxymethyl)propane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)CO)=C(C=CC=C3)C3=C(Cl)C2=C1 OIACUDJDHKEPBT-UHFFFAOYSA-N 0.000 claims 1
- FJELJMMDWGUYBQ-UHFFFAOYSA-N 2-[(10-chloroanthracen-9-yl)methylamino]-2-ethylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)CC)=C(C=CC=C3)C3=C(Cl)C2=C1 FJELJMMDWGUYBQ-UHFFFAOYSA-N 0.000 claims 1
- BRSCLDCWSJQDBL-UHFFFAOYSA-N 2-[(10-ethoxyanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(OCC)=C(C=CC=C3)C3=C(CNC(C)(CO)CO)C2=C1 BRSCLDCWSJQDBL-UHFFFAOYSA-N 0.000 claims 1
- UMULQAMTVAVTNV-UHFFFAOYSA-N 2-[(10-ethylsulfanylanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(SCC)=C(C=CC=C3)C3=C(CNC(C)(CO)CO)C2=C1 UMULQAMTVAVTNV-UHFFFAOYSA-N 0.000 claims 1
- SURDAPZTZUEGAK-UHFFFAOYSA-N 2-[(10-methoxyanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(OC)=C(C=CC=C3)C3=C(CNC(C)(CO)CO)C2=C1 SURDAPZTZUEGAK-UHFFFAOYSA-N 0.000 claims 1
- PSXJZJNULYLFKI-UHFFFAOYSA-N 2-[(12-chlorochrysen-6-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=CC3=C(C=CC=C4)C4=C(Cl)C=C3C2=C1 PSXJZJNULYLFKI-UHFFFAOYSA-N 0.000 claims 1
- XLWOXTIRSXDJAN-UHFFFAOYSA-N 2-[(12-ethoxychrysen-6-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(OCC)=CC3=C(C=CC=C4)C4=C(CNC(C)(CO)CO)C=C3C2=C1 XLWOXTIRSXDJAN-UHFFFAOYSA-N 0.000 claims 1
- ZPLNHPLFEZUABU-UHFFFAOYSA-N 2-[(12-ethylchrysen-6-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CC)=CC3=C(C=CC=C4)C4=C(CNC(C)(CO)CO)C=C3C2=C1 ZPLNHPLFEZUABU-UHFFFAOYSA-N 0.000 claims 1
- YEPNBWHDORAILR-UHFFFAOYSA-N 2-[(2,10-dichloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=C(Cl)C=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(Cl)C2=C1 YEPNBWHDORAILR-UHFFFAOYSA-N 0.000 claims 1
- XHFUJQYVAWTRMZ-UHFFFAOYSA-N 2-[(2-ethylanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=CC2=C(CNC(C)(CO)CO)C3=CC(CC)=CC=C3C=C21 XHFUJQYVAWTRMZ-UHFFFAOYSA-N 0.000 claims 1
- XHROJVNSSRZGGM-UHFFFAOYSA-N 2-[(2-tert-butyl-10-chloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=CC2=C(CNC(C)(CO)CO)C3=CC(C(C)(C)C)=CC=C3C(Cl)=C21 XHROJVNSSRZGGM-UHFFFAOYSA-N 0.000 claims 1
- GMODCAAYPNUSCX-UHFFFAOYSA-N 2-[(3,10-dichloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound ClC1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(Cl)C2=C1 GMODCAAYPNUSCX-UHFFFAOYSA-N 0.000 claims 1
- VPMDNFLLPRMGQT-UHFFFAOYSA-N 2-[(3-chloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound ClC1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=CC2=C1 VPMDNFLLPRMGQT-UHFFFAOYSA-N 0.000 claims 1
- JHNVCROHVHJQAR-UHFFFAOYSA-N 2-[(3-ethylanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=CC2=CC3=CC(CC)=CC=C3C(CNC(C)(CO)CO)=C21 JHNVCROHVHJQAR-UHFFFAOYSA-N 0.000 claims 1
- ZUPVHOQXYSUXEU-UHFFFAOYSA-N 2-[(3-fluoroanthracen-1-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C=C3C(CNC(CO)(CO)C)=CC(F)=CC3=CC2=C1 ZUPVHOQXYSUXEU-UHFFFAOYSA-N 0.000 claims 1
- KZKARGOFKJKKOE-UHFFFAOYSA-N 2-[(4,10-dichloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(Cl)C2=C1Cl KZKARGOFKJKKOE-UHFFFAOYSA-N 0.000 claims 1
- MONFNQXOIYGSIS-UHFFFAOYSA-N 2-[(4,5-dichloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3Cl)C3=CC2=C1Cl MONFNQXOIYGSIS-UHFFFAOYSA-N 0.000 claims 1
- ZPNAVMQQUZZOEK-UHFFFAOYSA-N 2-[(4-chloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=CC2=C1Cl ZPNAVMQQUZZOEK-UHFFFAOYSA-N 0.000 claims 1
- NXLBUKRIMCDLFX-UHFFFAOYSA-N 2-[[10-(hydroxymethyl)anthracen-9-yl]methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(CO)C2=C1 NXLBUKRIMCDLFX-UHFFFAOYSA-N 0.000 claims 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 claims 1
- XPOCRPKQQDATAQ-UHFFFAOYSA-N 2-ethyl-2-(fluoranthen-3-ylmethylamino)propane-1,3-diol Chemical compound C12=CC=CC=C2C2=CC=CC3=C2C1=CC=C3CNC(CO)(CO)CC XPOCRPKQQDATAQ-UHFFFAOYSA-N 0.000 claims 1
- JKWATNMPEICJJM-UHFFFAOYSA-N 2-methyl-2-(triphenylen-2-ylmethylamino)propane-1,3-diol Chemical compound C1=CC=C2C3=CC(CNC(CO)(CO)C)=CC=C3C3=CC=CC=C3C2=C1 JKWATNMPEICJJM-UHFFFAOYSA-N 0.000 claims 1
- UUYKNNBVKOYBLJ-UHFFFAOYSA-N 2-methyl-2-[(10-methylsulfonylanthracen-9-yl)methylamino]propane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(S(C)(=O)=O)C2=C1 UUYKNNBVKOYBLJ-UHFFFAOYSA-N 0.000 claims 1
- RBGHCWQNPRSNGW-UHFFFAOYSA-N 2-methyl-2-[(10-morpholin-4-ylanthracen-9-yl)methylamino]propane-1,3-diol Chemical compound C12=CC=CC=C2C(CNC(CO)(CO)C)=C2C=CC=CC2=C1N1CCOCC1 RBGHCWQNPRSNGW-UHFFFAOYSA-N 0.000 claims 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 claims 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 claims 1
- 229940124531 pharmaceutical excipient Drugs 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical class CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 abstract description 200
- 230000000694 effects Effects 0.000 abstract description 17
- 230000000259 anti-tumor effect Effects 0.000 abstract description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract description 5
- 239000003814 drug Substances 0.000 abstract description 4
- 150000002170 ethers Chemical class 0.000 abstract description 3
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 abstract 3
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 abstract 2
- 125000005843 halogen group Chemical group 0.000 abstract 2
- 125000002837 carbocyclic group Chemical group 0.000 abstract 1
- 125000005842 heteroatom Chemical group 0.000 abstract 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 217
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 126
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 123
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 116
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 111
- 239000000243 solution Substances 0.000 description 102
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 98
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 85
- 239000002904 solvent Substances 0.000 description 78
- 239000007787 solid Substances 0.000 description 75
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 66
- 229910052757 nitrogen Inorganic materials 0.000 description 58
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 52
- 239000011541 reaction mixture Substances 0.000 description 52
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 46
- 229910052799 carbon Inorganic materials 0.000 description 46
- 239000000741 silica gel Substances 0.000 description 45
- 229910002027 silica gel Inorganic materials 0.000 description 45
- 239000000047 product Substances 0.000 description 40
- 238000001914 filtration Methods 0.000 description 32
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 30
- 239000000706 filtrate Substances 0.000 description 30
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- 206010028980 Neoplasm Diseases 0.000 description 24
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 23
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- 238000004458 analytical method Methods 0.000 description 20
- 238000000746 purification Methods 0.000 description 19
- 230000009467 reduction Effects 0.000 description 19
- 238000006722 reduction reaction Methods 0.000 description 19
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 18
- 230000005764 inhibitory process Effects 0.000 description 18
- 239000003921 oil Substances 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 15
- 239000003480 eluent Substances 0.000 description 15
- 239000002244 precipitate Substances 0.000 description 15
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 15
- 241001465754 Metazoa Species 0.000 description 14
- 239000000463 material Substances 0.000 description 14
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 14
- 238000002390 rotary evaporation Methods 0.000 description 14
- 239000011521 glass Substances 0.000 description 13
- 239000012279 sodium borohydride Substances 0.000 description 13
- 229910000033 sodium borohydride Inorganic materials 0.000 description 13
- 238000003756 stirring Methods 0.000 description 13
- 229910052717 sulfur Inorganic materials 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 12
- 238000003556 assay Methods 0.000 description 12
- 238000001816 cooling Methods 0.000 description 12
- 239000012043 crude product Substances 0.000 description 12
- 239000000126 substance Substances 0.000 description 12
- 239000000725 suspension Substances 0.000 description 12
- 238000012360 testing method Methods 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 11
- 239000004480 active ingredient Substances 0.000 description 10
- 150000001299 aldehydes Chemical class 0.000 description 10
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 10
- 238000010438 heat treatment Methods 0.000 description 10
- 239000007788 liquid Substances 0.000 description 10
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 10
- 239000006188 syrup Substances 0.000 description 10
- 235000020357 syrup Nutrition 0.000 description 10
- SHYBXXMECBHHFH-UHFFFAOYSA-N 10-chloroanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(Cl)=C(C=CC=C3)C3=C(C=O)C2=C1 SHYBXXMECBHHFH-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- UHZNZGCBAFHDMZ-UHFFFAOYSA-N chrysene-6-carbaldehyde Chemical compound C1=CC=C2C(C=O)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 UHZNZGCBAFHDMZ-UHFFFAOYSA-N 0.000 description 9
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 9
- 150000002466 imines Chemical class 0.000 description 9
- 238000010992 reflux Methods 0.000 description 9
- UXFQFBNBSPQBJW-UHFFFAOYSA-N 2-amino-2-methylpropane-1,3-diol Chemical compound OCC(N)(C)CO UXFQFBNBSPQBJW-UHFFFAOYSA-N 0.000 description 8
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 8
- 241000699666 Mus <mouse, genus> Species 0.000 description 8
- 239000003153 chemical reaction reagent Substances 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 238000001035 drying Methods 0.000 description 8
- 229940098779 methanesulfonic acid Drugs 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- 239000012362 glacial acetic acid Substances 0.000 description 7
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- 238000006268 reductive amination reaction Methods 0.000 description 7
- 230000002829 reductive effect Effects 0.000 description 7
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 7
- 210000004881 tumor cell Anatomy 0.000 description 7
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- 229920002261 Corn starch Polymers 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 6
- 210000004027 cell Anatomy 0.000 description 6
- 239000003638 chemical reducing agent Substances 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 239000008120 corn starch Substances 0.000 description 6
- 229940099112 cornstarch Drugs 0.000 description 6
- 239000012458 free base Substances 0.000 description 6
- 239000008187 granular material Substances 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 6
- CCFAKBRKTKVJPO-UHFFFAOYSA-N 1-anthroic acid Chemical compound C1=CC=C2C=C3C(C(=O)O)=CC=CC3=CC2=C1 CCFAKBRKTKVJPO-UHFFFAOYSA-N 0.000 description 5
- 241000124008 Mammalia Species 0.000 description 5
- 241000699670 Mus sp. Species 0.000 description 5
- 239000012267 brine Substances 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 238000000921 elemental analysis Methods 0.000 description 5
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 5
- PVZBGCMQMBTMSR-UHFFFAOYSA-N fluoranthene-3-carbaldehyde Chemical compound C12=CC=CC=C2C2=CC=CC3=C2C1=CC=C3C=O PVZBGCMQMBTMSR-UHFFFAOYSA-N 0.000 description 5
- 238000004128 high performance liquid chromatography Methods 0.000 description 5
- 239000012280 lithium aluminium hydride Substances 0.000 description 5
- 235000019359 magnesium stearate Nutrition 0.000 description 5
- 239000002609 medium Substances 0.000 description 5
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 5
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 5
- 238000002953 preparative HPLC Methods 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- 239000012265 solid product Substances 0.000 description 5
- 230000004083 survival effect Effects 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- GSEDVPCKYAIRDW-UHFFFAOYSA-N 10-imidazol-1-ylanthracene-9-carbaldehyde Chemical compound C12=CC=CC=C2C(C=O)=C2C=CC=CC2=C1N1C=CN=C1 GSEDVPCKYAIRDW-UHFFFAOYSA-N 0.000 description 4
- HNQCQEGJQSCZMU-UHFFFAOYSA-N 3-(chloromethyl)fluoranthene Chemical compound C12=CC=CC=C2C2=CC=CC3=C2C1=CC=C3CCl HNQCQEGJQSCZMU-UHFFFAOYSA-N 0.000 description 4
- 244000182691 Echinochloa frumentacea Species 0.000 description 4
- 235000008247 Echinochloa frumentacea Nutrition 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 4
- 208000028018 Lymphocytic leukaemia Diseases 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 4
- 241001126259 Nippostrongylus brasiliensis Species 0.000 description 4
- 206010039491 Sarcoma Diseases 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 230000029936 alkylation Effects 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- WDECIBYCCFPHNR-UHFFFAOYSA-N chrysene Chemical compound C1=CC=CC2=CC=C3C4=CC=CC=C4C=CC3=C21 WDECIBYCCFPHNR-UHFFFAOYSA-N 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- GVEPBJHOBDJJJI-UHFFFAOYSA-N fluoranthene Chemical compound C1=CC(C2=CC=CC=C22)=C3C2=CC=CC3=C1 GVEPBJHOBDJJJI-UHFFFAOYSA-N 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 208000003747 lymphoid leukemia Diseases 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 125000005575 polycyclic aromatic hydrocarbon group Chemical group 0.000 description 4
- 239000011148 porous material Substances 0.000 description 4
- 239000003755 preservative agent Substances 0.000 description 4
- 238000011160 research Methods 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 3
- YHYBYHMUFTWZRR-UHFFFAOYSA-N 10-(2-hydroxyethoxy)anthracene-9-carbaldehyde Chemical compound C1=CC=C2C(OCCO)=C(C=CC=C3)C3=C(C=O)C2=C1 YHYBYHMUFTWZRR-UHFFFAOYSA-N 0.000 description 3
- GPWNWKWQOLEVEQ-UHFFFAOYSA-N 2,4-diaminopyrimidine-5-carbaldehyde Chemical compound NC1=NC=C(C=O)C(N)=N1 GPWNWKWQOLEVEQ-UHFFFAOYSA-N 0.000 description 3
- FXKASOSOVAVXTA-UHFFFAOYSA-N 2-(2-iodoethoxy)oxane Chemical compound ICCOC1CCCCO1 FXKASOSOVAVXTA-UHFFFAOYSA-N 0.000 description 3
- UMWGLDQKHSVSOX-UHFFFAOYSA-N 2-(benzylamino)-2-methylbutane-1,4-diol Chemical compound OCCC(CO)(C)NCC1=CC=CC=C1 UMWGLDQKHSVSOX-UHFFFAOYSA-N 0.000 description 3
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 3
- ZXAGXLDEMUNQSH-UHFFFAOYSA-N 2-ethylanthracene Chemical compound C1=CC=CC2=CC3=CC(CC)=CC=C3C=C21 ZXAGXLDEMUNQSH-UHFFFAOYSA-N 0.000 description 3
- WXXMKLFCLAUKPH-UHFFFAOYSA-N 3,10-dichloroanthracene-9-carbaldehyde Chemical compound C1=CC=CC2=C(Cl)C3=CC(Cl)=CC=C3C(C=O)=C21 WXXMKLFCLAUKPH-UHFFFAOYSA-N 0.000 description 3
- VFXDNQYXLCNZGA-UHFFFAOYSA-N 3-methyl-3-nitropentane-2,4-diol Chemical compound CC(O)C(C)(C(C)O)[N+]([O-])=O VFXDNQYXLCNZGA-UHFFFAOYSA-N 0.000 description 3
- RSHAKWUMVHQORJ-UHFFFAOYSA-N 3-nitropentane-2,4-diol Chemical compound CC(O)C(C(C)O)[N+]([O-])=O RSHAKWUMVHQORJ-UHFFFAOYSA-N 0.000 description 3
- SAGGALJEKVRKJT-UHFFFAOYSA-N 4,10-dichloroanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(Cl)=C3C(Cl)=CC=CC3=C(C=O)C2=C1 SAGGALJEKVRKJT-UHFFFAOYSA-N 0.000 description 3
- DDMHWNHZNBNNAN-UHFFFAOYSA-N 4-chloroanthracene-9-carbaldehyde Chemical compound C1=CC=C2C=C3C(Cl)=CC=CC3=C(C=O)C2=C1 DDMHWNHZNBNNAN-UHFFFAOYSA-N 0.000 description 3
- KREJIEGRPQSQAG-UHFFFAOYSA-N 4-ethylfluoranthene-3-carbaldehyde Chemical compound C12=CC=CC=C2C2=CC=C(C=O)C3=C2C1=CC=C3CC KREJIEGRPQSQAG-UHFFFAOYSA-N 0.000 description 3
- ZFKMDRNOZXVYEW-UHFFFAOYSA-N 6-(chloromethyl)chrysene Chemical compound C1=CC=C2C(CCl)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 ZFKMDRNOZXVYEW-UHFFFAOYSA-N 0.000 description 3
- POPBYCBXVLHSKO-UHFFFAOYSA-N 9,10-dioxoanthracene-1-carboxylic acid Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2C(=O)O POPBYCBXVLHSKO-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- HCMBHNXWAJENEK-UHFFFAOYSA-N CC(CO)(CO)N=CC1=C2C=CC=C3C2=C(C=C1)C4=CC=CC=C43 Chemical compound CC(CO)(CO)N=CC1=C2C=CC=C3C2=C(C=C1)C4=CC=CC=C43 HCMBHNXWAJENEK-UHFFFAOYSA-N 0.000 description 3
- HZNYNLMDQJEXJG-UHFFFAOYSA-N CC(CO)(CO)N=CC1=CC2=C(C=CC3=CC=CC=C32)C4=CC=CC=C41 Chemical compound CC(CO)(CO)N=CC1=CC2=C(C=CC3=CC=CC=C32)C4=CC=CC=C41 HZNYNLMDQJEXJG-UHFFFAOYSA-N 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- 241000223932 Eimeria tenella Species 0.000 description 3
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 3
- 208000009889 Herpes Simplex Diseases 0.000 description 3
- 241000282414 Homo sapiens Species 0.000 description 3
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 235000021355 Stearic acid Nutrition 0.000 description 3
- 241000193996 Streptococcus pyogenes Species 0.000 description 3
- 229930006000 Sucrose Natural products 0.000 description 3
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- MXEVUFSATVKQQG-UHFFFAOYSA-N [2-(chrysen-6-ylmethylamino)-3-hydroxy-2-methylpropyl] methanesulfonate Chemical compound C1=CC=C2C(CNC(CO)(COS(C)(=O)=O)C)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 MXEVUFSATVKQQG-UHFFFAOYSA-N 0.000 description 3
- 239000000908 ammonium hydroxide Substances 0.000 description 3
- XCCCHWWMLSAIOH-UHFFFAOYSA-N anthracen-1-ylmethanol Chemical compound C1=CC=C2C=C3C(CO)=CC=CC3=CC2=C1 XCCCHWWMLSAIOH-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 201000011510 cancer Diseases 0.000 description 3
- 229940095731 candida albicans Drugs 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- NEUQBSQDWWQGCF-UHFFFAOYSA-N chrysen-6-ylmethanol Chemical compound C1=CC=C2C(CO)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 NEUQBSQDWWQGCF-UHFFFAOYSA-N 0.000 description 3
- CJXWVJPKDWMXEG-UHFFFAOYSA-N chrysene-6-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 CJXWVJPKDWMXEG-UHFFFAOYSA-N 0.000 description 3
- 230000034994 death Effects 0.000 description 3
- 231100000517 death Toxicity 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- LYZBDHZAIXLWRM-JTQLQIEISA-N ethyl (2s)-2-(benzylideneamino)propanoate Chemical compound CCOC(=O)[C@H](C)N=CC1=CC=CC=C1 LYZBDHZAIXLWRM-JTQLQIEISA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 238000011835 investigation Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 3
- 239000002480 mineral oil Substances 0.000 description 3
- 235000010446 mineral oil Nutrition 0.000 description 3
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 3
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 3
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 3
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 3
- 201000002528 pancreatic cancer Diseases 0.000 description 3
- 239000002504 physiological saline solution Substances 0.000 description 3
- 229910003446 platinum oxide Inorganic materials 0.000 description 3
- 230000002335 preservative effect Effects 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- 239000008117 stearic acid Substances 0.000 description 3
- 239000005720 sucrose Substances 0.000 description 3
- 238000005303 weighing Methods 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- LGZWQUKBPLPMLI-UHFFFAOYSA-N (10-bromoanthracen-1-yl)methanol Chemical compound C1=CC=C2C=C3C(CO)=CC=CC3=C(Br)C2=C1 LGZWQUKBPLPMLI-UHFFFAOYSA-N 0.000 description 2
- NCYGRBUUKZQQSE-UHFFFAOYSA-N (10-chloroanthracen-1-yl)methanol Chemical compound C1=CC=C2C=C3C(CO)=CC=CC3=C(Cl)C2=C1 NCYGRBUUKZQQSE-UHFFFAOYSA-N 0.000 description 2
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- BOCJQSFSGAZAPQ-UHFFFAOYSA-N 1-chloroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2Cl BOCJQSFSGAZAPQ-UHFFFAOYSA-N 0.000 description 2
- QGJMBESZSDSIPI-UHFFFAOYSA-N 10-(2-chloroethyl)anthracene-9-carbaldehyde Chemical compound C1=CC=C2C(CCCl)=C(C=CC=C3)C3=C(C=O)C2=C1 QGJMBESZSDSIPI-UHFFFAOYSA-N 0.000 description 2
- BUQBVPIMMILONF-UHFFFAOYSA-N 10-(2-hydroxyethylsulfanyl)anthracene-9-carbaldehyde Chemical compound C1=CC=C2C(SCCO)=C(C=CC=C3)C3=C(C=O)C2=C1 BUQBVPIMMILONF-UHFFFAOYSA-N 0.000 description 2
- LEDNEHJWUBEXMD-UHFFFAOYSA-N 10-chloroanthracene-1-carbaldehyde Chemical compound C1=CC=C2C(Cl)=C(C=CC=C3)C3=CC2=C1C=O LEDNEHJWUBEXMD-UHFFFAOYSA-N 0.000 description 2
- YGNCGOICLFEGFB-UHFFFAOYSA-N 10-chloroanthracene-1-carboxylic acid Chemical compound C1=CC=C2C=C3C(C(=O)O)=CC=CC3=C(Cl)C2=C1 YGNCGOICLFEGFB-UHFFFAOYSA-N 0.000 description 2
- UBBCCUWEPZLHFQ-UHFFFAOYSA-N 10-ethoxyanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(OCC)=C(C=CC=C3)C3=C(C=O)C2=C1 UBBCCUWEPZLHFQ-UHFFFAOYSA-N 0.000 description 2
- MPCPUZXOKSGSPD-UHFFFAOYSA-N 10-ethylsulfanylanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(SCC)=C(C=CC=C3)C3=C(C=O)C2=C1 MPCPUZXOKSGSPD-UHFFFAOYSA-N 0.000 description 2
- WQPWBUMSUOZDCQ-UHFFFAOYSA-N 10-formylanthracene-9-carbonitrile Chemical compound C1=CC=C2C(C=O)=C(C=CC=C3)C3=C(C#N)C2=C1 WQPWBUMSUOZDCQ-UHFFFAOYSA-N 0.000 description 2
- YIEZXZOBPXOWKF-UHFFFAOYSA-N 10-methoxyanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(OC)=C(C=CC=C3)C3=C(C=O)C2=C1 YIEZXZOBPXOWKF-UHFFFAOYSA-N 0.000 description 2
- SIEYYGAWDCFHPO-UHFFFAOYSA-N 10-methylsulfanylanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(SC)=C(C=CC=C3)C3=C(C=O)C2=C1 SIEYYGAWDCFHPO-UHFFFAOYSA-N 0.000 description 2
- BYSQINLNQYQXJM-UHFFFAOYSA-N 10-methylsulfonylanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(S(=O)(=O)C)=C(C=CC=C3)C3=C(C=O)C2=C1 BYSQINLNQYQXJM-UHFFFAOYSA-N 0.000 description 2
- HKRIWQVLFFKJLR-UHFFFAOYSA-N 10-morpholin-4-ylanthracene-9-carbaldehyde Chemical compound C12=CC=CC=C2C(C=O)=C2C=CC=CC2=C1N1CCOCC1 HKRIWQVLFFKJLR-UHFFFAOYSA-N 0.000 description 2
- OJXDBKGZBVWOLY-UHFFFAOYSA-N 12-chlorochrysene-6-carbaldehyde Chemical compound C1=CC=C2C(Cl)=CC3=C(C=CC=C4)C4=C(C=O)C=C3C2=C1 OJXDBKGZBVWOLY-UHFFFAOYSA-N 0.000 description 2
- MXSTTZLDRATHFI-UHFFFAOYSA-N 2,10-dichloroanthracene-9-carbaldehyde Chemical compound C1=CC=CC2=C(C=O)C3=CC(Cl)=CC=C3C(Cl)=C21 MXSTTZLDRATHFI-UHFFFAOYSA-N 0.000 description 2
- CAPYJCTXFFWILC-UHFFFAOYSA-N 2-(chrysen-6-ylmethylamino)-2-methylpropane-1,3-diol;2-hydroxypropane-1,2,3-tricarboxylic acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O.C1=CC=C2C(CNC(CO)(CO)C)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 CAPYJCTXFFWILC-UHFFFAOYSA-N 0.000 description 2
- YGEGBGIKIMBDDO-UHFFFAOYSA-N 2-(chrysen-6-ylmethylamino)-2-methylpropane-1,3-diol;hydrochloride Chemical compound Cl.C1=CC=C2C(CNC(CO)(CO)C)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 YGEGBGIKIMBDDO-UHFFFAOYSA-N 0.000 description 2
- YTHQUBIKIOUZBQ-UHFFFAOYSA-N 2-(fluoranthen-3-ylmethylamino)-2-methylpropane-1,3-diol Chemical compound C12=CC=CC=C2C2=CC=CC3=C2C1=CC=C3CNC(CO)(CO)C YTHQUBIKIOUZBQ-UHFFFAOYSA-N 0.000 description 2
- FILRFJPITVZGRT-UHFFFAOYSA-N 2-[[10-(2-hydroxyethoxy)anthracen-9-yl]methylamino]-2-methylpropane-1,3-diol;hydrochloride Chemical compound Cl.C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(OCCO)C2=C1 FILRFJPITVZGRT-UHFFFAOYSA-N 0.000 description 2
- FPKCTSIVDAWGFA-UHFFFAOYSA-N 2-chloroanthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=CC(Cl)=CC=C3C(=O)C2=C1 FPKCTSIVDAWGFA-UHFFFAOYSA-N 0.000 description 2
- VHNJYJXDQKORPF-UHFFFAOYSA-N 2-chloroanthracene-9-carbaldehyde Chemical compound C1=CC=CC2=C(C=O)C3=CC(Cl)=CC=C3C=C21 VHNJYJXDQKORPF-UHFFFAOYSA-N 0.000 description 2
- QSECPQCFCWVBKM-UHFFFAOYSA-N 2-iodoethanol Chemical compound OCCI QSECPQCFCWVBKM-UHFFFAOYSA-N 0.000 description 2
- UREFUUVULNQGAM-UHFFFAOYSA-N 2-nitro-2-propan-2-ylpropane-1,3-diol Chemical compound CC(C)C(CO)(CO)[N+]([O-])=O UREFUUVULNQGAM-UHFFFAOYSA-N 0.000 description 2
- MGLNSOJNFQPFHK-UHFFFAOYSA-N 3,5-dihydro-1h-[1,3]oxazolo[3,4-c][1,3]oxazole Chemical compound O1CN2COCC2=C1 MGLNSOJNFQPFHK-UHFFFAOYSA-N 0.000 description 2
- YMGMUMVXYIDTGO-UHFFFAOYSA-N 3-chloroanthracene-9-carbaldehyde Chemical compound C1=CC=CC2=CC3=CC(Cl)=CC=C3C(C=O)=C21 YMGMUMVXYIDTGO-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- VOUURISRTXKVGG-UHFFFAOYSA-N 3-ethylanthracene-9-carbaldehyde Chemical compound C1=CC=CC2=CC3=CC(CC)=CC=C3C(C=O)=C21 VOUURISRTXKVGG-UHFFFAOYSA-N 0.000 description 2
- JXUOLJXLPIIRTP-UHFFFAOYSA-N 3-ethylfluoranthene Chemical compound C12=CC=CC=C2C2=CC=CC3=C2C1=CC=C3CC JXUOLJXLPIIRTP-UHFFFAOYSA-N 0.000 description 2
- DEWWXAQHKMIDNZ-UHFFFAOYSA-N 4-chloro-10-(2-hydroxyethoxy)anthracene-9-carbaldehyde Chemical compound C1=CC(Cl)=C2C(OCCO)=C(C=CC=C3)C3=C(C=O)C2=C1 DEWWXAQHKMIDNZ-UHFFFAOYSA-N 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- IAVCTKRTXLATPU-UHFFFAOYSA-N C1=CC=CC=2C3=CC(=C4C=CC=CC4=C3C=CC1=2)C(=O)Cl Chemical compound C1=CC=CC=2C3=CC(=C4C=CC=CC4=C3C=CC1=2)C(=O)Cl IAVCTKRTXLATPU-UHFFFAOYSA-N 0.000 description 2
- RPJJZMMPXPARTC-UHFFFAOYSA-N CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCCOC3=C4C=CC=CC4=C(C5=CC=CC=C53)C=O Chemical compound CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCCOC3=C4C=CC=CC4=C(C5=CC=CC=C53)C=O RPJJZMMPXPARTC-UHFFFAOYSA-N 0.000 description 2
- YCHFNNUVGJUAES-UHFFFAOYSA-N CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCCOC3=C4C=CC=CC4=C(C5=CC=CC=C53)CCl Chemical compound CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCCOC3=C4C=CC=CC4=C(C5=CC=CC=C53)CCl YCHFNNUVGJUAES-UHFFFAOYSA-N 0.000 description 2
- AZOWYIZFKMCYIO-UHFFFAOYSA-N CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCCOC3=C4C=CC=CC4=C(C5=CC=CC=C53)CO Chemical compound CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCCOC3=C4C=CC=CC4=C(C5=CC=CC=C53)CO AZOWYIZFKMCYIO-UHFFFAOYSA-N 0.000 description 2
- 241000222122 Candida albicans Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 241000206672 Gelidium Species 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 241000204031 Mycoplasma Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 2
- 241000224527 Trichomonas vaginalis Species 0.000 description 2
- 241000700605 Viruses Species 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- RJURFGZVJUQBHK-UHFFFAOYSA-N actinomycin D Natural products CC1OC(=O)C(C(C)C)N(C)C(=O)CN(C)C(=O)C2CCCN2C(=O)C(C(C)C)NC(=O)C1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)NC4C(=O)NC(C(N5CCCC5C(=O)N(C)CC(=O)N(C)C(C(C)C)C(=O)OC4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-UHFFFAOYSA-N 0.000 description 2
- 235000010419 agar Nutrition 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- XJDFBLQCLSBCGQ-UHFFFAOYSA-N anthracene-1-carbaldehyde Chemical compound C1=CC=C2C=C3C(C=O)=CC=CC3=CC2=C1 XJDFBLQCLSBCGQ-UHFFFAOYSA-N 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 244000309464 bull Species 0.000 description 2
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 2
- 239000000920 calcium hydroxide Substances 0.000 description 2
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 2
- 150000001722 carbon compounds Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000002512 chemotherapy Methods 0.000 description 2
- 229960004106 citric acid Drugs 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- PDXRQENMIVHKPI-UHFFFAOYSA-N cyclohexane-1,1-diol Chemical group OC1(O)CCCCC1 PDXRQENMIVHKPI-UHFFFAOYSA-N 0.000 description 2
- 239000011928 denatured alcohol Substances 0.000 description 2
- 239000008121 dextrose Substances 0.000 description 2
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 2
- GRTGGSXWHGKRSB-UHFFFAOYSA-N dichloromethyl methyl ether Chemical compound COC(Cl)Cl GRTGGSXWHGKRSB-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 2
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 2
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- VEBZMHDHLUNFCN-UHFFFAOYSA-N fluoranthen-3-ylmethanol Chemical compound C12=CC=CC=C2C2=CC=CC3=C2C1=CC=C3CO VEBZMHDHLUNFCN-UHFFFAOYSA-N 0.000 description 2
- 230000022244 formylation Effects 0.000 description 2
- 238000006170 formylation reaction Methods 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- RBBOWEDMXHTEPA-UHFFFAOYSA-N hexane;toluene Chemical compound CCCCCC.CC1=CC=CC=C1 RBBOWEDMXHTEPA-UHFFFAOYSA-N 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 201000005202 lung cancer Diseases 0.000 description 2
- 208000020816 lung neoplasm Diseases 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 244000052769 pathogen Species 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 125000003367 polycyclic group Chemical group 0.000 description 2
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 2
- 229920000053 polysorbate 80 Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- SUVIGLJNEAMWEG-UHFFFAOYSA-N propane-1-thiol Chemical compound CCCS SUVIGLJNEAMWEG-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000008213 purified water Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 229940079832 sodium starch glycolate Drugs 0.000 description 2
- 229920003109 sodium starch glycolate Polymers 0.000 description 2
- 239000008109 sodium starch glycolate Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YEKUWOWHPVKTCQ-UHFFFAOYSA-M tetraethylazanium;fluoride;hydrate Chemical compound O.[F-].CC[N+](CC)(CC)CC YEKUWOWHPVKTCQ-UHFFFAOYSA-M 0.000 description 2
- 150000003573 thiols Chemical class 0.000 description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- CKCZKCYXNIUSKF-UHFFFAOYSA-N (3-methyl-1-oxa-4-azaspiro[4.5]decan-3-yl)methanol Chemical compound N1C(C)(CO)COC11CCCCC1 CKCZKCYXNIUSKF-UHFFFAOYSA-N 0.000 description 1
- RHUHWUPHSJGTMK-UHFFFAOYSA-N 1,10-dichloroanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(C=O)=C3C(Cl)=CC=CC3=C(Cl)C2=C1 RHUHWUPHSJGTMK-UHFFFAOYSA-N 0.000 description 1
- MAOWXLISNQNMLK-UHFFFAOYSA-N 1,2-dibromoanthracene Chemical compound C1=CC=CC2=CC3=C(Br)C(Br)=CC=C3C=C21 MAOWXLISNQNMLK-UHFFFAOYSA-N 0.000 description 1
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical compound C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 1
- YGIUYXOOOGQGIS-UHFFFAOYSA-N 1,8-dichloroanthracene Chemical compound C1=CC(Cl)=C2C=C3C(Cl)=CC=CC3=CC2=C1 YGIUYXOOOGQGIS-UHFFFAOYSA-N 0.000 description 1
- WLXGQMVCYPUOLM-UHFFFAOYSA-N 1-hydroxyethanesulfonic acid Chemical compound CC(O)S(O)(=O)=O WLXGQMVCYPUOLM-UHFFFAOYSA-N 0.000 description 1
- KZNJSFHJUQDYHE-UHFFFAOYSA-N 1-methylanthracene Chemical compound C1=CC=C2C=C3C(C)=CC=CC3=CC2=C1 KZNJSFHJUQDYHE-UHFFFAOYSA-N 0.000 description 1
- ZNXWKFVCEHHAES-UHFFFAOYSA-N 10-(2-methoxyethoxy)anthracene-1-carbaldehyde Chemical compound C1=CC=C2C(OCCOC)=C(C=CC=C3)C3=CC2=C1C=O ZNXWKFVCEHHAES-UHFFFAOYSA-N 0.000 description 1
- QGPBHHUPMLKZHR-UHFFFAOYSA-N 10-(2-methoxyethoxy)anthracene-9-carbaldehyde Chemical compound C1=CC=C2C(OCCOC)=C(C=CC=C3)C3=C(C=O)C2=C1 QGPBHHUPMLKZHR-UHFFFAOYSA-N 0.000 description 1
- SGILCUWMMCJIFM-UHFFFAOYSA-N 10-bromoanthracene-1-carbaldehyde Chemical compound C1=CC=C2C(Br)=C(C=CC=C3)C3=CC2=C1C=O SGILCUWMMCJIFM-UHFFFAOYSA-N 0.000 description 1
- SKQMFIOVXMVNGO-UHFFFAOYSA-N 10-bromoanthracene-1-carboxylic acid Chemical compound C1=CC=C2C=C3C(C(=O)O)=CC=CC3=C(Br)C2=C1 SKQMFIOVXMVNGO-UHFFFAOYSA-N 0.000 description 1
- YPRQOJZRPXMBMQ-UHFFFAOYSA-N 10-bromoanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(Br)=C(C=CC=C3)C3=C(C=O)C2=C1 YPRQOJZRPXMBMQ-UHFFFAOYSA-N 0.000 description 1
- AFTPZMZVMBEKII-UHFFFAOYSA-N 10-methylsulfinylanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(S(=O)C)=C(C=CC=C3)C3=C(C=O)C2=C1 AFTPZMZVMBEKII-UHFFFAOYSA-N 0.000 description 1
- OTJPFEOGCOPJFC-UHFFFAOYSA-N 12-ethoxychrysene-6-carbaldehyde Chemical compound C1=CC=C2C(OCC)=CC3=C(C=CC=C4)C4=C(C=O)C=C3C2=C1 OTJPFEOGCOPJFC-UHFFFAOYSA-N 0.000 description 1
- QXTZNVIKIVFOFZ-UHFFFAOYSA-N 12-ethylchrysene-6-carbaldehyde Chemical compound C1=CC=C2C(CC)=CC3=C(C=CC=C4)C4=C(C=O)C=C3C2=C1 QXTZNVIKIVFOFZ-UHFFFAOYSA-N 0.000 description 1
- VFTFKUDGYRBSAL-UHFFFAOYSA-N 15-crown-5 Chemical compound C1COCCOCCOCCOCCO1 VFTFKUDGYRBSAL-UHFFFAOYSA-N 0.000 description 1
- FFVXOUFXDCYDCV-UHFFFAOYSA-N 2-(anthracen-2-ylmethylamino)-2-methylpropane-1,3-diol Chemical compound C1=CC=CC2=CC3=CC(CNC(CO)(CO)C)=CC=C3C=C21 FFVXOUFXDCYDCV-UHFFFAOYSA-N 0.000 description 1
- KKZVNNFFJBMXGC-UHFFFAOYSA-N 2-(benzylamino)-2-methylpropane-1,3-diol Chemical compound OCC(C)(CO)NCC1=CC=CC=C1 KKZVNNFFJBMXGC-UHFFFAOYSA-N 0.000 description 1
- FTMGTRJRGPVIET-UHFFFAOYSA-N 2-(chrysen-6-ylmethylamino)-2-methylbutane-1,4-diol Chemical compound C1=CC=C2C(CNC(CO)(CCO)C)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 FTMGTRJRGPVIET-UHFFFAOYSA-N 0.000 description 1
- BZOHHLMTCXVRJE-UHFFFAOYSA-N 2-(hydroxymethyl)-1,3-dihydroinden-2-ol Chemical compound C1=CC=C2CC(CO)(O)CC2=C1 BZOHHLMTCXVRJE-UHFFFAOYSA-N 0.000 description 1
- NBGCGUCYBRJVPZ-UHFFFAOYSA-N 2-[(10-chloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(Cl)C2=C1 NBGCGUCYBRJVPZ-UHFFFAOYSA-N 0.000 description 1
- OSAIYSGZYRAWDH-UHFFFAOYSA-N 2-amino-2-(ethoxymethoxy)propane-1,3-diol hydrochloride Chemical compound Cl.NC(CO)(CO)OCOCC OSAIYSGZYRAWDH-UHFFFAOYSA-N 0.000 description 1
- XFYZAFKKSNSAGS-UHFFFAOYSA-N 2-amino-2-(ethoxymethyl)propane-1,3-diol;hydrochloride Chemical compound Cl.CCOCC(N)(CO)CO XFYZAFKKSNSAGS-UHFFFAOYSA-N 0.000 description 1
- OHCOQXRUHRFRNM-UHFFFAOYSA-N 2-amino-2-methylbutane-1,4-diol;hydrochloride Chemical compound Cl.OCC(N)(C)CCO OHCOQXRUHRFRNM-UHFFFAOYSA-N 0.000 description 1
- XMBFYOWTPIQTEV-UHFFFAOYSA-N 2-amino-3-methoxy-2-methylpropan-1-ol Chemical compound COCC(C)(N)CO XMBFYOWTPIQTEV-UHFFFAOYSA-N 0.000 description 1
- CXDOZVCBIJMGPS-UHFFFAOYSA-N 2-amino-4-methoxybutan-1-ol Chemical compound COCCC(N)CO CXDOZVCBIJMGPS-UHFFFAOYSA-N 0.000 description 1
- MUVQIIBPDFTEKM-UHFFFAOYSA-N 2-aminobutane-1,3-diol Chemical compound CC(O)C(N)CO MUVQIIBPDFTEKM-UHFFFAOYSA-N 0.000 description 1
- SJEBAWHUJDUKQK-UHFFFAOYSA-N 2-ethylanthraquinone Chemical compound C1=CC=C2C(=O)C3=CC(CC)=CC=C3C(=O)C2=C1 SJEBAWHUJDUKQK-UHFFFAOYSA-N 0.000 description 1
- XFXRMDNWSGXSNJ-UHFFFAOYSA-N 2-methyl-1-nitropropane Chemical compound CC(C)C[N+]([O-])=O XFXRMDNWSGXSNJ-UHFFFAOYSA-N 0.000 description 1
- SKKLYHCODMXQEG-UHFFFAOYSA-N 2-methyl-2-[(10-methylanthracen-9-yl)methylamino]propane-1,3-diol Chemical compound C1=CC=C2C(C)=C(C=CC=C3)C3=C(CNC(C)(CO)CO)C2=C1 SKKLYHCODMXQEG-UHFFFAOYSA-N 0.000 description 1
- XBAPQUQVMYMKTP-UHFFFAOYSA-N 2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol Chemical compound C1=CC=C2C(SC)=C(C=CC=C3)C3=C(CNC(C)(CO)CO)C2=C1 XBAPQUQVMYMKTP-UHFFFAOYSA-N 0.000 description 1
- KKGDYKNUIKAIRJ-UHFFFAOYSA-N 2-methyl-2-[(10-methylsulfinylanthracen-9-yl)methylamino]propane-1,3-diol Chemical compound C1=CC=C2C(S(=O)C)=C(C=CC=C3)C3=C(CNC(C)(CO)CO)C2=C1 KKGDYKNUIKAIRJ-UHFFFAOYSA-N 0.000 description 1
- PCNWBUOSTLGPMI-UHFFFAOYSA-N 2-nitro-1-propanol Chemical compound OCC(C)[N+]([O-])=O PCNWBUOSTLGPMI-UHFFFAOYSA-N 0.000 description 1
- KFSOKSKYVDCQOY-UHFFFAOYSA-N 3-amino-3-methylpentane-2,4-diol Chemical compound CC(O)C(C)(N)C(C)O KFSOKSKYVDCQOY-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- UOQHWNPVNXSDDO-UHFFFAOYSA-N 3-bromoimidazo[1,2-a]pyridine-6-carbonitrile Chemical compound C1=CC(C#N)=CN2C(Br)=CN=C21 UOQHWNPVNXSDDO-UHFFFAOYSA-N 0.000 description 1
- AKJQJQGSCWRXPH-UHFFFAOYSA-N 3-ethylfluoranthene-2-carbaldehyde Chemical compound C12=CC=CC=C2C2=CC=CC3=C2C1=CC(C=O)=C3CC AKJQJQGSCWRXPH-UHFFFAOYSA-N 0.000 description 1
- AHCOSHUPTJVUDA-UHFFFAOYSA-N 3-ethylfluoranthene-7-carbaldehyde Chemical compound C12=CC=CC(C=O)=C2C2=CC=CC3=C2C1=CC=C3CC AHCOSHUPTJVUDA-UHFFFAOYSA-N 0.000 description 1
- IVZCQAJPSSUTNW-UHFFFAOYSA-N 3-ethylfluoranthene-8-carbaldehyde Chemical compound C12=CC=C(C=O)C=C2C2=CC=CC3=C2C1=CC=C3CC IVZCQAJPSSUTNW-UHFFFAOYSA-N 0.000 description 1
- OJVOGABFNZDOOZ-UHFFFAOYSA-N 3-nitrobutan-2-ol Chemical compound CC(O)C(C)[N+]([O-])=O OJVOGABFNZDOOZ-UHFFFAOYSA-N 0.000 description 1
- XENSVBQRWCELNY-UHFFFAOYSA-N 4,5-dichloroanthracene-9-carbaldehyde Chemical compound C1=CC(Cl)=C2C=C3C(Cl)=CC=CC3=C(C=O)C2=C1 XENSVBQRWCELNY-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- FBUPBJQUGLBFFY-UHFFFAOYSA-N 4-ethylfluoranthene-7-carbaldehyde Chemical compound C1=CC=C(C=O)C2=C1C1=CC=CC3=C1C2=CC=C3CC FBUPBJQUGLBFFY-UHFFFAOYSA-N 0.000 description 1
- MMKZTXUXSPHNRG-UHFFFAOYSA-N 4-ethylfluoranthene-8-carbaldehyde Chemical compound C12=CC(C=O)=CC=C2C2=CC=CC3=C2C1=CC=C3CC MMKZTXUXSPHNRG-UHFFFAOYSA-N 0.000 description 1
- GJGNPVCZUZPVRR-UHFFFAOYSA-N 4-hydroxypentan-2-yl methanesulfonate Chemical compound CC(O)CC(C)OS(C)(=O)=O GJGNPVCZUZPVRR-UHFFFAOYSA-N 0.000 description 1
- YGRBDDWMMUTWEI-UHFFFAOYSA-N 6-ethoxychrysene Chemical compound C1=CC=C2C(OCC)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 YGRBDDWMMUTWEI-UHFFFAOYSA-N 0.000 description 1
- ZJSYTTGSPQNXKT-UHFFFAOYSA-N 6-ethylchrysene Chemical compound C1=CC=C2C(CC)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 ZJSYTTGSPQNXKT-UHFFFAOYSA-N 0.000 description 1
- HUKPVYBUJRAUAG-UHFFFAOYSA-N 7-benzo[a]phenalenone Chemical compound C1=CC(C(=O)C=2C3=CC=CC=2)=C2C3=CC=CC2=C1 HUKPVYBUJRAUAG-UHFFFAOYSA-N 0.000 description 1
- OGOYZCQQQFAGRI-UHFFFAOYSA-N 9-ethenylanthracene Chemical compound C1=CC=C2C(C=C)=C(C=CC=C3)C3=CC2=C1 OGOYZCQQQFAGRI-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 208000008720 Bone Marrow Neoplasms Diseases 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- FRPHFZCDPYBUAU-UHFFFAOYSA-N Bromocresolgreen Chemical compound CC1=C(Br)C(O)=C(Br)C=C1C1(C=2C(=C(Br)C(O)=C(Br)C=2)C)C2=CC=CC=C2S(=O)(=O)O1 FRPHFZCDPYBUAU-UHFFFAOYSA-N 0.000 description 1
- AWZHOBJFTSXRDH-UHFFFAOYSA-N CC(CO)(CO)N=CC1=C2C=CC=CC2=C(C3=CC=CC=C31)OCCO Chemical compound CC(CO)(CO)N=CC1=C2C=CC=CC2=C(C3=CC=CC=C31)OCCO AWZHOBJFTSXRDH-UHFFFAOYSA-N 0.000 description 1
- LEQLSOPWFNZCBX-UHFFFAOYSA-N CCC1=C(C(O)=O)C2=CC3=CC=CC=C3C(Cl)=C2C=C1 Chemical compound CCC1=C(C(O)=O)C2=CC3=CC=CC=C3C(Cl)=C2C=C1 LEQLSOPWFNZCBX-UHFFFAOYSA-N 0.000 description 1
- 101100256732 Caenorhabditis elegans set-9 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 201000009030 Carcinoma Diseases 0.000 description 1
- GHOKWGTUZJEAQD-UHFFFAOYSA-N Chick antidermatitis factor Natural products OCC(C)(C)C(O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical group [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 206010009944 Colon cancer Diseases 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 1
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 108010092160 Dactinomycin Proteins 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 238000007107 Gatterman reaction Methods 0.000 description 1
- 238000005643 Gatterman-Koch carbonylation reaction Methods 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 241000250507 Gigaspora candida Species 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 206010022998 Irritability Diseases 0.000 description 1
- 229910000799 K alloy Inorganic materials 0.000 description 1
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 241001529936 Murinae Species 0.000 description 1
- FUSGACRLAFQQRL-UHFFFAOYSA-N N-Ethyl-N-nitrosourea Chemical compound CCN(N=O)C(N)=O FUSGACRLAFQQRL-UHFFFAOYSA-N 0.000 description 1
- 229910000528 Na alloy Inorganic materials 0.000 description 1
- 101001068640 Nicotiana tabacum Basic form of pathogenesis-related protein 1 Proteins 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 229910019213 POCl3 Inorganic materials 0.000 description 1
- 241000255969 Pieris brassicae Species 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 238000000297 Sandmeyer reaction Methods 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 208000005718 Stomach Neoplasms Diseases 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- SLGBZMMZGDRARJ-UHFFFAOYSA-N Triphenylene Natural products C1=CC=C2C3=CC=CC=C3C3=CC=CC=C3C2=C1 SLGBZMMZGDRARJ-UHFFFAOYSA-N 0.000 description 1
- 238000005874 Vilsmeier-Haack formylation reaction Methods 0.000 description 1
- ZBCLERGRDBWQBB-UHFFFAOYSA-N [2-(chrysen-6-ylmethylamino)-3-hydroxy-2-methylpropyl] 2-hydroxypropanoate Chemical compound C1=CC=C2C(CNC(C)(CO)COC(=O)C(O)C)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 ZBCLERGRDBWQBB-UHFFFAOYSA-N 0.000 description 1
- NVBAWZJWKSEHPJ-UHFFFAOYSA-N [2-amino-2-(hydroxymethyl)-3-methylbutyl] acetate Chemical compound CC(C)C(N)(CO)COC(C)=O NVBAWZJWKSEHPJ-UHFFFAOYSA-N 0.000 description 1
- AHRBRGONCCUGQY-UHFFFAOYSA-N [3-acetyloxy-2-(chrysen-6-ylmethylamino)-2-methylpropyl] acetate Chemical compound C1=CC=C2C(CNC(C)(COC(C)=O)COC(=O)C)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 AHRBRGONCCUGQY-UHFFFAOYSA-N 0.000 description 1
- 230000003187 abdominal effect Effects 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- RJURFGZVJUQBHK-IIXSONLDSA-N actinomycin D Chemical compound C[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)CN(C)C(=O)[C@@H]2CCCN2C(=O)[C@@H](C(C)C)NC(=O)[C@H]1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)N[C@@H]4C(=O)N[C@@H](C(N5CCC[C@H]5C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-IIXSONLDSA-N 0.000 description 1
- 238000002814 agar dilution Methods 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 230000000507 anthelmentic effect Effects 0.000 description 1
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 1
- YMNKUHIVVMFOFO-UHFFFAOYSA-N anthracene-9-carbaldehyde Chemical compound C1=CC=C2C(C=O)=C(C=CC=C3)C3=CC2=C1 YMNKUHIVVMFOFO-UHFFFAOYSA-N 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 230000002725 anti-mycoplasma Effects 0.000 description 1
- 230000000118 anti-neoplastic effect Effects 0.000 description 1
- 230000000842 anti-protozoal effect Effects 0.000 description 1
- 230000000840 anti-viral effect Effects 0.000 description 1
- 229940034982 antineoplastic agent Drugs 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000003139 biocide Substances 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 201000006491 bone marrow cancer Diseases 0.000 description 1
- MOOAHMCRPCTRLV-UHFFFAOYSA-N boron sodium Chemical compound [B].[Na] MOOAHMCRPCTRLV-UHFFFAOYSA-N 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000004663 cell proliferation Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 125000002676 chrysenyl group Chemical group C1(=CC=CC=2C3=CC=C4C=CC=CC4=C3C=CC12)* 0.000 description 1
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 1
- 229960004316 cisplatin Drugs 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 208000029742 colonic neoplasm Diseases 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 210000002808 connective tissue Anatomy 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 238000010219 correlation analysis Methods 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 229960004397 cyclophosphamide Drugs 0.000 description 1
- 229960000640 dactinomycin Drugs 0.000 description 1
- DIOQZVSQGTUSAI-NJFSPNSNSA-N decane Chemical compound CCCCCCCCC[14CH3] DIOQZVSQGTUSAI-NJFSPNSNSA-N 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- KXGVEGMKQFWNSR-LLQZFEROSA-N deoxycholic acid Chemical compound C([C@H]1CC2)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC(O)=O)C)[C@@]2(C)[C@@H](O)C1 KXGVEGMKQFWNSR-LLQZFEROSA-N 0.000 description 1
- 238000011033 desalting Methods 0.000 description 1
- 230000001066 destructive effect Effects 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- 239000002027 dichloromethane extract Substances 0.000 description 1
- YNHIGQDRGKUECZ-UHFFFAOYSA-N dichloropalladium;triphenylphosphanium Chemical compound Cl[Pd]Cl.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229960004679 doxorubicin Drugs 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000012156 elution solvent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical class CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- BDWFYHUDXIDTIU-UHFFFAOYSA-N ethanol;propane-1,2,3-triol Chemical compound CCO.OCC(O)CO BDWFYHUDXIDTIU-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- KIHQOLIIPBOGFG-UHFFFAOYSA-N ethyl 10-chloroanthracene-1-carboxylate Chemical compound C1=CC=C2C=C3C(C(=O)OCC)=CC=CC3=C(Cl)C2=C1 KIHQOLIIPBOGFG-UHFFFAOYSA-N 0.000 description 1
- SNIDNGPTLWWCLF-UHFFFAOYSA-N ethyl 2-ethoxybutanoate Chemical compound CCOC(CC)C(=O)OCC SNIDNGPTLWWCLF-UHFFFAOYSA-N 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- XRQRQDCKWNKQNL-UHFFFAOYSA-N fluoranthene-7-carbaldehyde Chemical compound C1=CC(C=2C(C=O)=CC=CC=22)=C3C2=CC=CC3=C1 XRQRQDCKWNKQNL-UHFFFAOYSA-N 0.000 description 1
- KSMRJNBUEKDYGN-UHFFFAOYSA-N fluoranthene-8-carbaldehyde Chemical compound C1=CC(C2=CC=C(C=C22)C=O)=C3C2=CC=CC3=C1 KSMRJNBUEKDYGN-UHFFFAOYSA-N 0.000 description 1
- 125000003914 fluoranthenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC=C4C1=C23)* 0.000 description 1
- 229960002949 fluorouracil Drugs 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 229940013688 formic acid Drugs 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 206010017758 gastric cancer Diseases 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 150000003903 lactic acid esters Chemical class 0.000 description 1
- 229940099563 lactobionic acid Drugs 0.000 description 1
- 201000004959 laryngeal benign neoplasm Diseases 0.000 description 1
- 206010023841 laryngeal neoplasm Diseases 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 1
- 201000006512 mast cell neoplasm Diseases 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 230000000684 melanotic effect Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 229960000485 methotrexate Drugs 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000007932 molded tablet Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- DIOQZVSQGTUSAI-UHFFFAOYSA-N n-butylhexane Natural products CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- YMVWGSQGCWCDGW-UHFFFAOYSA-N nitracrine Chemical compound C1=CC([N+]([O-])=O)=C2C(NCCCN(C)C)=C(C=CC=C3)C3=NC2=C1 YMVWGSQGCWCDGW-UHFFFAOYSA-N 0.000 description 1
- 229950008607 nitracrine Drugs 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007523 nucleic acids Chemical class 0.000 description 1
- 108020004707 nucleic acids Proteins 0.000 description 1
- 102000039446 nucleic acids Human genes 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- CELWCAITJAEQNL-UHFFFAOYSA-N oxan-2-ol Chemical compound OC1CCCCO1 CELWCAITJAEQNL-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 208000008443 pancreatic carcinoma Diseases 0.000 description 1
- 229940055726 pantothenic acid Drugs 0.000 description 1
- 239000011713 pantothenic acid Substances 0.000 description 1
- 235000019161 pantothenic acid Nutrition 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- 238000002962 plaque-reduction assay Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- RVYNIIJBIAINNT-UHFFFAOYSA-N propane-1,3-diol;hydrochloride Chemical compound Cl.OCCCO RVYNIIJBIAINNT-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000008137 solubility enhancer Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 201000011549 stomach cancer Diseases 0.000 description 1
- 150000003458 sulfonic acid derivatives Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- MHYGQXWCZAYSLJ-UHFFFAOYSA-N tert-butyl-chloro-diphenylsilane Chemical compound C=1C=CC=CC=1[Si](Cl)(C(C)(C)C)C1=CC=CC=C1 MHYGQXWCZAYSLJ-UHFFFAOYSA-N 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 210000000115 thoracic cavity Anatomy 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 125000005580 triphenylene group Chemical group 0.000 description 1
- 125000003960 triphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C3=CC=CC=C3C12)* 0.000 description 1
- 230000004565 tumor cell growth Effects 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/02—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C215/04—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated
- C07C215/20—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated the carbon skeleton being saturated and containing rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/045—Hydroxy compounds, e.g. alcohols; Salts thereof, e.g. alcoholates
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/13—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups
- C07C205/14—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups having nitro groups and hydroxy groups bound to acyclic carbon atoms
- C07C205/15—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups having nitro groups and hydroxy groups bound to acyclic carbon atoms of a saturated carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/02—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C215/04—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated
- C07C215/06—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic
- C07C215/10—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic with one amino group and at least two hydroxy groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/02—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C215/22—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being unsaturated
- C07C215/28—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/42—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having amino groups or hydroxy groups bound to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/48—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being unsaturated and containing rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/54—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
- C07C217/56—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains not further substituted by singly-bound oxygen atoms
- C07C217/58—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains not further substituted by singly-bound oxygen atoms with amino groups and the six-membered aromatic ring, or the condensed ring system containing that ring, bound to the same carbon atom of the carbon chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C255/58—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing cyano groups and singly-bound nitrogen atoms, not being further bound to other hetero atoms, bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/32—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/31—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
- C07C323/32—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton having at least one of the nitrogen atoms bound to an acyclic carbon atom of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/62—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems having two or more ring systems containing condensed 1,3-oxazole rings
- C07D263/64—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems having two or more ring systems containing condensed 1,3-oxazole rings linked in positions 2 and 2' by chains containing six-membered aromatic rings or ring systems containing such rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/135—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/04—1,3-Dioxanes; Hydrogenated 1,3-dioxanes
- C07D319/06—1,3-Dioxanes; Hydrogenated 1,3-dioxanes not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07J—STEROIDS
- C07J63/00—Steroids in which the cyclopenta(a)hydrophenanthrene skeleton has been modified by expansion of only one ring by one or two atoms
- C07J63/008—Expansion of ring D by one atom, e.g. D homo steroids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/22—Ortho- or ortho- and peri-condensed systems containing three rings containing only six-membered rings
- C07C2603/24—Anthracenes; Hydrogenated anthracenes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/22—Ortho- or ortho- and peri-condensed systems containing three rings containing only six-membered rings
- C07C2603/26—Phenanthrenes; Hydrogenated phenanthrenes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/40—Ortho- or ortho- and peri-condensed systems containing four condensed rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/40—Ortho- or ortho- and peri-condensed systems containing four condensed rings
- C07C2603/42—Ortho- or ortho- and peri-condensed systems containing four condensed rings containing only six-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/40—Ortho- or ortho- and peri-condensed systems containing four condensed rings
- C07C2603/42—Ortho- or ortho- and peri-condensed systems containing four condensed rings containing only six-membered rings
- C07C2603/48—Chrysenes; Hydrogenated chrysenes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/40—Ortho- or ortho- and peri-condensed systems containing four condensed rings
- C07C2603/42—Ortho- or ortho- and peri-condensed systems containing four condensed rings containing only six-membered rings
- C07C2603/50—Pyrenes; Hydrogenated pyrenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Epidemiology (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Catalysts (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838313571A GB8313571D0 (en) | 1983-05-17 | 1983-05-17 | Chemical compounds |
| APAP/P/1984/000003A AP1A (en) | 1983-05-17 | 1984-07-16 | Polycyclic aromatic compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT34149A HUT34149A (en) | 1985-02-28 |
| HU197875B true HU197875B (en) | 1989-06-28 |
Family
ID=39791481
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU841886A HU197875B (en) | 1983-05-17 | 1984-05-16 | Process for producing polycyclic aromatic amino-alcanol derivatives and pharmaceutical compositions containing themas active components |
Country Status (30)
| Country | Link |
|---|---|
| US (6) | US4530800A (index.php) |
| EP (2) | EP0125701B1 (index.php) |
| JP (3) | JPS59225149A (index.php) |
| KR (1) | KR910000854B1 (index.php) |
| AP (1) | AP1A (index.php) |
| AU (2) | AU572509B2 (index.php) |
| CA (1) | CA1222750A (index.php) |
| CS (1) | CS273314B2 (index.php) |
| CY (1) | CY1486A (index.php) |
| DD (1) | DD223439A5 (index.php) |
| DE (2) | DE3473141D1 (index.php) |
| DK (1) | DK242284A (index.php) |
| EG (1) | EG17595A (index.php) |
| ES (3) | ES532512A0 (index.php) |
| FI (1) | FI85263C (index.php) |
| GB (2) | GB8313571D0 (index.php) |
| GR (1) | GR82278B (index.php) |
| HK (1) | HK45089A (index.php) |
| HU (1) | HU197875B (index.php) |
| IE (1) | IE58416B1 (index.php) |
| IL (1) | IL71851A (index.php) |
| MC (1) | MC1595A1 (index.php) |
| NO (1) | NO157416C (index.php) |
| NZ (1) | NZ208168A (index.php) |
| PH (1) | PH22265A (index.php) |
| PL (3) | PL144294B1 (index.php) |
| PT (1) | PT78586A (index.php) |
| SG (1) | SG22389G (index.php) |
| SU (3) | SU1535377A3 (index.php) |
| ZA (1) | ZA843708B (index.php) |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4803221A (en) * | 1977-03-15 | 1989-02-07 | Burroughs Wellcome Co. | Anthracene derivatives |
| US4719048A (en) * | 1983-05-17 | 1988-01-12 | Burroughs Wellcome Co. | Crysene compound |
| GB8313571D0 (en) * | 1983-05-17 | 1983-06-22 | Wellcome Found | Chemical compounds |
| US4808625A (en) * | 1983-05-17 | 1989-02-28 | Burroughs Wellcome Co. | Phenanthrene derivatives |
| US4719046A (en) * | 1983-05-17 | 1988-01-12 | Burroughs Wellcome Co. | Crysene derivatives |
| US4719055A (en) * | 1983-05-17 | 1988-01-12 | Burroughs Wellcome Co. | Phenanthrene derivatives |
| US4803222A (en) * | 1983-05-17 | 1989-02-07 | Burroughs Wellcome Co. | Fluoranthene derivatives |
| US4829090A (en) * | 1983-05-17 | 1989-05-09 | Burroughs Wellcome Co. | Chrysene derivatives |
| US4810727A (en) * | 1983-05-17 | 1989-03-07 | Burroughs Wellcome Co. | Chrysene compound |
| US4803226A (en) * | 1983-05-17 | 1989-02-07 | Burroughs Wellcome Co. | Anthracene derivatives |
| US4808632A (en) * | 1983-05-17 | 1989-02-28 | Burroughs Wellcome Co. | Fluoranthene derivatives |
| US4717729A (en) * | 1983-05-31 | 1988-01-05 | Burroughs Wellcome Co. | Triphenylene derivatives |
| GB8428931D0 (en) * | 1984-11-15 | 1984-12-27 | Wellcome Found | Polycyclic biocidal compounds |
| ES8702905A1 (es) * | 1984-11-15 | 1987-01-16 | Wellcome Found | Un procedimiento para preparar derivados de alcanoles hete- ropoliciclicos |
| GB8428932D0 (en) * | 1984-11-15 | 1984-12-27 | Wellcome Found | Polycyclic biocidal compounds |
| GB8428930D0 (en) * | 1984-11-15 | 1984-12-27 | Wellcome Found | Polycyclic biocidal compounds |
| US4827034A (en) * | 1985-11-22 | 1989-05-02 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US4808753A (en) * | 1985-11-22 | 1989-02-28 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US4791233A (en) * | 1985-11-22 | 1988-12-13 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US4882358A (en) * | 1985-11-22 | 1989-11-21 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US4791232A (en) * | 1985-11-22 | 1988-12-13 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US4810823A (en) * | 1985-11-22 | 1989-03-07 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US4814502A (en) * | 1985-11-22 | 1989-03-21 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US5008286A (en) * | 1985-11-22 | 1991-04-16 | Burroughs Wellcome Co. | Certain substituted naphthofurans with anti-tumor properties |
| US4791231A (en) * | 1985-11-22 | 1988-12-13 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US4818443A (en) * | 1985-11-22 | 1989-04-04 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US5435667A (en) * | 1986-02-20 | 1995-07-25 | Slickbar Products Corp. | Protection of piles |
| JP2735609B2 (ja) * | 1989-03-31 | 1998-04-02 | 協和醗酵工業株式会社 | Ucn―1028d誘導体 |
| US5416244A (en) * | 1991-09-30 | 1995-05-16 | Ohmeda Pharmaceutical Products Division Inc. | Preparation of isoflurane |
| JPH06329679A (ja) * | 1993-01-20 | 1994-11-29 | Nissan Chem Ind Ltd | 光学活性β−アミノアルコキシボラン錯体 |
| EP1021397A4 (en) * | 1997-03-05 | 2000-10-04 | Trimeris Inc | BENZANTHRONE COMPOUNDS AND THEIR USE AGAINST VIRUSES |
| FR2775286B1 (fr) * | 1998-02-20 | 2001-09-07 | Centre Nat Rech Scient | Derives du triphenylene contre le sida |
| US6015811A (en) * | 1998-10-27 | 2000-01-18 | Board Of Regents, The University Of Texas System | Antitumor Chrysene derivatives |
| MXPA02006539A (es) * | 1999-12-30 | 2002-12-09 | Kimberly Clark Co | Tisu con locion antiviral y metodos para hacer y usar el mismo. |
| US6372785B1 (en) * | 2000-05-04 | 2002-04-16 | Keith Chan, President Globoasia, Llc | Synthesis of 1,8-dichloro-anthracene analogues and pharmaceutical compositions based thereon |
| US20050107430A1 (en) * | 2003-10-29 | 2005-05-19 | Banik Bimal K. | Antimicrobial and antiviral compounds |
| US7625497B2 (en) * | 2003-11-21 | 2009-12-01 | Board Of Regents Of The Nevada System Of Higher Education On Behalf Of The University Of Nevada, Reno | Materials and methods for the preparation of anisotropically-ordered solids |
| US20050233465A1 (en) * | 2004-04-14 | 2005-10-20 | Bioprocessors Corp. | Compositions of matter useful as pH indicators and related methods |
| TWI348463B (en) * | 2006-03-06 | 2011-09-11 | Lg Chemical Ltd | Novel anthracene derivative and organic electronic device using the same |
| RU2349311C1 (ru) * | 2007-08-02 | 2009-03-20 | Михаил Владимирович Кутушов | Применение дериватов нафталина в качестве средств для лечения онкологических заболеваний |
| US7635791B2 (en) * | 2008-04-17 | 2009-12-22 | Tpat Ip Llc | Biological buffers with wide buffering ranges |
| US7939659B2 (en) * | 2008-04-17 | 2011-05-10 | Thomas Daly | Biological buffers with wide buffering ranges |
| US8034951B2 (en) | 2008-04-17 | 2011-10-11 | Thomas Daly | Biological buffers with wide buffering ranges |
| US8334402B2 (en) * | 2008-04-17 | 2012-12-18 | Thomas Daly | Biological buffers with wide buffering ranges |
| US8822728B2 (en) | 2008-04-17 | 2014-09-02 | Thomas Daly | Biological buffers with wide buffering ranges |
| US9090638B2 (en) | 2008-04-17 | 2015-07-28 | Thomas Daly | Biological buffers with wide buffering ranges |
| US20170313920A1 (en) | 2010-10-06 | 2017-11-02 | Thomas P. Daly | Biological Buffers with Wide Buffering Ranges |
| US8519141B2 (en) | 2008-04-17 | 2013-08-27 | Thomas Daly | Biological buffers with wide buffering ranges |
| US9447310B2 (en) | 2008-04-17 | 2016-09-20 | Thomas P. Daly | Biological buffers with wide buffering ranges |
| US9475754B2 (en) | 2011-10-06 | 2016-10-25 | Thomas P. Daly | Biological buffers with wide buffering ranges |
| CN103086975A (zh) * | 2013-02-05 | 2013-05-08 | 广西师范大学 | 9-羟甲基-10-咪蒽腙及其合成方法和应用 |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2734920A (en) * | 1956-02-14 | New chemical compounds and their | ||
| CH135942A (de) * | 1927-02-02 | 1929-10-15 | Ig Farbenindustrie Ag | Verfahren zur Herstellung einer Aldehydverbindung. |
| US2194294A (en) * | 1938-07-16 | 1940-03-19 | Du Pont | Preparation of n-substituted alkylol amines |
| US2865925A (en) * | 1956-03-23 | 1958-12-23 | Sterling Drug Inc | Process for preparing n-(2-hydroxyethyl)-n-(lower-alkyl)-9-aminomethylanthracenes and intermediates therein |
| US3052722A (en) * | 1958-06-24 | 1962-09-04 | May & Baker Ltd | Aminophenoxyalkane derivatives |
| US3198794A (en) * | 1960-07-25 | 1965-08-03 | Sterling Drug Inc | Pyrenylmethyl quaternary ammonium salts |
| US3198835A (en) * | 1960-07-25 | 1965-08-03 | Sterling Drug Inc | Pyrenyl methyl tertiary amino amines |
| FR95908E (fr) * | 1963-11-09 | 1972-01-31 | Degussa | Procédé de préparation de nouvelles aminocétones et des alcools secondaires correspondants. |
| DE2123992C3 (de) * | 1971-05-14 | 1981-03-19 | Richardson-Merrell Inc., New York, N.Y. | 3,9-Bis-äther des Fluoranthens und deren Herstellung |
| US4034040A (en) * | 1971-05-24 | 1977-07-05 | Pfizer Inc. | Xylene-diamines as antiviral agents |
| US3882113A (en) * | 1972-12-21 | 1975-05-06 | Richardson Merrell Inc | Fluoranthene derivatives |
| US4197149A (en) * | 1975-11-05 | 1980-04-08 | Sigri Elektrographit Gmbh | Method for joining together shaped bodies of polytetrafluoroethylene |
| US4062958A (en) * | 1976-09-22 | 1977-12-13 | American Cyanamid Company | Method of treating anxiety and compositions therefor |
| US4197249A (en) * | 1977-08-15 | 1980-04-08 | American Cyanamid Company | 1,4-Bis(substituted-amino)-5,8-dihydroxyanthraquinones and leuco bases thereof |
| US4258181A (en) * | 1978-09-05 | 1981-03-24 | American Cyanamid Company | Substituted 9,10-anthracenebishydrazones |
| ATE3414T1 (de) * | 1979-02-02 | 1983-06-15 | Ciba-Geigy Ag | Neues rechts-drehendes, basisches derivat des 9,10-aethano-anthracens, verfahren zu dessen herstellung und dieses enthaltende pharmazeutische praeparate. |
| US4211726A (en) * | 1979-02-16 | 1980-07-08 | American Cyanamid Company | Synthesis of substituted 9,10-anthracene-dicarboxaldehydes and 9,10-dihydro-9,10-anthracenedicarboxaldehydes |
| JPS5999656A (ja) * | 1982-11-30 | 1984-06-08 | Toshiba Corp | 筒形空気電池 |
| US4511582A (en) * | 1983-06-01 | 1985-04-16 | Burroughs Wellcome Co. | Phenanthrene derivatives |
| GB8313571D0 (en) * | 1983-05-17 | 1983-06-22 | Wellcome Found | Chemical compounds |
| US4532344A (en) * | 1983-05-23 | 1985-07-30 | Burroughs Wellcome Co. | Fluoranthene derivatives |
| US4551282A (en) * | 1983-05-31 | 1985-11-05 | Burroughs Wellcome Co. | Triphenylene derivatives |
| US4997249A (en) * | 1990-02-26 | 1991-03-05 | The United States Of America As Represented By The Secretary Of The Navy | Variable weight fiber optic transversal filter |
-
1983
- 1983-05-17 GB GB838313571A patent/GB8313571D0/en active Pending
- 1983-06-01 US US06/499,813 patent/US4530800A/en not_active Expired - Lifetime
-
1984
- 1984-05-16 JP JP59099655A patent/JPS59225149A/ja active Pending
- 1984-05-16 EG EG315/84A patent/EG17595A/xx active
- 1984-05-16 JP JP59099656A patent/JPS59225150A/ja active Granted
- 1984-05-16 DD DD84263086A patent/DD223439A5/de not_active IP Right Cessation
- 1984-05-16 DE DE8484105584T patent/DE3473141D1/de not_active Expired
- 1984-05-16 GB GB08412485A patent/GB2140416B/en not_active Expired
- 1984-05-16 HU HU841886A patent/HU197875B/hu not_active IP Right Cessation
- 1984-05-16 DK DK242284A patent/DK242284A/da not_active Application Discontinuation
- 1984-05-16 CA CA000454514A patent/CA1222750A/en not_active Expired
- 1984-05-16 IE IE120384A patent/IE58416B1/en unknown
- 1984-05-16 PH PH30683A patent/PH22265A/en unknown
- 1984-05-16 GR GR74735A patent/GR82278B/el unknown
- 1984-05-16 NO NO841954A patent/NO157416C/no unknown
- 1984-05-16 MC MC841705A patent/MC1595A1/fr unknown
- 1984-05-16 CS CS364584A patent/CS273314B2/cs unknown
- 1984-05-16 IL IL71854A patent/IL71851A/xx not_active IP Right Cessation
- 1984-05-16 FI FI841966A patent/FI85263C/fi not_active IP Right Cessation
- 1984-05-16 PT PT78586A patent/PT78586A/pt not_active IP Right Cessation
- 1984-05-16 NZ NZ208168A patent/NZ208168A/en unknown
- 1984-05-16 SU SU843744951A patent/SU1535377A3/ru active
- 1984-05-16 EP EP84105584A patent/EP0125701B1/en not_active Expired
- 1984-05-16 ZA ZA843708A patent/ZA843708B/xx unknown
- 1984-05-16 KR KR1019840002647A patent/KR910000854B1/ko not_active Expired
- 1984-05-16 DE DE8484105585T patent/DE3465296D1/de not_active Expired
- 1984-05-16 AU AU28098/84A patent/AU572509B2/en not_active Ceased
- 1984-05-16 EP EP84105585A patent/EP0125702B1/en not_active Expired
- 1984-05-16 ES ES532512A patent/ES532512A0/es active Granted
- 1984-05-17 PL PL1984247759A patent/PL144294B1/pl unknown
- 1984-05-17 PL PL1984254245A patent/PL145421B1/pl unknown
- 1984-05-17 PL PL1984254244A patent/PL145420B1/pl unknown
- 1984-07-16 AP APAP/P/1984/000003A patent/AP1A/en active
- 1984-10-17 US US06/661,803 patent/US4719236A/en not_active Expired - Fee Related
- 1984-10-17 US US06/661,674 patent/US4720587A/en not_active Expired - Fee Related
- 1984-10-17 US US06/661,802 patent/US4719049A/en not_active Expired - Fee Related
-
1985
- 1985-02-06 ES ES540161A patent/ES540161A0/es active Granted
- 1985-02-06 ES ES540160A patent/ES8604487A1/es not_active Expired
- 1985-04-22 US US06/725,157 patent/US4719047A/en not_active Expired - Fee Related
- 1985-08-30 SU SU853947162A patent/SU1466648A3/ru active
- 1985-12-02 SU SU853982431A patent/SU1447277A3/ru active
-
1987
- 1987-09-28 US US07/102,275 patent/US4820873A/en not_active Expired - Fee Related
-
1988
- 1988-03-11 AU AU13052/88A patent/AU599215B2/en not_active Ceased
-
1989
- 1989-04-08 SG SG223/89A patent/SG22389G/en unknown
- 1989-06-01 HK HK450/89A patent/HK45089A/en not_active IP Right Cessation
- 1989-12-08 CY CY1486A patent/CY1486A/xx unknown
-
1990
- 1990-06-01 JP JP2144246A patent/JPH0684336B2/ja not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU197875B (en) | Process for producing polycyclic aromatic amino-alcanol derivatives and pharmaceutical compositions containing themas active components | |
| US6444706B2 (en) | Guanidine derivatives, processes for preparing them and their use as pharmaceutical compositions | |
| US4511582A (en) | Phenanthrene derivatives | |
| JP3908270B2 (ja) | アシルフルベン類似体およびその医薬組成物 | |
| US4551282A (en) | Triphenylene derivatives | |
| US4532344A (en) | Fluoranthene derivatives | |
| US4719046A (en) | Crysene derivatives | |
| US4719048A (en) | Crysene compound | |
| WO1991014688A1 (en) | Hetero polycyclic biocidal compounds and their use in medecine | |
| US4829090A (en) | Chrysene derivatives | |
| US4803226A (en) | Anthracene derivatives | |
| US5017600A (en) | Tricyclic derivatives | |
| US4717729A (en) | Triphenylene derivatives | |
| US4810727A (en) | Chrysene compound | |
| US5241107A (en) | Carbocyclic derivatives | |
| US4808632A (en) | Fluoranthene derivatives | |
| FR2683221A1 (fr) | Nouveaux derives de cinnolinones-4, leur preparation et leur application en therapeutique. | |
| US20040229931A1 (en) | 1-Aryl-3-(indol-5-yl) prop-2-en-1-ones, compositions containing them and use | |
| US4803222A (en) | Fluoranthene derivatives | |
| US5075455A (en) | Tricyclic derivatives | |
| JPH0157114B2 (index.php) | ||
| CS273348B2 (en) | Method of polycyclic aromatic alkanol derivatives preparation | |
| HU199105B (en) | Process for production of compositions with biocid effect and medical compositions containing them | |
| KR20020028391A (ko) | 항암활성을 가지는 아크리딘 유도체 | |
| AU5355290A (en) | Hetero polycyclic biocidal compounds and their use in medicine |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |