HU194810B - Process for producing new 2-/alkoxy-methylene/-3,3-dialkoxy-propanonitril derivatives - Google Patents
Process for producing new 2-/alkoxy-methylene/-3,3-dialkoxy-propanonitril derivatives Download PDFInfo
- Publication number
- HU194810B HU194810B HU854784A HU478485A HU194810B HU 194810 B HU194810 B HU 194810B HU 854784 A HU854784 A HU 854784A HU 478485 A HU478485 A HU 478485A HU 194810 B HU194810 B HU 194810B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- alcohol
- process according
- reaction
- compound
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 32
- 238000006243 chemical reaction Methods 0.000 claims abstract description 30
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 38
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 37
- 239000000203 mixture Substances 0.000 claims description 36
- 239000011541 reaction mixture Substances 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 17
- 229910052783 alkali metal Inorganic materials 0.000 claims description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 9
- 150000001340 alkali metals Chemical class 0.000 claims description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 6
- 229910052708 sodium Inorganic materials 0.000 claims description 6
- 239000011734 sodium Substances 0.000 claims description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 4
- 230000002829 reductive effect Effects 0.000 claims description 4
- 239000005977 Ethylene Substances 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 2
- 125000004849 alkoxymethyl group Chemical group 0.000 claims description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 229910052701 rubidium Inorganic materials 0.000 claims description 2
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 claims description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 claims 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical class CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 abstract description 21
- 150000001409 amidines Chemical class 0.000 abstract description 8
- 239000007858 starting material Substances 0.000 abstract description 8
- 238000004519 manufacturing process Methods 0.000 abstract description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- 235000019441 ethanol Nutrition 0.000 description 25
- -1 formic acid ester Chemical class 0.000 description 21
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- 238000003756 stirring Methods 0.000 description 18
- 238000009835 boiling Methods 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- 238000004821 distillation Methods 0.000 description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 239000003921 oil Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 150000003230 pyrimidines Chemical class 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- FLCFSWDRVQTDOK-UHFFFAOYSA-N 2-(dimethoxymethyl)-3-methoxyprop-2-enenitrile Chemical compound COC=C(C#N)C(OC)OC FLCFSWDRVQTDOK-UHFFFAOYSA-N 0.000 description 5
- WCJTULPFKRGBNH-UHFFFAOYSA-N 3-butoxy-2-(dibutoxymethyl)prop-2-enenitrile Chemical compound CCCCOC=C(C#N)C(OCCCC)OCCCC WCJTULPFKRGBNH-UHFFFAOYSA-N 0.000 description 5
- 238000004817 gas chromatography Methods 0.000 description 5
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- 238000005481 NMR spectroscopy Methods 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- WCQOBLXWLRDEQA-UHFFFAOYSA-N ethanimidamide;hydrochloride Chemical compound Cl.CC(N)=N WCQOBLXWLRDEQA-UHFFFAOYSA-N 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 238000006386 neutralization reaction Methods 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 238000004445 quantitative analysis Methods 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 3
- QODCADXMYFDAMD-UHFFFAOYSA-N 2-(dimethoxymethyl)-3,3-dimethoxypropanenitrile Chemical compound COC(OC)C(C#N)C(OC)OC QODCADXMYFDAMD-UHFFFAOYSA-N 0.000 description 3
- WPNRPBRVBAICQQ-UHFFFAOYSA-N 5-(dimethoxymethyl)-2-methylpyrimidin-4-amine Chemical compound COC(OC)C1=CN=C(C)N=C1N WPNRPBRVBAICQQ-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 3
- 238000004566 IR spectroscopy Methods 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000001110 calcium chloride Substances 0.000 description 3
- 229910001628 calcium chloride Inorganic materials 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000004949 mass spectrometry Methods 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- PDZKNPQAPGGAFJ-UHFFFAOYSA-N 4-aminopyrimidine-5-carbaldehyde Chemical compound NC1=NC=NC=C1C=O PDZKNPQAPGGAFJ-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- OQLZINXFSUDMHM-UHFFFAOYSA-N Acetamidine Chemical compound CC(N)=N OQLZINXFSUDMHM-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- CKFGINPQOCXMAZ-UHFFFAOYSA-N methanediol Chemical compound OCO CKFGINPQOCXMAZ-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- DRFJNEVYLFPWFD-UHFFFAOYSA-N 2-(diethoxymethyl)-3,3-diethoxypropanenitrile Chemical compound CCOC(OCC)C(C#N)C(OCC)OCC DRFJNEVYLFPWFD-UHFFFAOYSA-N 0.000 description 1
- BYEOUVGYGCYXLI-UHFFFAOYSA-N 2-(diethoxymethyl)-3-ethoxyprop-2-enenitrile Chemical compound CCOC=C(C#N)C(OCC)OCC BYEOUVGYGCYXLI-UHFFFAOYSA-N 0.000 description 1
- JVQUIFRKEPFYBR-UHFFFAOYSA-N 2-(dimethoxymethyl)-3-hydroxyprop-2-enenitrile Chemical compound COC(OC)C(=CO)C#N JVQUIFRKEPFYBR-UHFFFAOYSA-N 0.000 description 1
- IPCRTSDORDQHRO-UHFFFAOYSA-N 3-methoxyprop-2-enenitrile Chemical compound COC=CC#N IPCRTSDORDQHRO-UHFFFAOYSA-N 0.000 description 1
- XQSJHQXYQAUDFC-UHFFFAOYSA-N 4,6-dichloropyrimidine-5-carbaldehyde Chemical compound ClC1=NC=NC(Cl)=C1C=O XQSJHQXYQAUDFC-UHFFFAOYSA-N 0.000 description 1
- GOJNFUXEBVBARW-UHFFFAOYSA-N 4-amino-6-chloropyrimidine-5-carbaldehyde Chemical compound NC1=NC=NC(Cl)=C1C=O GOJNFUXEBVBARW-UHFFFAOYSA-N 0.000 description 1
- MKYITYRIURYLEQ-UHFFFAOYSA-N 5-(aminomethyl)pyrimidin-4-amine Chemical class NCC1=CN=CN=C1N MKYITYRIURYLEQ-UHFFFAOYSA-N 0.000 description 1
- HEPMEJCHTBWKIB-UHFFFAOYSA-N 5-(dibutoxymethyl)-2-methylpyrimidin-4-amine Chemical compound CCCCOC(OCCCC)C1=CN=C(C)N=C1N HEPMEJCHTBWKIB-UHFFFAOYSA-N 0.000 description 1
- XURCRGQBWOXHDS-UHFFFAOYSA-N 5-(diethoxymethyl)-2-methylpyrimidin-4-amine Chemical compound CCOC(OCC)C1=CN=C(C)N=C1N XURCRGQBWOXHDS-UHFFFAOYSA-N 0.000 description 1
- CBTMVNREUWQZLS-UHFFFAOYSA-N 5-(dimethoxymethyl)-2-phenylpyrimidin-4-amine Chemical compound N1=C(N)C(C(OC)OC)=CN=C1C1=CC=CC=C1 CBTMVNREUWQZLS-UHFFFAOYSA-N 0.000 description 1
- PARURSQSRZANMS-UHFFFAOYSA-N 5-(dimethoxymethyl)pyrimidin-4-amine Chemical compound COC(OC)C1=CN=CN=C1N PARURSQSRZANMS-UHFFFAOYSA-N 0.000 description 1
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 1
- XYFCKNRPDQWRFI-UHFFFAOYSA-N C(C)OC(C(C#N)=CO)OCC.[Na] Chemical compound C(C)OC(C(C#N)=CO)OCC.[Na] XYFCKNRPDQWRFI-UHFFFAOYSA-N 0.000 description 1
- YBCSVKQHGWCCQX-UHFFFAOYSA-N C(CCC)OC(C#N)C(OCCCC=C)OCCCC Chemical compound C(CCC)OC(C#N)C(OCCCC=C)OCCCC YBCSVKQHGWCCQX-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 229930003270 Vitamin B Natural products 0.000 description 1
- 229930003451 Vitamin B1 Natural products 0.000 description 1
- FLVHGIJGBKMFBB-UHFFFAOYSA-N [Na].COC(OC)C(=CO)C#N Chemical compound [Na].COC(OC)C(=CO)C#N FLVHGIJGBKMFBB-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- AXJDEHNQPMZKOS-UHFFFAOYSA-N acetylazanium;chloride Chemical compound [Cl-].CC([NH3+])=O AXJDEHNQPMZKOS-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- NMVVJCLUYUWBSZ-UHFFFAOYSA-N aminomethylideneazanium;chloride Chemical compound Cl.NC=N NMVVJCLUYUWBSZ-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- PXXJHWLDUBFPOL-UHFFFAOYSA-N benzamidine Chemical compound NC(=N)C1=CC=CC=C1 PXXJHWLDUBFPOL-UHFFFAOYSA-N 0.000 description 1
- LZCZIHQBSCVGRD-UHFFFAOYSA-N benzenecarboximidamide;hydron;chloride Chemical compound [Cl-].NC(=[NH2+])C1=CC=CC=C1 LZCZIHQBSCVGRD-UHFFFAOYSA-N 0.000 description 1
- BDFJWKALVSRGSR-UHFFFAOYSA-N butan-1-ol;sodium Chemical compound [Na].CCCCO BDFJWKALVSRGSR-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 235000019256 formaldehyde Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000005704 oxymethylene group Chemical group [H]C([H])([*:2])O[*:1] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- BITYAPCSNKJESK-UHFFFAOYSA-N potassiosodium Chemical group [Na].[K] BITYAPCSNKJESK-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 229960003495 thiamine Drugs 0.000 description 1
- DPJRMOMPQZCRJU-UHFFFAOYSA-M thiamine hydrochloride Chemical compound Cl.[Cl-].CC1=C(CCO)SC=[N+]1CC1=CN=C(C)N=C1N DPJRMOMPQZCRJU-UHFFFAOYSA-M 0.000 description 1
- 235000019156 vitamin B Nutrition 0.000 description 1
- 239000011720 vitamin B Substances 0.000 description 1
- 239000011691 vitamin B1 Substances 0.000 description 1
- 235000010374 vitamin B1 Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP57156687A JPS5946255A (ja) | 1982-09-10 | 1982-09-10 | 2−アルコキシメチレン−3,3−ジアルコキシプロパンニトリル類の製法 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU194810B true HU194810B (en) | 1988-03-28 |
Family
ID=15633128
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU854784A HU194810B (en) | 1982-09-10 | 1983-07-26 | Process for producing new 2-/alkoxy-methylene/-3,3-dialkoxy-propanonitril derivatives |
| HU832627A HU190498B (en) | 1982-09-10 | 1983-07-26 | Process for preparing 4-amino-5-/dialkoxy-methyl/-pyrimidine derivatives |
| HU854785A HU193617B (en) | 1982-09-10 | 1983-07-26 | Process for producing 2-/dialkoxy-methyl/-3,3-dialkoxy-propane-nitril derivatives |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU832627A HU190498B (en) | 1982-09-10 | 1983-07-26 | Process for preparing 4-amino-5-/dialkoxy-methyl/-pyrimidine derivatives |
| HU854785A HU193617B (en) | 1982-09-10 | 1983-07-26 | Process for producing 2-/dialkoxy-methyl/-3,3-dialkoxy-propane-nitril derivatives |
Country Status (7)
| Country | Link |
|---|---|
| EP (1) | EP0103126B1 (oth) |
| JP (1) | JPS5946255A (oth) |
| KR (1) | KR900001179B1 (oth) |
| AT (1) | ATE25680T1 (oth) |
| CA (1) | CA1253498A (oth) |
| DK (2) | DK159432C (oth) |
| HU (3) | HU194810B (oth) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3829850A1 (de) * | 1988-09-02 | 1990-03-15 | Basf Ag | Verfahren zur herstellung von 2-n-propyl-4-amino-5-methoxymethyl-pyrimidin |
| US6395920B1 (en) * | 2000-01-28 | 2002-05-28 | Creanova, Inc. | Process for preparing substituted acetals of malondialdehyde |
| WO2007104442A2 (en) * | 2006-03-15 | 2007-09-20 | Dsm Ip Assets B.V. | Process for the manufacture of a precursor of vitamin b1 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE937057C (de) * | 1954-04-02 | 1956-08-09 | Shionogi & Co | Verfahren zur Herstellung von 2-Methyl-4-amino-5-acetaminomethyl-(bzw. -5-aminomethyl-) pyrimidin |
| DE1016266B (de) * | 1954-09-01 | 1957-09-26 | Shionogi & Co | Verfahren zur Herstellung von 2-Methyl-4-amino-5-acetaminomethylpyrimidin |
| US4319024A (en) * | 1979-03-29 | 1982-03-09 | Dynamit Nobel Aktiengesellschaft | Method of preparing β-alkoxyacrlonitriles |
-
1982
- 1982-09-10 JP JP57156687A patent/JPS5946255A/ja active Granted
-
1983
- 1983-07-19 CA CA000432781A patent/CA1253498A/en not_active Expired
- 1983-07-26 HU HU854784A patent/HU194810B/hu not_active IP Right Cessation
- 1983-07-26 DK DK342383A patent/DK159432C/da not_active IP Right Cessation
- 1983-07-26 HU HU832627A patent/HU190498B/hu not_active IP Right Cessation
- 1983-07-26 HU HU854785A patent/HU193617B/hu not_active IP Right Cessation
- 1983-07-27 AT AT83107398T patent/ATE25680T1/de not_active IP Right Cessation
- 1983-07-27 EP EP83107398A patent/EP0103126B1/en not_active Expired
- 1983-07-27 KR KR1019830003495A patent/KR900001179B1/ko not_active Expired
-
1989
- 1989-09-01 DK DK434689A patent/DK434689A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| HU193617B (en) | 1987-11-30 |
| DK159432C (da) | 1991-03-18 |
| JPS6121624B2 (oth) | 1986-05-28 |
| DK342383A (da) | 1984-03-11 |
| DK434689D0 (da) | 1989-09-01 |
| DK434689A (da) | 1989-09-01 |
| CA1253498A (en) | 1989-05-02 |
| HU190498B (en) | 1986-09-29 |
| CA1273347C (oth) | 1990-08-28 |
| EP0103126B1 (en) | 1987-03-04 |
| KR840006217A (ko) | 1984-11-22 |
| DK159432B (da) | 1990-10-15 |
| EP0103126A1 (en) | 1984-03-21 |
| JPS5946255A (ja) | 1984-03-15 |
| DK342383D0 (da) | 1983-07-26 |
| ATE25680T1 (de) | 1987-03-15 |
| KR900001179B1 (ko) | 1990-02-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1263739B9 (en) | Crystalline salts of 7-¬4-(4-fluorophenyl)-6-isopropyl-2-¬methyl(methylsulfonyl)amino pyrimidin-5-yl -(3r,5s)-3,5-dihydroxyhept-6-enoic acid | |
| US6784171B2 (en) | Process for the production of tert-butyl (E)-(6-[2-[4-(4-fluorophenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]pyrimidin-5-yl]vinyl](4R,6S)-2, 2-dimethyl[1, 3]dioxan-4-yl)acetate | |
| EP2632889B1 (en) | Intermediate compounds and process for the preparation of fingolimod | |
| EP0574386A1 (en) | Novel process for the preparation of nucleotides | |
| KR102458638B1 (ko) | 메데토미딘의 합성에서 유용한 3-아릴부탄알과 같은 화합물의 제조 방법 | |
| HU194810B (en) | Process for producing new 2-/alkoxy-methylene/-3,3-dialkoxy-propanonitril derivatives | |
| US7847117B2 (en) | Process for preparing alkyl(methoxymethyl)trimethylsilanylmethylamines | |
| EP0808826B1 (en) | A method for preparing 3-amino substituted crotonates | |
| US6187926B1 (en) | Process for producing quinolone derivatives | |
| KR100233068B1 (ko) | 2-치환된 4,6-디알콕시피리미딘의 제조방법 | |
| US4144263A (en) | Benzyl cyanoacetals | |
| EP0131435B1 (en) | Process for preparing 3-phenoxy-1-azetidines and carboxamide derivatives | |
| US4492792A (en) | Process for preparing 4-amino-5-dialkoxy-methylpyrimidine derivatives | |
| US5777154A (en) | Method for preparing 3-amino substituted crotonates | |
| JPS626706B2 (oth) | ||
| FI76789C (fi) | Foerfarande foer framstaellning 2,4-diamino-5-(3',4',5'-trimetoxibensyl)pyrimidin. | |
| HK1051532B (en) | Crystalline salts of 7-(4-(4-fluorophenyl)-6-isopropyl-2-(methyl(methylsulfonyl)amino)pyrimidin-5-yl)-(3r,5s)-3,5-dihydroxyhept-6-enoic acid | |
| GB2104508A (en) | Improved process for the preparation of 2,4,-diamino-5-(3',4',5'-trimethoxy-benzyl) pyrimidine |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |