HU185383B - Process for preparing pyrazole derivatives - Google Patents
Process for preparing pyrazole derivatives Download PDFInfo
- Publication number
- HU185383B HU185383B HU801259A HU125980A HU185383B HU 185383 B HU185383 B HU 185383B HU 801259 A HU801259 A HU 801259A HU 125980 A HU125980 A HU 125980A HU 185383 B HU185383 B HU 185383B
- Authority
- HU
- Hungary
- Prior art keywords
- pyrazole
- chlorophenyl
- fluorophenyl
- acetic acid
- acetyl
- Prior art date
Links
- 150000003217 pyrazoles Chemical class 0.000 title description 6
- 238000004519 manufacturing process Methods 0.000 title description 2
- -1 3-pyrazolyl-thioacetyl Chemical group 0.000 claims abstract description 9
- 239000002253 acid Substances 0.000 claims abstract description 7
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 7
- 150000002367 halogens Chemical class 0.000 claims abstract description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 7
- 150000003839 salts Chemical class 0.000 claims abstract description 6
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 5
- 150000007513 acids Chemical class 0.000 claims abstract description 4
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 22
- 150000001875 compounds Chemical class 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 17
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 14
- 238000002360 preparation method Methods 0.000 claims description 13
- 239000007858 starting material Substances 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 4
- BMMBSROJAOISIS-UHFFFAOYSA-N 1-[4-(4-chlorophenyl)-1-(4-fluorophenyl)pyrazol-3-yl]ethanone Chemical compound CC(=O)C1=NN(C=2C=CC(F)=CC=2)C=C1C1=CC=C(Cl)C=C1 BMMBSROJAOISIS-UHFFFAOYSA-N 0.000 claims description 3
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims description 3
- 159000000000 sodium salts Chemical class 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- SDHFIWNBYPDKTQ-UHFFFAOYSA-N 1-[1,4-bis(4-chlorophenyl)pyrazol-3-yl]ethanone Chemical compound CC(=O)C1=NN(C=2C=CC(Cl)=CC=2)C=C1C1=CC=C(Cl)C=C1 SDHFIWNBYPDKTQ-UHFFFAOYSA-N 0.000 claims description 2
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 claims description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000010949 copper Substances 0.000 claims description 2
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims description 2
- 230000003301 hydrolyzing effect Effects 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims description 2
- 125000004768 (C1-C4) alkylsulfinyl group Chemical group 0.000 claims 1
- ZKVBGYQDXQLUKC-UHFFFAOYSA-N 1-[1,4-bis(4-fluorophenyl)pyrazol-3-yl]ethanone Chemical compound C(C)(=O)C1=NN(C=C1C1=CC=C(C=C1)F)C1=CC=C(C=C1)F ZKVBGYQDXQLUKC-UHFFFAOYSA-N 0.000 claims 1
- LXIVVSKVXXWGBJ-UHFFFAOYSA-N 1-[4-(2,4-dichlorophenyl)-1-(4-fluorophenyl)pyrazol-3-yl]ethanone Chemical compound C(C)(=O)C1=NN(C=C1C1=C(C=C(C=C1)Cl)Cl)C1=CC=C(C=C1)F LXIVVSKVXXWGBJ-UHFFFAOYSA-N 0.000 claims 1
- HSAGOIYWWLSXSM-UHFFFAOYSA-N 1-[4-(4-chlorophenyl)-1-(2-fluorophenyl)pyrazol-3-yl]ethanone Chemical compound C(C)(=O)C1=NN(C=C1C1=CC=C(C=C1)Cl)C1=C(C=CC=C1)F HSAGOIYWWLSXSM-UHFFFAOYSA-N 0.000 claims 1
- WCMPASSJODTWMG-UHFFFAOYSA-N 3-(4-chlorophenyl)-1-(4-fluorophenyl)pyrazole Chemical compound C1=CC(F)=CC=C1N1N=C(C=2C=CC(Cl)=CC=2)C=C1 WCMPASSJODTWMG-UHFFFAOYSA-N 0.000 claims 1
- OEDUIFSDODUDRK-UHFFFAOYSA-N 5-phenyl-1h-pyrazole Chemical compound N1N=CC=C1C1=CC=CC=C1 OEDUIFSDODUDRK-UHFFFAOYSA-N 0.000 claims 1
- 150000007980 azole derivatives Chemical class 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 150000001412 amines Chemical class 0.000 abstract description 3
- BHTZCIGVYSJBQB-UHFFFAOYSA-N 1-(1h-pyrazol-5-yl)ethanone Chemical compound CC(=O)C=1C=CNN=1 BHTZCIGVYSJBQB-UHFFFAOYSA-N 0.000 abstract description 2
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- NTVKSUPEUFXUGS-UHFFFAOYSA-N 2-(1h-pyrazol-5-yl)acetic acid Chemical compound OC(=O)CC=1C=CNN=1 NTVKSUPEUFXUGS-UHFFFAOYSA-N 0.000 abstract 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 abstract 1
- FJKIXWOMBXYWOQ-UHFFFAOYSA-N ethenoxyethane Chemical group CCOC=C FJKIXWOMBXYWOQ-UHFFFAOYSA-N 0.000 abstract 1
- 230000004048 modification Effects 0.000 abstract 1
- 238000012986 modification Methods 0.000 abstract 1
- 231100000252 nontoxic Toxicity 0.000 abstract 1
- 230000003000 nontoxic effect Effects 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 125000004076 pyridyl group Chemical group 0.000 abstract 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 19
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 241001465754 Metazoa Species 0.000 description 11
- 210000002683 foot Anatomy 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- 238000002474 experimental method Methods 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- 206010061218 Inflammation Diseases 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- 230000005764 inhibitory process Effects 0.000 description 5
- 238000002347 injection Methods 0.000 description 5
- 239000007924 injection Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- 206010030113 Oedema Diseases 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000002260 anti-inflammatory agent Substances 0.000 description 4
- 229940121363 anti-inflammatory agent Drugs 0.000 description 4
- 230000004054 inflammatory process Effects 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- UGAGMGHVRQLXKG-UHFFFAOYSA-N 1-(4-chlorophenyl)-n,n-dimethylethenamine Chemical compound CN(C)C(=C)C1=CC=C(Cl)C=C1 UGAGMGHVRQLXKG-UHFFFAOYSA-N 0.000 description 3
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000003110 anti-inflammatory effect Effects 0.000 description 3
- 235000013305 food Nutrition 0.000 description 3
- 210000000548 hind-foot Anatomy 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- FKNQCJSGGFJEIZ-UHFFFAOYSA-N 4-methylpyridine Chemical compound CC1=CC=NC=C1 FKNQCJSGGFJEIZ-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 208000009386 Experimental Arthritis Diseases 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 206010036030 Polyarthritis Diseases 0.000 description 2
- 241000700157 Rattus norvegicus Species 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 208000007107 Stomach Ulcer Diseases 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 208000025865 Ulcer Diseases 0.000 description 2
- 230000001154 acute effect Effects 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 2
- 206010003246 arthritis Diseases 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- 239000003651 drinking water Substances 0.000 description 2
- 235000020188 drinking water Nutrition 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 201000005917 gastric ulcer Diseases 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- GLYDHOZNBVJYBG-UHFFFAOYSA-N n-(4-fluorophenyl)-2-oxopropanehydrazonoyl chloride Chemical compound CC(=O)C(Cl)=NNC1=CC=C(F)C=C1 GLYDHOZNBVJYBG-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- YKJUQRWZPARTLM-UHFFFAOYSA-N 1-[4-(4-bromophenyl)-1-(4-fluorophenyl)pyrazol-3-yl]ethanone Chemical compound CC(=O)C1=NN(C=2C=CC(F)=CC=2)C=C1C1=CC=C(Br)C=C1 YKJUQRWZPARTLM-UHFFFAOYSA-N 0.000 description 1
- VMLSODMFKSZXDR-UHFFFAOYSA-N 1-[4-(4-bromophenyl)-2-(4-fluorophenyl)-3-morpholin-4-yl-3,4-dihydropyrazol-5-yl]ethanone Chemical compound CC(=O)C1=NN(C=2C=CC(F)=CC=2)C(N2CCOCC2)C1C1=CC=C(Br)C=C1 VMLSODMFKSZXDR-UHFFFAOYSA-N 0.000 description 1
- ZVPZZMHGAOROCC-UHFFFAOYSA-N 1-[4-(4-chlorophenyl)-1-(4-methylsulfanylphenyl)pyrazol-3-yl]ethanone Chemical compound C1=CC(SC)=CC=C1N1N=C(C(C)=O)C(C=2C=CC(Cl)=CC=2)=C1 ZVPZZMHGAOROCC-UHFFFAOYSA-N 0.000 description 1
- IRGRRSWKJQLVRB-UHFFFAOYSA-N 1-[4-(4-chlorophenyl)-1-phenylpyrazol-3-yl]ethanone Chemical compound CC(=O)C1=NN(C=2C=CC=CC=2)C=C1C1=CC=C(Cl)C=C1 IRGRRSWKJQLVRB-UHFFFAOYSA-N 0.000 description 1
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 1
- WPOYBLWKLDBTBP-UHFFFAOYSA-N 1-morpholin-4-ylethanethione Chemical class CC(=S)N1CCOCC1 WPOYBLWKLDBTBP-UHFFFAOYSA-N 0.000 description 1
- KEQTWHPMSVAFDA-UHFFFAOYSA-N 2,3-dihydro-1h-pyrazole Chemical class C1NNC=C1 KEQTWHPMSVAFDA-UHFFFAOYSA-N 0.000 description 1
- PXWJTOHJADWQQO-UHFFFAOYSA-N 2-(1h-pyrazol-4-yl)acetic acid Chemical compound OC(=O)CC=1C=NNC=1 PXWJTOHJADWQQO-UHFFFAOYSA-N 0.000 description 1
- RFBONBFMRTWGGB-UHFFFAOYSA-N 2-(4-bromophenyl)acetaldehyde Chemical compound BrC1=CC=C(CC=O)C=C1 RFBONBFMRTWGGB-UHFFFAOYSA-N 0.000 description 1
- MFHFWRBXPQDZSA-UHFFFAOYSA-N 2-(4-bromophenyl)acetonitrile Chemical compound BrC1=CC=C(CC#N)C=C1 MFHFWRBXPQDZSA-UHFFFAOYSA-N 0.000 description 1
- CUNUHKDDCQBLDQ-UHFFFAOYSA-N 2-[4-(4-bromophenyl)-1-(4-fluorophenyl)pyrazol-3-yl]-1-morpholin-4-ylethanethione Chemical compound C1=CC(F)=CC=C1N1N=C(CC(=S)N2CCOCC2)C(C=2C=CC(Br)=CC=2)=C1 CUNUHKDDCQBLDQ-UHFFFAOYSA-N 0.000 description 1
- JLBVDJWADOVLAN-UHFFFAOYSA-N 2-[4-(4-chlorophenyl)-1-(4-methylsulfanylphenyl)pyrazol-3-yl]-1-morpholin-4-ylethanethione Chemical compound C1=CC(SC)=CC=C1N1N=C(CC(=S)N2CCOCC2)C(C=2C=CC(Cl)=CC=2)=C1 JLBVDJWADOVLAN-UHFFFAOYSA-N 0.000 description 1
- IPNXVPVVRDCNAB-UHFFFAOYSA-N 2-[4-(4-chlorophenyl)-1-phenylpyrazol-3-yl]-1-morpholin-4-ylethanethione Chemical compound C1=CC(Cl)=CC=C1C1=CN(C=2C=CC=CC=2)N=C1CC(=S)N1CCOCC1 IPNXVPVVRDCNAB-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- VLRGXXKFHVJQOL-UHFFFAOYSA-N 3-chloropentane-2,4-dione Chemical compound CC(=O)C(Cl)C(C)=O VLRGXXKFHVJQOL-UHFFFAOYSA-N 0.000 description 1
- ITQTTZVARXURQS-UHFFFAOYSA-N 3-methylpyridine Chemical compound CC1=CC=CN=C1 ITQTTZVARXURQS-UHFFFAOYSA-N 0.000 description 1
- YKFROQCFVXOUPW-UHFFFAOYSA-N 4-(methylthio) aniline Chemical compound CSC1=CC=C(N)C=C1 YKFROQCFVXOUPW-UHFFFAOYSA-N 0.000 description 1
- RMCCCVIYWRJQEW-UHFFFAOYSA-N 4-[2-(4-bromophenyl)ethenyl]morpholine Chemical compound C1=CC(Br)=CC=C1C=CN1CCOCC1 RMCCCVIYWRJQEW-UHFFFAOYSA-N 0.000 description 1
- AOAJHBQTGNMXKH-UHFFFAOYSA-N 4-[2-(4-chlorophenyl)ethenyl]morpholine Chemical compound C1=CC(Cl)=CC=C1C=CN1CCOCC1 AOAJHBQTGNMXKH-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- IVYMIRMKXZAHRV-UHFFFAOYSA-N 4-chlorophenylacetonitrile Chemical compound ClC1=CC=C(CC#N)C=C1 IVYMIRMKXZAHRV-UHFFFAOYSA-N 0.000 description 1
- KRZCOLNOCZKSDF-UHFFFAOYSA-N 4-fluoroaniline Chemical compound NC1=CC=C(F)C=C1 KRZCOLNOCZKSDF-UHFFFAOYSA-N 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- 206010006797 Burns first degree Diseases 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 201000004624 Dermatitis Diseases 0.000 description 1
- 206010012442 Dermatitis contact Diseases 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 201000009053 Neurodermatitis Diseases 0.000 description 1
- 208000008350 Pruritus Vulvae Diseases 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 206010056530 Vulvovaginal pruritus Diseases 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- MDXDLWCTQWPZLI-UHFFFAOYSA-N acetic acid;1h-pyrazole Chemical class CC(O)=O.C=1C=NNC=1 MDXDLWCTQWPZLI-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 208000026816 acute arthritis Diseases 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- KZIBQYUFIVUOHY-UHFFFAOYSA-N bis(2-methylpropyl)alumane toluene Chemical compound Cc1ccccc1.[H][Al](CC(C)C)CC(C)C KZIBQYUFIVUOHY-UHFFFAOYSA-N 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- GLNADSQYFUSGOU-UHFFFAOYSA-J chembl1640 Chemical compound [Na+].[Na+].[Na+].[Na+].C1=C(S([O-])(=O)=O)C=C2C=C(S([O-])(=O)=O)C(N=NC3=CC=C(C=C3C)C=3C=C(C(=CC=3)N=NC=3C(=CC4=CC(=CC(N)=C4C=3O)S([O-])(=O)=O)S([O-])(=O)=O)C)=C(O)C2=C1N GLNADSQYFUSGOU-UHFFFAOYSA-J 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 208000010247 contact dermatitis Diseases 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 210000002919 epithelial cell Anatomy 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 208000030603 inherited susceptibility to asthma Diseases 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000000041 non-steroidal anti-inflammatory agent Substances 0.000 description 1
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 208000030428 polyarticular arthritis Diseases 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000000770 proinflammatory effect Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- DGPIGKCOQYBCJH-UHFFFAOYSA-M sodium;acetic acid;hydroxide Chemical compound O.[Na+].CC([O-])=O DGPIGKCOQYBCJH-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 231100000397 ulcer Toxicity 0.000 description 1
- 230000036269 ulceration Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/06—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792920941 DE2920941A1 (de) | 1979-05-21 | 1979-05-21 | Verfahren zur herstellung von pyrazol- derivaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU185383B true HU185383B (en) | 1985-01-28 |
Family
ID=6071550
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU801259A HU185383B (en) | 1979-05-21 | 1980-05-20 | Process for preparing pyrazole derivatives |
Country Status (6)
| Country | Link |
|---|---|
| DE (1) | DE2920941A1 (OSRAM) |
| DK (1) | DK151626C (OSRAM) |
| FI (1) | FI77655C (OSRAM) |
| GR (1) | GR68455B (OSRAM) |
| HU (1) | HU185383B (OSRAM) |
| NO (1) | NO801496L (OSRAM) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE748539C (de) * | 1941-01-16 | 1944-11-06 | Verfahren zur Herstellung der Amide heterocyclich substituierter Essigsaeuren bzw. der freien Saeuren |
-
1979
- 1979-05-21 DE DE19792920941 patent/DE2920941A1/de not_active Withdrawn
-
1980
- 1980-05-19 GR GR61980A patent/GR68455B/el unknown
- 1980-05-20 NO NO801496A patent/NO801496L/no unknown
- 1980-05-20 DK DK219180A patent/DK151626C/da not_active IP Right Cessation
- 1980-05-20 HU HU801259A patent/HU185383B/hu unknown
- 1980-05-21 FI FI801639A patent/FI77655C/fi not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FI801639A7 (fi) | 1980-11-22 |
| DE2920941A1 (de) | 1980-11-27 |
| NO801496L (no) | 1980-11-24 |
| DK151626C (da) | 1988-07-18 |
| FI77655C (fi) | 1989-04-10 |
| DK219180A (da) | 1980-11-22 |
| GR68455B (OSRAM) | 1981-12-30 |
| FI77655B (fi) | 1988-12-30 |
| DK151626B (da) | 1987-12-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU667107B2 (en) | Thiazolylvinylphenyl derivatives | |
| US4355040A (en) | Hypotensive imidazole-5-acetic acid derivatives | |
| EP0138464B1 (en) | 2-amino-5-hydroxy-4-methylpyrimidine derivatives | |
| US4284629A (en) | Process for the preparation of 4-pyridone-3-carboxylic acids and/or derivatives thereof | |
| US4110337A (en) | Triazolobenzodiazepines | |
| JPH07324076A (ja) | 新規なピラゾール−3−カルボキサミド誘導体、これらを製造するための方法及びこれらが存在する薬学的組成物 | |
| WO1998022442A2 (en) | Pharmaceutical compositions comprising diaryl-cyclomethylenpyrazole compounds and their use as cyclooxygenase i (cox 1) inhibitors | |
| JPH0629270B2 (ja) | N―置換2―アミノチアゾール類及び治療用組成物 | |
| US4678802A (en) | 1-acylcarbamoyloxindole-3-carboxamides as antiinflammatory agents | |
| US4442115A (en) | 2'Hydroxy tetrazole-5-carboxanilides and anti-allergic use thereof | |
| US4375479A (en) | Indanyl derivatives and use | |
| US4786642A (en) | Phenylnaphthyridines containing a methyl substituent in the 3-position useful in the treatment of ulcers | |
| HU196749B (en) | Process for producing 2-pyrrolidone derivatives and pharmaceutical compositions comprising such compounds as active ingredient | |
| JP2707936B2 (ja) | β−オキソ−β−ベンゼンプロパンチオアミド誘導体 | |
| HU201015B (en) | Process for producing pyridine derivatives | |
| HU182670B (en) | Process for preparing alpha-carbamoyl-pyrrole-propionitriles | |
| US4560696A (en) | Analgesic, antipyretic or anti-inflammatory imidazole compounds | |
| HU185383B (en) | Process for preparing pyrazole derivatives | |
| US4032533A (en) | 3,4-disubstituted-1,3,4-thiadiazoline-2,5-diones | |
| PL128998B1 (en) | Process for preparing novel 2-amino-3-benzoylphenylacetamides and their derivatives | |
| CS216205B2 (en) | Method of making the derivatives of the 1,4-diphenylpyrazole | |
| US4243665A (en) | 2-Heterocyclylalkyl-6-methoxy-naphthalenes | |
| US4085102A (en) | 2-Amino-8-arylideno-3,4,5,6,7,8-hexahydro-4-arlypyrido[4,3-d]pyrimidines | |
| US3974176A (en) | Halogen pyrazoles derivatives, a method for producing these halogen pyrazole derivatives and medicaments containing them | |
| IE48442B1 (en) | Imidazolylethyl ether derivatives of pyrazolo(3,4-b)pyridine-5-methanols |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |