HU182569B - Process for producing alpha-halogenated and alpha-cyano esters - Google Patents
Process for producing alpha-halogenated and alpha-cyano esters Download PDFInfo
- Publication number
- HU182569B HU182569B HU78RO998A HURO000998A HU182569B HU 182569 B HU182569 B HU 182569B HU 78RO998 A HU78RO998 A HU 78RO998A HU RO000998 A HURO000998 A HU RO000998A HU 182569 B HU182569 B HU 182569B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- dimethyl
- cyclopropane
- phenoxybenzyl
- carboxylate
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 29
- AFVLVVWMAFSXCK-VMPITWQZSA-N alpha-cyano-4-hydroxycinnamic acid Chemical group OC(=O)C(\C#N)=C\C1=CC=C(O)C=C1 AFVLVVWMAFSXCK-VMPITWQZSA-N 0.000 title claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 68
- -1 alkali metal salt Chemical class 0.000 claims description 40
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 23
- 238000002360 preparation method Methods 0.000 claims description 23
- 239000011347 resin Substances 0.000 claims description 13
- 229920005989 resin Polymers 0.000 claims description 13
- 239000007858 starting material Substances 0.000 claims description 13
- 239000011592 zinc chloride Substances 0.000 claims description 12
- 235000005074 zinc chloride Nutrition 0.000 claims description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 11
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 claims description 10
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 10
- 239000011737 fluorine Substances 0.000 claims description 10
- 229910052731 fluorine Inorganic materials 0.000 claims description 10
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 9
- 229910052794 bromium Inorganic materials 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 150000004820 halides Chemical class 0.000 claims description 9
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 claims description 8
- 150000002148 esters Chemical class 0.000 claims description 8
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 7
- 125000001153 fluoro group Chemical group F* 0.000 claims description 7
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 6
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical compound OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 claims description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 5
- 229910021578 Iron(III) chloride Inorganic materials 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 claims description 4
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 229910001413 alkali metal ion Inorganic materials 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 3
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 3
- PCZOZSATUTWXIC-UHFFFAOYSA-N tetraethylazanium;cyanide Chemical compound N#[C-].CC[N+](CC)(CC)CC PCZOZSATUTWXIC-UHFFFAOYSA-N 0.000 claims description 3
- RCEJCSULJQNRQQ-UHFFFAOYSA-N 2-methylbutanenitrile Chemical compound CCC(C)C#N RCEJCSULJQNRQQ-UHFFFAOYSA-N 0.000 claims description 2
- 239000002841 Lewis acid Substances 0.000 claims description 2
- 150000007517 lewis acids Chemical class 0.000 claims description 2
- 229960002317 succinimide Drugs 0.000 claims description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 4
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 claims 3
- 150000007942 carboxylates Chemical class 0.000 claims 3
- 239000003456 ion exchange resin Substances 0.000 claims 3
- 229920003303 ion-exchange polymer Polymers 0.000 claims 3
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 claims 2
- AJGDRDUWEWODJP-UHFFFAOYSA-N 2-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane Chemical compound CC1(C)CC1C=C(Br)Br AJGDRDUWEWODJP-UHFFFAOYSA-N 0.000 claims 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- 206010029897 Obsessive thoughts Diseases 0.000 claims 1
- 239000011968 lewis acid catalyst Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 26
- 229910052739 hydrogen Inorganic materials 0.000 description 18
- 239000001257 hydrogen Substances 0.000 description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 17
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 229910052799 carbon Inorganic materials 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 9
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 8
- 230000000749 insecticidal effect Effects 0.000 description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 7
- MZONOPSOHSEQMN-UHFFFAOYSA-N 2,2-dibromoethenyl cyclopropanecarboxylate Chemical compound BrC(Br)=COC(=O)C1CC1 MZONOPSOHSEQMN-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000010521 absorption reaction Methods 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- MRLGCTNJRREZHZ-UHFFFAOYSA-N 3-phenoxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2C=CC=CC=2)=C1 MRLGCTNJRREZHZ-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 150000001299 aldehydes Chemical class 0.000 description 5
- 238000002329 infrared spectrum Methods 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 4
- 241000238631 Hexapoda Species 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 150000001721 carbon Chemical group 0.000 description 4
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- CYCYDSJDZNVSPP-ZZKAVYKESA-N (1s,3s)-3-(1,2-dibromo-2,2-dichloroethyl)-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)[C@@H](C(Br)C(Cl)(Cl)Br)[C@@H]1C(O)=O CYCYDSJDZNVSPP-ZZKAVYKESA-N 0.000 description 3
- HZBVXCJRIHPDOP-UHFFFAOYSA-N 1-bromo-2-(fluoromethyl)-3-phenoxybenzene Chemical compound FCC1=C(Br)C=CC=C1OC1=CC=CC=C1 HZBVXCJRIHPDOP-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- LHSBWVWOBZFDOS-UHFFFAOYSA-N 1-(fluoromethyl)-3-phenoxybenzene Chemical compound FCC1=CC=CC(OC=2C=CC=CC=2)=C1 LHSBWVWOBZFDOS-UHFFFAOYSA-N 0.000 description 2
- FCSKOFQQCWLGMV-UHFFFAOYSA-N 5-{5-[2-chloro-4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]pentyl}-3-methylisoxazole Chemical compound O1N=C(C)C=C1CCCCCOC1=CC=C(C=2OCCN=2)C=C1Cl FCSKOFQQCWLGMV-UHFFFAOYSA-N 0.000 description 2
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 2
- 229940126062 Compound A Drugs 0.000 description 2
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229920001429 chelating resin Polymers 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 238000002983 circular dichroism Methods 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 230000006698 induction Effects 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- 230000000361 pesticidal effect Effects 0.000 description 2
- 229960005235 piperonyl butoxide Drugs 0.000 description 2
- JIIXEQFJRLRHSW-UJURSFKZSA-N (1S,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride Chemical compound CC1([C@H]([C@@H]1C=C(Br)Br)C(=O)Cl)C JIIXEQFJRLRHSW-UJURSFKZSA-N 0.000 description 1
- MDIQXIJPQWLFSD-UJURSFKZSA-N (1s,3r)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)[C@@H](C=C(Br)Br)[C@@H]1C(O)=O MDIQXIJPQWLFSD-UJURSFKZSA-N 0.000 description 1
- KJPRLNWUNMBNBZ-QPJJXVBHSA-N (E)-cinnamaldehyde Chemical compound O=C\C=C\C1=CC=CC=C1 KJPRLNWUNMBNBZ-QPJJXVBHSA-N 0.000 description 1
- PYQUFDITSDHLQE-UHFFFAOYSA-N 1-(2,2-dibromoethenyl)cyclopropane-1-carboxylic acid Chemical compound BrC(Br)=CC1(C(=O)O)CC1 PYQUFDITSDHLQE-UHFFFAOYSA-N 0.000 description 1
- QUYVTGFWFHQVRO-UHFFFAOYSA-N 1-(chloromethyl)-3-phenoxybenzene Chemical compound ClCC1=CC=CC(OC=2C=CC=CC=2)=C1 QUYVTGFWFHQVRO-UHFFFAOYSA-N 0.000 description 1
- ZQDDFKMLOJICSL-UHFFFAOYSA-N 2,2-dichloroethenyl cyclopropanecarboxylate Chemical compound ClC(Cl)=COC(=O)C1CC1 ZQDDFKMLOJICSL-UHFFFAOYSA-N 0.000 description 1
- OPLCSTZDXXUYDU-UHFFFAOYSA-N 2,4-dimethyl-6-tert-butylphenol Chemical compound CC1=CC(C)=C(O)C(C(C)(C)C)=C1 OPLCSTZDXXUYDU-UHFFFAOYSA-N 0.000 description 1
- 241000238876 Acari Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- NOTFZGFABLVTIG-UHFFFAOYSA-N Cyclohexylethyl acetate Chemical compound CC(=O)OCCC1CCCCC1 NOTFZGFABLVTIG-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- AXMVYSVVTMKQSL-UHFFFAOYSA-N UNPD142122 Natural products OC1=CC=C(C=CC=O)C=C1O AXMVYSVVTMKQSL-UHFFFAOYSA-N 0.000 description 1
- FERHOZBBXIEIOU-UHFFFAOYSA-N [chloro-(3-phenoxyphenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate Chemical compound C=1C=C(Cl)C=CC=1C(C(C)C)C(=O)OC(Cl)C(C=1)=CC=CC=1OC1=CC=CC=C1 FERHOZBBXIEIOU-UHFFFAOYSA-N 0.000 description 1
- GPWHDDKQSYOYBF-UHFFFAOYSA-N ac1l2u0q Chemical compound Br[Br-]Br GPWHDDKQSYOYBF-UHFFFAOYSA-N 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229940117916 cinnamic aldehyde Drugs 0.000 description 1
- KJPRLNWUNMBNBZ-UHFFFAOYSA-N cinnamic aldehyde Natural products O=CC=CC1=CC=CC=C1 KJPRLNWUNMBNBZ-UHFFFAOYSA-N 0.000 description 1
- GKIRPKYJQBWNGO-OCEACIFDSA-N clomifene Chemical compound C1=CC(OCCN(CC)CC)=CC=C1C(\C=1C=CC=CC=1)=C(\Cl)C1=CC=CC=C1 GKIRPKYJQBWNGO-OCEACIFDSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 244000144992 flock Species 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/225—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Furan Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7732415A FR2407200A1 (fr) | 1977-10-27 | 1977-10-27 | Procede de preparation d'esters d'alcools a-cyanes |
| FR7732414A FR2424249A1 (fr) | 1977-10-27 | 1977-10-27 | Esters d'alcools a-halogenes, leur procede de preparation et les compositions insecticides les renfermant |
| FR7821812A FR2432016A2 (fr) | 1978-07-24 | 1978-07-24 | Procede de preparation d'esters d'alcools a-cyanes |
| FR7821811A FR2432011A2 (fr) | 1978-07-24 | 1978-07-24 | Esters d'alcools a-halogenes; leur procede de preparation et les compositions insecticides les renfermant |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU182569B true HU182569B (en) | 1984-03-28 |
Family
ID=27446369
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU78RO998A HU182569B (en) | 1977-10-27 | 1978-10-27 | Process for producing alpha-halogenated and alpha-cyano esters |
Country Status (12)
| Country | Link |
|---|---|
| US (2) | US4277617A (member.php) |
| EP (1) | EP0001944B1 (member.php) |
| JP (1) | JPS5470242A (member.php) |
| BR (1) | BR7807025A (member.php) |
| CA (1) | CA1181411A (member.php) |
| DE (1) | DE2861367D1 (member.php) |
| DK (1) | DK475878A (member.php) |
| ES (1) | ES474545A1 (member.php) |
| HU (1) | HU182569B (member.php) |
| IE (1) | IE47961B1 (member.php) |
| IT (1) | IT1106074B (member.php) |
| PT (1) | PT68708A (member.php) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU526817B2 (en) * | 1978-06-21 | 1983-02-03 | Ici Australia Limited | Pesticides |
| FR2471369A1 (fr) * | 1979-12-17 | 1981-06-19 | Roussel Uclaf | Nouvelles imines, derivant d'esters d'acides formyl cyclopropane carboxyliques, leur procede de preparation et leur application a la preparation d'esters insecticides |
| DE3004092A1 (de) * | 1980-02-05 | 1981-08-13 | Bayer Ag, 5090 Leverkusen | Substituierte 3-(1,2-dibrom-alkyl)- 2,2-dimethyl-cyclopropan-1-carbonsaeureester, verfahren sowie zwischenprodukte zu ihrer herstellung und ihre verwendung in schaedlingsbekaempfungsmitteln |
| US4360689A (en) * | 1980-05-12 | 1982-11-23 | Shell Oil Company | α-Halobenzyl esters |
| US4360478A (en) * | 1980-05-12 | 1982-11-23 | Shell Oil Company | Preparation of α-cyanobenzyl esters |
| US6986898B1 (en) * | 1999-06-28 | 2006-01-17 | Ecosmart Technologies, Inc. | Synergistic and residual pesticidal compositions containing plant essential oils with enzyme inhibitors |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3666789A (en) * | 1969-05-21 | 1972-05-30 | Sumitomo Chemical Co | Cyclopropanecarboxylic acid esters |
| US3683005A (en) * | 1970-01-08 | 1972-08-08 | Taisho Pharmaceutical Co Ltd | Cyclopropanecarboxylic acid esters |
| JPS515450B1 (member.php) * | 1971-06-29 | 1976-02-20 | ||
| JPS5025727A (member.php) * | 1973-07-10 | 1975-03-18 | ||
| JPS5638563B2 (member.php) * | 1973-07-28 | 1981-09-08 | ||
| IT1047139B (it) * | 1973-08-06 | 1980-09-10 | Sumitomo Chemical Co | Procedimento per preparare esteri di acidi carbossilici organici |
| GB1572183A (en) * | 1975-09-05 | 1980-07-23 | Wellcome Found | Cyclopropane carboxylic acid ester synthesis and intermediates therefor |
| DE2540653C3 (de) * | 1975-09-12 | 1981-03-19 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von substituierten 1-Phenyl-2,2,2-trihalogen-äthanolestern |
| FR2364884A1 (fr) * | 1976-09-21 | 1978-04-14 | Roussel Uclaf | Nouveaux esters d'acides cyclopropane, carboxyliques comportant un substituant polyhalogene, procedes de preparation et compositions insecticides les renfermant |
| US4152455A (en) * | 1977-02-02 | 1979-05-01 | Fmc Corporation | Insecticidal α-trifluoromethyl-3-phenoxybenzyl carboxylates |
| US4153626A (en) * | 1977-12-14 | 1979-05-08 | Shell Oil Company | Preparation of α-cyanobenzyl esters |
-
1978
- 1978-10-13 US US05/951,184 patent/US4277617A/en not_active Expired - Lifetime
- 1978-10-20 DE DE7878400142T patent/DE2861367D1/de not_active Expired
- 1978-10-20 EP EP78400142A patent/EP0001944B1/fr not_active Expired
- 1978-10-24 JP JP13009278A patent/JPS5470242A/ja active Granted
- 1978-10-25 BR BR7807025A patent/BR7807025A/pt unknown
- 1978-10-26 DK DK475878A patent/DK475878A/da not_active Application Discontinuation
- 1978-10-26 ES ES474545A patent/ES474545A1/es not_active Expired
- 1978-10-26 IE IE2126/78A patent/IE47961B1/en not_active IP Right Cessation
- 1978-10-26 PT PT68708A patent/PT68708A/pt unknown
- 1978-10-26 IT IT51658/78A patent/IT1106074B/it active
- 1978-10-27 HU HU78RO998A patent/HU182569B/hu not_active IP Right Cessation
- 1978-10-27 CA CA000314610A patent/CA1181411A/fr not_active Expired
-
1980
- 1980-10-03 US US06/193,798 patent/US4315868A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5470242A (en) | 1979-06-05 |
| DE2861367D1 (en) | 1982-01-28 |
| BR7807025A (pt) | 1979-05-08 |
| IE47961B1 (en) | 1984-08-08 |
| US4315868A (en) | 1982-02-16 |
| IT7851658A0 (it) | 1978-10-26 |
| CA1181411A (fr) | 1985-01-22 |
| JPS6347702B2 (member.php) | 1988-09-26 |
| DK475878A (da) | 1979-04-28 |
| EP0001944B1 (fr) | 1981-11-25 |
| PT68708A (fr) | 1978-11-01 |
| EP0001944A3 (en) | 1979-11-14 |
| EP0001944A2 (fr) | 1979-05-16 |
| IE782126L (en) | 1979-04-27 |
| ES474545A1 (es) | 1979-10-16 |
| US4277617A (en) | 1981-07-07 |
| IT1106074B (it) | 1985-11-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0112742B2 (member.php) | ||
| JPH0212942B2 (member.php) | ||
| JPS6217583B2 (member.php) | ||
| US3786052A (en) | Novel cyclopropanecarboxylic acids and esters | |
| EP0143153A2 (en) | Insecticidal 1,1'-Biphenyl -3-ylmethyl esters, their production and use and compositions containing them | |
| HU189627B (en) | Process for producing /1,1'-biphenyl/-3-yl-methyl-derivatives | |
| IE41614B1 (en) | Substituted 2,2-dimethyl cylopropane carboxylic acid estersprocess for their preperation and their use as insecticides | |
| IE46987B1 (en) | 2,2-dimethyl-3-(1-hydroxy-2,2,2-trihaloethyl)-cyclopropane-carboxylic acid lactones | |
| US4788305A (en) | Novel resolution process | |
| HU182569B (en) | Process for producing alpha-halogenated and alpha-cyano esters | |
| DE2708182C3 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| US4479005A (en) | Selective preparation of isomers and enantiomers of cyclopropane carboxylic acids | |
| US4288370A (en) | Halogenovinyl-substituted tetra-hydrofuran-2-ones | |
| Elliott et al. | The pyrethrins and related compounds; Part XXIV: synthesis, 13C‐nuclear magnetic resonance spectra and insecticidal activity of cycloalkyl analogues of fenvalerate | |
| US4299967A (en) | Process for producing optically active 2-(2,2-dihalogenovinyl)-cyclopropane-1-carboxylic acids substituted in the 3-position, and derivatives thereof, as well as novel 4-(2,2,2-trihalogenoethyl)-cyclobutane-1-sulfonic acid salts | |
| Kanamaru et al. | 14C‐labelling of optically active fenvalerate,(S)‐α‐cyano‐3‐phenoxybenzyl (s)‐2‐(4‐chlorophenyl)‐3‐methylbutyrate (II) | |
| US4008268A (en) | Process for isomerization of a cyclopropanecarboxylic acid | |
| Nakada et al. | Studies on chrysanthemate derivatives. VI. A stereoselective synthesis of trans-3-(2, 2-dichlorovinyl)-2, 2-dimethyl-1-cyclopropanecarboxylic acid and related compounds. | |
| US4482731A (en) | Process for the preparation of trans-3-(z-2-chloro-2-aryl-vinyl)-2,2-dimethyl-cyclopropane-1-carboxylic acid derivatives, and the use of intermediate products in agents for compating pests | |
| Okada et al. | Synthesis of Some Novel Carboxylie Acids and Insecticidal Activity of Their Esters | |
| US4567265A (en) | Cyclopropanoid cyanoesters and method of making same | |
| DD261601A5 (de) | Verfahren zur herstellung von 2,3-dihydrofuranverbindungen | |
| US4474980A (en) | Process for the preparation of intermediates for pyrethroids | |
| US4772629A (en) | Optically active isomers of trans-3-(2-chloro-2-(4-chloro-phenyl)-vinyl)-2,2-dimethyl-cyclopropane-1-carboxylic acid alpha-cyano-4-fluoro-3-phenoxy-benzyl ester and their use as ectoparasiticides | |
| FR2458542A1 (fr) | Procede de preparation d'alcools a-cyanes optiquement actifs |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |