HU176077B - Process for preparing terephtalic acid monoamide derivatives - Google Patents
Process for preparing terephtalic acid monoamide derivatives Download PDFInfo
- Publication number
- HU176077B HU176077B HU79CU163A HUCU000163A HU176077B HU 176077 B HU176077 B HU 176077B HU 79CU163 A HU79CU163 A HU 79CU163A HU CU000163 A HUCU000163 A HU CU000163A HU 176077 B HU176077 B HU 176077B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- priority
- compound
- june
- reaction
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 6
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title description 3
- 150000003839 salts Chemical class 0.000 claims abstract description 11
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 10
- JMHSCWJIDIKGNZ-UHFFFAOYSA-N 4-carbamoylbenzoic acid Chemical class NC(=O)C1=CC=C(C(O)=O)C=C1 JMHSCWJIDIKGNZ-UHFFFAOYSA-N 0.000 claims abstract description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract 4
- 150000001875 compounds Chemical class 0.000 claims description 34
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 26
- 238000000034 method Methods 0.000 claims description 25
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 22
- 239000000203 mixture Substances 0.000 claims description 21
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 11
- 239000002904 solvent Substances 0.000 claims description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 claims description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 5
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 5
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 4
- 150000008064 anhydrides Chemical class 0.000 claims description 3
- 150000005130 benzoxazines Chemical class 0.000 claims description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims description 2
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 239000000945 filler Substances 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- 150000007529 inorganic bases Chemical class 0.000 claims description 2
- 150000007530 organic bases Chemical class 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 claims description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 239000000969 carrier Substances 0.000 claims 1
- 239000000043 antiallergic agent Substances 0.000 abstract description 2
- 239000004615 ingredient Substances 0.000 abstract 1
- 239000007795 chemical reaction product Substances 0.000 description 11
- -1 aliphatic acid amide Chemical class 0.000 description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 241000700159 Rattus Species 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- LDQMZKBIBRAZEA-UHFFFAOYSA-N 2,4-diaminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C(N)=C1 LDQMZKBIBRAZEA-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 230000003266 anti-allergic effect Effects 0.000 description 6
- 239000007924 injection Substances 0.000 description 6
- 238000002347 injection Methods 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000013078 crystal Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- PXLKBVFZAMQOBY-UHFFFAOYSA-N 4-[4-oxo-7-(propanoylamino)-3,1-benzoxazin-2-yl]benzoic acid Chemical compound C=1C(NC(=O)CC)=CC=C(C(O2)=O)C=1N=C2C1=CC=C(C(O)=O)C=C1 PXLKBVFZAMQOBY-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 108010058846 Ovalbumin Proteins 0.000 description 4
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- BUBVVEAEAWHBBD-UHFFFAOYSA-N 4-[[2-ethoxycarbonyl-5-(propanoylamino)phenyl]carbamoyl]benzoic acid Chemical compound CCOC(=O)C1=CC=C(NC(=O)CC)C=C1NC(=O)C1=CC=C(C(O)=O)C=C1 BUBVVEAEAWHBBD-UHFFFAOYSA-N 0.000 description 3
- XSMJEZONDSZQKY-UHFFFAOYSA-N 4-amino-2-[(4-carboxybenzoyl)amino]benzoic acid Chemical compound NC1=CC=C(C(O)=O)C(NC(=O)C=2C=CC(=CC=2)C(O)=O)=C1 XSMJEZONDSZQKY-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- COXVTLYNGOIATD-HVMBLDELSA-N CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O Chemical compound CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O COXVTLYNGOIATD-HVMBLDELSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229960003699 evans blue Drugs 0.000 description 3
- 239000002504 physiological saline solution Substances 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- 210000002966 serum Anatomy 0.000 description 3
- 239000011877 solvent mixture Substances 0.000 description 3
- RNHDAKUGFHSZEV-UHFFFAOYSA-N 1,4-dioxane;hydrate Chemical compound O.C1COCCO1 RNHDAKUGFHSZEV-UHFFFAOYSA-N 0.000 description 2
- VPNLSUCKLQLPNE-UHFFFAOYSA-N 2-[(4-carboxybenzoyl)amino]-4-(propanoylamino)benzoic acid Chemical compound CCC(=O)NC1=CC=C(C(O)=O)C(NC(=O)C=2C=CC(=CC=2)C(O)=O)=C1 VPNLSUCKLQLPNE-UHFFFAOYSA-N 0.000 description 2
- AGLCKVYCEMXSSR-UHFFFAOYSA-N 2-[(4-ethoxycarbonylbenzoyl)amino]-4-(propanoylamino)benzoic acid Chemical compound C1=CC(C(=O)OCC)=CC=C1C(=O)NC1=CC(NC(=O)CC)=CC=C1C(O)=O AGLCKVYCEMXSSR-UHFFFAOYSA-N 0.000 description 2
- MFIGXDNVMFEFDX-UHFFFAOYSA-N 4-[[5-(propanoylamino)-2-propoxycarbonylphenyl]carbamoyl]benzoic acid Chemical compound CCCOC(=O)C1=CC=C(NC(=O)CC)C=C1NC(=O)C1=CC=C(C(O)=O)C=C1 MFIGXDNVMFEFDX-UHFFFAOYSA-N 0.000 description 2
- GZEOMCWZTIUAEZ-UHFFFAOYSA-N 4-amino-2-[(4-ethoxycarbonylbenzoyl)amino]benzoic acid Chemical compound C1=CC(C(=O)OCC)=CC=C1C(=O)NC1=CC(N)=CC=C1C(O)=O GZEOMCWZTIUAEZ-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- FSCBUTSARUGLSE-UHFFFAOYSA-N ethyl 2-[(4-ethoxycarbonylbenzoyl)amino]-4-(propanoylamino)benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1C(=O)NC1=CC(NC(=O)CC)=CC=C1C(=O)OCC FSCBUTSARUGLSE-UHFFFAOYSA-N 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- LSACYLWPPQLVSM-UHFFFAOYSA-N isobutyric acid anhydride Chemical compound CC(C)C(=O)OC(=O)C(C)C LSACYLWPPQLVSM-UHFFFAOYSA-N 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- VUZHTCPPOJYNAL-UHFFFAOYSA-N 2-[(4-butoxycarbonylbenzoyl)amino]-4-(propanoylamino)benzoic acid Chemical compound C1=CC(C(=O)OCCCC)=CC=C1C(=O)NC1=CC(NC(=O)CC)=CC=C1C(O)=O VUZHTCPPOJYNAL-UHFFFAOYSA-N 0.000 description 1
- MYTKRAYTMYCXHY-UHFFFAOYSA-N 2-[(4-carboxybenzoyl)amino]-4-(2-methylpropanoylamino)benzoic acid Chemical compound CC(C)C(=O)NC1=CC=C(C(O)=O)C(NC(=O)C=2C=CC(=CC=2)C(O)=O)=C1 MYTKRAYTMYCXHY-UHFFFAOYSA-N 0.000 description 1
- PVDBFTHSLKGRSB-UHFFFAOYSA-N 2-[(4-ethoxycarbonylbenzoyl)amino]-4-(2-methylpropanoylamino)benzoic acid Chemical compound C1=CC(C(=O)OCC)=CC=C1C(=O)NC1=CC(NC(=O)C(C)C)=CC=C1C(O)=O PVDBFTHSLKGRSB-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 1
- COOGCYDPBSRHJC-UHFFFAOYSA-N 4-(propanoylamino)-2-[(4-propan-2-yloxycarbonylbenzoyl)amino]benzoic acid Chemical compound CCC(=O)NC1=CC=C(C(O)=O)C(NC(=O)C=2C=CC(=CC=2)C(=O)OC(C)C)=C1 COOGCYDPBSRHJC-UHFFFAOYSA-N 0.000 description 1
- GZSZXYMKOAZLKE-UHFFFAOYSA-N 4-(propanoylamino)-2-[(4-propoxycarbonylbenzoyl)amino]benzoic acid Chemical compound C1=CC(C(=O)OCCC)=CC=C1C(=O)NC1=CC(NC(=O)CC)=CC=C1C(O)=O GZSZXYMKOAZLKE-UHFFFAOYSA-N 0.000 description 1
- GVQHKHBFWRFBKE-UHFFFAOYSA-N 4-[(5-amino-2-butoxycarbonylphenyl)carbamoyl]benzoic acid Chemical compound CCCCOC(=O)C1=CC=C(N)C=C1NC(=O)C1=CC=C(C(O)=O)C=C1 GVQHKHBFWRFBKE-UHFFFAOYSA-N 0.000 description 1
- WFZMGMGJYJSKFW-UHFFFAOYSA-N 4-[(5-amino-2-ethoxycarbonylphenyl)carbamoyl]benzoic acid Chemical compound CCOC(=O)C1=CC=C(N)C=C1NC(=O)C1=CC=C(C(O)=O)C=C1 WFZMGMGJYJSKFW-UHFFFAOYSA-N 0.000 description 1
- SKKVKTLBUVMODO-UHFFFAOYSA-N 4-[(5-amino-2-propoxycarbonylphenyl)carbamoyl]benzoic acid Chemical compound CCCOC(=O)C1=CC=C(N)C=C1NC(=O)C1=CC=C(C(O)=O)C=C1 SKKVKTLBUVMODO-UHFFFAOYSA-N 0.000 description 1
- DSTFDDPNDAKZBU-UHFFFAOYSA-N 4-[[2-butoxycarbonyl-5-(propanoylamino)phenyl]carbamoyl]benzoic acid Chemical compound CCCCOC(=O)C1=CC=C(NC(=O)CC)C=C1NC(=O)C1=CC=C(C(O)=O)C=C1 DSTFDDPNDAKZBU-UHFFFAOYSA-N 0.000 description 1
- OYJVXKZLBIGSGA-UHFFFAOYSA-N 4-acetamido-2-[(4-carboxybenzoyl)amino]benzoic acid Chemical compound CC(=O)NC1=CC=C(C(O)=O)C(NC(=O)C=2C=CC(=CC=2)C(O)=O)=C1 OYJVXKZLBIGSGA-UHFFFAOYSA-N 0.000 description 1
- OWBIWBRHQSXFGK-UHFFFAOYSA-N 4-amino-2-[(4-butoxycarbonylbenzoyl)amino]benzoic acid Chemical compound C1=CC(C(=O)OCCCC)=CC=C1C(=O)NC1=CC(N)=CC=C1C(O)=O OWBIWBRHQSXFGK-UHFFFAOYSA-N 0.000 description 1
- APWJUWSQSWFNHO-UHFFFAOYSA-N 4-amino-2-[(4-methoxycarbonylbenzoyl)amino]benzoic acid Chemical compound C1=CC(C(=O)OC)=CC=C1C(=O)NC1=CC(N)=CC=C1C(O)=O APWJUWSQSWFNHO-UHFFFAOYSA-N 0.000 description 1
- BTOBCBZYMVYXPP-UHFFFAOYSA-N 4-amino-2-[(4-propan-2-yloxycarbonylbenzoyl)amino]benzoic acid Chemical compound C1=CC(C(=O)OC(C)C)=CC=C1C(=O)NC1=CC(N)=CC=C1C(O)=O BTOBCBZYMVYXPP-UHFFFAOYSA-N 0.000 description 1
- YPJRVRRZXKLBRD-UHFFFAOYSA-N 4-amino-2-[(4-propoxycarbonylbenzoyl)amino]benzoic acid Chemical compound C1=CC(C(=O)OCCC)=CC=C1C(=O)NC1=CC(N)=CC=C1C(O)=O YPJRVRRZXKLBRD-UHFFFAOYSA-N 0.000 description 1
- SVWCVXFHTHCJJB-UHFFFAOYSA-N 4-methylpentanoyl chloride Chemical compound CC(C)CCC(Cl)=O SVWCVXFHTHCJJB-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241000588832 Bordetella pertussis Species 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 206010012434 Dermatitis allergic Diseases 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical class CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- 206010070834 Sensitisation Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- BECSQAHHSLDJDG-UHFFFAOYSA-M [K+].C(=O)([O-])C1=CC=C(C(=O)NC2=C(C(=O)OCC)C=CC(=C2)NC(CC)=O)C=C1 Chemical compound [K+].C(=O)([O-])C1=CC=C(C(=O)NC2=C(C(=O)OCC)C=CC(=C2)NC(CC)=O)C=C1 BECSQAHHSLDJDG-UHFFFAOYSA-M 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 201000008937 atopic dermatitis Diseases 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- FLXWZCRIBSLCRG-UHFFFAOYSA-N ethyl 4-[4-oxo-7-(propanoylamino)-3,1-benzoxazin-2-yl]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1C1=NC2=CC(NC(=O)CC)=CC=C2C(=O)O1 FLXWZCRIBSLCRG-UHFFFAOYSA-N 0.000 description 1
- NBWJWSSXPCELHO-UHFFFAOYSA-N ethyl 4-amino-2-[(4-ethoxycarbonylbenzoyl)amino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1C(=O)NC1=CC(N)=CC=C1C(=O)OCC NBWJWSSXPCELHO-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 208000030603 inherited susceptibility to asthma Diseases 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- 150000003872 salicylic acid derivatives Chemical class 0.000 description 1
- 230000008313 sensitization Effects 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000010356 sorbitol Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 150000003503 terephthalic acid derivatives Chemical class 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/185—Acids; Anhydrides, halides or salts thereof, e.g. sulfur acids, imidic, hydrazonic or hydroximic acids
- A61K31/19—Carboxylic acids, e.g. valproic acid
- A61K31/195—Carboxylic acids, e.g. valproic acid having an amino group
- A61K31/197—Carboxylic acids, e.g. valproic acid having an amino group the amino and the carboxyl groups being attached to the same acyclic carbon chain, e.g. gamma-aminobutyric acid [GABA], beta-alanine, epsilon-aminocaproic acid or pantothenic acid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/21—Esters, e.g. nitroglycerine, selenocyanates
- A61K31/215—Esters, e.g. nitroglycerine, selenocyanates of carboxylic acids
- A61K31/235—Esters, e.g. nitroglycerine, selenocyanates of carboxylic acids having an aromatic ring attached to a carboxyl group
- A61K31/24—Esters, e.g. nitroglycerine, selenocyanates of carboxylic acids having an aromatic ring attached to a carboxyl group having an amino or nitro group
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/21—Esters, e.g. nitroglycerine, selenocyanates
- A61K31/215—Esters, e.g. nitroglycerine, selenocyanates of carboxylic acids
- A61K31/235—Esters, e.g. nitroglycerine, selenocyanates of carboxylic acids having an aromatic ring attached to a carboxyl group
- A61K31/24—Esters, e.g. nitroglycerine, selenocyanates of carboxylic acids having an aromatic ring attached to a carboxyl group having an amino or nitro group
- A61K31/245—Amino benzoic acid types, e.g. procaine, novocaine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/70—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/84—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton with the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Emergency Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP6893178A JPS6056131B2 (ja) | 1978-06-09 | 1978-06-09 | テレフタル酸アミド誘導体及びその塩 |
| JP14969678A JPS5576853A (en) | 1978-12-05 | 1978-12-05 | Preparation of derivative of terephthalic acid amide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU176077B true HU176077B (en) | 1980-12-28 |
Family
ID=26410112
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU79CU163A HU176077B (en) | 1978-06-09 | 1979-06-08 | Process for preparing terephtalic acid monoamide derivatives |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4221814A (enExample) |
| AR (2) | AR225896A1 (enExample) |
| CA (1) | CA1140571A (enExample) |
| CH (1) | CH642059A5 (enExample) |
| DE (1) | DE2923298A1 (enExample) |
| DK (1) | DK214679A (enExample) |
| ES (2) | ES481416A1 (enExample) |
| FR (1) | FR2428026A1 (enExample) |
| GB (1) | GB2023576B (enExample) |
| HU (1) | HU176077B (enExample) |
| IT (1) | IT1165210B (enExample) |
| NL (1) | NL7904466A (enExample) |
| SE (1) | SE445830B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0478787B1 (en) * | 1990-03-20 | 1994-12-21 | Shionogi & Co., Ltd. | Novel process for producing benzoic acid derivative |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2088667A (en) * | 1934-10-30 | 1937-08-03 | Ici Ltd | Amino-aroylamino-benzoic acid and process of making it |
| CH489993A (de) * | 1967-12-19 | 1970-05-15 | Ciba Geigy | Das Pflanzenwachstum regulierendes und phytocides Mittel |
| FR7409M (enExample) * | 1968-06-28 | 1969-11-03 | ||
| US3953496A (en) * | 1973-03-27 | 1976-04-27 | Chugai Seiyaku Kabushiki Kaisha | Bis(benzamido)-benzoic acid derivatives |
| US4123455A (en) * | 1977-06-13 | 1978-10-31 | American Cyanamid Company | Phenenyltris(carbonylimino) multi-anionic substituted triphenyl acids and salts |
| US4089974A (en) * | 1977-06-13 | 1978-05-16 | American Cyanamid Company | 5-Carboxy-phenylenebis(carbonylimino)benzene carboxylic and dicarboxylic acids and salts |
| US4120895A (en) * | 1977-06-29 | 1978-10-17 | American Cyanamid Company | S-phenenyltris (iminocarbonyl) triisophthalic acid salts |
-
1979
- 1979-05-23 DK DK214679A patent/DK214679A/da not_active Application Discontinuation
- 1979-05-31 IT IT7968172A patent/IT1165210B/it active
- 1979-06-01 US US06/044,687 patent/US4221814A/en not_active Expired - Lifetime
- 1979-06-07 NL NL7904466A patent/NL7904466A/xx not_active Application Discontinuation
- 1979-06-08 HU HU79CU163A patent/HU176077B/hu not_active IP Right Cessation
- 1979-06-08 GB GB7920005A patent/GB2023576B/en not_active Expired
- 1979-06-08 AR AR276872A patent/AR225896A1/es active
- 1979-06-08 CH CH540379A patent/CH642059A5/de not_active IP Right Cessation
- 1979-06-08 CA CA000329379A patent/CA1140571A/en not_active Expired
- 1979-06-08 FR FR7914734A patent/FR2428026A1/fr active Granted
- 1979-06-08 DE DE19792923298 patent/DE2923298A1/de active Granted
- 1979-06-08 ES ES481416A patent/ES481416A1/es not_active Expired
- 1979-06-08 SE SE7905025A patent/SE445830B/sv not_active IP Right Cessation
-
1980
- 1980-03-12 ES ES489475A patent/ES8104198A1/es not_active Expired
-
1981
- 1981-02-27 AR AR284485A patent/AR225072A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| FR2428026B1 (enExample) | 1983-12-16 |
| US4221814A (en) | 1980-09-09 |
| IT1165210B (it) | 1987-04-22 |
| SE445830B (sv) | 1986-07-21 |
| DE2923298A1 (de) | 1979-12-20 |
| AR225896A1 (es) | 1982-05-14 |
| CH642059A5 (de) | 1984-03-30 |
| NL7904466A (nl) | 1979-12-11 |
| IT7968172A0 (it) | 1979-05-31 |
| AR225072A1 (es) | 1982-02-15 |
| ES489475A0 (es) | 1981-04-01 |
| CA1140571A (en) | 1983-02-01 |
| DE2923298C2 (enExample) | 1987-10-01 |
| GB2023576A (en) | 1980-01-03 |
| FR2428026A1 (fr) | 1980-01-04 |
| SE7905025L (sv) | 1979-12-10 |
| GB2023576B (en) | 1982-08-11 |
| DK214679A (da) | 1979-12-10 |
| ES8104198A1 (es) | 1981-04-01 |
| ES481416A1 (es) | 1980-08-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0288973B1 (en) | Benzothiazolinone derivatives, their production and pharmaceutical composition | |
| HU197295B (en) | Process for production of new derivatives of n-/2'-aminphenil/-benzamid and medical preparatives containing those as active substance | |
| US4613598A (en) | Piperazine derivatives and their acid addition salts | |
| US3639477A (en) | Novel propoxyguanidine compounds and means of producing the same | |
| CA1202317A (en) | Acetylsalicylic acid thioesters, a process for their preparation and pharmaceutical compositions containing them | |
| US4297357A (en) | N-Phenethylacetamide compounds and process for preparation thereof | |
| US4775673A (en) | Substituted acylpiperazinoquinazolines and pharmaceutical compositions containing same | |
| US4585589A (en) | Water-soluble alkanoyloxy and alkoxycarbonyloxy rifampicin derivatives, process for its preparation, intermediates, and its pharmaceutical composition as antibacterials | |
| HU176077B (en) | Process for preparing terephtalic acid monoamide derivatives | |
| HU179391B (en) | Process for producing thiasolo-square bracket-2,3-b-square bracket closed-quinasoline derivatives | |
| US4103016A (en) | Antiinflammatory imidazothiazoles and thiazolopyrimidines | |
| JPS63119455A (ja) | グリシン誘導体 | |
| US4246272A (en) | Benzamidine derivatives | |
| US3676463A (en) | Oxobenzofuran carboxamides | |
| US4143143A (en) | Substituted imidazo[5,1-a]isoquinolines | |
| KR880001298B1 (ko) | 벤조일-페닐-피페리딘 유도체의 제법 | |
| US4713382A (en) | N-phenyl-4-phenyl-1-piperazinecarboxamidines and related compounds as antiarrhythmic agents | |
| US3687936A (en) | 11-AMINOALIPHATIC-5:10-METHANODIBENZO {8 a:d{9 {0 {8 1:4{9 {0 CYCLOHEPTADIENES AND THE SALTS THEREOF | |
| CY1324A (en) | Antibacterial compositions containing chlorhexidine | |
| US4405633A (en) | Method of treatment of asthma | |
| GB2087869A (en) | Piperazine derivatives | |
| HU218655B (hu) | Daganatellenes hatású tioxantenonszármazékok, ezeket hatóanyagként tartalmazó gyógyszerkészítmények és eljárás előállításukra | |
| US5079241A (en) | Cephalosporin derivatives and pharmaceutical compositions in which they are present | |
| US5091547A (en) | Phenylacetic acid derivative and process for making same | |
| US4038283A (en) | 4-Alkoxy or hydroxy derivatives of 2H-pyrazolo[3,4-b]pyridine-5-carboxylic acids and esters |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |