GB993584A - - Google Patents
Info
- Publication number
- GB993584A GB993584A GB993584DA GB993584A GB 993584 A GB993584 A GB 993584A GB 993584D A GB993584D A GB 993584DA GB 993584 A GB993584 A GB 993584A
- Authority
- GB
- United Kingdom
- Prior art keywords
- hydrogen
- aralkyl
- lower alkyl
- preparations
- ring
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- -1 hydroxy, amino Chemical group 0.000 abstract 5
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 4
- 229910052739 hydrogen Inorganic materials 0.000 abstract 4
- 239000001257 hydrogen Substances 0.000 abstract 4
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 150000002431 hydrogen Chemical group 0.000 abstract 3
- 229940035676 analgesics Drugs 0.000 abstract 2
- 239000000730 antalgic agent Substances 0.000 abstract 2
- 239000003242 anti bacterial agent Substances 0.000 abstract 2
- 125000005160 aryl oxy alkyl group Chemical group 0.000 abstract 2
- 229960000686 benzalkonium chloride Drugs 0.000 abstract 2
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 abstract 2
- 125000004432 carbon atom Chemical group C* 0.000 abstract 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 2
- 238000002360 preparation method Methods 0.000 abstract 2
- 239000000243 solution Substances 0.000 abstract 2
- FUFLCEKSBBHCMO-UHFFFAOYSA-N 11-dehydrocorticosterone Natural products O=C1CCC2(C)C3C(=O)CC(C)(C(CC4)C(=O)CO)C4C3CCC2=C1 FUFLCEKSBBHCMO-UHFFFAOYSA-N 0.000 abstract 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 abstract 1
- DBAKFASWICGISY-BTJKTKAUSA-N Chlorpheniramine maleate Chemical compound OC(=O)\C=C/C(O)=O.C=1C=CC=NC=1C(CCN(C)C)C1=CC=C(Cl)C=C1 DBAKFASWICGISY-BTJKTKAUSA-N 0.000 abstract 1
- MFYSYFVPBJMHGN-ZPOLXVRWSA-N Cortisone Chemical compound O=C1CC[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 MFYSYFVPBJMHGN-ZPOLXVRWSA-N 0.000 abstract 1
- MFYSYFVPBJMHGN-UHFFFAOYSA-N Cortisone Natural products O=C1CCC2(C)C3C(=O)CC(C)(C(CC4)(O)C(=O)CO)C4C3CCC2=C1 MFYSYFVPBJMHGN-UHFFFAOYSA-N 0.000 abstract 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 229930193140 Neomycin Natural products 0.000 abstract 1
- 229910019142 PO4 Inorganic materials 0.000 abstract 1
- 108010021006 Tyrothricin Proteins 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 239000002269 analeptic agent Substances 0.000 abstract 1
- 230000003555 analeptic effect Effects 0.000 abstract 1
- 230000001387 anti-histamine Effects 0.000 abstract 1
- 229940121363 anti-inflammatory agent Drugs 0.000 abstract 1
- 239000002260 anti-inflammatory agent Substances 0.000 abstract 1
- 230000001754 anti-pyretic effect Effects 0.000 abstract 1
- 230000002421 anti-septic effect Effects 0.000 abstract 1
- 229940088710 antibiotic agent Drugs 0.000 abstract 1
- 229940125715 antihistaminic agent Drugs 0.000 abstract 1
- 239000000739 antihistaminic agent Substances 0.000 abstract 1
- 239000002221 antipyretic Substances 0.000 abstract 1
- 229940125716 antipyretic agent Drugs 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 abstract 1
- 239000002981 blocking agent Substances 0.000 abstract 1
- 229940124630 bronchodilator Drugs 0.000 abstract 1
- 239000000168 bronchodilator agent Substances 0.000 abstract 1
- 239000002775 capsule Substances 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 239000000470 constituent Substances 0.000 abstract 1
- 229960004544 cortisone Drugs 0.000 abstract 1
- 229940079593 drug Drugs 0.000 abstract 1
- 239000003814 drug Substances 0.000 abstract 1
- 239000003937 drug carrier Substances 0.000 abstract 1
- 230000000694 effects Effects 0.000 abstract 1
- 239000003172 expectorant agent Substances 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 239000003326 hypnotic agent Substances 0.000 abstract 1
- 230000000147 hypnotic effect Effects 0.000 abstract 1
- 239000002184 metal Substances 0.000 abstract 1
- 229960001397 methdilazine hydrochloride Drugs 0.000 abstract 1
- IEISBKIVLDXSMZ-UHFFFAOYSA-N methdilazine hydrochloride Chemical compound Cl.C1N(C)CCC1CN1C2=CC=CC=C2SC2=CC=CC=C21 IEISBKIVLDXSMZ-UHFFFAOYSA-N 0.000 abstract 1
- 229940066491 mucolytics Drugs 0.000 abstract 1
- 239000000133 nasal decongestant Substances 0.000 abstract 1
- 229960004927 neomycin Drugs 0.000 abstract 1
- 239000002674 ointment Substances 0.000 abstract 1
- 238000007911 parenteral administration Methods 0.000 abstract 1
- 239000000825 pharmaceutical preparation Substances 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 abstract 1
- 239000010452 phosphate Substances 0.000 abstract 1
- 239000002504 physiological saline solution Substances 0.000 abstract 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 abstract 1
- 239000003755 preservative agent Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 229940125723 sedative agent Drugs 0.000 abstract 1
- 239000000932 sedative agent Substances 0.000 abstract 1
- 210000002460 smooth muscle Anatomy 0.000 abstract 1
- 239000000021 stimulant Substances 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
- 239000004094 surface-active agent Substances 0.000 abstract 1
- 239000000725 suspension Substances 0.000 abstract 1
- RTKIYNMVFMVABJ-UHFFFAOYSA-L thimerosal Chemical compound [Na+].CC[Hg]SC1=CC=CC=C1C([O-])=O RTKIYNMVFMVABJ-UHFFFAOYSA-L 0.000 abstract 1
- 229940033663 thimerosal Drugs 0.000 abstract 1
- 125000003944 tolyl group Chemical group 0.000 abstract 1
- 238000011200 topical administration Methods 0.000 abstract 1
- 230000000699 topical effect Effects 0.000 abstract 1
- MDYZKJNTKZIUSK-UHFFFAOYSA-N tyloxapol Chemical compound O=C.C1CO1.CC(C)(C)CC(C)(C)C1=CC=C(O)C=C1 MDYZKJNTKZIUSK-UHFFFAOYSA-N 0.000 abstract 1
- GSXRBRIWJGAPDU-BBVRJQLQSA-N tyrocidine A Chemical compound C([C@H]1C(=O)N[C@H](C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(N[C@H](CC=2C=CC=CC=2)C(=O)N2CCC[C@H]2C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N1)=O)CC(C)C)C(C)C)C1=CC=C(O)C=C1 GSXRBRIWJGAPDU-BBVRJQLQSA-N 0.000 abstract 1
- 229960003281 tyrothricin Drugs 0.000 abstract 1
- 230000002541 vasodepressive effect Effects 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/02—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C311/03—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton having the nitrogen atoms of the sulfonamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C311/05—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton having the nitrogen atoms of the sulfonamide groups bound to hydrogen atoms or to acyclic carbon atoms to acyclic carbon atoms of hydrocarbon radicals substituted by nitrogen atoms, not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/16—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom
- C07C311/18—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom to an acyclic carbon atom of a hydrocarbon radical substituted by nitrogen atoms, not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/092—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings with aromatic radicals attached to the chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US16849862A | 1962-01-24 | 1962-01-24 | |
| US24459762A | 1962-12-14 | 1962-12-14 | |
| US38550464A | 1964-07-27 | 1964-07-27 | |
| US439086A US3341584A (en) | 1962-01-24 | 1965-03-11 | Anilides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB993584A true GB993584A (enExample) |
Family
ID=27496795
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB993584D Active GB993584A (enExample) | 1962-01-24 |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3341584A (enExample) |
| BR (1) | BR6346374D0 (enExample) |
| CH (1) | CH475962A (enExample) |
| DE (1) | DE1493955B2 (enExample) |
| DK (1) | DK122662B (enExample) |
| FR (4) | FR1599658A (enExample) |
| GB (1) | GB993584A (enExample) |
| NL (1) | NL139523B (enExample) |
| SE (1) | SE334368B (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2141339A (en) * | 1983-05-23 | 1984-12-19 | Bristol Myers Co | Antiarrhythmic drug |
| US4730008A (en) * | 1984-10-17 | 1988-03-08 | Glaxo Group Limited | Aminophenol derivatives |
| US5066678A (en) * | 1989-04-24 | 1991-11-19 | Glaxo Group Limited | Phenethandamine derivatives and pharmaceutical use thereof |
| US5360822A (en) * | 1990-02-07 | 1994-11-01 | Nippon Shinyaku Co. Ltd. | Sulfonanilide derivatives and medicine |
| EP2266590A2 (en) | 2002-02-22 | 2010-12-29 | Shire LLC | Active agent delivery sytems and methods for protecting and administering active agents |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3759993A (en) * | 1971-09-27 | 1973-09-18 | Riker Laboratories Inc | Fluoromethanesulfonic acid derivatives |
| US3919424A (en) * | 1972-02-16 | 1975-11-11 | Mead Johnson & Co | Bronchodilator process and composition |
| US3993776A (en) * | 1973-10-15 | 1976-11-23 | Mead Johnson & Company | Anorexigenic process and composition |
| US3979514A (en) * | 1974-08-26 | 1976-09-07 | Mead Johnson & Company | Process for interrupting pregnancy with sulfonamidoaminophene interceptive agents |
| US3968242A (en) * | 1974-08-26 | 1976-07-06 | Mead Johnson & Company | Sulfonamidoaminopropiophenone interceptive process |
| GB1482099A (en) * | 1974-12-11 | 1977-08-03 | Wyeth John & Brother Ltd | Sulphonamido derivatives |
| US3966770A (en) * | 1975-03-25 | 1976-06-29 | Smithkline Corporation | 4-Hydroxy-α-[(3,4-methylenedioxyphenyl)isopropylaminoethyl]-3-(methylsulfonylmethyl)benzyl alcohol |
| US4044150A (en) * | 1976-06-18 | 1977-08-23 | Mead Johnson & Company | Antihypertensive 4'-[1-hydroxy-2-[(1-phenoxy ethyl)-amino]ethyl]methanesulfonanilide and salts thereof and therapeutic use |
| NZ186175A (en) * | 1977-01-27 | 1980-03-05 | Shionogi & Co | Meta-sulphonamidobenzamide derivatives |
| GB2077102A (en) * | 1980-06-09 | 1981-12-16 | Bristol Myers Co | Ophthalmic compositions |
| US4618624A (en) * | 1981-12-02 | 1986-10-21 | American Cyanamid Company | 3-amino-4-hydroxy(or alkoxy)phenethanolamine derivatives and pharmacologically-acceptable acid addition salts thereof for increasing the growth rate and/or improving the lean meat to fat ratio of warm-blooded animals |
| US4404224A (en) * | 1981-12-02 | 1983-09-13 | American Cyanamid Company | Alkanesulfonanilide derivatives and pharmaceutically acceptable acid addition salts thereof for increasing the growth rate and/or improving the lean meat to fat ratio of warm blooded animals |
| FR2541999B1 (fr) * | 1983-03-04 | 1986-09-19 | Bristol Myers Co | Phenethanolamines et leurs utilisations |
| US4540581A (en) * | 1984-01-31 | 1985-09-10 | Bristol-Myers Company | Topical nonsteroidal anti-inflammatory compositions and uses |
| US5089526A (en) * | 1983-05-23 | 1992-02-18 | Bristol-Myers Company | Antiarrhythmic class III process |
| US4657929A (en) * | 1983-10-25 | 1987-04-14 | Fisons Plc | Compounds |
| US4507320A (en) * | 1983-12-07 | 1985-03-26 | Smithkline Beckman Corporation | Dopaminergic agonist N,N-di-n-propyl-4-hydroxy-3-methanesulfonamidophenethylamine |
| US4574129A (en) * | 1984-01-31 | 1986-03-04 | Bristol-Myers Company | Topical nonsteroidal anti-inflammatory methods |
| US5155268A (en) * | 1984-05-04 | 1992-10-13 | The Upjohn Company | Antiarrhythmic N-aminoalkylene alkyl and aryl sulfonamides |
| US4920116A (en) * | 1985-06-28 | 1990-04-24 | Schering A.G. | N-(aminoalkyl)-substituted(N or C alkyl)-aryl-4(methylsulfonylamino)benzamides |
| GB8603120D0 (en) * | 1986-02-07 | 1986-03-12 | Pfizer Ltd | Anti-dysrhythmia agents |
| GB8609331D0 (en) * | 1986-04-16 | 1986-05-21 | Pfizer Ltd | Anti-arrythmia agents |
| EG18188A (en) * | 1986-05-01 | 1992-09-30 | Pfizer Ltd | Process for preparation anti-arhythmia agents |
| GB8707120D0 (en) * | 1987-03-25 | 1987-04-29 | Pfizer Ltd | Antiarrhythmic agents |
| US4857651A (en) * | 1987-07-29 | 1989-08-15 | American Cyanamid Company | α-(2,3-Di(C1 -C4 alkoxy)ethylamino)-β-cyanostyrene and β-nitrostyrene compounds useful as intermediates in the preparation of insecticidal, acaricidal and nematicidal arylpyrroles and method for the preparation thereof |
| PH25458A (en) * | 1987-08-24 | 1991-07-01 | Eisai Co Ltd | Piperidine derivatives, therapeutic, preventive agents |
| US5405997A (en) * | 1989-07-25 | 1995-04-11 | The Upjohn Company | Antiarrhythmic methanesulfonamides |
| HU209251B (en) * | 1992-03-13 | 1994-04-28 | Synepos Ag | Process for producing stable, peroral solution drug forms with controlled release of active ingredient and comprising beta-blocking pharmacons |
| ES2182159T3 (es) * | 1992-08-26 | 2003-03-01 | Procter & Gamble | Aparato para la fabricacion de papel que tiene un patron semicontinuo. |
| US5776983A (en) * | 1993-12-21 | 1998-07-07 | Bristol-Myers Squibb Company | Catecholamine surrogates useful as β3 agonists |
| US5874475A (en) * | 1995-12-21 | 1999-02-23 | Pharmacia & Upjohn Company | Antiarrhythmic (S)-enantiomers of methanesulfonamides |
| US5770615A (en) * | 1996-04-04 | 1998-06-23 | Bristol-Myers Squibb Company | Catecholamine surrogates useful as β3 agonists |
| US6660772B2 (en) | 2001-02-01 | 2003-12-09 | Boehringer Ingelheim Pharma Kg | Use of 2-amino-1-(4-hydroxy-2-methanesulfonamidophenyl)ethanol for treating urinary incontinence |
| DE10104369A1 (de) * | 2001-02-01 | 2002-08-08 | Boehringer Ingelheim Pharma | Verwendung von 2-Amino-(4-hydroxy-2-methansulfonamidophenyl)ethanol zur Behandlung der Harninkontinenz |
| NZ577031A (en) | 2003-05-30 | 2010-09-30 | Ranbaxy Lab Ltd | Substituted pyrrole derivatives and their use as HMG-CO inhibitors |
| EA200701613A1 (ru) * | 2005-02-21 | 2008-02-28 | Лонца Аг | Способ получения энантиомерно чистых 1-замещенных 3-аминоспиртов |
| WO2007054896A1 (en) | 2005-11-08 | 2007-05-18 | Ranbaxy Laboratories Limited | Process for (3r, 5r)-7-[2-(4-fluorophenyl)-5-isopropyl-3-phenyl-4- [(4-hydroxy methyl phenyl amino) carbonyl]-pyrrol-1-yl]-3, 5-dihydroxy-heptanoic acid hemi calcium salt |
| AU2008210637B2 (en) | 2007-01-31 | 2012-08-16 | Toray Industries, Inc. | Benzylamine derivative or pharmaceutically acceptable acid addition salt thereof, and use thereof for medical purposes |
| MX2011000844A (es) | 2008-07-31 | 2011-03-15 | Toray Industries | Agente terapeutico o profilactico para diabetes, obesidad, dislipidemia o sindrome metabolico, el cual comprende un derivado de bencilamina representado por una formula o una sal de adicion de acido farmaceuticamente aceptable del mismo. |
| CN102197023B (zh) * | 2008-10-22 | 2015-12-16 | 奥克塞拉有限公司 | 治疗眼科疾病和紊乱的化合物 |
| US10793519B2 (en) | 2018-05-02 | 2020-10-06 | Academic Pharmaceuticals Incorporated | Ultra short acting anti-arrhythmic agents |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH364248A (de) * | 1957-12-24 | 1962-09-15 | Geigy Ag J R | Verfahren zur Herstellung neuer Aminobenzoesäure-Derivate |
-
0
- FR FR148D patent/FR148F/fr active Active
- GB GB993584D patent/GB993584A/en active Active
-
1963
- 1963-01-19 DE DE1963M0055500 patent/DE1493955B2/de active Granted
- 1963-01-23 NL NL63288065A patent/NL139523B/xx not_active IP Right Cessation
- 1963-01-23 FR FR1599658D patent/FR1599658A/fr not_active Expired
- 1963-01-23 SE SE00731/63A patent/SE334368B/xx unknown
- 1963-01-23 BR BR146374/63A patent/BR6346374D0/pt unknown
- 1963-01-23 DK DK31663AA patent/DK122662B/da unknown
- 1963-01-24 CH CH85463A patent/CH475962A/de not_active IP Right Cessation
- 1963-04-22 FR FR932206A patent/FR3027M/fr active Active
-
1965
- 1965-03-11 US US439086A patent/US3341584A/en not_active Expired - Lifetime
- 1965-06-05 FR FR19770A patent/FR95660E/fr not_active Expired
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2141339A (en) * | 1983-05-23 | 1984-12-19 | Bristol Myers Co | Antiarrhythmic drug |
| US4730008A (en) * | 1984-10-17 | 1988-03-08 | Glaxo Group Limited | Aminophenol derivatives |
| US4853382A (en) * | 1984-10-17 | 1989-08-01 | Glaxo Group Limited | Aminophenol derivatives |
| US5066678A (en) * | 1989-04-24 | 1991-11-19 | Glaxo Group Limited | Phenethandamine derivatives and pharmaceutical use thereof |
| US5360822A (en) * | 1990-02-07 | 1994-11-01 | Nippon Shinyaku Co. Ltd. | Sulfonanilide derivatives and medicine |
| EP2266590A2 (en) | 2002-02-22 | 2010-12-29 | Shire LLC | Active agent delivery sytems and methods for protecting and administering active agents |
| EP2316469A1 (en) | 2002-02-22 | 2011-05-04 | Shire LLC | Delivery system and methods for protecting and administering dextroamphetamine |
| EP2316468A1 (en) | 2002-02-22 | 2011-05-04 | Shire LLC | Delivery system and methods for protecting and administering dextroamphetamine |
Also Published As
| Publication number | Publication date |
|---|---|
| FR95660E (fr) | 1971-04-16 |
| NL139523B (nl) | 1973-08-15 |
| US3341584A (en) | 1967-09-12 |
| CH475962A (de) | 1969-07-31 |
| FR3027M (fr) | 1964-12-28 |
| SE334368B (enExample) | 1971-04-26 |
| FR148F (enExample) | |
| DK122662B (da) | 1972-03-27 |
| DE1493955B2 (de) | 1976-11-18 |
| FR1599658A (enExample) | 1970-07-20 |
| BR6346374D0 (pt) | 1973-05-24 |
| DE1493955A1 (de) | 1971-08-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB993584A (enExample) | ||
| MX9804107A (es) | Derivados de quinolina. | |
| NZ314207A (en) | 1-(2-Oxoacetyl)-piperidine-2-carboxylic acid derivatives as multi drug resistant cancer cell sensitizers | |
| NO2013002I1 (no) | Aklidinium haogenid (Aklidinium bromid) | |
| HUP9800026A2 (hu) | Új, virális vagy bakteriális eredetű neuraminidázt szelektíven gátló vegyületek, azokat hatóanyagként tartalmazó gyógyszerkészítmények és eljárás előállításukra | |
| GB1520963A (en) | Erythromycin derivatives | |
| GB1435139A (en) | Thiazole derivatives | |
| ATE87313T1 (de) | Cephemverbindungen, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische praeparate. | |
| GB1451212A (en) | Pharmaceutical compositions containing a 4-aryl-2-3-pyridyl- thiazole and methods of using same | |
| MXPA99009882A (es) | Derivados de amidina como inhibidores de la oxidonitrico sintasa. | |
| HUP9702448A2 (hu) | Indolkarbonsavat tartalmazó, parenterálisan adható gyógyászati készítmény | |
| SE9701682D0 (sv) | Compounds | |
| GB1279543A (en) | Novel imidazolines, the preparation thereof and compositions containing the same | |
| NO174886C (no) | Analogifremgangsmåte for fremstilling av terapeutisk aktive pyrrolidin-derivater | |
| GB1464242A (en) | Benzoyl benzofurans and compositions comprising them | |
| GB1518621A (en) | Analgesic composition | |
| ZA911452B (en) | New use of 5-(2-(tert-butylamino)-1-hydroxyethyl)-m-phenylene-bis(dimethylcarbanate) | |
| GB1527483A (en) | 2-aminomethyl-5-phenyloxazoles and the pharmaceutically acceptable acid addition salts thereof | |
| SE7700814L (sv) | 2-nitroimidazolderivat | |
| DK36788D0 (da) | 6beta-(heterocyclyl-(s)-hydroxy)methyl-penicillansyreforbindelser og farmaceutiske praeparater indeholdende disse | |
| GB1531781A (en) | N-propargyl-piperonylamine and its preparation and use | |
| ES8301994A1 (es) | Procedimiento para preparar derivados de tetrahidrotiopira- no-(3,2-b) indol | |
| GB1420976A (en) | Pharmaceutical compositions for use in the treatment of certain respiratory diseases or conditions in prematurely born children | |
| GB1375806A (enExample) | ||
| GB1454390A (en) | Nasal decongestants |