GB528817A - Improvements in or relating to radio antenna - Google Patents
Improvements in or relating to radio antennaInfo
- Publication number
- GB528817A GB528817A GB14501/39A GB1450139A GB528817A GB 528817 A GB528817 A GB 528817A GB 14501/39 A GB14501/39 A GB 14501/39A GB 1450139 A GB1450139 A GB 1450139A GB 528817 A GB528817 A GB 528817A
- Authority
- GB
- United Kingdom
- Prior art keywords
- aerial
- elements
- conductor
- impedance
- radiated
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004020 conductor Substances 0.000 abstract 11
- 230000005540 biological transmission Effects 0.000 abstract 7
- 238000003491 array Methods 0.000 abstract 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 abstract 1
- 239000011889 copper foil Substances 0.000 abstract 1
- 238000006880 cross-coupling reaction Methods 0.000 abstract 1
- 230000003247 decreasing effect Effects 0.000 abstract 1
- 238000010438 heat treatment Methods 0.000 abstract 1
- 239000011810 insulating material Substances 0.000 abstract 1
- 239000012212 insulator Substances 0.000 abstract 1
- 230000003993 interaction Effects 0.000 abstract 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 abstract 1
- 230000005855 radiation Effects 0.000 abstract 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01Q—ANTENNAS, i.e. RADIO AERIALS
- H01Q9/00—Electrically-short antennas having dimensions not more than twice the operating wavelength and consisting of conductive active radiating elements
- H01Q9/04—Resonant antennas
- H01Q9/16—Resonant antennas with feed intermediate between the extremities of the antenna, e.g. centre-fed dipole
- H01Q9/28—Conical, cylindrical, cage, strip, gauze, or like elements having an extended radiating surface; Elements comprising two conical surfaces having collinear axes and adjacent apices and fed by two-conductor transmission lines
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01Q—ANTENNAS, i.e. RADIO AERIALS
- H01Q21/00—Antenna arrays or systems
- H01Q21/24—Combinations of antenna units polarised in different directions for transmitting or receiving circularly and elliptically polarised waves or waves linearly polarised in any direction
- H01Q21/26—Turnstile or like antennas comprising arrangements of three or more elongated elements disposed radially and symmetrically in a horizontal plane about a common centre
Landscapes
- Aerials With Secondary Devices (AREA)
- Variable-Direction Aerials And Aerial Arrays (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US208573A US2239724A (en) | 1938-05-18 | 1938-05-18 | Wide band antenna |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB528817A true GB528817A (en) | 1940-11-07 |
Family
ID=22775097
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB14501/39A Expired GB528817A (en) | 1938-05-18 | 1939-05-15 | Improvements in or relating to radio antenna |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US2239724A (enEXAMPLES) |
| DE (1) | DE894575C (enEXAMPLES) |
| GB (1) | GB528817A (enEXAMPLES) |
| NL (1) | NL62581C (enEXAMPLES) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0251818A3 (en) * | 1986-07-04 | 1990-03-14 | Nec Corporation | Omnidirectional antenna assembly |
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2450893A (en) * | 1941-05-17 | 1948-10-12 | Sperry Corp | High-frequency tube structure |
| US2434925A (en) * | 1942-05-27 | 1948-01-27 | Sperry Gyroscope Co Inc | Coupling means for relatively movable wave guides |
| US2486620A (en) * | 1943-10-25 | 1949-11-01 | Us Navy | Antenna system for short waves |
| US2478913A (en) * | 1944-02-07 | 1949-08-16 | Stromberg Carlson Co | Dipole antenna |
| US2512137A (en) * | 1944-06-16 | 1950-06-20 | Us Sec War | Antenna |
| US2418961A (en) * | 1944-08-01 | 1947-04-15 | Rca Corp | Broad band antenna for aircraft |
| US2417793A (en) * | 1944-08-01 | 1947-03-18 | Rca Corp | Antenna |
| US2449562A (en) * | 1944-10-03 | 1948-09-21 | Us Sec War | Antenna |
| US2490957A (en) * | 1945-06-30 | 1949-12-13 | Rca Corp | Antenna system |
| US2485930A (en) * | 1945-09-06 | 1949-10-25 | Us Socretary Of War | Connector |
| US2508438A (en) * | 1945-10-16 | 1950-05-23 | Douglas W Wilson | Broad band antenna |
| US2568710A (en) * | 1945-11-13 | 1951-09-25 | John T Bolljahn | Wide-band antenna |
| US2539680A (en) * | 1945-11-26 | 1951-01-30 | Rca Corp | Ultra high frequency antenna |
| US2501094A (en) * | 1945-12-10 | 1950-03-21 | Us Sec War | Antenna |
| US2512078A (en) * | 1946-01-22 | 1950-06-20 | Rca Corp | Broad-band antenna |
| US2485177A (en) * | 1946-02-28 | 1949-10-18 | Rca Corp | Broad-band antenna system |
| US2572995A (en) * | 1946-03-26 | 1951-10-30 | Allen S Dunbar | Antenna |
| US2633531A (en) * | 1946-03-29 | 1953-03-31 | Jessie A Nelson | Broad band antenna system |
| US2493569A (en) * | 1946-05-13 | 1950-01-03 | Gen Electric | Composite loop antenna system |
| US2799017A (en) * | 1946-08-31 | 1957-07-09 | Alford Andrew | Slotted cylindrical antennas |
| US2487567A (en) * | 1946-09-05 | 1949-11-08 | Rca Corp | Antenna |
| US2615131A (en) * | 1946-09-12 | 1952-10-21 | Rca Corp | Antenna and matching circuit |
| US2518843A (en) * | 1947-04-25 | 1950-08-15 | Rca Corp | Aircraft antenna |
| US2757738A (en) * | 1948-09-20 | 1956-08-07 | Union Oil Co | Radiation heating |
| US2659819A (en) * | 1949-02-15 | 1953-11-17 | Marconi Wireless Telegraph Co | Aerial system |
| US2700104A (en) * | 1949-04-29 | 1955-01-18 | Airborne Instr Lab Inc | Antenna feed system |
| FR1008844A (fr) * | 1950-01-18 | 1952-05-22 | Radio Industrie Sa | Perfectionnements aux aériens radioélectriques |
| US2706778A (en) * | 1950-06-19 | 1955-04-19 | Andrew W Walters | Cylindrical sleeve antenna |
| US2704811A (en) * | 1950-06-19 | 1955-03-22 | Andrew W Walters | Cylindrical antenna |
| US2724052A (en) * | 1950-11-30 | 1955-11-15 | Douglas Aircraft Co Inc | Radio antennas |
| US2742641A (en) * | 1951-01-19 | 1956-04-17 | Gen Electric | Antenna system |
| US2757370A (en) * | 1951-07-27 | 1956-07-31 | Andrew Corp | Television transmitting antennas |
| DE975023C (de) * | 1952-07-24 | 1961-07-06 | Heinz Dr Phil Graziadei | Breitband-Richtstrahlantenne mit einer leitenden Flaeche variabler Breite |
| DE1109748B (de) * | 1958-12-10 | 1961-06-29 | Siemens Ag | Antennenanordnung fuer kurze und sehr kurze elektromagnetische Wellen |
| US3273158A (en) * | 1961-07-19 | 1966-09-13 | Ling Temco Vought Inc | Multi-polarized tracking antenna |
| NL6403044A (enEXAMPLES) * | 1963-03-22 | 1964-09-23 | ||
| US3550145A (en) * | 1968-08-05 | 1970-12-22 | Us Army | Manipole broadband antenna |
| US4147912A (en) * | 1977-02-07 | 1979-04-03 | Roper Corporation | Shaped antenna for energy distribution in a microwave cooking cavity |
| JPS61176202A (ja) * | 1985-01-31 | 1986-08-07 | Harada Kogyo Kk | 広帯域極超短波用小型アンテナ |
| US5231412A (en) * | 1990-12-24 | 1993-07-27 | Motorola, Inc. | Sleeved monopole antenna |
| KR19990001739A (ko) * | 1997-06-17 | 1999-01-15 | 윤종용 | 이동통신용 듀얼밴드 안테나 |
| US6054961A (en) * | 1997-09-08 | 2000-04-25 | Andrew Corporation | Dual band, glass mount antenna and flexible housing therefor |
| US6351246B1 (en) * | 1999-05-03 | 2002-02-26 | Xtremespectrum, Inc. | Planar ultra wide band antenna with integrated electronics |
| WO2002013313A2 (en) * | 2000-08-07 | 2002-02-14 | Xtremespectrum, Inc. | Electrically small planar uwb antenna apparatus and system thereof |
| US6845253B1 (en) | 2000-09-27 | 2005-01-18 | Time Domain Corporation | Electromagnetic antenna apparatus |
| US6512488B2 (en) | 2001-05-15 | 2003-01-28 | Time Domain Corporation | Apparatus for establishing signal coupling between a signal line and an antenna structure |
| US6642903B2 (en) | 2001-05-15 | 2003-11-04 | Time Domain Corporation | Apparatus for establishing signal coupling between a signal line and an antenna structure |
| FR2843237B1 (fr) * | 2002-07-30 | 2008-07-04 | Thomson Licensing Sa | Antenne large bande et procedes de fabrication d'une telle antenne |
| US7064723B2 (en) * | 2003-10-20 | 2006-06-20 | Next-Rf, Inc. | Spectral control antenna apparatus and method |
| TWI267230B (en) * | 2004-06-15 | 2006-11-21 | Lin Ting Yu | Ultra wide band planner volcano smoke antenna |
| DE102005003685B4 (de) * | 2005-01-26 | 2021-02-11 | Rohde & Schwarz GmbH & Co. Kommanditgesellschaft | Antenne mit Reflektor |
| FR2883671A1 (fr) * | 2005-03-24 | 2006-09-29 | Groupe Ecoles Telecomm | Antenne ultra-large bande offrant une grande flexibilite de conception |
| US7737894B2 (en) * | 2007-05-31 | 2010-06-15 | Intel Corporation | CMOS IC and high-gain antenna integration for point-to-point wireless communication |
| US20160099505A1 (en) * | 2014-10-03 | 2016-04-07 | Nokia Solutions And Networks Oy | Modular active antenna structures and arrangements |
| EP4009442B1 (en) * | 2020-12-02 | 2025-08-06 | Rohde & Schwarz GmbH & Co. KG | Biconical antenna assembly |
-
0
- NL NL62581D patent/NL62581C/xx active
-
1938
- 1938-05-18 US US208573A patent/US2239724A/en not_active Expired - Lifetime
-
1939
- 1939-05-15 GB GB14501/39A patent/GB528817A/en not_active Expired
- 1939-05-20 DE DER2931D patent/DE894575C/de not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0251818A3 (en) * | 1986-07-04 | 1990-03-14 | Nec Corporation | Omnidirectional antenna assembly |
Also Published As
| Publication number | Publication date |
|---|---|
| NL62581C (enEXAMPLES) | |
| DE894575C (de) | 1953-10-26 |
| US2239724A (en) | 1941-04-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB528817A (en) | Improvements in or relating to radio antenna | |
| US2321454A (en) | Multiple section antenna | |
| US3273158A (en) | Multi-polarized tracking antenna | |
| US4446465A (en) | Low windload circularly polarized antenna | |
| US2455403A (en) | Antenna | |
| US2267889A (en) | Antenna with wide wave range | |
| US3789416A (en) | Shortened turnstile antenna | |
| GB538036A (en) | Antenna systems | |
| US4518968A (en) | Dipole and ground plane antennas with improved terminations for coaxial feeders | |
| US5818397A (en) | Circularly polarized horizontal beamwidth antenna having binary feed network with microstrip transmission line | |
| US2267951A (en) | Antenna | |
| US2539433A (en) | Circularly polarized antenna | |
| US2352977A (en) | Self-compensating video antenna | |
| US2688083A (en) | Multifrequency antenna | |
| US3613098A (en) | Electrically small cavity antenna | |
| US4031539A (en) | Broadband turnstile antenna | |
| US3702479A (en) | Space diversity antenna system for uhf satellite communications for helicopters | |
| US2210491A (en) | High frequency antenna | |
| US2465379A (en) | Antenna unit | |
| GB635343A (en) | Improvements in radio antennas | |
| US4611214A (en) | Tactical high frequency array antennas | |
| US2243677A (en) | Wide band antenna | |
| US3576567A (en) | Circularly polarized broadcast antenna | |
| US3114913A (en) | Wing type dipole antenna with u-shaped director | |
| US2267613A (en) | Broadcast antenna |