GB1574503A - Sailboard - Google Patents
Sailboard Download PDFInfo
- Publication number
- GB1574503A GB1574503A GB13242/77A GB1324277A GB1574503A GB 1574503 A GB1574503 A GB 1574503A GB 13242/77 A GB13242/77 A GB 13242/77A GB 1324277 A GB1324277 A GB 1324277A GB 1574503 A GB1574503 A GB 1574503A
- Authority
- GB
- United Kingdom
- Prior art keywords
- sailboard
- surfboard
- keel
- coupling
- coupling member
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000008878 coupling Effects 0.000 claims description 83
- 238000010168 coupling process Methods 0.000 claims description 83
- 238000005859 coupling reaction Methods 0.000 claims description 83
- 239000012858 resilient material Substances 0.000 claims description 10
- 230000014759 maintenance of location Effects 0.000 claims description 3
- 239000002131 composite material Substances 0.000 claims description 2
- 230000000295 complement effect Effects 0.000 claims 1
- 239000004033 plastic Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 238000010276 construction Methods 0.000 description 2
- JTJMJGYZQZDUJJ-UHFFFAOYSA-N phencyclidine Chemical compound C1CCCCN1C1(C=2C=CC=CC=2)CCCCC1 JTJMJGYZQZDUJJ-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- RYAUSSKQMZRMAI-YESZJQIVSA-N (S)-fenpropimorph Chemical compound C([C@@H](C)CC=1C=CC(=CC=1)C(C)(C)C)N1C[C@H](C)O[C@H](C)C1 RYAUSSKQMZRMAI-YESZJQIVSA-N 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B63—SHIPS OR OTHER WATERBORNE VESSELS; RELATED EQUIPMENT
- B63B—SHIPS OR OTHER WATERBORNE VESSELS; EQUIPMENT FOR SHIPPING
- B63B32/00—Water sports boards; Accessories therefor
- B63B32/50—Boards characterised by their constructional features
- B63B32/53—Sectionalised boards, e.g. modular, dismountable or foldable boards
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B63—SHIPS OR OTHER WATERBORNE VESSELS; RELATED EQUIPMENT
- B63H—MARINE PROPULSION OR STEERING
- B63H8/00—Sail or rigging arrangements specially adapted for water sports boards, e.g. for windsurfing or kitesurfing
- B63H8/20—Rigging arrangements involving masts, e.g. for windsurfing
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Combustion & Propulsion (AREA)
- Mechanical Engineering (AREA)
- Ocean & Marine Engineering (AREA)
- Aiming, Guidance, Guns With A Light Source, Armor, Camouflage, And Targets (AREA)
- Toys (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19767610087 DE7610087U (de) | 1976-04-01 | Teilbares Segelsurf brett | |
| DE19777707436 DE7707436U (de) | 1977-03-10 | Segelbrett oder Windsurfer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1574503A true GB1574503A (en) | 1980-09-10 |
Family
ID=25947789
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB13242/77A Expired GB1574503A (en) | 1976-04-01 | 1977-03-29 | Sailboard |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US4100870A (cg-RX-API-DMAC7.html) |
| FR (1) | FR2346205A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1574503A (cg-RX-API-DMAC7.html) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2161428A (en) * | 1984-07-11 | 1986-01-15 | Gilbert Marcus Filshie | Sail board |
| GB2186853A (en) * | 1986-02-20 | 1987-08-26 | Kristoffer Idland | Mooring device |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES237490Y (es) * | 1978-01-20 | 1979-06-16 | Akutec Angewandte Kunststofftechnik Gmbh | Plataforma para la navegacion ligera a vela |
| US4284024A (en) * | 1978-04-25 | 1981-08-18 | Montgomery Jon A | Multi-hull boat |
| NL7906848A (nl) * | 1978-09-20 | 1980-03-24 | Ten Cate Sports | Samengestelde zeilplank. |
| EP0012288A1 (de) * | 1978-12-09 | 1980-06-25 | Duetto - Surf Wassersportgeräte GmbH | Schwimmbrettanordnung für ein Windsurfgerät sowie Brückeneinheit hierfür |
| US4234211A (en) * | 1979-04-27 | 1980-11-18 | Gregory Lux | Ski sail apparatus |
| USD260106S (en) | 1979-07-09 | 1981-08-04 | Peritz Richard C | Plural man surfboat |
| US4345534A (en) * | 1979-10-15 | 1982-08-24 | Carter Offshore Design, Inc. | Sail rigging system |
| NL8000841A (nl) * | 1980-02-11 | 1981-09-01 | Polymarin Bv | Surfplank of dergelijk planerend vaartuig. |
| US4421491A (en) * | 1981-06-22 | 1983-12-20 | Pleass Charles M | Linking sailboards |
| US4365570A (en) * | 1981-08-03 | 1982-12-28 | Jamieson Robert S | Sail system for sailboards |
| EP0106932A1 (fr) * | 1982-10-22 | 1984-05-02 | Guiseppe Poggi | Embarcation pouvant être transformée alternativement en planche à voile (wind surf) et en catamaran |
| DE3309502A1 (de) * | 1983-03-17 | 1984-09-27 | Joachim 7141 Beilstein Puschbeck | Surfschlitten |
| FR2549442B1 (fr) * | 1983-07-21 | 1985-10-11 | Vacher Serge | Planche a voile extensible en tandem |
| US4807549A (en) * | 1984-07-12 | 1989-02-28 | Stephen Rhodes | Collapsable elongated articles including sailboards and the like |
| FR2572703A1 (fr) * | 1984-11-07 | 1986-05-09 | Germain Guillaume | Planche a voile a polyvalence conferee par diverses extensions de son arriere |
| US5592892A (en) * | 1995-10-13 | 1997-01-14 | Kerckhoff; Brian | Multihull windsurfer |
| FR2742119B1 (fr) * | 1995-12-11 | 1998-03-06 | Noot Yan | Embarcation en au moins deux parties montables et demontables |
| US20070178783A1 (en) * | 2006-01-31 | 2007-08-02 | Alyssa Hansen | Wave rider with connector strap and signal light |
| ES1062541Y (es) * | 2006-03-23 | 2006-10-01 | Roig Prudenci Sarda | Embarcacion de vela ligera perfeccionada |
| FR2905352B1 (fr) * | 2006-09-04 | 2009-08-14 | Richard Gaston | Ensemble d'element composants une planche de glisse. |
| US9174709B2 (en) | 2011-07-01 | 2015-11-03 | Johan Ekstedt | Arrangements for windsurfing |
| US10023275B2 (en) * | 2015-03-09 | 2018-07-17 | Mark Carroll | Selectively deployable fin system for watercraft and method of use |
| US10059411B1 (en) * | 2016-04-09 | 2018-08-28 | Shaine Shahin Ebrahimi | Quad bow paddle board |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US350123A (en) * | 1886-10-05 | Toboggan | ||
| US2593806A (en) * | 1949-05-07 | 1952-04-22 | Doty M Steele | Surf board with an extensible keel member |
| US2741782A (en) * | 1952-04-03 | 1956-04-17 | Oskar A Muller | Sectional row boat |
| US2776637A (en) * | 1954-03-04 | 1957-01-08 | William R Chadwick | Boat construction |
| US2944505A (en) * | 1955-11-22 | 1960-07-12 | Berge Jacques Marie Al Charles | Catamaran sail boat |
| US2927799A (en) * | 1958-10-10 | 1960-03-08 | Franz X Schnitzler | Multi-part sled |
| US3090053A (en) * | 1961-11-20 | 1963-05-21 | William G Fletcher | Device for securing small boats together |
| FR1313023A (fr) * | 1962-01-30 | 1962-12-21 | Canot constitué au moyen d'éléments démontables | |
| US3150385A (en) * | 1962-09-12 | 1964-09-29 | Julian F Gerber | Collapsible boat |
| US3273528A (en) * | 1964-07-20 | 1966-09-20 | Michael C Kiefer | Windsurfer |
| US3409920A (en) * | 1966-10-25 | 1968-11-12 | Charles R. Brownley | Sectionalized surfboard |
| US3374495A (en) * | 1967-08-22 | 1968-03-26 | William P. Joyce | Surfboard nose bumper |
| US3455261A (en) * | 1968-05-15 | 1969-07-15 | Hugh Perrin | Kite board |
| FR2202491A5 (cg-RX-API-DMAC7.html) * | 1972-10-10 | 1974-05-03 | Lombard Jacques | |
| DE2423251A1 (de) * | 1974-05-14 | 1975-11-27 | Immobilien Commerce Establishm | Windsurfer |
-
1977
- 1977-03-29 GB GB13242/77A patent/GB1574503A/en not_active Expired
- 1977-04-01 US US05/783,845 patent/US4100870A/en not_active Expired - Lifetime
- 1977-04-01 FR FR7709891A patent/FR2346205A1/fr active Granted
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2161428A (en) * | 1984-07-11 | 1986-01-15 | Gilbert Marcus Filshie | Sail board |
| GB2186853A (en) * | 1986-02-20 | 1987-08-26 | Kristoffer Idland | Mooring device |
| GB2186853B (en) * | 1986-02-20 | 1990-03-07 | Kristoffer Idland | Arrangement for mooring barges to each other |
Also Published As
| Publication number | Publication date |
|---|---|
| US4100870A (en) | 1978-07-18 |
| FR2346205A1 (fr) | 1977-10-28 |
| FR2346205B1 (cg-RX-API-DMAC7.html) | 1982-02-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4100870A (en) | Surfboard | |
| US5127862A (en) | Water craft | |
| US9586651B2 (en) | Universal hydrofoil connector system and method of attachment | |
| GB1574881A (en) | Dismantlable floating craft | |
| US5809926A (en) | Lifting fin | |
| US4929207A (en) | Body surfboard with added flotation | |
| JPH02502987A (ja) | 舟艇用フランジ付フィン | |
| US4561371A (en) | Catamaran stabilization structure | |
| US6106346A (en) | Stabilizing fin for a water planing device | |
| US4730568A (en) | Waterborne craft | |
| JPH0328356B2 (cg-RX-API-DMAC7.html) | ||
| US4703708A (en) | Steerable keel | |
| US5024177A (en) | Wind sailing surf vessel with dual planar surfaces | |
| US4479451A (en) | Sail with air envelope and contour shaping parts | |
| US6070544A (en) | Boat with outriggers | |
| EP0083806A1 (en) | A sail and rigging for a sailing-apparatus | |
| GB2053806A (en) | Surfboards | |
| US5038694A (en) | Small sailing ship | |
| US6254446B1 (en) | Wakeboard fin | |
| GB2128568A (en) | Boat | |
| US20050022717A1 (en) | Self-propelled personal watercraft | |
| US4922845A (en) | Boom for a sailing device | |
| US4753183A (en) | Double boom rigged windsurfer | |
| US5704305A (en) | Wind sailing vessel | |
| US20020053312A1 (en) | Adjustable thigh brace |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |