GB1569588A - Electrical radiation heater for a glass ceramic plate - Google Patents
Electrical radiation heater for a glass ceramic plate Download PDFInfo
- Publication number
- GB1569588A GB1569588A GB46898/76A GB4689876A GB1569588A GB 1569588 A GB1569588 A GB 1569588A GB 46898/76 A GB46898/76 A GB 46898/76A GB 4689876 A GB4689876 A GB 4689876A GB 1569588 A GB1569588 A GB 1569588A
- Authority
- GB
- United Kingdom
- Prior art keywords
- radiation heater
- insulating
- strip
- insulating sheet
- sheet
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000005855 radiation Effects 0.000 title claims description 40
- 239000002241 glass-ceramic Substances 0.000 title claims description 28
- 238000010438 heat treatment Methods 0.000 claims description 48
- 239000004020 conductor Substances 0.000 claims description 38
- 239000000463 material Substances 0.000 claims description 16
- 238000004873 anchoring Methods 0.000 claims description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 9
- WYTGDNHDOZPMIW-RCBQFDQVSA-N alstonine Natural products C1=CC2=C3C=CC=CC3=NC2=C2N1C[C@H]1[C@H](C)OC=C(C(=O)OC)[C@H]1C2 WYTGDNHDOZPMIW-RCBQFDQVSA-N 0.000 claims description 9
- 239000011810 insulating material Substances 0.000 claims description 9
- 239000000126 substance Substances 0.000 claims description 8
- 239000011230 binding agent Substances 0.000 claims description 4
- 239000000377 silicon dioxide Substances 0.000 claims description 4
- 238000005452 bending Methods 0.000 claims description 3
- 230000000149 penetrating effect Effects 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 239000002657 fibrous material Substances 0.000 claims 1
- QEVHRUUCFGRFIF-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C(C5=CC=C(OC)C=C5N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 QEVHRUUCFGRFIF-MDEJGZGSSA-N 0.000 claims 1
- 239000000919 ceramic Substances 0.000 description 8
- 239000000523 sample Substances 0.000 description 7
- 238000010276 construction Methods 0.000 description 3
- 238000013021 overheating Methods 0.000 description 3
- 125000006850 spacer group Chemical group 0.000 description 3
- 238000010411 cooking Methods 0.000 description 2
- 238000009413 insulation Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- MWRWFPQBGSZWNV-UHFFFAOYSA-N Dinitrosopentamethylenetetramine Chemical compound C1N2CN(N=O)CN1CN(N=O)C2 MWRWFPQBGSZWNV-UHFFFAOYSA-N 0.000 description 1
- HHUIAYDQMNHELC-UHFFFAOYSA-N [O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O HHUIAYDQMNHELC-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229910010293 ceramic material Inorganic materials 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000012777 electrically insulating material Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 238000004080 punching Methods 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05B—ELECTRIC HEATING; ELECTRIC LIGHT SOURCES NOT OTHERWISE PROVIDED FOR; CIRCUIT ARRANGEMENTS FOR ELECTRIC LIGHT SOURCES, IN GENERAL
- H05B3/00—Ohmic-resistance heating
- H05B3/68—Heating arrangements specially adapted for cooking plates or analogous hot-plates
- H05B3/74—Non-metallic plates, e.g. vitroceramic, ceramic or glassceramic hobs, also including power or control circuits
- H05B3/748—Resistive heating elements, i.e. heating elements exposed to the air, e.g. coil wire heater
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05B—ELECTRIC HEATING; ELECTRIC LIGHT SOURCES NOT OTHERWISE PROVIDED FOR; CIRCUIT ARRANGEMENTS FOR ELECTRIC LIGHT SOURCES, IN GENERAL
- H05B2203/00—Aspects relating to Ohmic resistive heating covered by group H05B3/00
- H05B2203/002—Heaters using a particular layout for the resistive material or resistive elements
- H05B2203/003—Heaters using a particular layout for the resistive material or resistive elements using serpentine layout
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05B—ELECTRIC HEATING; ELECTRIC LIGHT SOURCES NOT OTHERWISE PROVIDED FOR; CIRCUIT ARRANGEMENTS FOR ELECTRIC LIGHT SOURCES, IN GENERAL
- H05B2203/00—Aspects relating to Ohmic resistive heating covered by group H05B3/00
- H05B2203/014—Heaters using resistive wires or cables not provided for in H05B3/54
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Ceramic Engineering (AREA)
- Resistance Heating (AREA)
- Surface Heating Bodies (AREA)
- Electric Stoves And Ranges (AREA)
- Baking, Grill, Roasting (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2551137A DE2551137C2 (de) | 1975-11-14 | 1975-11-14 | Elektrischer Strahlungsheizkörper für Glaskeramikkochplatten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1569588A true GB1569588A (en) | 1980-06-18 |
Family
ID=5961732
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB46898/76A Expired GB1569588A (en) | 1975-11-14 | 1976-11-11 | Electrical radiation heater for a glass ceramic plate |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4161648A (enExample) |
| JP (1) | JPS5284538A (enExample) |
| AU (1) | AU506463B2 (enExample) |
| CA (1) | CA1076185A (enExample) |
| DE (1) | DE2551137C2 (enExample) |
| FR (1) | FR2331931A1 (enExample) |
| GB (1) | GB1569588A (enExample) |
| SE (1) | SE421477B (enExample) |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2136659A (en) * | 1983-01-21 | 1984-09-19 | Irca Spa | An electric heating element particularly for hot-plates |
| GB2275161A (en) * | 1993-02-11 | 1994-08-17 | Ceramaspeed Ltd | A radiant electric heating element |
| GB2275160A (en) * | 1993-02-11 | 1994-08-17 | Ceramaspeed Ltd | Supporting radiant heating element |
| EP0612199A1 (en) * | 1993-02-11 | 1994-08-24 | Ceramaspeed Limited | Electrical heating element, its manufacture and use |
| GB2275405A (en) * | 1993-02-11 | 1994-08-24 | Ceramaspeed Ltd | Mounting radiant electrical heating element |
| GB2290688A (en) * | 1994-06-24 | 1996-01-03 | Ceramaspeed Ltd | Conductive strip heating element |
| GB2324233A (en) * | 1997-04-12 | 1998-10-14 | Ceramaspeed Ltd | Flexible support for heating element |
| US10451292B2 (en) | 2014-12-11 | 2019-10-22 | Eika, S. Coop. | Radiant heater for a cooktop |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2729930C2 (de) * | 1977-07-02 | 1993-02-18 | E.G.O. Elektro-Geräte Blanc u. Fischer, 7519 Oberderdingen | Verfahren zur Herstellung eines elektrischen Strahlungs-Heizelementes |
| GB2044057B (en) * | 1979-02-07 | 1983-04-20 | Micropore International Ltd | Smooth top cookers |
| US4262192A (en) * | 1979-08-15 | 1981-04-14 | The Kanthal Corporation | Molybdenum disilicide resistance wire and support |
| US4292504A (en) * | 1979-10-02 | 1981-09-29 | Tutco, Inc. | Expanded metal electric heating element with edge support |
| DE3008505C2 (de) * | 1980-03-05 | 1983-08-25 | Grünzweig + Hartmann und Glasfaser AG, 6700 Ludwigshafen | Vorrichtung zur Wärmedämmung einer Wärmequelle |
| EP0037638B1 (en) * | 1980-03-05 | 1984-05-09 | Kenwood Manufacturing Company Limited | Cooking apparatus |
| DE3020326C2 (de) * | 1980-05-29 | 1985-12-19 | Grünzweig + Hartmann und Glasfaser AG, 6700 Ludwigshafen | Strahlungsheizkörper mit einer elektrischen Heizwendel, insbesondere für eine Glaskeramik-Kochplatte |
| JPH028399Y2 (enExample) * | 1980-08-12 | 1990-02-28 | ||
| DE3034775C2 (de) * | 1980-09-15 | 1983-08-18 | Grünzweig + Hartmann und Glasfaser AG, 6700 Ludwigshafen | Verfahren zur Herstellung einer Vorrichtung zur Wärmedämmung einer Wärmequelle |
| DE3129239A1 (de) * | 1981-07-24 | 1983-02-10 | E.G.O. Elektro-Geräte Blanc u. Fischer, 7519 Oberderdingen | Elektrischer heizkoerper fuer die beheizung einer platte und verfahren zu seiner herstellung |
| DE3519350A1 (de) * | 1985-05-30 | 1986-12-04 | E.G.O. Elektro-Geräte Blanc u. Fischer, 7519 Oberderdingen | Strahlungs-heizeinheit |
| DE3527413A1 (de) * | 1985-07-31 | 1987-02-12 | Ego Elektro Blanc & Fischer | Elektrischer strahlheizkoerper zur beheizung von heizflaechen sowie verfahren und vorrichtung zu seiner herstellung |
| JPS62103190U (enExample) * | 1985-12-20 | 1987-07-01 | ||
| DE3617742A1 (de) * | 1986-05-27 | 1987-12-03 | Ego Elektro Blanc & Fischer | Elektrokochplatte |
| DE3635345A1 (de) * | 1986-10-17 | 1988-04-28 | Ego Elektro Blanc & Fischer | Strahlheizkoerper |
| DE3800676A1 (de) * | 1988-01-13 | 1989-07-27 | Eichenauer Gmbh & Co Kg F | Heizvorrichtung, insbesondere als kochplatte |
| US4829282A (en) * | 1988-01-21 | 1989-05-09 | Btu Engineering Corporation | High efficiency high heat output electrical heater assembly |
| US5221829A (en) * | 1990-10-15 | 1993-06-22 | Shimon Yahav | Domestic cooking apparatus |
| DE4039501A1 (de) * | 1990-12-11 | 1992-06-17 | Ego Elektro Blanc & Fischer | Elektrischer heizkoerper, insbesondere strahlheizkoerper |
| ES2077329T3 (es) * | 1991-11-13 | 1995-11-16 | Ego Elektro Blanc & Fischer | Conductor de caldeo radiante de un elemento radiador electrico. |
| US5796075A (en) * | 1992-03-09 | 1998-08-18 | E.G.O. Elektro-Gerate Blanc Und Fisher Gmbh & Co. Kg | Heater, particularly for kitchen appliances |
| DE4229375C2 (de) * | 1992-09-03 | 2000-05-04 | Ego Elektro Blanc & Fischer | Strahlungs-Heizkörper |
| DE4229373A1 (de) * | 1992-09-03 | 1994-03-10 | Ego Elektro Blanc & Fischer | Heizkörper, insbesondere für Kochgeräte |
| GB2275162B (en) * | 1993-02-11 | 1996-04-10 | Ceramaspeed Ltd | Radiant electric heater method |
| GB2275163B (en) * | 1993-02-11 | 1996-04-03 | Ceramaspeed Ltd | Radiant electric heater and method |
| DE4304539A1 (de) * | 1993-02-11 | 1994-08-18 | Belzig Elektrowaerme Gmbh | Strahlungsheizkörper für Glaskeramikkochflächen |
| GB2278261B (en) * | 1993-05-21 | 1996-07-03 | Ceramaspeed Ltd | Method of manufacturing a radiant electric heater |
| DE4332884A1 (de) * | 1993-09-21 | 1995-03-23 | Belzig Elektrowaerme Gmbh | Strahlungsheizkörper für Glaskeramikkochflächen |
| ES2079293B1 (es) * | 1993-09-28 | 1998-01-16 | Eika S Coop Ltda | Dispositivo calefactor para placa de cocina. |
| DE19506685A1 (de) * | 1995-02-25 | 1996-08-29 | Ego Elektro Blanc & Fischer | Elektrischer Strahlungsheizkörper und Verfahren zu seiner Herstellung |
| DE19518109A1 (de) * | 1995-05-17 | 1996-11-21 | Ego Elektro Blanc & Fischer | Strahlungs-Heizer |
| DE19522798A1 (de) * | 1995-06-23 | 1997-01-02 | Ego Elektro Blanc & Fischer | Verfahren zur Herstellung eines Strahlungsheizkörpers und Strahlungsheizkörper |
| US5837975A (en) * | 1996-07-29 | 1998-11-17 | Emerson Electric Co. | Corrugated strip, radiant heater element |
| GB2318489B (en) * | 1996-10-18 | 2000-09-06 | Ceramaspeed Ltd | Radiant electric heater and method of manufacture |
| CZ169298A3 (cs) * | 1997-07-15 | 1999-02-17 | Ako-Werke Gmbh & Co. Kg | Topný vodič pro sálavé topné těleso kuchyňského vařiče |
| US5977524A (en) * | 1997-10-15 | 1999-11-02 | Emerson Electric Company | Microwire staple for holding the resistive member of a heating element in place |
| US5935469A (en) * | 1997-10-23 | 1999-08-10 | Emerson Electric Co. | Insulating staple for holding the resistive member of a heating element in place |
| DE19755114A1 (de) | 1997-12-11 | 1999-06-17 | Ego Elektro Geraetebau Gmbh | Heizkörper, insbesondere für Küchengeräte |
| ES2137135B1 (es) * | 1998-04-08 | 2000-08-16 | Eika S Coop | Fijacion de la resistencia calefactora en placa de cocina. |
| GB2336985A (en) * | 1998-04-30 | 1999-11-03 | Ceramaspeed Ltd | A radiant electric heater having both a lamp-form heating element and a ribbon heating element |
| DE19856669A1 (de) * | 1998-12-09 | 2000-06-15 | Ego Elektro Geraetebau Gmbh | Heizkörper, insbesondere für Küchengeräte |
| WO2000075018A1 (en) * | 1999-06-09 | 2000-12-14 | Atsunobu Sakamoto | Heater wire for device such as impulse heat sealer |
| ES1048230Y (es) * | 2001-02-02 | 2001-12-01 | Eika S Coop | Resistencia electrica de caldeo plana para una placa de cocina. |
| ITPN20010045U1 (it) * | 2001-11-19 | 2003-05-19 | Irca Spa | Resistenza elettrica corrugata e relativa piastra irradiante. |
| DE102005036581A1 (de) * | 2005-08-01 | 2007-02-08 | Electrovac Ag | Heizband für einen elektrischen Heizer, Heizer mit einem derartigen Heizband sowie Verfahren zum Herstellen des Heizbandes |
| GB0811980D0 (en) * | 2008-07-07 | 2008-07-30 | Ceramaspeed Ltd | Radiant electric heater |
| WO2014199647A1 (en) * | 2013-06-14 | 2014-12-18 | Sandvik Kk | Molybdenum disilicide-based ceramic heating element holding structure |
| US10757762B2 (en) | 2017-12-01 | 2020-08-25 | Haier Us Appliance Solutions, Inc. | Electric cooktop appliance |
| CN109392203A (zh) * | 2018-08-01 | 2019-02-26 | 安吉热威电热科技有限公司 | 一种电阻丝结构及带有该电阻丝的电辐射加热器 |
| DE102018218245A1 (de) | 2018-10-24 | 2020-04-30 | E.G.O. Elektro-Gerätebau GmbH | Heizeinrichtung und Elektrokochgerät |
| RU2770898C1 (ru) * | 2021-10-07 | 2022-04-25 | Общество с ограниченной ответственностью «ДЖИБИЭСРУС» | Малошумный нагревательный элемент (варианты) и профилированное дно емкости |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US600057A (en) * | 1898-03-01 | Rheostat and electric heater | ||
| US1233183A (en) * | 1916-06-05 | 1917-07-10 | Gen Electric | Electrical heating unit and method of making the same. |
| GB196480A (en) * | 1922-05-01 | 1923-04-26 | Robert Frederick Baerlocher | Improvements in electrical resistance grids |
| CH250845A (de) * | 1942-06-02 | 1947-09-30 | Satchwell Leonard | Verfahren zur Herstellung eines induktionsfreien, gitterförmigen, elektrischen Widerstandselementes. |
| US2570975A (en) * | 1946-07-27 | 1951-10-09 | Mcgraw Electric Co | Electric heating element |
| US3086101A (en) * | 1956-05-17 | 1963-04-16 | Philco Corp | Heaters |
| GB877776A (en) * | 1959-06-08 | 1961-09-20 | Gen Electric Co Ltd | Improvements in or relating to electric heating elements |
| US3346720A (en) * | 1965-05-25 | 1967-10-10 | Gen Motors Corp | Infrared surface heating unit with corrugated ribbon-shaped filament |
| DE1917257A1 (de) * | 1969-04-03 | 1970-12-23 | Heinrich Steinel Ohg | Infrarotstrahler |
| US3567906A (en) * | 1969-04-14 | 1971-03-02 | Gen Electric | Planar surface heater with integral fasteners for heating element |
| US3612827A (en) * | 1970-01-12 | 1971-10-12 | Gen Electric | Flat plate surface heating unit |
| US3612828A (en) * | 1970-06-22 | 1971-10-12 | Gen Motors Corp | Infrared radiant open coil heating unit with reflective fibrous-ceramic heater block |
| US3646321A (en) * | 1970-06-22 | 1972-02-29 | Gen Motors Corp | Infrared surface heating unit |
| US3612829A (en) * | 1970-07-17 | 1971-10-12 | Gen Motors Corp | Ceramic top infrared cooking assembly |
| US3612826A (en) * | 1970-07-17 | 1971-10-12 | Gen Motors Corp | Surface temperature indicator light for ceramic top infrared radiant range |
| GB1342070A (en) * | 1970-12-15 | 1973-12-25 | Thorn Electrical Ind Ltd | Electrical devices having thermal or incandescent elements |
| DE2207343B1 (de) * | 1972-02-17 | 1973-08-09 | Siemens-Electrogeräte GmbH, 1000 Berlin u. 8000 München | Elektrische heizplatte |
| US3749883A (en) * | 1972-07-17 | 1973-07-31 | Emerson Electric Co | Electric heater assembly |
| GB1433478A (en) * | 1972-08-05 | 1976-04-28 | Mcwilliams J A | Electrical heating apparatus |
| US3838505A (en) * | 1973-11-02 | 1974-10-01 | Whirlpool Co | Method of forming glass-ceramic cooktop construction |
| US3912905A (en) * | 1974-02-25 | 1975-10-14 | Kanthal Corp | Electric resistance heating device |
| US3984615A (en) * | 1975-10-14 | 1976-10-05 | Btu Engineering Corporation | Electrical resistance furnace heater |
-
1975
- 1975-11-14 DE DE2551137A patent/DE2551137C2/de not_active Expired
-
1976
- 1976-10-04 SE SE7610982A patent/SE421477B/xx not_active IP Right Cessation
- 1976-10-25 JP JP12740276A patent/JPS5284538A/ja active Granted
- 1976-10-29 AU AU19137/76A patent/AU506463B2/en not_active Expired
- 1976-11-02 FR FR7632997A patent/FR2331931A1/fr active Granted
- 1976-11-03 US US05/738,517 patent/US4161648A/en not_active Expired - Lifetime
- 1976-11-11 GB GB46898/76A patent/GB1569588A/en not_active Expired
- 1976-11-12 CA CA265,424A patent/CA1076185A/en not_active Expired
Cited By (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2136659A (en) * | 1983-01-21 | 1984-09-19 | Irca Spa | An electric heating element particularly for hot-plates |
| US5477031A (en) * | 1993-02-11 | 1995-12-19 | Ceramaspeed Limited | Electrical heating element, its manufacture and use |
| GB2275160B (en) * | 1993-02-11 | 1996-04-03 | Ceramaspeed Ltd | Method of manufacturing a radiant electric heater |
| EP0612199A1 (en) * | 1993-02-11 | 1994-08-24 | Ceramaspeed Limited | Electrical heating element, its manufacture and use |
| GB2275405A (en) * | 1993-02-11 | 1994-08-24 | Ceramaspeed Ltd | Mounting radiant electrical heating element |
| EP0612198A1 (en) * | 1993-02-11 | 1994-08-24 | Ceramaspeed Limited | Electrical heating element and heater incorporating same |
| US5453597A (en) * | 1993-02-11 | 1995-09-26 | Ceramaspeed Limited | Electrical heating element and heater incorporating same |
| US5471737A (en) * | 1993-02-11 | 1995-12-05 | Ceramaspeed Limited | Method of manufacturing a radiant electric heater |
| GB2275161A (en) * | 1993-02-11 | 1994-08-17 | Ceramaspeed Ltd | A radiant electric heating element |
| GB2275160A (en) * | 1993-02-11 | 1994-08-17 | Ceramaspeed Ltd | Supporting radiant heating element |
| GB2275161B (en) * | 1993-02-11 | 1996-05-15 | Ceramaspeed Ltd | Method of manufacturing a radiant electric heater |
| US5699606A (en) * | 1993-02-11 | 1997-12-23 | Ceramaspeed Limited | Method of manufacturing a radiant electric heater |
| GB2275405B (en) * | 1993-02-11 | 1996-07-24 | Ceramaspeed Ltd | Electric heating element |
| GB2290688A (en) * | 1994-06-24 | 1996-01-03 | Ceramaspeed Ltd | Conductive strip heating element |
| GB2324233A (en) * | 1997-04-12 | 1998-10-14 | Ceramaspeed Ltd | Flexible support for heating element |
| GB2324233B (en) * | 1997-04-12 | 2001-02-28 | Ceramaspeed Ltd | Electric heater and method of manufacture |
| US6216334B1 (en) | 1997-04-12 | 2001-04-17 | Ceramaspeed Limited | Electric heater and method of manufacture |
| US10451292B2 (en) | 2014-12-11 | 2019-10-22 | Eika, S. Coop. | Radiant heater for a cooktop |
Also Published As
| Publication number | Publication date |
|---|---|
| SE421477B (sv) | 1981-12-21 |
| FR2331931B1 (enExample) | 1982-08-20 |
| AU506463B2 (en) | 1980-01-03 |
| US4161648A (en) | 1979-07-17 |
| JPS5284538A (en) | 1977-07-14 |
| DE2551137C2 (de) | 1986-04-24 |
| DE2551137A1 (de) | 1977-05-18 |
| FR2331931A1 (fr) | 1977-06-10 |
| CA1076185A (en) | 1980-04-22 |
| JPS5614223B2 (enExample) | 1981-04-02 |
| AU1913776A (en) | 1978-05-04 |
| SE7610982L (sv) | 1977-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1569588A (en) | Electrical radiation heater for a glass ceramic plate | |
| US4350875A (en) | Radiant heating elements for smooth top cookers | |
| CA1066343A (en) | Flat plate heating unit with foil heating means | |
| US4150280A (en) | High efficiency free expansion foil heating element | |
| US4292504A (en) | Expanded metal electric heating element with edge support | |
| FI69230B (fi) | Elektrisk kokplatta | |
| GB1600568A (en) | Heating unit for an electric cooking appliance | |
| ATE24814T1 (de) | Elektrischer heizkoerper. | |
| US5837975A (en) | Corrugated strip, radiant heater element | |
| GB2275161A (en) | A radiant electric heating element | |
| JP3418842B2 (ja) | 放射電熱器及びその製造方法 | |
| US6207935B1 (en) | Radiant heating element with a metal foil heat conductor | |
| GB2069300A (en) | Radiant heating elements for smooth top cookers | |
| GB2275162A (en) | Supporting radiant heating element | |
| EP0954202B1 (en) | Radiant electric heater | |
| US6216334B1 (en) | Electric heater and method of manufacture | |
| FR2559886B1 (fr) | Dispositif de chauffage electrique comportant un element chauffant resistif | |
| GB2324946A (en) | Radiant electric heater with visible radiation shielding | |
| US5977524A (en) | Microwire staple for holding the resistive member of a heating element in place | |
| KR20200047387A (ko) | 가열 장치 및 전기 조리 기구 | |
| JPH0538555Y2 (enExample) | ||
| SU714663A1 (ru) | Панельный электронагреватель | |
| JP2861577B2 (ja) | 電気ヒーター | |
| IT8322031A0 (it) | Dispositivo di connessione per un radiatore di riscaldamento, preferibilmente con isolamento a perline, specilamente per apparecchio di riscaldamento per forni di cottura. | |
| JPS6238832B2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |
Effective date: 19951111 |