GB1568439A - Polystyrenes comprising organoarsine substituents - Google Patents
Polystyrenes comprising organoarsine substituents Download PDFInfo
- Publication number
- GB1568439A GB1568439A GB53264/77A GB5326477A GB1568439A GB 1568439 A GB1568439 A GB 1568439A GB 53264/77 A GB53264/77 A GB 53264/77A GB 5326477 A GB5326477 A GB 5326477A GB 1568439 A GB1568439 A GB 1568439A
- Authority
- GB
- United Kingdom
- Prior art keywords
- polystyrene
- polymer
- catalyst
- reaction
- isocyanate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004793 Polystyrene Substances 0.000 title description 45
- 229920002223 polystyrene Polymers 0.000 title description 45
- 229920000642 polymer Polymers 0.000 claims description 28
- 239000003054 catalyst Substances 0.000 claims description 25
- 238000000034 method Methods 0.000 claims description 24
- 239000012948 isocyanate Substances 0.000 claims description 17
- 150000002513 isocyanates Chemical class 0.000 claims description 17
- 150000001718 carbodiimides Chemical class 0.000 claims description 13
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 32
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- -1 hexadecenyl Chemical group 0.000 description 9
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 8
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical group C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 6
- 125000001246 bromo group Chemical group Br* 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 239000000178 monomer Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 229910015900 BF3 Inorganic materials 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 125000003944 tolyl group Chemical group 0.000 description 3
- SBYMUDUGTIKLCR-UHFFFAOYSA-N 2-chloroethenylbenzene Chemical compound ClC=CC1=CC=CC=C1 SBYMUDUGTIKLCR-UHFFFAOYSA-N 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- VAYMIYBJLRRIFR-UHFFFAOYSA-N 2-tolyl isocyanate Chemical compound CC1=CC=CC=C1N=C=O VAYMIYBJLRRIFR-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- XRWAYKRSXRGJTC-UHFFFAOYSA-N C(C=C1)=CC=C1[AsH]C1=CC=CC=C1.Cl Chemical compound C(C=C1)=CC=C1[AsH]C1=CC=CC=C1.Cl XRWAYKRSXRGJTC-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 2
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 2
- 229910052785 arsenic Inorganic materials 0.000 description 2
- CXKRDMQZBMZKKJ-UHFFFAOYSA-N arsine oxide Chemical class [AsH3]=O CXKRDMQZBMZKKJ-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 230000031709 bromination Effects 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- 229940061627 chloromethyl methyl ether Drugs 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 125000002346 iodo group Chemical group I* 0.000 description 2
- JCNCSCMYYGONLU-UHFFFAOYSA-N n,n'-bis(2-methylphenyl)methanediimine Chemical compound CC1=CC=CC=C1N=C=NC1=CC=CC=C1C JCNCSCMYYGONLU-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- NPUQEZJLLSALQX-UHFFFAOYSA-N 1,2-dimethoxybiphenylene Chemical group C1=CC=C2C3=C(OC)C(OC)=CC=C3C2=C1 NPUQEZJLLSALQX-UHFFFAOYSA-N 0.000 description 1
- JXMBHJOWDAGCPP-UHFFFAOYSA-N 1-isocyanato-3-nitropropane Chemical class [O-][N+](=O)CCCN=C=O JXMBHJOWDAGCPP-UHFFFAOYSA-N 0.000 description 1
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 description 1
- HRQGCQVOJVTVLU-UHFFFAOYSA-N bis(chloromethyl) ether Chemical compound ClCOCCl HRQGCQVOJVTVLU-UHFFFAOYSA-N 0.000 description 1
- NGIGUEHAKGOTKM-UHFFFAOYSA-N bromo(dicyclohexyl)arsane Chemical compound C1CCCCC1[As](Br)C1CCCCC1 NGIGUEHAKGOTKM-UHFFFAOYSA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- CKMAOLFFRUZLAL-UHFFFAOYSA-N chloro(diethyl)arsane Chemical compound CC[As](Cl)CC CKMAOLFFRUZLAL-UHFFFAOYSA-N 0.000 description 1
- DXCZGVVDXIPLCQ-UHFFFAOYSA-N chloro(dimethyl)arsane Chemical compound C[As](C)Cl DXCZGVVDXIPLCQ-UHFFFAOYSA-N 0.000 description 1
- FBSCJLVPKHEFQH-UHFFFAOYSA-N chloro-ethyl-phenylarsane Chemical compound CC[As](Cl)C1=CC=CC=C1 FBSCJLVPKHEFQH-UHFFFAOYSA-N 0.000 description 1
- XGRJZXREYAXTGV-UHFFFAOYSA-N chlorodiphenylphosphine Chemical compound C=1C=CC=CC=1P(Cl)C1=CC=CC=C1 XGRJZXREYAXTGV-UHFFFAOYSA-N 0.000 description 1
- 238000007265 chloromethylation reaction Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000003493 decenyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- ZTEHTGMWGUKFNE-UHFFFAOYSA-N methyl 3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]propanimidate Chemical compound COC(=N)CCSCC1=CSC(N=C(N)N)=N1 ZTEHTGMWGUKFNE-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 125000005064 octadecenyl group Chemical group C(=CCCCCCCCCCCCCCCCC)* 0.000 description 1
- 125000004365 octenyl group Chemical group C(=CCCCCCC)* 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- DXMXZAQDIGDJON-UHFFFAOYSA-N phospholan-1-ylphosphonic acid Chemical class OP(O)(=O)P1CCCC1 DXMXZAQDIGDJON-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001228 polyisocyanate Polymers 0.000 description 1
- 239000005056 polyisocyanate Substances 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 239000012254 powdered material Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 125000005040 tridecenyl group Chemical group C(=CCCCCCCCCCCC)* 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000005065 undecenyl group Chemical group C(=CCCCCCCCCC)* 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J31/00—Catalysts comprising hydrides, coordination complexes or organic compounds
- B01J31/02—Catalysts comprising hydrides, coordination complexes or organic compounds containing organic compounds or metal hydrides
- B01J31/06—Catalysts comprising hydrides, coordination complexes or organic compounds containing organic compounds or metal hydrides containing polymers
- B01J31/069—Hybrid organic-inorganic polymers, e.g. silica derivatized with organic groups
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/42—Introducing metal atoms or metal-containing groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- General Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polyurethanes Or Polyureas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/764,376 US4098973A (en) | 1977-01-31 | 1977-01-31 | Compounds and process |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1568439A true GB1568439A (en) | 1980-05-29 |
Family
ID=25070553
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB53264/77A Expired GB1568439A (en) | 1977-01-31 | 1977-12-21 | Polystyrenes comprising organoarsine substituents |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US4098973A (enExample) |
| JP (1) | JPS5396092A (enExample) |
| DE (1) | DE2802521C3 (enExample) |
| FR (1) | FR2378803A1 (enExample) |
| GB (1) | GB1568439A (enExample) |
| IT (1) | IT1103115B (enExample) |
| NL (1) | NL184901C (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4098973A (en) * | 1977-01-31 | 1978-07-04 | The Upjohn Company | Compounds and process |
| US4286068A (en) * | 1978-07-31 | 1981-08-25 | Allied Chemical Corporation | Catalyst and process for oxidation of organic substrates by hydrogen peroxide |
| CA1143741A (en) * | 1978-07-31 | 1983-03-29 | Allied Corporation | Process for oxidation of ketones by hydrogen peroxide |
| US4226958A (en) * | 1979-08-27 | 1980-10-07 | The Upjohn Company | Process for preparing organo-arsenic derivatives of polystyrene and related polymers |
| US4223111A (en) * | 1979-08-27 | 1980-09-16 | The Upjohn Company | Process for preparing arylarsine substituted polystyrene |
| FR2498191B1 (fr) * | 1981-01-19 | 1986-01-17 | Poudres & Explosifs Ste Nale | Procede de synthese d'oxydes et de sulfures de phosphines tertiaires et nouveaux oxydes et sulfures de phosphines tertiaires |
| JPS57164732U (enExample) * | 1981-04-14 | 1982-10-18 | ||
| JPS57171324A (en) * | 1981-04-14 | 1982-10-21 | Victor Co Of Japan Ltd | Shifting mechanism of viewfinder |
| US4503195A (en) * | 1981-11-02 | 1985-03-05 | Board Of Regents, The University Of Texas System | Di- and triphenylated cation radical polymers and their use as Diels-Alder catalysts |
| US4552928A (en) * | 1981-11-02 | 1985-11-12 | Board Of Regents, The University Of Texas System | Di- and triphenylated cation radical polymers and their use as Diels-Alder catalysts |
| JPS61235415A (ja) * | 1985-04-12 | 1986-10-20 | Nisshinbo Ind Inc | 熱硬化性樹脂の製造方法 |
| GB8521325D0 (en) * | 1985-08-27 | 1985-10-02 | Raychem Ltd | Preparation of side-chain polymers |
| US6528292B1 (en) | 1987-05-29 | 2003-03-04 | Aventis Pharmaceuticals Holdings Inc. | Derivatized polystyrene and other polymer supports for spectroscopic studies |
| US5352400A (en) * | 1992-04-29 | 1994-10-04 | E. I. Du Pont De Nemours And Company | Carbodiimides and processes therefor |
| EP0636640B1 (en) * | 1993-07-29 | 1998-03-11 | The Procter & Gamble Company | Oxidation process |
| US6548081B2 (en) | 2000-07-28 | 2003-04-15 | Anika Therapeutics, Inc. | Bioabsorbable composites of derivatized hyaluronic acid and other biodegradable, biocompatible polymers |
| WO2002068383A2 (en) | 2001-02-22 | 2002-09-06 | Anika Therapeutics, Inc. | Thiol-modified hyaluronan |
| US8124120B2 (en) | 2003-12-22 | 2012-02-28 | Anika Therapeutics, Inc. | Crosslinked hyaluronic acid compositions for tissue augmentation |
| EP3028677A1 (en) | 2005-12-14 | 2016-06-08 | Anika Therapeutics Inc. | Treatment of arthritis and other musculoskeletal disorders with crosslinked hyaluronic acid |
| JP5549006B2 (ja) * | 2009-05-12 | 2014-07-16 | 国立大学法人大阪大学 | ポリマーの酸化方法 |
| NZ747413A (en) | 2016-04-27 | 2020-09-25 | Anika Therapeutics Inc | Compositions for use in treating tendon degeneration |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD96940A1 (enExample) * | 1971-08-11 | 1973-04-12 | ||
| US3970603A (en) * | 1973-05-24 | 1976-07-20 | Owens-Illinois, Inc. | Amino acid derivatives of chloromethylated polymers and methods of making the same |
| US3995094A (en) * | 1975-09-12 | 1976-11-30 | Dynapol Corporation | Halomethylation of polystyrene |
| US4098973A (en) * | 1977-01-31 | 1978-07-04 | The Upjohn Company | Compounds and process |
| US4068055A (en) * | 1977-01-31 | 1978-01-10 | The Upjohn Company | Compounds and process |
-
1977
- 1977-01-31 US US05/764,376 patent/US4098973A/en not_active Expired - Lifetime
- 1977-12-21 GB GB53264/77A patent/GB1568439A/en not_active Expired
-
1978
- 1978-01-10 IT IT47582/78A patent/IT1103115B/it active
- 1978-01-20 DE DE2802521A patent/DE2802521C3/de not_active Expired
- 1978-01-25 NL NLAANVRAGE7800907,A patent/NL184901C/xx not_active IP Right Cessation
- 1978-01-30 FR FR7802494A patent/FR2378803A1/fr active Granted
- 1978-01-30 JP JP922178A patent/JPS5396092A/ja active Granted
- 1978-05-03 US US05/902,489 patent/US4137386A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2378803B1 (enExample) | 1981-06-19 |
| US4137386A (en) | 1979-01-30 |
| DE2802521A1 (de) | 1978-08-03 |
| JPS5396092A (en) | 1978-08-22 |
| DE2802521B2 (de) | 1980-08-07 |
| DE2802521C3 (de) | 1981-07-09 |
| NL7800907A (nl) | 1978-08-02 |
| IT7847582A0 (it) | 1978-01-10 |
| IT1103115B (it) | 1985-10-14 |
| NL184901C (nl) | 1989-12-01 |
| JPS5650895B2 (enExample) | 1981-12-02 |
| US4098973A (en) | 1978-07-04 |
| NL184901B (nl) | 1989-07-03 |
| FR2378803A1 (fr) | 1978-08-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4098973A (en) | Compounds and process | |
| US4143063A (en) | Preparation of carbodiimide-containing polyisocyanates | |
| US4895964A (en) | Quarternary ammonium pendant siloxane copolymers | |
| US4518758A (en) | Organopolysiloxane/polyurethane elastomeric block copolymers | |
| CA2039953A1 (en) | Diene polymers and copolymers terminated by reaction with n-alkyl and n-aryl imines | |
| US4068055A (en) | Compounds and process | |
| JPS59168029A (ja) | 二官能性ポリフエニレンオキシドの製法 | |
| US5087685A (en) | Process for preparing polycarbosilanes and new polycarbosilanes | |
| CA1273348A (en) | Free-radical initiators, curable compositions and methods | |
| US4841083A (en) | Ladder polysilanes | |
| GB1569027A (en) | Polymers comprising phospholene substituents | |
| US4226958A (en) | Process for preparing organo-arsenic derivatives of polystyrene and related polymers | |
| JPS6335659B2 (enExample) | ||
| Wang et al. | Intramolecular cyclization of 2, 2'-dibenzoylbiphenyl units as a new route to increase the rigidity and solvent resistance in poly (arylene ethers) | |
| EP0350059A2 (en) | Monofunctional polymers of olefins and block copolymers obtained therefrom | |
| US3364181A (en) | Cyclic carbamate resins and method of preparation | |
| EP0161164B1 (en) | Process for preparing polyphenylenethers | |
| US4906713A (en) | "Acrylic" ladder polymers | |
| US4576747A (en) | Isocyanato-azetidinediones | |
| US4223111A (en) | Process for preparing arylarsine substituted polystyrene | |
| US3458546A (en) | Peroxy containing organometallic (ivbtin,germanium,silicon and lead) compounds and the preparation thereof | |
| US4278774A (en) | Block-copolymers of vinyltrialkylsilane-hexaorganocyclotrisiloxanes and method for producing same | |
| Hagen et al. | Chemical modification of polystyrene: Introduction of sulfinate and sulfone functionalities | |
| JPH04185642A (ja) | ポリシランの製造方法 | |
| JPH04342726A (ja) | シリコン含有重合体およびその製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| 732 | Registration of transactions, instruments or events in the register (sect. 32/1977) | ||
| PCNP | Patent ceased through non-payment of renewal fee |
Effective date: 19941221 |