GB1530157A - 3-(substituted)cephems - Google Patents
3-(substituted)cephemsInfo
- Publication number
- GB1530157A GB1530157A GB49766/75A GB4976675A GB1530157A GB 1530157 A GB1530157 A GB 1530157A GB 49766/75 A GB49766/75 A GB 49766/75A GB 4976675 A GB4976675 A GB 4976675A GB 1530157 A GB1530157 A GB 1530157A
- Authority
- GB
- United Kingdom
- Prior art keywords
- cephem
- resulting
- group
- compound
- derivative
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001782 cephems Chemical class 0.000 title 1
- -1 cyanomethyl Chemical group 0.000 abstract 16
- 150000001875 compounds Chemical class 0.000 abstract 4
- 229910052739 hydrogen Inorganic materials 0.000 abstract 4
- 239000001257 hydrogen Substances 0.000 abstract 4
- 230000001590 oxidative effect Effects 0.000 abstract 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 abstract 3
- 229930186147 Cephalosporin Natural products 0.000 abstract 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 abstract 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 abstract 3
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 229940124587 cephalosporin Drugs 0.000 abstract 3
- 150000001780 cephalosporins Chemical class 0.000 abstract 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 abstract 2
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 abstract 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 abstract 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 abstract 2
- 239000002253 acid Substances 0.000 abstract 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 abstract 2
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 abstract 2
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 abstract 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 2
- 231100000252 nontoxic Toxicity 0.000 abstract 2
- 230000003000 nontoxic effect Effects 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- 125000000547 substituted alkyl group Chemical group 0.000 abstract 2
- AOZWBOILSUIIBW-BLDCVEFLSA-N (6r)-3-(acetyloxymethyl)-7-methoxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid Chemical compound S([C@@H]12)C=C(COC(C)=O)C(C(O)=O)N1C(=O)C2(OC)NC(=O)CC1=CC=CS1 AOZWBOILSUIIBW-BLDCVEFLSA-N 0.000 abstract 1
- QXIGENOFEMZRJV-PUUKEUDRSA-N 2-O-benzhydryl 3-O-ethoxycarbonyl (6R)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2,3-dicarboxylate Chemical compound S1C(=CC=C1)CC(=O)NC1[C@@H]2N(C(C(=CS2)C(=O)OC(=O)OCC)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O QXIGENOFEMZRJV-PUUKEUDRSA-N 0.000 abstract 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 abstract 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 abstract 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 abstract 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 abstract 1
- ITLHXEGAYQFOHJ-UHFFFAOYSA-N [diazo(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(=[N+]=[N-])C1=CC=CC=C1 ITLHXEGAYQFOHJ-UHFFFAOYSA-N 0.000 abstract 1
- XVUDRSZQKGTCPH-UHFFFAOYSA-N acetic acid;n,n-dimethylformamide Chemical compound CC(O)=O.CN(C)C=O XVUDRSZQKGTCPH-UHFFFAOYSA-N 0.000 abstract 1
- 150000007513 acids Chemical class 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 abstract 1
- YMDAACDANMEWHD-OXOHJMPHSA-N benzhydryl (6r)-3-formyl-7-methoxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate Chemical compound S([C@@H]12)C=C(C=O)C(C(=O)OC(C=3C=CC=CC=3)C=3C=CC=CC=3)N1C(=O)C2(OC)NC(=O)CC1=CC=CS1 YMDAACDANMEWHD-OXOHJMPHSA-N 0.000 abstract 1
- DNQSSESRMZLVCL-QGPIEZSZSA-N benzhydryl (6r)-3-formyl-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate Chemical compound C1([C@H]2SC=C(C(N2C1=O)C(=O)OC(C=1C=CC=CC=1)C=1C=CC=CC=1)C=O)NC(=O)CC1=CC=CS1 DNQSSESRMZLVCL-QGPIEZSZSA-N 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 230000003115 biocidal effect Effects 0.000 abstract 1
- 229910052794 bromium Inorganic materials 0.000 abstract 1
- 229910052801 chlorine Inorganic materials 0.000 abstract 1
- 125000004093 cyano group Chemical group *C#N 0.000 abstract 1
- 239000003937 drug carrier Substances 0.000 abstract 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 abstract 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 125000004970 halomethyl group Chemical group 0.000 abstract 1
- 150000002431 hydrogen Chemical class 0.000 abstract 1
- 230000003301 hydrolyzing effect Effects 0.000 abstract 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 abstract 1
- 229910052740 iodine Inorganic materials 0.000 abstract 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 abstract 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 229910052698 phosphorus Inorganic materials 0.000 abstract 1
- 239000011574 phosphorus Substances 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
- 229910052717 sulfur Inorganic materials 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 abstract 1
- 229920002554 vinyl polymer Polymers 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/531,264 US4012380A (en) | 1974-12-10 | 1974-12-10 | 7-Acylamino-3-acyl-2(or 3)cephems |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1530157A true GB1530157A (en) | 1978-10-25 |
Family
ID=24116935
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB49766/75A Expired GB1530157A (en) | 1974-12-10 | 1975-12-04 | 3-(substituted)cephems |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4012380A (https=) |
| JP (1) | JPS5182291A (https=) |
| BE (1) | BE836415A (https=) |
| CA (1) | CA1039269A (https=) |
| DE (1) | DE2555182A1 (https=) |
| FR (1) | FR2293934A1 (https=) |
| GB (1) | GB1530157A (https=) |
| IE (1) | IE42450B1 (https=) |
| IL (1) | IL48342A (https=) |
| NL (1) | NL7514429A (https=) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5168589A (https=) * | 1974-12-06 | 1976-06-14 | Shionogi Seiyaku Kk | |
| US4094978A (en) * | 1976-07-29 | 1978-06-13 | Syntex (U.S.A.) Inc. | 3-propenyl derivatives of cephalosporin, compositions and their use |
| US4112087A (en) * | 1976-11-04 | 1978-09-05 | Syntex (U.S.A.) Inc. | Cephalosporin type antibacterials having a substituted propenyl group in the 3-position |
| US4244885A (en) * | 1977-12-08 | 1981-01-13 | Yeda Research And Development Co. Ltd. | α-Substituted-3-(halomethyl)-4-hydroxybenzeneacetic acids |
| EP0485639B1 (en) * | 1990-11-10 | 1995-03-29 | Kuo-Nan Yang | EVA insole manufacturing process |
| GB0019124D0 (en) | 2000-08-03 | 2000-09-27 | Pfizer | Novel process |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL129220C (https=) * | 1965-12-09 | |||
| US3488729A (en) * | 1966-08-22 | 1970-01-06 | Lilly Co Eli | Cephalothin ester |
| US3647786A (en) * | 1968-10-03 | 1972-03-07 | Lilly Co Eli | Preparation of cephalosporin sulfoxides |
| US3714154A (en) * | 1970-12-24 | 1973-01-30 | Lilly Co Eli | Recovery of cephalothin salts |
| US3905967A (en) * | 1971-05-07 | 1975-09-16 | Smithkline Corp | Method for O-acylating 7-acylamino-cephalosporadesic acids |
| ZA718229B (en) * | 1971-12-08 | 1973-04-25 | E Bruigom | Improvements in and relating to the welding of lined metal pipes |
| US3947413A (en) * | 1972-11-13 | 1976-03-30 | Merck & Co., Inc. | 3-α-Substituted cephalosporins |
| US3897424A (en) * | 1973-07-23 | 1975-07-29 | Lilly Co Eli | Process for 7-{62 -amino-7-{60 -methoxy-cephalosporanic acid esters and related compounds |
-
1974
- 1974-12-10 US US05/531,264 patent/US4012380A/en not_active Expired - Lifetime
-
1975
- 1975-10-17 CA CA237,873A patent/CA1039269A/en not_active Expired
- 1975-10-22 IE IE2298/75A patent/IE42450B1/en unknown
- 1975-10-22 IL IL48342A patent/IL48342A/xx unknown
- 1975-12-04 GB GB49766/75A patent/GB1530157A/en not_active Expired
- 1975-12-04 JP JP50144912A patent/JPS5182291A/ja active Pending
- 1975-12-08 DE DE19752555182 patent/DE2555182A1/de not_active Withdrawn
- 1975-12-09 BE BE1007068A patent/BE836415A/xx unknown
- 1975-12-10 FR FR7537769A patent/FR2293934A1/fr active Granted
- 1975-12-10 NL NL7514429A patent/NL7514429A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| IL48342A0 (en) | 1975-12-31 |
| CA1039269A (en) | 1978-09-26 |
| FR2293934B1 (https=) | 1978-11-10 |
| DE2555182A1 (de) | 1976-06-16 |
| FR2293934A1 (fr) | 1976-07-09 |
| IE42450L (en) | 1976-06-10 |
| IL48342A (en) | 1980-09-16 |
| NL7514429A (nl) | 1976-06-14 |
| US4012380A (en) | 1977-03-15 |
| JPS5182291A (https=) | 1976-07-19 |
| IE42450B1 (en) | 1980-08-13 |
| BE836415A (fr) | 1976-06-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3993646A (en) | Process for the ring expansion of penicillins to cephalosporin compounds | |
| US3218318A (en) | 7-heterocyclic-substituted-acylamido cephalosporins | |
| GB1526978A (en) | 3-thiosubstituted cephalosporin antibiotics | |
| US3917587A (en) | Cephalosporin ethers | |
| KR850002992A (ko) | 3-비사이클릭피리디늄-메틸 세파로스포린의 제조방법 | |
| GB1530157A (en) | 3-(substituted)cephems | |
| US3925368A (en) | Acylureido substituted cephalosporins | |
| US3917588A (en) | {60 -Aminoacyl cephalosporin ethers | |
| US3728342A (en) | 3-acyloxymethyl cephalosporins and method of preparation | |
| GB1501711A (en) | Hydroxy-substituted cephalosporins | |
| GB1525739A (en) | Cephalosporin derivatives | |
| JPH04225985A (ja) | セフアロスポリン化合物 | |
| GB1560532A (en) | Cepham and penam compounds | |
| JPS5444695A (en) | 3,7-disubstituted-3-cephem-4-carboxylic acid and its salt and their preparation | |
| GB1457668A (en) | Cephalo | |
| DE2262500A1 (de) | 3-oxyiminomethylcephalosporinverbindungen | |
| JPS6133825B2 (https=) | ||
| GB1261780A (en) | Orally active sulfur-containing cephalosporin antibiotics | |
| US4705784A (en) | Cephem compounds | |
| US4267340A (en) | Disulfide substituted oxazetidine derivatives | |
| JPS5934715B2 (ja) | 7−置換アシルアミノ−3−置換−3−セフエム−4−カルボン酸類の製造法 | |
| GB1561062A (en) | 7-acyloxy cephalosporins | |
| JP2567799B2 (ja) | カルボキシアルケン酸及びその誘導体 | |
| GB1584861A (en) | Cephalosporin compounds | |
| CA1043332A (en) | 3,4-dicarboxycephalosporins and derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |