GB1455474A - Haloacetanilides for influencing plant growth - Google Patents
Haloacetanilides for influencing plant growthInfo
- Publication number
- GB1455474A GB1455474A GB564074A GB564074A GB1455474A GB 1455474 A GB1455474 A GB 1455474A GB 564074 A GB564074 A GB 564074A GB 564074 A GB564074 A GB 564074A GB 1455474 A GB1455474 A GB 1455474A
- Authority
- GB
- United Kingdom
- Prior art keywords
- methyl
- formula
- haloacetanilides
- methoxy
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000008635 plant growth Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 4
- 239000001257 hydrogen Substances 0.000 abstract 3
- 229910052739 hydrogen Inorganic materials 0.000 abstract 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 abstract 2
- 239000005977 Ethylene Substances 0.000 abstract 2
- 239000003795 chemical substances by application Substances 0.000 abstract 2
- 229910052801 chlorine Inorganic materials 0.000 abstract 2
- 239000000460 chlorine Substances 0.000 abstract 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract 2
- 239000004009 herbicide Substances 0.000 abstract 2
- 150000002431 hydrogen Chemical class 0.000 abstract 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 abstract 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 abstract 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 125000003277 amino group Chemical group 0.000 abstract 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 abstract 1
- 229910052731 fluorine Inorganic materials 0.000 abstract 1
- 239000011737 fluorine Substances 0.000 abstract 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 abstract 1
- -1 methoxy, ethoxy Chemical group 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH180073A CH579348A5 (cg-RX-API-DMAC10.html) | 1973-02-08 | 1973-02-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1455474A true GB1455474A (en) | 1976-11-10 |
Family
ID=4218891
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB564074A Expired GB1455474A (en) | 1973-02-08 | 1974-02-07 | Haloacetanilides for influencing plant growth |
Country Status (20)
| Country | Link |
|---|---|
| JP (1) | JPS5736881B2 (cg-RX-API-DMAC10.html) |
| AT (1) | AT335220B (cg-RX-API-DMAC10.html) |
| BE (1) | BE810763A (cg-RX-API-DMAC10.html) |
| BG (1) | BG20265A3 (cg-RX-API-DMAC10.html) |
| BR (1) | BR7400927D0 (cg-RX-API-DMAC10.html) |
| CA (1) | CA1049558A (cg-RX-API-DMAC10.html) |
| CH (1) | CH579348A5 (cg-RX-API-DMAC10.html) |
| CS (1) | CS177162B2 (cg-RX-API-DMAC10.html) |
| DD (1) | DD111277A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2405479C2 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2216916B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1455474A (cg-RX-API-DMAC10.html) |
| HU (1) | HU169034B (cg-RX-API-DMAC10.html) |
| IL (1) | IL44136A (cg-RX-API-DMAC10.html) |
| NL (1) | NL7401655A (cg-RX-API-DMAC10.html) |
| PH (1) | PH10605A (cg-RX-API-DMAC10.html) |
| PL (1) | PL98124B1 (cg-RX-API-DMAC10.html) |
| RO (1) | RO72493A (cg-RX-API-DMAC10.html) |
| SU (1) | SU579847A3 (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA74817B (cg-RX-API-DMAC10.html) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2479204A1 (fr) * | 1980-03-25 | 1981-10-02 | Monsanto Co | 2-haloacetanilides herbicides et compositions les renfermant en tant qu'ingredients actifs |
| US4399306A (en) * | 1979-04-24 | 1983-08-16 | Nitrokemia Ipartelepek | Process for the preparation of 2,6-dialkyl-N-alkoxymethyl-2-chloro-acetanilides |
| US4983772A (en) * | 1983-11-14 | 1991-01-08 | The Dow Chemical Company | 2,6-disubstituted anilines |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PL103793B1 (pl) * | 1976-03-19 | 1979-07-31 | Monsanto Co | Srodek chwastobojczy |
| DE2726253A1 (de) * | 1977-06-10 | 1978-12-21 | Bayer Ag | N-acylmethyl-chloracetanilide, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide |
| DE2825543A1 (de) * | 1978-06-10 | 1979-12-13 | Bayer Ag | N-substituierte halogenacetanilide, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| US4606759A (en) * | 1980-03-25 | 1986-08-19 | Monsanto Company | Herbicidal 2-haloacetanilides |
| US4731109A (en) * | 1980-03-25 | 1988-03-15 | Monsanto Company | Herbicidal 2-haloacetanilides |
-
1973
- 1973-02-08 CH CH180073A patent/CH579348A5/xx not_active IP Right Cessation
-
1974
- 1974-01-31 CA CA191,475A patent/CA1049558A/en not_active Expired
- 1974-02-04 IL IL44136A patent/IL44136A/en unknown
- 1974-02-05 DE DE19742405479 patent/DE2405479C2/de not_active Expired
- 1974-02-06 RO RO7477538A patent/RO72493A/ro unknown
- 1974-02-06 PH PH15480A patent/PH10605A/en unknown
- 1974-02-06 DD DD17641274A patent/DD111277A5/xx unknown
- 1974-02-06 BG BG025713A patent/BG20265A3/xx unknown
- 1974-02-06 HU HUCI001443 patent/HU169034B/hu unknown
- 1974-02-06 NL NL7401655A patent/NL7401655A/xx not_active Application Discontinuation
- 1974-02-07 AT AT96374A patent/AT335220B/de not_active IP Right Cessation
- 1974-02-07 ZA ZA00740817A patent/ZA74817B/xx unknown
- 1974-02-07 SU SU7401992654A patent/SU579847A3/ru active
- 1974-02-07 PL PL16863674A patent/PL98124B1/pl unknown
- 1974-02-07 GB GB564074A patent/GB1455474A/en not_active Expired
- 1974-02-07 FR FR7404083A patent/FR2216916B1/fr not_active Expired
- 1974-02-08 BE BE140680A patent/BE810763A/xx not_active IP Right Cessation
- 1974-02-08 BR BR92774A patent/BR7400927D0/pt unknown
- 1974-02-08 CS CS91074A patent/CS177162B2/cs unknown
- 1974-02-08 JP JP1616274A patent/JPS5736881B2/ja not_active Expired
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4399306A (en) * | 1979-04-24 | 1983-08-16 | Nitrokemia Ipartelepek | Process for the preparation of 2,6-dialkyl-N-alkoxymethyl-2-chloro-acetanilides |
| FR2479204A1 (fr) * | 1980-03-25 | 1981-10-02 | Monsanto Co | 2-haloacetanilides herbicides et compositions les renfermant en tant qu'ingredients actifs |
| US4983772A (en) * | 1983-11-14 | 1991-01-08 | The Dow Chemical Company | 2,6-disubstituted anilines |
Also Published As
| Publication number | Publication date |
|---|---|
| DD111277A5 (cg-RX-API-DMAC10.html) | 1975-02-12 |
| FR2216916B1 (cg-RX-API-DMAC10.html) | 1976-11-26 |
| BR7400927D0 (pt) | 1974-09-10 |
| JPS5736881B2 (cg-RX-API-DMAC10.html) | 1982-08-06 |
| SU579847A3 (ru) | 1977-11-05 |
| NL7401655A (cg-RX-API-DMAC10.html) | 1974-08-12 |
| BG20265A3 (bg) | 1975-11-05 |
| ZA74817B (en) | 1975-01-29 |
| DE2405479A1 (de) | 1974-08-15 |
| IL44136A (en) | 1976-12-31 |
| CH579348A5 (cg-RX-API-DMAC10.html) | 1976-09-15 |
| BE810763A (fr) | 1974-08-08 |
| JPS49109531A (cg-RX-API-DMAC10.html) | 1974-10-18 |
| AT335220B (de) | 1977-02-25 |
| IL44136A0 (en) | 1974-05-16 |
| CS177162B2 (cg-RX-API-DMAC10.html) | 1977-07-29 |
| RO72493A (ro) | 1982-08-17 |
| ATA96374A (de) | 1976-06-15 |
| DE2405479C2 (de) | 1982-12-30 |
| CA1049558A (en) | 1979-02-27 |
| FR2216916A1 (cg-RX-API-DMAC10.html) | 1974-09-06 |
| AU6526374A (en) | 1975-08-07 |
| PH10605A (en) | 1977-07-15 |
| PL98124B1 (pl) | 1978-04-29 |
| HU169034B (cg-RX-API-DMAC10.html) | 1976-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1460410A (en) | Benzoylureidodiphenyl ethers and their use as insecticides | |
| ES316768A1 (es) | Procedimiento para la preparacion de una nueva poliamida. | |
| GB1488285A (en) | Substituted pyrazoles | |
| GB1138529A (en) | Novel imidazole derivatives and a process for the manufacture thereof | |
| GB1495348A (en) | Haloacetanilides as fungicidally active substances | |
| GB1397234A (en) | N,n-disubstituted thioureas their preparation and their use as antimicrobial substances | |
| GB1455474A (en) | Haloacetanilides for influencing plant growth | |
| GB1221237A (en) | Malonitriles and their use as pesticides | |
| GB1095378A (cg-RX-API-DMAC10.html) | ||
| GB1449387A (en) | Benzylpyrimidine derivatives | |
| IE43614L (en) | Diphenylamines. | |
| GB1507414A (en) | Hydantoin derivatives | |
| NZ189091A (en) | Prostaglandin derivatives | |
| GB1463582A (en) | Pyridine derivatives | |
| GB1422473A (en) | Chloroacetanilides for regulating plant growth | |
| GB1439838A (en) | Process for the preparation of diphenylamine and substituted derivatives thereof | |
| GB1374404A (en) | Phenylhydrazone derivatives | |
| GB1530629A (en) | 5-nitroimidazole derivatives | |
| GB1287084A (en) | Benzimidazole derivatives, process for their preparation, and their fungicidal use | |
| GB1476859A (en) | Process and compositions for plant protection | |
| GB1348856A (en) | Insecticidal phosphoroamidothioates and compositions containing them | |
| GB1447954A (en) | Process for the preparation of 1,2,4-triazole derivative | |
| GB1211556A (en) | 0,2,4-oxdiazolidine derivatives, process for their production and herbicidal compositions containing same | |
| GB1339244A (en) | N-1,1 substituted acetonitrilo-a-3,5-substituted phenoxy alkyl amides and their use as herbicides | |
| GB1352464A (en) | N-alkyl-alpha-3,5-substituted phenoxy-alkyl amides and their use as herbicides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |