GB1433151A - Benzo-ij-quinolizines - Google Patents
Benzo-ij-quinolizinesInfo
- Publication number
- GB1433151A GB1433151A GB1627973A GB1627973A GB1433151A GB 1433151 A GB1433151 A GB 1433151A GB 1627973 A GB1627973 A GB 1627973A GB 1627973 A GB1627973 A GB 1627973A GB 1433151 A GB1433151 A GB 1433151A
- Authority
- GB
- United Kingdom
- Prior art keywords
- benzo
- quinolizine
- dihydro
- oxo
- carboxylic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 tetrahydropyranyloxy Chemical group 0.000 abstract 6
- 150000001875 compounds Chemical class 0.000 abstract 4
- 230000003301 hydrolyzing effect Effects 0.000 abstract 4
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- IPEUOIVHXBNZOQ-UHFFFAOYSA-N 9-hydroxy-1-oxo-6,7-dihydro-1h,5h-pyrido[3,2,1-ij]quinoline-2-carboxylic acid Chemical compound C1CCC2=CC(O)=CC3=C2N1C=C(C(=O)O)C3=O IPEUOIVHXBNZOQ-UHFFFAOYSA-N 0.000 abstract 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 abstract 2
- 125000005605 benzo group Chemical group 0.000 abstract 2
- 150000003250 quinolizines Chemical class 0.000 abstract 2
- MMYKTRPLXXWLBC-UHFFFAOYSA-N 1-bromo-2-ethoxyethane Chemical compound CCOCCBr MMYKTRPLXXWLBC-UHFFFAOYSA-N 0.000 abstract 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 abstract 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 abstract 1
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 abstract 1
- ULRPISSMEBPJLN-UHFFFAOYSA-N 2h-tetrazol-5-amine Chemical compound NC1=NN=NN1 ULRPISSMEBPJLN-UHFFFAOYSA-N 0.000 abstract 1
- WZRREUKDGXPYLF-UHFFFAOYSA-N 4-oxo-7-phenylmethoxy-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid Chemical compound C(C1=CC=CC=C1)OC1=CC=2CCCN3C=C(C(C(C23)=C1)=O)C(=O)O WZRREUKDGXPYLF-UHFFFAOYSA-N 0.000 abstract 1
- XYWGOXMFYZUNQR-UHFFFAOYSA-N 4-oxo-7-propan-2-yl-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid Chemical compound C(C)(C)C1=CC=2CCCN3C=C(C(C(C23)=C1)=O)C(=O)O XYWGOXMFYZUNQR-UHFFFAOYSA-N 0.000 abstract 1
- VQLDRXZBNUFGIY-UHFFFAOYSA-N 42835-54-1 Chemical class C1CCC2=CC=CC3=C2N1C=C(C(=O)O)C3=O VQLDRXZBNUFGIY-UHFFFAOYSA-N 0.000 abstract 1
- JEABVAYJIJIXLO-UHFFFAOYSA-N 6-propan-2-yl-1,2,3,4-tetrahydroquinoline Chemical compound N1CCCC2=CC(C(C)C)=CC=C21 JEABVAYJIJIXLO-UHFFFAOYSA-N 0.000 abstract 1
- NKCQEIXYLHACJC-UHFFFAOYSA-N 6-propan-2-ylquinoline Chemical compound N1=CC=CC2=CC(C(C)C)=CC=C21 NKCQEIXYLHACJC-UHFFFAOYSA-N 0.000 abstract 1
- VELSKNSBJSUBGX-UHFFFAOYSA-N 7-[2-[benzyl(methyl)amino]ethoxy]-4-oxo-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid hydrochloride Chemical compound Cl.C(C1=CC=CC=C1)N(C)CCOC1=CC=2CCCN3C=C(C(C(C23)=C1)=O)C(=O)O VELSKNSBJSUBGX-UHFFFAOYSA-N 0.000 abstract 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 abstract 1
- RXSLSBIORTUSHO-UHFFFAOYSA-N Cl.CN(CCOC1=CC=2CCCN3C=C(C(C(C23)=C1)=O)C(=O)O)C Chemical compound Cl.CN(CCOC1=CC=2CCCN3C=C(C(C(C23)=C1)=O)C(=O)O)C RXSLSBIORTUSHO-UHFFFAOYSA-N 0.000 abstract 1
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 125000004423 acyloxy group Chemical group 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000004947 alkyl aryl amino group Chemical group 0.000 abstract 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000004104 aryloxy group Chemical group 0.000 abstract 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 abstract 1
- 230000017858 demethylation Effects 0.000 abstract 1
- 238000010520 demethylation reaction Methods 0.000 abstract 1
- 125000004663 dialkyl amino group Chemical group 0.000 abstract 1
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 abstract 1
- WGLNHDAJQXBHQC-UHFFFAOYSA-N diethyl 2-[(6-propan-2-yl-3,4-dihydro-2H-quinolin-1-yl)methylidene]propanedioate Chemical compound C(C)(C)C=1C=C2CCCN(C2=CC1)C=C(C(=O)OCC)C(=O)OCC WGLNHDAJQXBHQC-UHFFFAOYSA-N 0.000 abstract 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 125000004494 ethyl ester group Chemical group 0.000 abstract 1
- 238000007327 hydrogenolysis reaction Methods 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 125000005113 hydroxyalkoxy group Chemical group 0.000 abstract 1
- 150000004682 monohydrates Chemical class 0.000 abstract 1
- XTMXITMZHSOHEV-UHFFFAOYSA-N n-benzyl-2-bromo-n-methylethanamine Chemical compound BrCCN(C)CC1=CC=CC=C1 XTMXITMZHSOHEV-UHFFFAOYSA-N 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/04—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms
- C07D215/06—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms having only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D455/00—Heterocyclic compounds containing quinolizine ring systems, e.g. emetine alkaloids, protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine
- C07D455/03—Heterocyclic compounds containing quinolizine ring systems, e.g. emetine alkaloids, protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine containing quinolizine ring systems directly condensed with at least one six-membered carbocyclic ring, e.g. protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine
- C07D455/04—Heterocyclic compounds containing quinolizine ring systems, e.g. emetine alkaloids, protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine containing quinolizine ring systems directly condensed with at least one six-membered carbocyclic ring, e.g. protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine containing a quinolizine ring system condensed with only one six-membered carbocyclic ring, e.g. julolidine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1627973A GB1433151A (en) | 1973-04-05 | 1973-04-05 | Benzo-ij-quinolizines |
| ZA00741860A ZA741860B (en) | 1973-04-05 | 1974-03-21 | Heterocyclic compounds |
| IE649/74A IE39101B1 (en) | 1973-04-05 | 1974-03-25 | Benzo (ij) quinolizines |
| US455071A US3917608A (en) | 1973-04-05 | 1974-03-27 | Substituted 6,7 dihydro-1-oxo N(1H-tetrazol-5-yl)-1H,5H-benzo{8 ij{9 quinolizine carboxamides |
| AU67200/74A AU6720074A (en) | 1973-04-05 | 1974-03-27 | Heterocyclic compounds |
| BE142731A BE813158A (fr) | 1973-04-05 | 1974-04-01 | Nouvelles benzoquinolizines |
| LU69756A LU69756A1 (enExample) | 1973-04-05 | 1974-04-01 | |
| DE2415763A DE2415763A1 (de) | 1973-04-05 | 1974-04-01 | Neue benzochinolizine, verfahren zu ihrer herstellung und diese enthaltende mittel |
| CH462974A CH602722A5 (enExample) | 1973-04-05 | 1974-04-02 | |
| AT277074A AT330180B (de) | 1973-04-05 | 1974-04-03 | Verfahren zur herstellung von neuen benzo-(ij)-chinolizinderivaten und ihren salzen |
| FR7411776A FR2230355B1 (enExample) | 1973-04-05 | 1974-04-03 | |
| JP49039368A JPS5024296A (enExample) | 1973-04-05 | 1974-04-05 | |
| NL7404719A NL7404719A (enExample) | 1973-04-05 | 1974-04-05 | |
| CA197,107A CA1015758A (en) | 1973-04-05 | 1974-04-05 | 6,7-dihydro-1-oxo-n(1h-tetrazol-5-yl)-1h,5h-benzo(ij)quinolizine-2-carboxamides |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1627973A GB1433151A (en) | 1973-04-05 | 1973-04-05 | Benzo-ij-quinolizines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1433151A true GB1433151A (en) | 1976-04-22 |
Family
ID=10074459
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB1627973A Expired GB1433151A (en) | 1973-04-05 | 1973-04-05 | Benzo-ij-quinolizines |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3917608A (enExample) |
| JP (1) | JPS5024296A (enExample) |
| AT (1) | AT330180B (enExample) |
| AU (1) | AU6720074A (enExample) |
| BE (1) | BE813158A (enExample) |
| CA (1) | CA1015758A (enExample) |
| CH (1) | CH602722A5 (enExample) |
| DE (1) | DE2415763A1 (enExample) |
| FR (1) | FR2230355B1 (enExample) |
| GB (1) | GB1433151A (enExample) |
| IE (1) | IE39101B1 (enExample) |
| LU (1) | LU69756A1 (enExample) |
| NL (1) | NL7404719A (enExample) |
| ZA (1) | ZA741860B (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0157346A3 (en) * | 1984-03-30 | 1986-02-05 | Fujisawa Pharmaceutical Co., Ltd. | Quinolizinone compound, processes for preparation thereof and pharmaceutical composition comprising the same |
| WO1997031000A1 (en) * | 1996-02-21 | 1997-08-28 | Darwin Discovery Limited | Quinolones and their therapeutic use |
| WO1997030999A1 (en) * | 1996-02-21 | 1997-08-28 | Darwin Discovery Limited | Quinolones and their therapeutic use |
| US5792774A (en) * | 1996-02-21 | 1998-08-11 | Chiroscience Limited | Quinolones and their therapeutic use |
| RU2204553C2 (ru) * | 1997-03-10 | 2003-05-20 | Янссен Фармацевтика Н.В. | 1,8-аннелированные производные хинолинона, замещенные n- или c-связанными имидазолами, ингибирующие фарнезилтрансферазу |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4051247A (en) * | 1975-04-14 | 1977-09-27 | Riker Laboratories, Inc. | Method of using 7-hydroxy-benzo[ij]quinolizine-2-carboxylic acid derivatives |
| AT377986B (de) * | 1978-08-31 | 1985-05-28 | Otsuka Pharma Co Ltd | Verfahren zur herstellung von neuen piperazinylbenzoheterozyklischen verbindungen und ihren pharmazeutisch annehmbaren salzen |
| JPS5540616A (en) * | 1978-09-14 | 1980-03-22 | Otsuka Pharmaceut Co Ltd | Preparation of benzo-hetero-compound |
| AT377987B (de) * | 1979-04-11 | 1985-05-28 | Otsuka Pharma Co Ltd | Verfahren zur herstellung von neuen piperazinylbenzoheterozyklischen verbindungen und ihren pharmazeutisch annehmbaren salzen |
| US4400386A (en) * | 1981-11-06 | 1983-08-23 | Riker Laboratories, Inc. | Antimicrobial derivatives of 8-amino and 8-aminomethyl benzo(ij)quinolizine |
| US4472407A (en) * | 1983-03-17 | 1984-09-18 | Riker Laboratories, Inc. | Antimicrobial 8-alkoxy-6,7-dihydro-5-methyl-9-fluoro-1-oxo-1H,5H-benzo[ij]qu |
| CA1266484A (en) * | 1984-12-14 | 1990-03-06 | Ronald Edward Mac Leay | Tert-octylhydrazine, its salts and derivatives |
| DE3519926A1 (de) * | 1985-06-04 | 1986-12-04 | Bayer Ag | Indolinderivate, verfahren zu ihrer herstellung und diese indolinderivate enthaltende kosmetische lichtschutzmittel |
| HUE032540T2 (en) | 2004-06-24 | 2017-09-28 | Vertex Pharma | Modulators of ATP-binding cassette transporters |
| US8354427B2 (en) | 2004-06-24 | 2013-01-15 | Vertex Pharmaceutical Incorporated | Modulators of ATP-binding cassette transporters |
| RU2525115C2 (ru) * | 2004-06-24 | 2014-08-10 | Вертекс Фармасьютикалз Инкорпорейтед | Способ модуляции транспортеров атф-связывающей кассеты |
| EP2502912A3 (en) * | 2004-06-24 | 2013-11-06 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-binding cassette transporters |
| CA2635581C (en) | 2005-12-28 | 2017-02-28 | Vertex Pharmaceuticals Incorporated | Solid forms of n-[2,4-bis(1,1-dimethylethyl)-5-hydroxyphenyl]-1,4-dihydro-4-oxoquinoline-3-carboxamide |
| US20100074949A1 (en) | 2008-08-13 | 2010-03-25 | William Rowe | Pharmaceutical composition and administration thereof |
| US12458635B2 (en) | 2008-08-13 | 2025-11-04 | Vertex Pharmaceuticals Incorporated | Pharmaceutical composition and administrations thereof |
| EP2821400B1 (en) | 2009-03-20 | 2017-09-27 | Vertex Pharmaceuticals Incorporated | Process for making modulators of cystic fibrosis transmembrane conductance regulator |
| US8802700B2 (en) | 2010-12-10 | 2014-08-12 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-Binding Cassette transporters |
| RU2692779C2 (ru) | 2012-02-27 | 2019-06-27 | Вертекс Фармасьютикалз Инкорпорейтед | Фармацевтическая композиция и ее введения |
| RU2749213C2 (ru) | 2014-10-07 | 2021-06-07 | Вертекс Фармасьютикалз Инкорпорейтед | Сокристаллы модуляторов регулятора трансмембранной проводимости при кистозном фиброзе |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3728350A (en) * | 1967-07-17 | 1973-04-17 | Lilly Co Eli | 1-(2-carboxyphenyl)-5,7-dimethoxy-3,4-dihydrocarbostyril intermediates for acronycis |
| US3793328A (en) * | 1969-11-03 | 1974-02-19 | Upjohn Co | 8benzoyl 1,2,3,4 tetrahydroquinoline |
| BE789822A (fr) * | 1971-10-08 | 1973-04-06 | Allen & Hanburys Ltd | Nouveaux composes heterocycliques |
| BE793524A (fr) * | 1971-12-30 | 1973-06-29 | Riker Laboratories Inc | Acides benzoquinolizine-carboxyliques et leurs derives |
-
1973
- 1973-04-05 GB GB1627973A patent/GB1433151A/en not_active Expired
-
1974
- 1974-03-21 ZA ZA00741860A patent/ZA741860B/xx unknown
- 1974-03-25 IE IE649/74A patent/IE39101B1/xx unknown
- 1974-03-27 AU AU67200/74A patent/AU6720074A/en not_active Expired
- 1974-03-27 US US455071A patent/US3917608A/en not_active Expired - Lifetime
- 1974-04-01 LU LU69756A patent/LU69756A1/xx unknown
- 1974-04-01 BE BE142731A patent/BE813158A/xx unknown
- 1974-04-01 DE DE2415763A patent/DE2415763A1/de active Pending
- 1974-04-02 CH CH462974A patent/CH602722A5/xx not_active IP Right Cessation
- 1974-04-03 FR FR7411776A patent/FR2230355B1/fr not_active Expired
- 1974-04-03 AT AT277074A patent/AT330180B/de not_active IP Right Cessation
- 1974-04-05 CA CA197,107A patent/CA1015758A/en not_active Expired
- 1974-04-05 NL NL7404719A patent/NL7404719A/xx not_active Application Discontinuation
- 1974-04-05 JP JP49039368A patent/JPS5024296A/ja active Pending
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0157346A3 (en) * | 1984-03-30 | 1986-02-05 | Fujisawa Pharmaceutical Co., Ltd. | Quinolizinone compound, processes for preparation thereof and pharmaceutical composition comprising the same |
| WO1997031000A1 (en) * | 1996-02-21 | 1997-08-28 | Darwin Discovery Limited | Quinolones and their therapeutic use |
| WO1997030999A1 (en) * | 1996-02-21 | 1997-08-28 | Darwin Discovery Limited | Quinolones and their therapeutic use |
| US5792774A (en) * | 1996-02-21 | 1998-08-11 | Chiroscience Limited | Quinolones and their therapeutic use |
| RU2204553C2 (ru) * | 1997-03-10 | 2003-05-20 | Янссен Фармацевтика Н.В. | 1,8-аннелированные производные хинолинона, замещенные n- или c-связанными имидазолами, ингибирующие фарнезилтрансферазу |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2415763A1 (de) | 1974-10-17 |
| JPS5024296A (enExample) | 1975-03-15 |
| AT330180B (de) | 1976-06-25 |
| AU6720074A (en) | 1975-10-02 |
| LU69756A1 (enExample) | 1975-06-16 |
| NL7404719A (enExample) | 1974-10-08 |
| BE813158A (fr) | 1974-10-01 |
| ZA741860B (en) | 1975-02-26 |
| CH602722A5 (enExample) | 1978-07-31 |
| FR2230355A1 (enExample) | 1974-12-20 |
| IE39101B1 (en) | 1978-08-02 |
| IE39101L (en) | 1974-10-05 |
| ATA277074A (de) | 1975-09-15 |
| FR2230355B1 (enExample) | 1977-05-06 |
| US3917608A (en) | 1975-11-04 |
| CA1015758A (en) | 1977-08-16 |
| AU474838B2 (enExample) | 1976-08-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1433151A (en) | Benzo-ij-quinolizines | |
| US3506667A (en) | Furo quinoline carboxylates | |
| KR860009030A (ko) | 포스폰산 및 그의 유도체의 제조 | |
| ES8503686A1 (es) | Procedimiento de preparar derivados de penicilina. | |
| KOBAYASHI et al. | Alkaloidal constituents of Leucojum asetivum L.(Amaryllidaceae) | |
| FI881959A0 (fi) | Karboksyylihappoestereiden pelkistys | |
| IL33846A (en) | Derivatives of 1-thiachromone and 4-thionchromone,their preparation and pharmaceutical compositions containing them | |
| ES262677A1 (es) | Un metodo para hacer emetinao sus analogos | |
| KR870003107A (ko) | 키산틴 유도체의 제조방법 | |
| GB1496492A (en) | Optically active lysergic acid derivatives | |
| KR920008039A (ko) | (IR,5S,6S)- 2-[(6,7-디히드로-5H-피라졸로[1,2-a][1,2,4]트리아졸륨-6-일)]티오-6- [(R)-1-히드록시 에틸]-1-메틸-카르바페넴-3-카르복실레이트 및 그의 출발물질의 제조방법 | |
| CA1257268A (en) | Octahydroindolizinepropanoic acids and related compounds as enzyme inhibitors | |
| CA2016664A1 (en) | Indole derivative and method of production thereof | |
| US4855445A (en) | Substituted-8-alkenyl-1,3,4,9-tetrahydropyrano[3,4-b]indole-1-acetic acids | |
| KR860008159A (ko) | 디벤즈[be] 옥세핀 아세트산 유도체, 그 제법 및 치료에의 응용 | |
| GB1158868A (en) | Novel 2,4-Disubstituted 7- and 8-Chloroquinolines, the preparation thereof and Compositions containing the same | |
| US4785015A (en) | Substituted 1,3,4,9-tetrahydropyrano [3,4-B]indole-1-acetic acids | |
| US4540806A (en) | Benzocycloalkane amines | |
| IE790190L (en) | Purine derivatives | |
| EP0330444A3 (en) | Novel thiorhodamines and a novel method of preparation | |
| GB1209799A (en) | Aminoalkylbicyclocarboxylic acids | |
| GB1126860A (en) | Novel 4-substituted-7- and 8-chloroquinolines and a process for the preparation thereof | |
| IE870488L (en) | 1,3,4,9 - TETRAHYDROPYRANO (3,4-b) INDOLE -1-ACETIC ACIDS | |
| GB1462676A (en) | Substituted esters of n-4-quinolyl-anthranilic acids | |
| IE40676L (en) | Dibenzo (thiepino or oxepino-) -pyrrole compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |