GB1386992A - Pesticidal compounds and compositions - Google Patents
Pesticidal compounds and compositionsInfo
- Publication number
- GB1386992A GB1386992A GB2554272A GB2554272A GB1386992A GB 1386992 A GB1386992 A GB 1386992A GB 2554272 A GB2554272 A GB 2554272A GB 2554272 A GB2554272 A GB 2554272A GB 1386992 A GB1386992 A GB 1386992A
- Authority
- GB
- United Kingdom
- Prior art keywords
- alpha
- dimethoxyphenyl
- compounds
- butyronitrile
- compositions
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title abstract 5
- 230000000361 pesticidal effect Effects 0.000 title abstract 2
- 239000000203 mixture Substances 0.000 title 1
- OUIZGIDKSQXOMA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-2-ethylbutanenitrile Chemical compound CCC(CC)(C#N)C1=CC=C(OC)C(OC)=C1 OUIZGIDKSQXOMA-UHFFFAOYSA-N 0.000 abstract 1
- BHMBMWRWZRLPDX-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-4-methoxybutanenitrile Chemical compound COC=1C=C(C=CC=1OC)C(C#N)CCOC BHMBMWRWZRLPDX-UHFFFAOYSA-N 0.000 abstract 1
- XGZJSISYWSHQQX-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)butanenitrile Chemical compound CCC(C#N)C1=CC=C(OC)C(OC)=C1 XGZJSISYWSHQQX-UHFFFAOYSA-N 0.000 abstract 1
- IBHVGJLHZDJUHG-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)octadecanenitrile Chemical compound COC=1C=C(C=CC1OC)C(C#N)CCCCCCCCCCCCCCCC IBHVGJLHZDJUHG-UHFFFAOYSA-N 0.000 abstract 1
- HCSVOKWUXPFAEI-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)pentanenitrile Chemical compound CCCC(C#N)C1=CC=C(OC)C(OC)=C1 HCSVOKWUXPFAEI-UHFFFAOYSA-N 0.000 abstract 1
- 125000004185 ester group Chemical group 0.000 abstract 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 abstract 1
- 230000000855 fungicidal effect Effects 0.000 abstract 1
- 125000001475 halogen functional group Chemical group 0.000 abstract 1
- 230000002363 herbicidal effect Effects 0.000 abstract 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 abstract 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/01—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms
- C07C255/32—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms having cyano groups bound to acyclic carbon atoms of a carbon skeleton containing at least one six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI1120A HU164015B (enExample) | 1971-05-31 | 1971-05-31 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1386992A true GB1386992A (en) | 1975-03-12 |
Family
ID=10994406
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB2554272A Expired GB1386992A (en) | 1971-05-31 | 1972-05-31 | Pesticidal compounds and compositions |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3886283A (enExample) |
| AT (1) | AT318300B (enExample) |
| AU (1) | AU4270772A (enExample) |
| BE (1) | BE784160A (enExample) |
| BR (1) | BR7203531D0 (enExample) |
| CA (1) | CA994239A (enExample) |
| CS (1) | CS196508B1 (enExample) |
| DD (1) | DD105381A1 (enExample) |
| DE (1) | DE2223957A1 (enExample) |
| ES (1) | ES403303A1 (enExample) |
| FR (1) | FR2143678B1 (enExample) |
| GB (1) | GB1386992A (enExample) |
| HU (1) | HU164015B (enExample) |
| IL (1) | IL39505A (enExample) |
| PL (1) | PL89021B1 (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5163145A (en) * | 1974-11-26 | 1976-06-01 | Sumitomo Chemical Co | 33 mechiru 22 * 44 harogenofueniru * buchironitoriruno seizoho |
| US4056509A (en) * | 1975-07-09 | 1977-11-01 | Shell Oil Company | Preparation of benzyl cyanides |
| US4182625A (en) * | 1977-07-05 | 1980-01-08 | Stauffer Chemical Company | 3-Halo-5-(lower alkoxy) phenoxy alkyl amides |
| US4224052A (en) * | 1978-05-05 | 1980-09-23 | American Cyanamid Company | Polysubstituted butanoic acids, esters and derivatives thereof utilizing the same as herbicides |
| US4383848A (en) * | 1978-05-05 | 1983-05-17 | American Cyanamid Company | Polysubstituted butanoic acids, esters and derivatives thereof utilizing the same as herbicides |
| US4430114A (en) | 1979-07-25 | 1984-02-07 | American Cyanamid Company | 2,6-Dinitroaniline herbicides, and use thereof |
| DE3047106A1 (de) * | 1980-12-13 | 1982-07-29 | Henkel Kgaa | Topische kosmetische zubereitungen zur behandlung von stark fettendem haar und seborrhoeischer haut |
| US4511394A (en) * | 1981-03-16 | 1985-04-16 | Stauffer Chemical Co. | Substituted benzyloxy chloroethoxy ethane herbicide antidotes |
| US4400204A (en) * | 1981-03-16 | 1983-08-23 | Stauffer Chemical Company | Substituted benzyloxy chloroethoxy ethane herbicide antidotes |
| US4489007A (en) * | 1981-03-16 | 1984-12-18 | Stauffer Chemical Company | Substituted benzyloxy chloroethoxy ethane herbicide antidotes |
| JPS57185252A (en) * | 1981-05-07 | 1982-11-15 | Nippon Tokushu Kagaku Kogyo Kk | Production of phenylacetonitrile derivative |
| US4806673A (en) * | 1986-12-10 | 1989-02-21 | The Dow Chemical Company | Preparation of cyanoalkylphenols from bisphenols |
| US4916251A (en) * | 1987-01-02 | 1990-04-10 | The Dow Chemical Company | Cyanoisoalkylation of hydroxy substituted aryl compounds using ketones |
| US7622504B2 (en) * | 2006-12-20 | 2009-11-24 | MCS Laboratories, Inc. | Esters of 2-phenylalkanenitriles and antifungal compositions containing them |
| JP2020203835A (ja) * | 2017-08-25 | 2020-12-24 | アグロカネショウ株式会社 | フェニルアセトニトリル誘導体を用いた植物の細菌性病害の防除方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2695319A (en) * | 1954-11-23 | Process of producing verairyl | ||
| US2740806A (en) * | 1953-01-29 | 1956-04-03 | Searle & Co | Nuclearly hydroxylated derivatives of alpha, beta-diphenylalkanonitriles |
| US2897229A (en) * | 1954-02-09 | 1959-07-28 | Kali Chemie Ag | Phenyl acetonitrile compounds and a process of making same |
| US3441617A (en) * | 1966-03-15 | 1969-04-29 | Lummus Co | Oxidation of aromatic compounds |
-
1971
- 1971-05-31 HU HUCI1120A patent/HU164015B/hu unknown
-
1972
- 1972-05-17 DE DE19722223957 patent/DE2223957A1/de active Pending
- 1972-05-23 IL IL39505A patent/IL39505A/en unknown
- 1972-05-24 AT AT447472A patent/AT318300B/de not_active IP Right Cessation
- 1972-05-24 US US256268A patent/US3886283A/en not_active Expired - Lifetime
- 1972-05-25 AU AU42707/72A patent/AU4270772A/en not_active Expired
- 1972-05-29 FR FR7219104A patent/FR2143678B1/fr not_active Expired
- 1972-05-29 PL PL1972155654A patent/PL89021B1/pl unknown
- 1972-05-29 DD DD163260A patent/DD105381A1/xx unknown
- 1972-05-30 CS CS723717A patent/CS196508B1/cs unknown
- 1972-05-30 ES ES403303A patent/ES403303A1/es not_active Expired
- 1972-05-30 BE BE784160A patent/BE784160A/xx not_active IP Right Cessation
- 1972-05-31 CA CA143,542A patent/CA994239A/en not_active Expired
- 1972-05-31 GB GB2554272A patent/GB1386992A/en not_active Expired
- 1972-05-31 BR BR3531/72A patent/BR7203531D0/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL39505A0 (en) | 1972-09-28 |
| ES403303A1 (es) | 1975-05-01 |
| AU4270772A (en) | 1973-11-29 |
| US3886283A (en) | 1975-05-27 |
| CS196508B1 (en) | 1980-03-31 |
| BE784160A (fr) | 1972-09-18 |
| BR7203531D0 (pt) | 1973-05-31 |
| HU164015B (enExample) | 1973-12-28 |
| DD105381A1 (enExample) | 1974-04-20 |
| PL89021B1 (en) | 1976-10-30 |
| DE2223957A1 (de) | 1972-12-14 |
| CA994239A (en) | 1976-08-03 |
| IL39505A (en) | 1976-01-30 |
| AT318300B (de) | 1974-10-10 |
| FR2143678A1 (enExample) | 1973-02-09 |
| FR2143678B1 (enExample) | 1975-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1386992A (en) | Pesticidal compounds and compositions | |
| GB1460410A (en) | Benzoylureidodiphenyl ethers and their use as insecticides | |
| GB1455207A (en) | Substituted dinitro-diphenylamines and their pesticidal compositions | |
| GB1377640A (en) | Pesticides | |
| GB1254999A (en) | Substituted nitrosalicylanilides and bactericidal and lamprecidal uses thereof | |
| GB1226250A (enExample) | ||
| DE3267188D1 (en) | Hydroxybenzylamino-aryl compounds, process for preparing and pharmaceutical compositions containing the same | |
| IE37717L (en) | N-BENZHYDRYL-N'-p-HYDROXYBENZYL-PIPERAZINES. | |
| GB1394619A (en) | Imides | |
| GB1455474A (en) | Haloacetanilides for influencing plant growth | |
| IE40395L (en) | 2,3- dihydrobenzofuranyl -7-n-methylcarbamates;¹insecticides | |
| ATE13302T1 (de) | 3-o-demethyl-derivate von verbindungen der istamycin b-serie und ihre herstellung. | |
| SE8300870L (sv) | Mellanprodukter for framstellning av derivat av 4"-desoxi-4"-amino-erytromycin a | |
| DE3372773D1 (de) | 7-oxo-4-thia-1-azabicyclo(3,2,0)heptane derivatives | |
| FR2371431A1 (fr) | Complexes metalliques de composes heterocycliques azotes, utilisables comme stabilisants de macropolymeres | |
| ES385531A1 (es) | Un procedimiento para la preparacion de compuestos aril- ceto-acetilenicos. | |
| GB1237658A (en) | Substituted 1-oxy-1-thiono-3-halogen- or -3-alkyl phospholines | |
| GB1348856A (en) | Insecticidal phosphoroamidothioates and compositions containing them | |
| GB1443096A (en) | Organophosphorus pesticides processes for producing them and compositions containing them | |
| GB1352464A (en) | N-alkyl-alpha-3,5-substituted phenoxy-alkyl amides and their use as herbicides | |
| GB1498200A (en) | Herbicidally effective 1,3,4-thiadiazolyl-(2)-hexahydrotriazinone derivatives | |
| IE35441B1 (en) | 3-acyloxypropyl-2'-trimethylammoniumethyl phosphates | |
| GB1266646A (enExample) | ||
| GB1476529A (en) | Aryl diamines and their use as herbicides | |
| GB1210034A (en) | NOVEL p-CARBAMOYLAMINOPHENOL ETHERS, PROCESSES FOR THEIR PREPARATION, AND COMPOSITIONS INCORPORATING THEM |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| 435 | Patent endorsed 'licences of right' on the date specified (sect. 35/1949) | ||
| PCNP | Patent ceased through non-payment of renewal fee |