GB1367677A - Optically active basically substituted phenylacetonitriles - Google Patents
Optically active basically substituted phenylacetonitrilesInfo
- Publication number
- GB1367677A GB1367677A GB5472171A GB5472171A GB1367677A GB 1367677 A GB1367677 A GB 1367677A GB 5472171 A GB5472171 A GB 5472171A GB 5472171 A GB5472171 A GB 5472171A GB 1367677 A GB1367677 A GB 1367677A
- Authority
- GB
- United Kingdom
- Prior art keywords
- methoxy
- hydrogen
- formula
- laevo
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000007962 benzene acetonitriles Chemical class 0.000 title abstract 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 abstract 8
- 239000001257 hydrogen Substances 0.000 abstract 7
- 229910052739 hydrogen Inorganic materials 0.000 abstract 7
- 150000001875 compounds Chemical class 0.000 abstract 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 3
- 150000002431 hydrogen Chemical class 0.000 abstract 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 239000000460 chlorine Substances 0.000 abstract 1
- 229910052801 chlorine Inorganic materials 0.000 abstract 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 1
- 230000001225 therapeutic effect Effects 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702059923 DE2059923C3 (de) | 1970-12-05 | 1970-12-05 | l-a-Isopropyl-o-[(N-methyl-N-homoveratryl)v-aminopropyl] -3,4-dimethoxyphenylacetonitril, Verfahren zu dessen Herstellung und dieses enthaltende Arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1367677A true GB1367677A (en) | 1974-09-18 |
Family
ID=5790091
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB5472171A Expired GB1367677A (en) | 1970-12-05 | 1971-11-25 | Optically active basically substituted phenylacetonitriles |
Country Status (8)
| Country | Link |
|---|---|
| AT (1) | AT305262B (enExample) |
| BE (1) | BE776218A (enExample) |
| CH (1) | CH565748A5 (enExample) |
| DE (1) | DE2059923C3 (enExample) |
| FR (1) | FR2116564B1 (enExample) |
| GB (1) | GB1367677A (enExample) |
| NL (1) | NL172744C (enExample) |
| YU (2) | YU35346B (enExample) |
Cited By (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4305887A (en) | 1979-11-11 | 1981-12-15 | Basf Aktiengesellschaft | Process for obtaining the enantiomeric forms of 4-cyano-1-[N-methyl-N-(2'-{3",4"-dimethoxyphenyl}-ethyl)-amino]-5-methyl-4-(3',4',5'-trimethoxyphenyl)-hexane and of salts thereof |
| US4350636A (en) | 1980-09-11 | 1982-09-21 | Basf Aktiengesellschaft | Preparation of phenylacetonitriles carrying basic substituents |
| US4438131A (en) | 1981-04-10 | 1984-03-20 | Basf Aktiengesellschaft | Ω-Cyano-1, Ω-diphenyl-azaalkane derivatives, their preparation and drugs containing them |
| US4596820A (en) * | 1983-12-10 | 1986-06-24 | Basf Aktiengesellschaft | 1,7-diphenyl-3-methylaza-7-cyano-8-methylnonane for use in the treatment of diseases |
| US5457224A (en) * | 1992-02-07 | 1995-10-10 | Knoll Aktiengesellschaft | Resolution of racemic verapamil |
| WO1998011061A1 (en) * | 1996-09-10 | 1998-03-19 | Darwin Discovery Limited | New intermediates for the preparation of verapamil derivates |
| US5859279A (en) * | 1996-09-10 | 1999-01-12 | Darwin Discovery Limited | Compound and process |
| US5892093A (en) * | 1996-02-08 | 1999-04-06 | Darwin Discovery Limited | Resolution |
| WO2000055122A1 (en) * | 1999-03-16 | 2000-09-21 | Eisai Co., Ltd. | Nitrile derivatives |
| US7030103B2 (en) | 1999-07-06 | 2006-04-18 | Methylgene, Inc. | Sulfonamidomethyl phosphonate inhibitors of β-lactamase |
| US7514556B2 (en) | 1999-07-06 | 2009-04-07 | Methylgene Inc. | Inhibitors of β-lactamase |
| EP2170050A4 (en) * | 2007-06-20 | 2010-11-24 | Milestone Pharmaceuticals Inc | PHENYL ALKYLAMINE CALCIUM CHANNEL BLOCKERS WITH SHORT DURATION AND ITS USES |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3138488A1 (de) * | 1981-09-28 | 1983-04-14 | Knoll Ag, 6700 Ludwigshafen | Verwendung von basisch substituierten phenylacetonritrilen bei der vorbeugenden bekaempfung von krankheiten und mittel dafuer |
| DE3635930A1 (de) * | 1986-10-22 | 1988-04-28 | Basf Ag | Wirkstoffe zur anwendung bei der behandlung von tumoren |
| DE3603660C2 (de) * | 1986-02-06 | 1994-09-15 | Fresenius Ag | Verbesserte Peritonealdialyse |
| GB9319918D0 (en) * | 1993-09-27 | 1993-11-10 | Chiros Ltd | Chiral compounds and their preparation |
| US5910601A (en) * | 1994-09-26 | 1999-06-08 | Darwin Discovery Limited | Chiral nitriles, their preparation and their use for the manufacture of verapamil and analogues |
| JP2000504683A (ja) * | 1996-02-08 | 2000-04-18 | ダーウィン・ディスカバリー・リミテッド | 4―シアノ―4―(3,4―ジメトキシフェニル)―5―メチルヘキサン酸の分割 |
| WO1997044025A1 (en) * | 1996-05-23 | 1997-11-27 | G.D. Searle & Co. | Pharmaceutical compositions containing non-racemic verapamil and process for optimizing the pharmaceutical activity of r- and s-verapamil |
| EP3294703A4 (en) | 2015-05-12 | 2019-01-02 | Piramal Enterprises Limited | A process for the preparation of verapamil hydrochloride |
-
1970
- 1970-12-05 DE DE19702059923 patent/DE2059923C3/de not_active Expired
-
1971
- 1971-11-25 GB GB5472171A patent/GB1367677A/en not_active Expired
- 1971-11-26 CH CH1728771A patent/CH565748A5/xx not_active IP Right Cessation
- 1971-12-01 AT AT1035371A patent/AT305262B/de not_active IP Right Cessation
- 1971-12-01 YU YU302371A patent/YU35346B/xx unknown
- 1971-12-02 NL NL7116577A patent/NL172744C/xx not_active IP Right Cessation
- 1971-12-03 BE BE776218A patent/BE776218A/xx not_active IP Right Cessation
- 1971-12-06 FR FR7143744A patent/FR2116564B1/fr not_active Expired
-
1979
- 1979-02-01 YU YU21879A patent/YU35348B/xx unknown
Cited By (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4305887A (en) | 1979-11-11 | 1981-12-15 | Basf Aktiengesellschaft | Process for obtaining the enantiomeric forms of 4-cyano-1-[N-methyl-N-(2'-{3",4"-dimethoxyphenyl}-ethyl)-amino]-5-methyl-4-(3',4',5'-trimethoxyphenyl)-hexane and of salts thereof |
| US4350636A (en) | 1980-09-11 | 1982-09-21 | Basf Aktiengesellschaft | Preparation of phenylacetonitriles carrying basic substituents |
| US4438131A (en) | 1981-04-10 | 1984-03-20 | Basf Aktiengesellschaft | Ω-Cyano-1, Ω-diphenyl-azaalkane derivatives, their preparation and drugs containing them |
| US4596820A (en) * | 1983-12-10 | 1986-06-24 | Basf Aktiengesellschaft | 1,7-diphenyl-3-methylaza-7-cyano-8-methylnonane for use in the treatment of diseases |
| AU569354B2 (en) * | 1983-12-10 | 1988-01-28 | Basf Aktiengesellschaft | (-)-1,7-diphenyl-3-methylaza-7-cyano-8-methylnonane |
| US5457224A (en) * | 1992-02-07 | 1995-10-10 | Knoll Aktiengesellschaft | Resolution of racemic verapamil |
| US5892093A (en) * | 1996-02-08 | 1999-04-06 | Darwin Discovery Limited | Resolution |
| WO1998011061A1 (en) * | 1996-09-10 | 1998-03-19 | Darwin Discovery Limited | New intermediates for the preparation of verapamil derivates |
| US5859279A (en) * | 1996-09-10 | 1999-01-12 | Darwin Discovery Limited | Compound and process |
| US6667412B1 (en) | 1999-03-16 | 2003-12-23 | Eisai Co., Ltd. | Nitrile compound |
| WO2000055122A1 (en) * | 1999-03-16 | 2000-09-21 | Eisai Co., Ltd. | Nitrile derivatives |
| US7030103B2 (en) | 1999-07-06 | 2006-04-18 | Methylgene, Inc. | Sulfonamidomethyl phosphonate inhibitors of β-lactamase |
| US7514556B2 (en) | 1999-07-06 | 2009-04-07 | Methylgene Inc. | Inhibitors of β-lactamase |
| EP2170050A4 (en) * | 2007-06-20 | 2010-11-24 | Milestone Pharmaceuticals Inc | PHENYL ALKYLAMINE CALCIUM CHANNEL BLOCKERS WITH SHORT DURATION AND ITS USES |
| AU2008266798B2 (en) * | 2007-06-20 | 2014-07-17 | Milestone Pharmaceuticals Inc. | Short acting phenylalkylamine calcium channel blockers and uses thereof |
| US9227918B2 (en) | 2007-06-20 | 2016-01-05 | Milestone Pharmaceuticals | Short acting phenylalkylamine calcium channel blockers and uses thereof |
| US9463179B2 (en) | 2007-06-20 | 2016-10-11 | Milestone Pharmaceuticals Inc. | Short acting phenylalkylamine calcium channel blockers and uses thereof |
| US9737503B2 (en) | 2007-06-20 | 2017-08-22 | Milestone Pharmaceuticals Inc. | Short acting phenylalkylamine calcium channel blockers and uses thereof |
| US10010523B2 (en) | 2007-06-20 | 2018-07-03 | Milestone Pharmaceuticals Inc. | Short acting phenylalkylamine calcium channel blockers and uses thereof |
| US10010522B2 (en) | 2007-06-20 | 2018-07-03 | Milestone Pharmaceuticals Inc. | Short acting phenylalkylamine calcium channel blockers and uses thereof |
| US10010524B2 (en) | 2007-06-20 | 2018-07-03 | Milestone Pharmaceuticals Inc. | Short acting phenylalkylamine calcium channel blockers and uses thereof |
Also Published As
| Publication number | Publication date |
|---|---|
| YU35346B (en) | 1980-12-31 |
| NL172744B (nl) | 1983-05-16 |
| YU21879A (en) | 1980-06-30 |
| DE2059923C3 (de) | 1979-01-25 |
| CH565748A5 (enExample) | 1975-08-29 |
| NL172744C (nl) | 1983-10-17 |
| BE776218A (fr) | 1972-06-05 |
| AT305262B (de) | 1973-02-26 |
| FR2116564B1 (enExample) | 1975-03-14 |
| YU302371A (en) | 1980-06-30 |
| FR2116564A1 (enExample) | 1972-07-13 |
| YU35348B (en) | 1980-12-31 |
| DE2059923A1 (de) | 1972-06-15 |
| NL7116577A (enExample) | 1972-06-07 |
| DE2059923B2 (de) | 1978-05-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1367677A (en) | Optically active basically substituted phenylacetonitriles | |
| GB1331405A (en) | Esters their production and their medicinal use | |
| GB1438265A (enExample) | ||
| GB1363597A (en) | 2-acyloxy-benzoic acid anilides process for their preparation and their insecticidal and acaricidal use | |
| GB1308028A (en) | Thiazolylbenzoic acid derivatives and a process for their manufactur | |
| GB1228736A (enExample) | ||
| GB1448026A (en) | 2-aminomethyleneindanone analgesic agents | |
| GB1417542A (en) | Theophylline 7acetate salts | |
| GB1434805A (en) | 5-phenoxy-4-amino pyrimidines | |
| GB1378068A (en) | Citric acid derivatives | |
| GB1128079A (en) | Process for the manufacture of new cyclohexane derivatives | |
| GB1363658A (en) | Benzobicycloalkane compounds | |
| GB1458217A (en) | Distributed azabicycloalkanes a process for their preparation and pharmaceutical compositions containing them | |
| GB1174349A (en) | Novel 2-Anilinomethylimidazoline Derivatives and process for the preparation thereof | |
| GB1359560A (en) | Preparation of pyrrylsalicylic acid | |
| GB1310282A (en) | Pyrazolopyridine carboxylic acid compounds and derivatives | |
| GB1383259A (en) | 5-hydroxy-1- -5-substituted phenyl furfurylidene- amino - hydantoins | |
| GB1442619A (en) | 3-phenoxypropylamine derivatives their preparation and use | |
| GB1503626A (en) | Substituted piperazine derivative its preparation and compositions containing it | |
| GB1187198A (en) | Substituted Anilides and preparation thereof | |
| GB1295556A (enExample) | ||
| GB1365097A (en) | Substituted phenoxyalkyamines process for their preparation and applications thereof | |
| GB1342540A (en) | Sulphonic acid esters their preparation and their medicinal use | |
| GB1298057A (en) | Bis(aminoalkylsulphamoyl)anthraquinones | |
| GB1503118A (en) | 7-amino-6,7-dihydro-(5h)-benzocycloheptenes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed | ||
| PE20 | Patent expired after termination of 20 years |