GB1364466A - Rotary harrows - Google Patents
Rotary harrowsInfo
- Publication number
- GB1364466A GB1364466A GB1641871A GB1641871A GB1364466A GB 1364466 A GB1364466 A GB 1364466A GB 1641871 A GB1641871 A GB 1641871A GB 1641871 A GB1641871 A GB 1641871A GB 1364466 A GB1364466 A GB 1364466A
- Authority
- GB
- United Kingdom
- Prior art keywords
- tines
- tine
- supports
- bolts
- working
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002689 soil Substances 0.000 abstract 2
- 230000004075 alteration Effects 0.000 abstract 1
- 230000004048 modification Effects 0.000 abstract 1
- 238000012986 modification Methods 0.000 abstract 1
- OCDRLZFZBHZTKQ-NMUBGGKPSA-N onetine Chemical compound C[C@@H](O)[C@@]1(O)C[C@@H](C)[C@@](C)(O)C(=O)OC\C2=C\CN(C)CC[C@@H](OC1=O)C2=O OCDRLZFZBHZTKQ-NMUBGGKPSA-N 0.000 abstract 1
- 230000000717 retained effect Effects 0.000 abstract 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01B—SOIL WORKING IN AGRICULTURE OR FORESTRY; PARTS, DETAILS, OR ACCESSORIES OF AGRICULTURAL MACHINES OR IMPLEMENTS, IN GENERAL
- A01B33/00—Tilling implements with rotary driven tools, e.g. in combination with fertiliser distributors or seeders, with grubbing chains, with sloping axles, with driven discs
- A01B33/08—Tools; Details, e.g. adaptations of transmissions or gearings
- A01B33/14—Attaching the tools to the rotating shaft, e.g. resiliently or flexibly-attached tools
- A01B33/146—Attaching the tools to the rotating shaft, e.g. resiliently or flexibly-attached tools the rotating shaft being oriented vertically or steeply inclined
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Soil Sciences (AREA)
- Environmental Sciences (AREA)
- Soil Working Implements (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7007690A NL7007690A (enExample) | 1970-05-28 | 1970-05-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1364466A true GB1364466A (en) | 1974-08-21 |
Family
ID=19810171
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB1641871A Expired GB1364466A (en) | 1970-05-28 | 1971-05-21 | Rotary harrows |
| GB5897373A Expired GB1364468A (en) | 1970-05-28 | 1971-05-21 | Rotary harrows |
| GB184473A Expired GB1364467A (en) | 1970-05-28 | 1971-05-21 | Rotary harrows |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB5897373A Expired GB1364468A (en) | 1970-05-28 | 1971-05-21 | Rotary harrows |
| GB184473A Expired GB1364467A (en) | 1970-05-28 | 1971-05-21 | Rotary harrows |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3774687A (enExample) |
| DE (1) | DE2125553C2 (enExample) |
| FR (1) | FR2090356B1 (enExample) |
| GB (3) | GB1364466A (enExample) |
| NL (1) | NL7007690A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0501349A1 (de) * | 1991-02-27 | 1992-09-02 | Kverneland Klepp As | Bodenbearbeitungsgerät |
| US10327373B2 (en) * | 2015-09-23 | 2019-06-25 | Deere & Company | Harrow downforce adjustment |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4043400A (en) * | 1972-06-23 | 1977-08-23 | C. Van Der Lely N. V. | Harrows |
| NL7216408A (enExample) * | 1972-12-04 | 1974-06-06 | ||
| DE2360004A1 (de) * | 1972-12-04 | 1974-06-06 | Lely Nv C Van Der | Bodenbearbeitungsmaschine |
| US4003436A (en) * | 1973-08-15 | 1977-01-18 | The Black And Decker Manufacturing Company | Oscillatory cultivator |
| AT339647B (de) * | 1974-01-31 | 1977-10-25 | Lely Nv C Van Der | Zinkenhalter fur bodenbearbeitungsmaschinen mit zwangslaufig angetriebenen werkzeugtragern |
| NL7402069A (nl) * | 1974-02-15 | 1975-08-19 | Lely Nv C Van Der | Grondbewerkingsmachine. |
| NL7402787A (nl) * | 1974-03-01 | 1975-09-03 | Lely Nv C Van Der | Grondbewerkingsmachine. |
| NL7409705A (nl) * | 1974-07-18 | 1976-01-20 | Lely Nv C Van Der | Grondbewerkingsmachine. |
| NL7601786A (nl) * | 1976-02-23 | 1977-08-25 | Lely Nv C Van Der | Grondbewerkingsmachine. |
| NL7511330A (nl) * | 1975-09-26 | 1977-03-29 | Lely Nv C Van Der | Grondbewerkingsmachine. |
| NL7513962A (nl) * | 1975-12-01 | 1977-06-03 | Lely Nv C Van Der | Grondbewerkingsmachine. |
| NL7614117A (nl) * | 1976-12-20 | 1978-06-22 | Lely Nv C Van Der | Grondbewerkingsmachine. |
| US4324123A (en) * | 1978-10-17 | 1982-04-13 | Lely Nv C Van Der | Soil cultivating implements |
| NL7810717A (nl) * | 1978-10-27 | 1980-04-29 | Patent Concern Nv | Grondbewerkingsmachine. |
| NL7810716A (nl) * | 1978-10-27 | 1980-04-29 | Patent Concern Nv | Grondbewerkingsmachine. |
| US4501200A (en) * | 1982-12-12 | 1985-02-26 | Canron Corp. | Tamping tool retainer |
| DE3664088D1 (en) * | 1985-08-01 | 1989-08-03 | Amazonen Werke Dreyer H | Soil-tilling implement |
| DE3629500A1 (de) * | 1986-08-29 | 1988-03-03 | Amazonen Werke Dreyer H | Bodenbearbeitungsmaschine |
| GB8626626D0 (en) * | 1986-11-07 | 1986-12-10 | Dowdeswell Eng Co Ltd | Cultivator blade mounting |
| DE9006000U1 (de) * | 1990-05-26 | 1990-08-02 | H. Niemeyer Söhne GmbH & Co KG, 4446 Hörstel | Bodenbearbeitungsmaschine |
| AT405592B (de) * | 1992-04-02 | 1999-09-27 | Poettinger Ohg Alois | Kreiselegge |
| DE19952874B4 (de) * | 1999-11-03 | 2009-06-18 | Hans Hofmann | Fahrbares Bodenbearbeitungsgerät |
| ITVE20010011U1 (it) * | 2001-05-08 | 2002-11-08 | Alpina Spa | Zappetta frangizolle |
| DE10307234B4 (de) * | 2003-02-20 | 2006-08-31 | F.X.S. Sauerburger Traktoren und Gerätebau GmbH | Vorrichtung zur Bodenbearbeitung |
| RU2243632C1 (ru) * | 2003-09-16 | 2005-01-10 | Бурков Лев Николаевич | Зуб бороны конструкции буркова л.н. |
| CN112425286B (zh) * | 2020-11-25 | 2022-07-29 | 湖南省农友机械集团有限公司 | 一种可主动避障的旋耕机构和旋耕设备 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2983322A (en) * | 1961-05-09 | heeren | ||
| FR1075353A (fr) * | 1953-02-10 | 1954-10-15 | Appareil motoculteur perfectionné | |
| IT616146A (enExample) * | 1959-09-03 | |||
| US3084748A (en) * | 1960-08-01 | 1963-04-09 | Heeren | Tined mulcher head |
| NL141753B (nl) * | 1968-04-17 | 1974-04-16 | Eerste Emmeloorer Maschf Nv | Grondbewerkingsinrichting. |
-
1970
- 1970-05-28 NL NL7007690A patent/NL7007690A/xx unknown
-
1971
- 1971-05-21 GB GB1641871A patent/GB1364466A/en not_active Expired
- 1971-05-21 GB GB5897373A patent/GB1364468A/en not_active Expired
- 1971-05-21 GB GB184473A patent/GB1364467A/en not_active Expired
- 1971-05-22 DE DE2125553A patent/DE2125553C2/de not_active Expired
- 1971-05-27 US US00147439A patent/US3774687A/en not_active Expired - Lifetime
- 1971-05-28 FR FR7119572A patent/FR2090356B1/fr not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0501349A1 (de) * | 1991-02-27 | 1992-09-02 | Kverneland Klepp As | Bodenbearbeitungsgerät |
| US10327373B2 (en) * | 2015-09-23 | 2019-06-25 | Deere & Company | Harrow downforce adjustment |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2090356A1 (enExample) | 1972-01-14 |
| GB1364467A (en) | 1974-08-21 |
| FR2090356B1 (enExample) | 1976-02-06 |
| US3774687A (en) | 1973-11-27 |
| NL7007690A (enExample) | 1971-11-30 |
| GB1364468A (en) | 1974-08-21 |
| DE2125553C2 (de) | 1986-03-06 |
| DE2125553A1 (de) | 1971-12-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1364466A (en) | Rotary harrows | |
| US3783948A (en) | Cultivators | |
| FR2267016A1 (en) | Vertical axis rotary harrow | |
| GB1312959A (en) | Rotary harrows | |
| DE1782929A1 (de) | Bodenbearbeitungsmaschine | |
| GB1189047A (en) | Improvements in or relating to Soil Cultivating Implements | |
| GB1266432A (enExample) | ||
| US3252522A (en) | Agricultural tool carrier | |
| GB1371801A (en) | Cultivators | |
| GB1468991A (en) | Tines | |
| US3554297A (en) | Cultivator | |
| US2288110A (en) | Earth working implement | |
| US4126186A (en) | Soil cultivating implements | |
| ES451473A1 (es) | Un apero perfeccionado para cultivar el suelo. | |
| RU205451U1 (ru) | Почвообрабатывающее орудие для бахчеводства | |
| GB1458009A (en) | Rotary soil cultivating implements | |
| RU213407U1 (ru) | Дисковый орган для комбинированных почвообрабатывающих и посевных машин | |
| US453469A (en) | Gultivatoe | |
| DE8536446U1 (de) | Bodenbearbeitungsgeraet mit nacheordnetem einebnungsteil | |
| GB1387851A (en) | Tine mountings | |
| RU150900U1 (ru) | Борона дисковая трехрядная | |
| US4140185A (en) | Soil cultivating implements | |
| RU86377U1 (ru) | Дисковое почвообрабатывающее орудие | |
| RU150899U1 (ru) | Четырехрядная дисковая борона | |
| GB1401800A (en) | Cultivating implements |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |