GB1361388A - Ny--sulphamoylaryl--pyrrolidines - Google Patents
Ny--sulphamoylaryl--pyrrolidinesInfo
- Publication number
- GB1361388A GB1361388A GB3784270A GB3784270A GB1361388A GB 1361388 A GB1361388 A GB 1361388A GB 3784270 A GB3784270 A GB 3784270A GB 3784270 A GB3784270 A GB 3784270A GB 1361388 A GB1361388 A GB 1361388A
- Authority
- GB
- United Kingdom
- Prior art keywords
- compounds
- phenylpyrrolidin
- rnh
- aug
- ones
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 abstract 3
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 abstract 2
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 abstract 2
- 125000003118 aryl group Chemical group 0.000 abstract 2
- 239000000543 intermediate Substances 0.000 abstract 2
- 239000000203 mixture Substances 0.000 abstract 2
- IFUYYGRQBCXJNC-UHFFFAOYSA-N 4-cyclohexyl-1-phenylpyrrolidin-2-one Chemical class C1(CCCCC1)C1CC(N(C1)C1=CC=CC=C1)=O IFUYYGRQBCXJNC-UHFFFAOYSA-N 0.000 abstract 1
- UAGGSHCHBSDSMJ-UHFFFAOYSA-N 4-methyl-1,4-diphenylpyrrolidin-2-one Chemical compound C1(=CC=CC=C1)N1C(CC(C1)(C)C1=CC=CC=C1)=O UAGGSHCHBSDSMJ-UHFFFAOYSA-N 0.000 abstract 1
- 208000034308 Grand mal convulsion Diseases 0.000 abstract 1
- 206010034759 Petit mal epilepsy Diseases 0.000 abstract 1
- 125000001931 aliphatic group Chemical group 0.000 abstract 1
- 150000001412 amines Chemical class 0.000 abstract 1
- 229930188620 butyrolactone Natural products 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 206010015037 epilepsy Diseases 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- -1 sulphonyl halide Chemical class 0.000 abstract 1
- 230000001225 therapeutic effect Effects 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/263—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms
- C07D207/267—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/263—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms
- C07D207/27—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (21)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3784270A GB1361388A (en) | 1970-08-05 | 1970-08-05 | Ny--sulphamoylaryl--pyrrolidines |
| HUGE894A HU162250B (enExample) | 1970-08-05 | 1971-08-04 | |
| FR7128543A FR2101241B1 (enExample) | 1970-08-05 | 1971-08-04 | |
| AR237175A AR202884A1 (es) | 1970-08-05 | 1971-08-04 | Procedimiento para preparar nuevos derivados de n-sulfanoilfenil pirrolidinonas |
| CA119,749A CA996565A (en) | 1970-08-05 | 1971-08-04 | 1-(sulphamoylaryl)-pyrrolidin-2-ones |
| NL7110775A NL7110775A (enExample) | 1970-08-05 | 1971-08-04 | |
| ES393883A ES393883A1 (es) | 1970-08-05 | 1971-08-04 | Procedimiento para la preparacion de sulfamoilfenil pirri- lidinonas. |
| US00169062A US3813387A (en) | 1970-08-05 | 1971-08-04 | Sulphamoylphenyl pyrrolidinones |
| NO2923/71A NO137153C (no) | 1970-08-05 | 1971-08-04 | Analogifremgangsm}te for fremstilling av terapeutisk aktive sulfamoylfenyl-pyrrolidoner |
| DE2139072A DE2139072C3 (de) | 1970-08-05 | 1971-08-04 | N-(4-Sulfamoylphenyl)-pyiTolidin-2-one, Verfahren zu ihrer Herstellung und pharmazeutische Zusammensetzungen |
| PL1971149829A PL88911B1 (enExample) | 1970-08-05 | 1971-08-04 | |
| AU31984/71A AU442903B2 (en) | 1970-08-05 | 1971-08-04 | 1 sulphamoyl-aryl-pyrrolidin 2-ones |
| DK380171AA DK135503B (da) | 1970-08-05 | 1971-08-04 | Analogifremgangsmåde til fremstilling af 1-(sulfamoylfenyl)-pyrrolidinoner eller salte deraf. |
| AT682971A AT305997B (de) | 1970-08-05 | 1971-08-04 | Verfahren zur Herstellung neuer Pyrrolidin-2-onderivate und ihrer Salze |
| ZA715205A ZA715205B (en) | 1970-08-05 | 1971-08-04 | Novel compounds for use in the treatment of epilepsy |
| FI2190/71A FI54104C (fi) | 1970-08-05 | 1971-08-04 | Foerfarande foer framstaellning av terapeutiskt verksamma pyrrolidinonfoereningar |
| CH1148171A CH571489A5 (enExample) | 1970-08-05 | 1971-08-04 | |
| JP46058396A JPS5118948B1 (enExample) | 1970-08-05 | 1971-08-04 | |
| SE7110004A SE390730B (sv) | 1970-08-05 | 1971-08-04 | Forfarande for framstellning av pyrrolidinonforeningar anvendbara for behandling av epilepsi |
| BE770938A BE770938A (fr) | 1970-08-05 | 1971-08-04 | Sulfamoylarylpyrrolidones, leur preparation et leurs applications |
| SU7101691585A SU567401A3 (ru) | 1970-08-05 | 1971-08-04 | Способ получени сульфамоилфенилпирролидинонов или их солей |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3784270A GB1361388A (en) | 1970-08-05 | 1970-08-05 | Ny--sulphamoylaryl--pyrrolidines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1361388A true GB1361388A (en) | 1974-07-24 |
Family
ID=10399388
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB3784270A Expired GB1361388A (en) | 1970-08-05 | 1970-08-05 | Ny--sulphamoylaryl--pyrrolidines |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US3813387A (enExample) |
| JP (1) | JPS5118948B1 (enExample) |
| AR (1) | AR202884A1 (enExample) |
| AT (1) | AT305997B (enExample) |
| AU (1) | AU442903B2 (enExample) |
| BE (1) | BE770938A (enExample) |
| CA (1) | CA996565A (enExample) |
| CH (1) | CH571489A5 (enExample) |
| DE (1) | DE2139072C3 (enExample) |
| DK (1) | DK135503B (enExample) |
| ES (1) | ES393883A1 (enExample) |
| FI (1) | FI54104C (enExample) |
| FR (1) | FR2101241B1 (enExample) |
| GB (1) | GB1361388A (enExample) |
| HU (1) | HU162250B (enExample) |
| NL (1) | NL7110775A (enExample) |
| NO (1) | NO137153C (enExample) |
| PL (1) | PL88911B1 (enExample) |
| SE (1) | SE390730B (enExample) |
| SU (1) | SU567401A3 (enExample) |
| ZA (1) | ZA715205B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4138495A (en) * | 1978-05-19 | 1979-02-06 | Stauffer Chemical Company | N-Substituted pyrrolidones and their use as miticides |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH618682A5 (enExample) * | 1975-11-07 | 1980-08-15 | Ciba Geigy Ag | |
| AT360980B (de) * | 1976-01-14 | 1981-02-10 | Pliva Pharm & Chem Works | Verfahren zur herstellung von n-alkylamiden des 2-oxo-1-pyrrolidins |
| DE2737195A1 (de) * | 1977-08-18 | 1979-03-01 | Hoechst Ag | Benzolsulfonamidderivate und verfahren zu ihrer herstellung |
| US4194982A (en) * | 1978-07-03 | 1980-03-25 | Texaco Inc. | N-sulfonylated polyalkenylsuccinimide and lubricant composition |
| CH626877A5 (enExample) * | 1978-08-22 | 1981-12-15 | Aerni Leuch Ag | |
| JP2833817B2 (ja) * | 1989-03-15 | 1998-12-09 | 三井化学株式会社 | ４―エチル―３―（置換フェニル）―１―（３―トリフルオロメチルフェニル）―２―ピロリジノン誘導体、その製造法およびこれらを有効成分とする除草剤 |
| US6620823B2 (en) * | 2000-07-11 | 2003-09-16 | Bristol-Myers Squibb Pharme Company | Lactam metalloprotease inhibitors |
-
1970
- 1970-08-05 GB GB3784270A patent/GB1361388A/en not_active Expired
-
1971
- 1971-08-04 NL NL7110775A patent/NL7110775A/xx not_active Application Discontinuation
- 1971-08-04 CA CA119,749A patent/CA996565A/en not_active Expired
- 1971-08-04 AU AU31984/71A patent/AU442903B2/en not_active Expired
- 1971-08-04 HU HUGE894A patent/HU162250B/hu unknown
- 1971-08-04 BE BE770938A patent/BE770938A/xx unknown
- 1971-08-04 ZA ZA715205A patent/ZA715205B/xx unknown
- 1971-08-04 CH CH1148171A patent/CH571489A5/xx not_active IP Right Cessation
- 1971-08-04 AR AR237175A patent/AR202884A1/es active
- 1971-08-04 ES ES393883A patent/ES393883A1/es not_active Expired
- 1971-08-04 DK DK380171AA patent/DK135503B/da unknown
- 1971-08-04 US US00169062A patent/US3813387A/en not_active Expired - Lifetime
- 1971-08-04 FI FI2190/71A patent/FI54104C/fi active
- 1971-08-04 AT AT682971A patent/AT305997B/de not_active IP Right Cessation
- 1971-08-04 SU SU7101691585A patent/SU567401A3/ru active
- 1971-08-04 DE DE2139072A patent/DE2139072C3/de not_active Expired
- 1971-08-04 NO NO2923/71A patent/NO137153C/no unknown
- 1971-08-04 JP JP46058396A patent/JPS5118948B1/ja active Pending
- 1971-08-04 FR FR7128543A patent/FR2101241B1/fr not_active Expired
- 1971-08-04 SE SE7110004A patent/SE390730B/xx unknown
- 1971-08-04 PL PL1971149829A patent/PL88911B1/pl unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4138495A (en) * | 1978-05-19 | 1979-02-06 | Stauffer Chemical Company | N-Substituted pyrrolidones and their use as miticides |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2139072C3 (de) | 1980-10-09 |
| NO137153B (no) | 1977-10-03 |
| DE2139072A1 (de) | 1972-02-10 |
| PL88911B1 (enExample) | 1976-10-30 |
| CA996565A (en) | 1976-09-07 |
| AR202884A1 (es) | 1975-07-31 |
| AT305997B (de) | 1973-03-26 |
| US3813387A (en) | 1974-05-28 |
| SE390730B (sv) | 1977-01-17 |
| ZA715205B (en) | 1972-08-30 |
| HU162250B (enExample) | 1973-01-29 |
| AU442903B2 (en) | 1973-12-06 |
| DK135503B (da) | 1977-05-09 |
| FI54104C (fi) | 1978-10-10 |
| DK135503C (enExample) | 1977-10-24 |
| NL7110775A (enExample) | 1972-02-08 |
| FR2101241B1 (enExample) | 1975-02-07 |
| FR2101241A1 (enExample) | 1972-03-31 |
| ES393883A1 (es) | 1973-11-01 |
| BE770938A (fr) | 1972-02-04 |
| NO137153C (no) | 1978-01-11 |
| DE2139072B2 (de) | 1980-02-14 |
| CH571489A5 (enExample) | 1976-01-15 |
| AU3198471A (en) | 1973-05-03 |
| SU567401A3 (ru) | 1977-07-30 |
| JPS5118948B1 (enExample) | 1976-06-14 |
| FI54104B (fi) | 1978-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1289089A (enExample) | ||
| GB1455728A (en) | 5-6-benzene ring substituted benzimidazole-2-carbamate deriva tives having anthelmintic activity | |
| GB1369259A (en) | Acylxylidide local anaesthetics | |
| GB1361388A (en) | Ny--sulphamoylaryl--pyrrolidines | |
| GB1380129A (en) | Benzofuran derivatives and preparation thereof | |
| GB1129116A (en) | Lactam derivatives | |
| GB1298313A (en) | Quinazoline derivatives | |
| CH612431A5 (en) | Process for the preparation of novel indole derivatives | |
| GB1325527A (en) | Aminophenylamidine derivatives their production and their pharmaceutical use | |
| ES443845A1 (es) | Un procedimiento para la preparacion de n-(1-sustituido-3- pirrolidinil)-1-naftalen y 4-quinoleincarboxamidas. | |
| IE36383L (en) | Aryl guanidines | |
| GB1417029A (en) | Quinazoline-derived amines | |
| ATE28453T1 (de) | Verbindungen mit diazotiertem heterocyclischem kern, verfahren zu deren herstellung und diese enthaltende, auf das zentrale nervensystem wirkende arzneimittel. | |
| GB1304392A (enExample) | ||
| GB1362918A (en) | Thioesters of guanidinoorganic acids and production thereof | |
| GB1420067A (en) | Aryldiamides | |
| GB1346911A (en) | Benzofuran derivatives and a process for the manufacture thereof | |
| GB1161062A (en) | Active Sulphonamides | |
| GB1319772A (en) | Succinimides | |
| GB1305725A (enExample) | ||
| GB1514225A (en) | Paracetamol derivatives | |
| GB989557A (en) | Hydroxylamine derivative and processes for making it | |
| GB1383465A (en) | Glucosamide of 1- p-chlorobenzoyl indolyl-3-acetic acid and processes for its preparation | |
| ES407722A1 (es) | Procedimiento para la preparacion de derivados de la 3h-1,-5-benzodiacepina. | |
| ES368607A1 (es) | Un procedimiento para la produccion de compuestos seleccio-nados del grupo de los 1-sustituido-2,5-difenilpirroles. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |