GB1260882A - New penicillins - Google Patents
New penicillinsInfo
- Publication number
- GB1260882A GB1260882A GB28715/69A GB2871569A GB1260882A GB 1260882 A GB1260882 A GB 1260882A GB 28715/69 A GB28715/69 A GB 28715/69A GB 2871569 A GB2871569 A GB 2871569A GB 1260882 A GB1260882 A GB 1260882A
- Authority
- GB
- United Kingdom
- Prior art keywords
- substituted
- formula
- cycloaliphatic
- radical
- heterocyclic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229930182555 Penicillin Natural products 0.000 title abstract 4
- 150000002960 penicillins Chemical class 0.000 title abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 125000005842 heteroatom Chemical group 0.000 abstract 2
- 231100000252 nontoxic Toxicity 0.000 abstract 2
- 230000003000 nontoxic effect Effects 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- -1 sulphonyl-ureido penicillins Chemical class 0.000 abstract 2
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 abstract 1
- 241000894006 Bacteria Species 0.000 abstract 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 230000003115 biocidal effect Effects 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 239000003085 diluting agent Substances 0.000 abstract 1
- 239000002552 dosage form Substances 0.000 abstract 1
- 239000003937 drug carrier Substances 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 125000000623 heterocyclic group Chemical group 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract 1
- 239000012948 isocyanate Substances 0.000 abstract 1
- 229940049954 penicillin Drugs 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 239000008024 pharmaceutical diluent Substances 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 abstract 1
- 125000003107 substituted aryl group Chemical group 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681770620 DE1770620A1 (de) | 1968-06-12 | 1968-06-12 | Neue Penicilline |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1260882A true GB1260882A (en) | 1972-01-19 |
Family
ID=5700576
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB28715/69A Expired GB1260882A (en) | 1968-06-12 | 1969-06-06 | New penicillins |
Country Status (12)
| Country | Link |
|---|---|
| AT (1) | AT287199B (enExample) |
| BE (1) | BE734455A (enExample) |
| BR (1) | BR6909698D0 (enExample) |
| CH (1) | CH525238A (enExample) |
| CS (1) | CS163737B2 (enExample) |
| DE (1) | DE1770620A1 (enExample) |
| ES (1) | ES368248A1 (enExample) |
| FR (1) | FR2010786A1 (enExample) |
| GB (1) | GB1260882A (enExample) |
| IE (1) | IE33535B1 (enExample) |
| IL (1) | IL32288A (enExample) |
| NL (1) | NL6908909A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4035502A (en) * | 1974-12-05 | 1977-07-12 | Hoechst Aktiengesellschaft | Acylaminopenicillanic acids and process for preparing them |
| FR2426691A1 (fr) * | 1978-05-26 | 1979-12-21 | Chugai Pharmaceutical Co Ltd | Derives de l'acide penicillanique, leur preparation et leur application en therapeutique |
| US4355038A (en) | 1980-08-05 | 1982-10-19 | Chugai Seiyaku Kabushiki Kaisha | α-Substituted ureido-benzylpenicillanic acids |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3959258A (en) * | 1970-05-25 | 1976-05-25 | Bayer Aktiengesellschaft | Ureidoacetamido-penicillins |
| US3933795A (en) * | 1970-05-25 | 1976-01-20 | Hans-Bodo Konig | Ureidoacetamido-penicillins |
| DE2104579C3 (de) * | 1971-02-01 | 1981-07-09 | Bayer Ag, 5090 Leverkusen | Cyclische Acylureidopenicilline und sie enthaltende Arzneimittel |
| DE2104580C3 (de) * | 1971-02-01 | 1981-04-02 | Bayer Ag, 5090 Leverkusen | Acylureidopenicilline |
| US3980792A (en) * | 1970-05-25 | 1976-09-14 | Bayer Aktiengesellschaft | Ureidoacetamido-penicillins |
| US4016282A (en) * | 1970-05-25 | 1977-04-05 | Bayer Aktiengesellschaft | Ureidoacetamido-penicillins |
| US3939149A (en) * | 1970-05-25 | 1976-02-17 | Bayer Aktiengesellschaft | Ureidoacetamido-penicillins |
| BE790440A (enExample) * | 1971-10-23 | 1973-04-24 | Bayer Ag | |
| DE2320039C3 (de) * | 1973-04-19 | 1981-04-23 | Bayer Ag, 5090 Leverkusen | Penicilline und ihre Verwendung als Arzneimittel |
| IL47168A (en) * | 1974-05-09 | 1979-07-25 | Toyama Chemical Co Ltd | Mono or dioxo piperazino(thio)carbonylamino derivatives ofpenicillins and cephalosporins and process for producing the same |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1061335A (en) * | 1965-02-16 | 1967-03-08 | Beecham Group Ltd | Penicillins |
-
1968
- 1968-06-12 DE DE19681770620 patent/DE1770620A1/de active Pending
-
1969
- 1969-05-22 CH CH784069A patent/CH525238A/de not_active IP Right Cessation
- 1969-05-26 IL IL32288A patent/IL32288A/xx unknown
- 1969-05-29 AT AT509669A patent/AT287199B/de not_active IP Right Cessation
- 1969-06-06 GB GB28715/69A patent/GB1260882A/en not_active Expired
- 1969-06-10 IE IE792/69A patent/IE33535B1/xx unknown
- 1969-06-11 ES ES368248A patent/ES368248A1/es not_active Expired
- 1969-06-11 NL NL6908909A patent/NL6908909A/xx unknown
- 1969-06-12 CS CS4168*BA patent/CS163737B2/cs unknown
- 1969-06-12 FR FR6919578A patent/FR2010786A1/fr not_active Withdrawn
- 1969-06-12 BR BR209698/69A patent/BR6909698D0/pt unknown
- 1969-06-12 BE BE734455D patent/BE734455A/xx unknown
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4035502A (en) * | 1974-12-05 | 1977-07-12 | Hoechst Aktiengesellschaft | Acylaminopenicillanic acids and process for preparing them |
| FR2426691A1 (fr) * | 1978-05-26 | 1979-12-21 | Chugai Pharmaceutical Co Ltd | Derives de l'acide penicillanique, leur preparation et leur application en therapeutique |
| US4229348A (en) * | 1978-05-26 | 1980-10-21 | Chugai Seiyaku Kabushiki Kaisha | Penicillanic acid derivatives |
| US4355038A (en) | 1980-08-05 | 1982-10-19 | Chugai Seiyaku Kabushiki Kaisha | α-Substituted ureido-benzylpenicillanic acids |
Also Published As
| Publication number | Publication date |
|---|---|
| IL32288A (en) | 1973-08-29 |
| IL32288A0 (en) | 1969-07-30 |
| BR6909698D0 (pt) | 1973-02-08 |
| IE33535B1 (en) | 1974-08-07 |
| DE1770620A1 (de) | 1971-11-11 |
| AT287199B (de) | 1971-01-11 |
| ES368248A1 (es) | 1971-05-01 |
| BE734455A (enExample) | 1969-12-12 |
| CH525238A (de) | 1972-07-15 |
| IE33535L (en) | 1969-12-12 |
| CS163737B2 (enExample) | 1975-11-07 |
| NL6908909A (enExample) | 1969-12-16 |
| FR2010786A1 (enExample) | 1970-02-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES8104233A1 (es) | Procedimiento para preparar derivados de acidos quinolina- carboxilicos | |
| GB1491018A (en) | Cephalosporin derivatives | |
| GB1260882A (en) | New penicillins | |
| US3833568A (en) | Heterocyclic ureidocephalosporins | |
| US3741962A (en) | Alpha-thioureidocephalosporanic acid compounds | |
| JPS5543011A (en) | 7-halothiazolylalkoxyiminoacetamido-3-cephem compound | |
| GB1348737A (en) | Cephalosporin derivatives | |
| GB1289358A (enExample) | ||
| GB1429539A (en) | Derivatives of penam-3-carboxylic acid and cephem-4-carboxylic acid and processes for their manufacture | |
| US3862941A (en) | 2-(Thiocarbonylamino)acetamidocephalosporanic acid compounds | |
| GB1382494A (en) | Acylaminocephalosporanic acids and process for their manufacture | |
| US3796709A (en) | (alpha-cyanamino)acetamidocephalosporins | |
| GB1358008A (en) | Cephalosporin derivatives | |
| US3539562A (en) | Alpha - amino - 2,4,6 - cycloheptatrienylmethylcephalosporins | |
| US3558601A (en) | Penicillins and their preparation | |
| GB1161908A (en) | Antibiotically Active Derivatives of Rifamycin S and Rifamycin SV and Process for their Manufacture | |
| GB1436977A (en) | 7-alkylthioacetamido cephaosporins | |
| GB894460A (en) | Improvements in or relating to penicillins | |
| GB1061335A (en) | Penicillins | |
| US3886140A (en) | Penicillin derivatives | |
| GB1285790A (en) | Acylaminopenicillanic acids and process for preparing them | |
| GB1246495A (en) | Penicillins and their production | |
| GB1178790A (en) | Basically Substituted Oximes, their production and their use as Pharmaceutical Agents | |
| US3268518A (en) | Amino-acylamino-acylamino-penicillanic acids | |
| GB1398564A (en) | 1-amino substituted-1-cycloalkane derivatives of 6-amino penicillanic acid |