GB1176093A - Improvements in or relating to Phenyl Arylacylpiperidinols - Google Patents
Improvements in or relating to Phenyl ArylacylpiperidinolsInfo
- Publication number
- GB1176093A GB1176093A GB00142/69A GB1014269A GB1176093A GB 1176093 A GB1176093 A GB 1176093A GB 00142/69 A GB00142/69 A GB 00142/69A GB 1014269 A GB1014269 A GB 1014269A GB 1176093 A GB1176093 A GB 1176093A
- Authority
- GB
- United Kingdom
- Prior art keywords
- phenyl
- hydrogen
- formula
- arylacylpiperidinols
- piperidinol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 title abstract 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 abstract 4
- -1 chloro, bromo, methyl Chemical group 0.000 abstract 3
- 229910052739 hydrogen Inorganic materials 0.000 abstract 3
- 239000001257 hydrogen Substances 0.000 abstract 3
- KQKFQBTWXOGINC-UHFFFAOYSA-N 4-phenylpiperidin-4-ol Chemical compound C=1C=CC=CC=1C1(O)CCNCC1 KQKFQBTWXOGINC-UHFFFAOYSA-N 0.000 abstract 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 abstract 2
- 125000004432 carbon atom Chemical group C* 0.000 abstract 2
- XXTZHYXQVWRADW-UHFFFAOYSA-N diazomethanone Chemical compound [N]N=C=O XXTZHYXQVWRADW-UHFFFAOYSA-N 0.000 abstract 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 abstract 2
- 125000001153 fluoro group Chemical group F* 0.000 abstract 2
- 150000002431 hydrogen Chemical class 0.000 abstract 2
- 229910001923 silver oxide Inorganic materials 0.000 abstract 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 abstract 1
- 238000006218 Arndt-Eistert homologation reaction Methods 0.000 abstract 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 239000005864 Sulphur Chemical group 0.000 abstract 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 abstract 1
- 239000012346 acetyl chloride Substances 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 125000001246 bromo group Chemical group Br* 0.000 abstract 1
- 125000001309 chloro group Chemical group Cl* 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 abstract 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 235000019260 propionic acid Nutrition 0.000 abstract 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 abstract 1
- 239000007858 starting material Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D333/60—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US62062867A | 1967-03-06 | 1967-03-06 | |
| US66970767A | 1967-09-22 | 1967-09-22 | |
| US86547469A | 1969-10-10 | 1969-10-10 | |
| US86547369A | 1969-10-10 | 1969-10-10 | |
| US86547569A | 1969-10-10 | 1969-10-10 | |
| US86547669A | 1969-10-10 | 1969-10-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1176093A true GB1176093A (en) | 1970-01-01 |
Family
ID=27560185
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB00141/69A Expired GB1176092A (en) | 1967-03-06 | 1968-02-15 | Improvements in or relating to Substituted Piperidinoalkylthianaphthenes and Benzofurans |
| GB7566/68A Expired GB1176091A (en) | 1967-03-06 | 1968-02-15 | Improvements in or relating to Substituted Piperidinoalkylthianaphthenes and Benzofurans |
| GB00142/69A Expired GB1176093A (en) | 1967-03-06 | 1968-02-15 | Improvements in or relating to Phenyl Arylacylpiperidinols |
Family Applications Before (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB00141/69A Expired GB1176092A (en) | 1967-03-06 | 1968-02-15 | Improvements in or relating to Substituted Piperidinoalkylthianaphthenes and Benzofurans |
| GB7566/68A Expired GB1176091A (en) | 1967-03-06 | 1968-02-15 | Improvements in or relating to Substituted Piperidinoalkylthianaphthenes and Benzofurans |
Country Status (7)
| Country | Link |
|---|---|
| US (5) | US3476760A (enExample) |
| BE (1) | BE711675A (enExample) |
| CH (1) | CH498142A (enExample) |
| DE (1) | DE1695836B2 (enExample) |
| FR (1) | FR7281M (enExample) |
| GB (3) | GB1176092A (enExample) |
| NL (1) | NL6803079A (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3476760A (en) * | 1967-03-06 | 1969-11-04 | Smithkline Corp | Substituted piperidinoalkylthianaphthenes and benzofurans |
| US3546236A (en) * | 1968-10-15 | 1970-12-08 | Smithkline Corp | 1 - (benzoheterocyclic cyclopropylmethyl) - 4 - phenyl - 1,2,5,6 - tetrahydropyridines |
| US3629267A (en) * | 1968-10-28 | 1971-12-21 | Smith Kline French Lab | Benzoheterocyclicalkyl derivatives of 4-(2-keto -1-benzimidazolinyl)-piperidine 4-(2-keto - 1 - benzimidazolinyl) -1 2 3 6 tetrahydropyridine 1 - phenyl - 1 3 8-triazaspiro(4 5)decan - 4 - one and 2 4 9-triazaspiro(5 5)undecan-1 3 5-trione |
| GB1382282A (en) * | 1972-06-01 | 1975-01-29 | Labaz | Benzo b thiophene compounds and processes for preparing the same |
| US4039676A (en) * | 1975-06-23 | 1977-08-02 | Ciba-Geigy Corporation | 2-piperidinoalkyl-1,4-benzodioxans |
| US4129655A (en) * | 1976-04-26 | 1978-12-12 | Ciba-Geigy Corporation | Neuroleptic 2-piperidinoalkyl-1,4-benzodioxans |
| US4066772A (en) * | 1975-07-21 | 1978-01-03 | Janssen Pharmaceutica N.V. | 1,3-Dihydro-1-[3-(1-piperidinyl)propyl]-2H-benzimidazol-2-ones and related compounds |
| EP0077607A1 (en) * | 1981-09-17 | 1983-04-27 | Beecham Group Plc | N-substituted 3-aryl piperidines and derivatives thereof |
| US5087638A (en) * | 1984-06-20 | 1992-02-11 | Merck Frosst Canada, Inc. | Benzofuran derivatives |
| CA1281325C (en) * | 1984-06-20 | 1991-03-12 | Patrice C. Belanger | Benzofuran derivatives |
| IE68675B1 (en) * | 1990-11-01 | 1996-07-10 | Takeda Chemical Industries Ltd | Aminocoumaran derivatives their production and use |
| US5643784A (en) * | 1990-12-04 | 1997-07-01 | H, Lundbeck A/S | Indan derivatives |
| NZ243065A (en) * | 1991-06-13 | 1995-07-26 | Lundbeck & Co As H | Piperidine derivatives and pharmaceutical compositions |
| DE4128690A1 (de) * | 1991-08-29 | 1993-03-04 | Boehringer Mannheim Gmbh | Bicyclische sulfone, verfahren zu ihrer herstellung und diese enthaltende arzneimittel |
| DK78692D0 (da) * | 1992-06-12 | 1992-06-12 | Lundbeck & Co As H | Dimere piperidin- og piperazinderivater |
| TW334433B (en) * | 1992-12-09 | 1998-06-21 | Takeda Pharm Industry Co Ltd | Crystalline salt of (S)-(+)-5-amino-2,4,6,7-tetramethyl-2-(4-phenylpiperidinomethyl)-2,3-dihydrobenzo(b)furan dihydrochloride their production and use |
| EP0846683B1 (en) * | 1996-12-03 | 2001-09-19 | F. Hoffmann-La Roche Ag | 4-Hydroxy-piperidine derivatives |
| CA2220649C (en) | 1996-12-03 | 2007-02-13 | F. Hoffmann-La Roche Ag | 4-hydroxy-piperidine derivatives |
| CA2666406A1 (en) * | 2006-10-16 | 2008-04-24 | Gruenenthal Gmbh | Substituted sulfonamide derivatives for use as bradykinin 1 receptor modulators |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3070606A (en) * | 1962-12-25 | Xchxn | ||
| CA632437A (en) * | 1961-12-12 | A. J. Janssen Paul | 1-aroylalkyl-4-arylpiperidin-4-ols and process | |
| US3476760A (en) * | 1967-03-06 | 1969-11-04 | Smithkline Corp | Substituted piperidinoalkylthianaphthenes and benzofurans |
-
1967
- 1967-09-22 US US669707A patent/US3476760A/en not_active Expired - Lifetime
-
1968
- 1968-02-15 GB GB00141/69A patent/GB1176092A/en not_active Expired
- 1968-02-15 GB GB7566/68A patent/GB1176091A/en not_active Expired
- 1968-02-15 GB GB00142/69A patent/GB1176093A/en not_active Expired
- 1968-02-27 DE DE1968S0114333 patent/DE1695836B2/de active Granted
- 1968-03-01 CH CH309868A patent/CH498142A/de not_active IP Right Cessation
- 1968-03-05 NL NL6803079A patent/NL6803079A/xx unknown
- 1968-03-05 BE BE711675D patent/BE711675A/xx unknown
- 1968-03-05 FR FR142351A patent/FR7281M/fr not_active Expired
-
1969
- 1969-10-10 US US865476A patent/US3558637A/en not_active Expired - Lifetime
- 1969-10-10 US US865474A patent/US3558636A/en not_active Expired - Lifetime
- 1969-10-10 US US865473A patent/US3547931A/en not_active Expired - Lifetime
- 1969-10-10 US US865475A patent/US3551568A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BE711675A (enExample) | 1968-09-05 |
| GB1176092A (en) | 1970-01-01 |
| DE1695836B2 (de) | 1977-03-31 |
| US3558637A (en) | 1971-01-26 |
| US3558636A (en) | 1971-01-26 |
| US3551568A (en) | 1970-12-29 |
| DE1695836A1 (de) | 1971-05-13 |
| GB1176091A (en) | 1970-01-01 |
| NL6803079A (enExample) | 1968-09-09 |
| FR7281M (enExample) | 1969-09-22 |
| US3547931A (en) | 1970-12-15 |
| CH498142A (de) | 1970-10-31 |
| US3476760A (en) | 1969-11-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1176093A (en) | Improvements in or relating to Phenyl Arylacylpiperidinols | |
| GB1159546A (en) | Liquid Phase process for Isobutane Oxidation | |
| GB1244576A (en) | PREPARATION OF beta-DIMETHYLAMINO ETHYL METHACRYLATE | |
| ES366943A1 (es) | Procedimiento para la preparacion de derivados de 1-etil-3,3-dimetil-ciclohexano. | |
| GB1398287A (en) | Production of alpha, beta-unsaturated aldehydes | |
| GB1141496A (en) | Photosensitive insulation based on p-xylylene polymers | |
| GB1492717A (en) | Process for preparing a methyl-isoxazolyl compound | |
| ATE16188T1 (de) | Herstellung von bis-carbo xyethylgermaniumsesquioxyd und seiner propionsaeurederivate. | |
| GB1132230A (en) | Photosensitive insulation based on unsaturated -Ð-xylylene polymers | |
| GB1502275A (en) | Naphthoquinone derivatives | |
| GB1196598A (en) | Preparation of a Ketosebacic Acid | |
| GB911522A (en) | Preparation of aluminium trialkoxide compounds | |
| GB1433565A (en) | Process for the preparation of anthraquinone | |
| SE7509138L (sv) | Difenylbutylpiperidiner. | |
| GB1155589A (en) | Improved process for the production of Terephthalic Acid | |
| GB1496231A (en) | Chemical products | |
| GB1456101A (en) | Process for dehydrating aqueous solutions of maleic acid to maleic anhydride | |
| GB1196595A (en) | Preparation of a Lactone | |
| GB1131728A (en) | N,n-dimethylcinnamamides | |
| SU676561A1 (ru) | Способ получени растворов хлорного железа | |
| GB1165442A (en) | Process for the Production of Acetic Acid by Catalytic Gas Phase Oxidation of Butenes | |
| GB1294371A (en) | PRODUCTION OF alpha-HYDROXYCARBOXYLIC ESTERS | |
| GB1387497A (en) | Process for the production of anthraquinone | |
| GB1228303A (enExample) | ||
| GB1084468A (en) | Improvements in or relating to steroids and the manufacture thereof |