FR2449715A1 - - Google Patents
Info
- Publication number
- FR2449715A1 FR2449715A1 FR8003720A FR8003720A FR2449715A1 FR 2449715 A1 FR2449715 A1 FR 2449715A1 FR 8003720 A FR8003720 A FR 8003720A FR 8003720 A FR8003720 A FR 8003720A FR 2449715 A1 FR2449715 A1 FR 2449715A1
- Authority
- FR
- France
- Prior art keywords
- solvents
- composition
- pentaerythritol
- tetyldiphende
- ethylglycols
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000203 mixture Substances 0.000 abstract 3
- 150000002148 esters Chemical class 0.000 abstract 2
- 239000002904 solvent Substances 0.000 abstract 2
- 239000000758 substrate Substances 0.000 abstract 2
- MYWOJODOMFBVCB-UHFFFAOYSA-N 1,2,6-trimethylphenanthrene Chemical compound CC1=CC=C2C3=CC(C)=CC=C3C=CC2=C1C MYWOJODOMFBVCB-UHFFFAOYSA-N 0.000 abstract 1
- 239000004342 Benzoyl peroxide Substances 0.000 abstract 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 abstract 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 abstract 1
- 150000001298 alcohols Chemical class 0.000 abstract 1
- 235000019400 benzoyl peroxide Nutrition 0.000 abstract 1
- 229910052799 carbon Inorganic materials 0.000 abstract 1
- 229920006217 cellulose acetate butyrate Polymers 0.000 abstract 1
- 239000008199 coating composition Substances 0.000 abstract 1
- 150000002576 ketones Chemical class 0.000 abstract 1
- 239000003960 organic solvent Substances 0.000 abstract 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 abstract 1
- 229920000058 polyacrylate Polymers 0.000 abstract 1
- 229920000193 polymethacrylate Polymers 0.000 abstract 1
- 238000006748 scratching Methods 0.000 abstract 1
- 230000002393 scratching effect Effects 0.000 abstract 1
- 238000005507 spraying Methods 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F251/00—Macromolecular compounds obtained by polymerising monomers on to polysaccharides or derivatives thereof
- C08F251/02—Macromolecular compounds obtained by polymerising monomers on to polysaccharides or derivatives thereof on to cellulose or derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Paints Or Removers (AREA)
- Polymerisation Methods In General (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Lubricants (AREA)
- Sliding-Contact Bearings (AREA)
- Application Of Or Painting With Fluid Materials (AREA)
- Manufacture Of Macromolecular Shaped Articles (AREA)
- Coating Of Shaped Articles Made Of Macromolecular Substances (AREA)
- Laminated Bodies (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US1341879A | 1979-02-21 | 1979-02-21 | |
| US06/104,351 US4308119A (en) | 1979-02-21 | 1980-01-07 | Abrasion-resistant optical coating composition containing pentaerythritol based polyacrylates and cellulose esters |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FR2449715A1 true FR2449715A1 (enExample) | 1980-09-19 |
| FR2449715B1 FR2449715B1 (enExample) | 1984-10-05 |
Family
ID=26684814
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR8003720A Expired FR2449715B1 (enExample) | 1979-02-21 | 1980-02-20 |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4308119A (enExample) |
| JP (2) | JPH021162B2 (enExample) |
| CA (1) | CA1153491A (enExample) |
| FR (1) | FR2449715B1 (enExample) |
| GB (1) | GB2056886B (enExample) |
| WO (1) | WO1980001805A1 (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4308119A (en) * | 1979-02-21 | 1981-12-29 | Panelgraphic Corporation | Abrasion-resistant optical coating composition containing pentaerythritol based polyacrylates and cellulose esters |
| US4373007A (en) * | 1980-11-03 | 1983-02-08 | Panelgraphic Corporation | [Non-photoinitialio] non-photocatalyzed dipentaerythritol polyacrylate based coating compositions exhibiting high abrasion resistance |
| US4758448A (en) * | 1982-09-07 | 1988-07-19 | Signet Armorlite, Inc. | Coated ophthalmic lenses and method for coating the same |
| DE3443088A1 (de) * | 1984-03-03 | 1985-09-19 | Wolff Walsrode Ag, 3030 Walsrode | Waessrige dispersionen auf basis von cellulosenitraten, verfahren zu ihrer herstellung und ihre verwendung als schnellhaertende ueberzuege |
| US4557980A (en) * | 1984-08-21 | 1985-12-10 | Martin Processing, Inc. | Radiation curable coating for film structure |
| US4958148A (en) * | 1985-03-22 | 1990-09-18 | Elmwood Sensors, Inc. | Contrast enhancing transparent touch panel device |
| US4656202A (en) * | 1985-08-28 | 1987-04-07 | Reliance Universal, Inc. | Acrylated cellulosic furniture coatings |
| US4774035A (en) * | 1986-01-14 | 1988-09-27 | Camelot Industries Corporation | Process of coating an ophthalmic lens |
| US4855184A (en) * | 1988-02-02 | 1989-08-08 | Minnesota Mining And Manufacturing Company | Radiation-curable protective coating composition |
| US5254395A (en) * | 1988-08-23 | 1993-10-19 | Thor Radiation Research, Inc. | Protective coating system for imparting resistance to abrasion, impact and solvents |
| US5114783A (en) * | 1988-08-23 | 1992-05-19 | Thor Radiation Research, Inc. | Protective coating system for imparting resistance to abrasion, impact and solvents |
| US5104692A (en) * | 1990-04-20 | 1992-04-14 | Pilkington Visioncare Holdings, Inc. | Two-layer antireflective coating applied in solution |
| US5906788A (en) * | 1992-10-05 | 1999-05-25 | Cook Composites And Polymers Co. | Dual cure, in-mold process for manufacturing abrasion resistant, coated thermoplastic articles |
| US6235396B1 (en) | 1998-06-26 | 2001-05-22 | Younger Mfg | Optical lens comprising a polyvinylalcohol layer covalently bonded to a bulk lens polymer |
| US6410147B1 (en) | 2000-08-24 | 2002-06-25 | E. I. Du Pont De Nemours And Company | Low gloss crosslinkable coating compositions |
| US7375144B2 (en) * | 2005-06-16 | 2008-05-20 | Eastman Chemical Company | Abrasion resistant coatings |
| EP1884958B1 (en) | 2006-07-31 | 2012-11-21 | Agfa HealthCare NV | Polymer compositions and use thereof as topcoat layers for phosphor or scintillator screens or panels. |
| DE102008055194A1 (de) * | 2008-12-30 | 2010-07-08 | Federal-Mogul Wiesbaden Gmbh | Gleitelement |
| JP2020196806A (ja) * | 2019-06-03 | 2020-12-10 | ナトコ株式会社 | 膜形成用樹脂組成物、樹脂膜および樹脂膜を備える物品 |
| US12247133B2 (en) * | 2022-02-17 | 2025-03-11 | Canon Kabushiki Kaisha | Photocurable composition including a reactive polymer |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1318974A (fr) * | 1961-03-29 | 1963-02-22 | Du Pont | Production de compositions photopolymérisables comprenant un ester cellulosique mixte comme liant |
| US3203802A (en) * | 1962-04-09 | 1965-08-31 | Du Pont | Photopolymerizable composition and element |
| US4012302A (en) * | 1976-02-17 | 1977-03-15 | Eastman Kodak Company | Photocurable compositions containing s-aryl arylcarbothioic acid esters as photoinitiators |
Family Cites Families (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1552795A (en) * | 1924-06-16 | 1925-09-08 | Eastman Kodak Co | Cellulose-ester composition |
| US2288352A (en) * | 1938-12-24 | 1942-06-30 | Paper Patents Co | Transfer machine |
| US2505067A (en) * | 1947-09-29 | 1950-04-25 | Alexander H Kerr & Co | Catalytic photopolymerization process and compositions |
| US3047422A (en) * | 1956-01-09 | 1962-07-31 | Miehle Goss Dexter Inc | Coating material and method of drying same |
| NL218803A (enExample) * | 1956-07-09 | |||
| GB841454A (en) * | 1957-09-16 | 1960-07-13 | Du Pont | Improvements in or relating to photopolymerisable elements |
| US3046127A (en) * | 1957-10-07 | 1962-07-24 | Du Pont | Photopolymerizable compositions, elements and processes |
| US3076723A (en) * | 1958-05-26 | 1963-02-05 | Du Pont | Coating weight determination by means of ultraviolet light |
| US3149975A (en) * | 1962-07-06 | 1964-09-22 | Du Pont | Photopolymerizable compositions and elements |
| GB1054125A (enExample) * | 1963-04-22 | |||
| US3380831A (en) * | 1964-05-26 | 1968-04-30 | Du Pont | Photopolymerizable compositions and elements |
| NL129237C (enExample) * | 1965-03-11 | |||
| US3551235A (en) * | 1967-07-10 | 1970-12-29 | Sun Chemical Corp | Radiation-curable compositions |
| US3551311A (en) * | 1967-11-24 | 1970-12-29 | Sun Chemical Corp | Radiation-curable compositions |
| US3551236A (en) * | 1968-07-10 | 1970-12-29 | Theodore H Fairbanks | Method and apparatus for the manufacture of net-like materials |
| US3567494A (en) * | 1968-08-29 | 1971-03-02 | Continental Can Co | Process for preparing polymerized surface coatings using ultra-violet radiation |
| CH528957A (de) * | 1969-06-04 | 1972-10-15 | Lonza Ag | Verfahren zur Herstellung von cellulosehaltigem Material mit verbesserter Abriebfestigkeit |
| US3661614A (en) * | 1969-12-11 | 1972-05-09 | Sun Chemical Corp | Radiation-curable ink compositions |
| US4045416A (en) * | 1971-01-21 | 1977-08-30 | Union Carbide Corporation | Amine acrylate addition reaction product compositions |
| DE2232365C2 (de) * | 1972-07-01 | 1982-06-09 | Basf Ag, 6700 Ludwigshafen | Durch UV-Bestrahlung polymerisierbare Gemische |
| US3874906A (en) * | 1972-09-22 | 1975-04-01 | Ppg Industries Inc | Process for applying polyester-acrylate containing ionizing irradiation curable coatings |
| US3826014A (en) * | 1973-03-19 | 1974-07-30 | Sun Chemical Corp | Shutter mechanism for radiation-curing lamp |
| US3914594A (en) * | 1973-03-19 | 1975-10-21 | Sun Chemical Corp | Radiation lamp reflector assembly |
| JPS5419895B2 (enExample) * | 1973-07-27 | 1979-07-18 | ||
| US3903322A (en) * | 1974-03-07 | 1975-09-02 | Continental Can Co | Photopolymerizable ethylenically unsaturated compounds photoinitiated with benzoyl derivatives of diphenyl sulfide and an organic amine compound |
| GB1481131A (en) * | 1974-03-22 | 1977-07-27 | Nat Starch Chem Corp | Actinic radiation curable materials |
| US4005244A (en) * | 1974-09-30 | 1977-01-25 | Ppg Industries, Inc. | Ultraviolet light curable opacifying compositions |
| US4084021A (en) * | 1974-10-08 | 1978-04-11 | Minnesota Mining And Manufacturing Company | Method for rendering substrates resistant to abrasion |
| US4042749A (en) * | 1974-10-08 | 1977-08-16 | Minnesota Mining And Manufacturing Company | Article having abrasion resistant surface formed from the reaction product of a silane and a metal ester |
| US4016334A (en) * | 1975-02-18 | 1977-04-05 | Celanese Corporation | Method of applying high adhesion ultraviolet curable coatings and coated articles |
| US3992276A (en) * | 1975-03-17 | 1976-11-16 | Celanese Corporation | Unsaturated polyesters for ultraviolet curable coatings |
| US4037112A (en) * | 1975-03-25 | 1977-07-19 | Ppg Industries, Inc. | Apparatus for crosslinking ultraviolet light curable coatings |
| US4086373A (en) * | 1975-04-02 | 1978-04-25 | Owens-Illinois, Inc. | Protective polymeric coating for glass substrate |
| US4113893A (en) * | 1975-07-01 | 1978-09-12 | Ppg Industries, Inc. | Radiation cure of coating compositions containing diacrylate monomer and hiding pigment |
| US3988228A (en) * | 1975-08-29 | 1976-10-26 | Eastman Kodak Company | Photopolymerizable polymeric compositions containing halogen containing aromatic ketones |
| GB1553580A (en) * | 1975-11-21 | 1979-09-26 | Espe Pharm Praep | Photopolymerisable acrylic or methacrylic acid ester-containing compositions |
| US4091050A (en) * | 1976-01-27 | 1978-05-23 | Ppg Industries, Inc. | Method for the preparation of mixtures of (meth)acrylic terminated polyether resin and 3-halo-2-hydroxypropyl (meth)acrylate |
| US4024297A (en) * | 1976-02-02 | 1977-05-17 | Ppg Industries, Inc. | Actinic light polymerizable coating compositions |
| US4065368A (en) * | 1976-02-23 | 1977-12-27 | Bell Telephone Laboratories, Incorporated | Printed circuit cover coating comprising an ultraviolet radiation sensitive acrylic resin |
| JPS591401B2 (ja) * | 1976-04-26 | 1984-01-12 | 東洋インキ製造株式会社 | 紫外線硬化性組成物 |
| US4099837A (en) * | 1976-05-26 | 1978-07-11 | Bell Telephone Laboratories, Incorporated | Coating of fiber lightguides with UV cured polymerization products |
| US4147603A (en) * | 1976-07-27 | 1979-04-03 | Eastman Kodak Company | Radiation curable cellulose compositions |
| US4066582A (en) * | 1976-09-27 | 1978-01-03 | Union Carbide Corporation | Improved acrylate based radiation curable coating compositions containing nitrocellulose |
| US4134809A (en) * | 1977-08-22 | 1979-01-16 | Eastman Kodak Company | Radiation curable cellulose ester-acrylate compositions |
| US4194955A (en) * | 1978-11-13 | 1980-03-25 | Celanese Corporation | Ultraviolet curable self-pigmented coating composition |
| US4308119A (en) * | 1979-02-21 | 1981-12-29 | Panelgraphic Corporation | Abrasion-resistant optical coating composition containing pentaerythritol based polyacrylates and cellulose esters |
-
1980
- 1980-01-07 US US06/104,351 patent/US4308119A/en not_active Expired - Lifetime
- 1980-02-12 CA CA000345431A patent/CA1153491A/en not_active Expired
- 1980-02-20 FR FR8003720A patent/FR2449715B1/fr not_active Expired
- 1980-02-20 JP JP55500574A patent/JPH021162B2/ja not_active Expired
- 1980-02-20 WO PCT/US1980/000162 patent/WO1980001805A1/en not_active Ceased
- 1980-02-20 GB GB8033385A patent/GB2056886B/en not_active Expired
-
1988
- 1988-04-13 JP JP63091208A patent/JPS6426647A/ja active Granted
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1318974A (fr) * | 1961-03-29 | 1963-02-22 | Du Pont | Production de compositions photopolymérisables comprenant un ester cellulosique mixte comme liant |
| US3203802A (en) * | 1962-04-09 | 1965-08-31 | Du Pont | Photopolymerizable composition and element |
| US4012302A (en) * | 1976-02-17 | 1977-03-15 | Eastman Kodak Company | Photocurable compositions containing s-aryl arylcarbothioic acid esters as photoinitiators |
Also Published As
| Publication number | Publication date |
|---|---|
| GB2056886B (en) | 1983-08-24 |
| FR2449715B1 (enExample) | 1984-10-05 |
| JPH021162B2 (enExample) | 1990-01-10 |
| GB2056886A (en) | 1981-03-25 |
| JPS56500258A (enExample) | 1981-03-05 |
| CA1153491A (en) | 1983-09-06 |
| JPS6426647A (en) | 1989-01-27 |
| US4308119A (en) | 1981-12-29 |
| WO1980001805A1 (en) | 1980-09-04 |
| JPH0341495B2 (enExample) | 1991-06-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FR2449715A1 (enExample) | ||
| BR8806391A (pt) | Composto homo-ou copolimerico,composicao,processo de formacao de um revestimento sobre uma superficie e artigo revestido | |
| ATE20599T1 (de) | Fluessige zusammensetzungen zum aufbringen transparenter ueberzuege auf feste oberflaechen, anwendung des ueberzugsmittels und hergestellte ueberzuege. | |
| FR2383216A1 (fr) | Procede pour revetir un substrat avec une composition de revetement durcissable par irradiation | |
| ATE91702T1 (de) | Vorlaeuferbeschichtungszusammensetzungen. | |
| NO861223L (no) | Flytende beleggblanding og fremgangsmaate ved belegning av et substrat med denne. | |
| ATE30922T1 (de) | Verfahren zum ueberziehen von substraten. | |
| ES8708001A1 (es) | Un procedimiento para revestir un sustrato con una composicion de revestimiento a base de una resina olquidica modificada con uretano. | |
| DE3376330D1 (en) | Process for coating wood or wood fibres-containing substrates, and an oxidatively drying coating composition to be used therewith | |
| ATE19785T1 (de) | Verfahren zur herstellung von ueberzuegen. | |
| DE3883413D1 (de) | Behandlung eines Metalls. | |
| ATE74943T1 (de) | Fremdvernetzende bindemittelkombination, diese enthaltende waessriges ueberzugsmittel und dessen verwendung. | |
| ES277603A1 (es) | Un procedimiento para la producción de una composición resinosa de recubrimiento superficial | |
| DE59203497D1 (de) | Flüssige, strahlenhärtbare überzugsmasse für die beschichtung von glasoberflächen. | |
| BR9508337A (pt) | Soluções de resina de resina de poliacrilato com indicce de cor aperfeiçoado assim como sua aplicação em agentes de revestimento | |
| ATE61423T1 (de) | Korrosionsinhibierung. | |
| US4389433A (en) | Sulfur dioxide cured coatings | |
| FR2400059A1 (fr) | Compositions de revetements et de liaison | |
| DE69509284D1 (de) | Härtbare Zusammensetzungen mit verbesserter Haftung und ihre Verwendung zum Beschichten von Substraten | |
| NO912768D0 (no) | Bindemiddel for uv-herdende belegningsstoffer, fremgangsmaate ved dets fremstilling samt dets anvendelse i belegningsstoffer for poroese og/eller sugende underlag. | |
| MX9300175A (es) | Composicion de revestimiento de bajo curado. | |
| SE7904698L (sv) | Vermeaterhemtbart foremal | |
| KR930008087A (ko) | 보호 피복 조성물 및 이를 사용하는 방법 | |
| US2630409A (en) | Paint and varnish remover | |
| JPS5787476A (en) | Stripping composition |