FI79292C - Foerfarande foer framstaellning av ringhydroxileringsprodukter av fenoler eller fenoletrar. - Google Patents
Foerfarande foer framstaellning av ringhydroxileringsprodukter av fenoler eller fenoletrar. Download PDFInfo
- Publication number
- FI79292C FI79292C FI840692A FI840692A FI79292C FI 79292 C FI79292 C FI 79292C FI 840692 A FI840692 A FI 840692A FI 840692 A FI840692 A FI 840692A FI 79292 C FI79292 C FI 79292C
- Authority
- FI
- Finland
- Prior art keywords
- hydrogen peroxide
- catalyst
- phenol
- ortho
- phenols
- Prior art date
Links
- 238000005805 hydroxylation reaction Methods 0.000 title claims abstract description 12
- 230000033444 hydroxylation Effects 0.000 title claims abstract description 10
- 238000000034 method Methods 0.000 title claims description 23
- 230000008569 process Effects 0.000 title claims description 19
- 150000002989 phenols Chemical class 0.000 title claims description 13
- 238000002360 preparation method Methods 0.000 title claims description 6
- 150000008379 phenol ethers Chemical class 0.000 title claims description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims abstract description 90
- 239000003054 catalyst Substances 0.000 claims abstract description 27
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 claims abstract description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 10
- 238000009835 boiling Methods 0.000 claims abstract description 8
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 5
- 239000011593 sulfur Substances 0.000 claims abstract description 5
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical group [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052711 selenium Inorganic materials 0.000 claims abstract description 4
- 239000011669 selenium Chemical group 0.000 claims abstract description 4
- 239000003960 organic solvent Substances 0.000 claims abstract description 3
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 26
- 239000002904 solvent Substances 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 10
- FLKPEMZONWLCSK-UHFFFAOYSA-N diethyl phthalate Chemical group CCOC(=O)C1=CC=CC=C1C(=O)OCC FLKPEMZONWLCSK-UHFFFAOYSA-N 0.000 claims description 10
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical group CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 claims description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 abstract description 17
- 238000006243 chemical reaction Methods 0.000 abstract description 17
- 229910052714 tellurium Chemical group 0.000 abstract description 2
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical group [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 abstract description 2
- 239000000243 solution Substances 0.000 description 24
- 239000002253 acid Substances 0.000 description 12
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 12
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 10
- 150000007513 acids Chemical class 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 125000000217 alkyl group Chemical group 0.000 description 7
- 150000005205 dihydroxybenzenes Chemical class 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 230000000640 hydroxylating effect Effects 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- -1 iron ions Chemical class 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000020169 heat generation Effects 0.000 description 3
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 3
- 229940011051 isopropyl acetate Drugs 0.000 description 3
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- FNYDIAAMUCQQDE-UHFFFAOYSA-N 4-methylbenzene-1,3-diol Chemical compound CC1=CC=C(O)C=C1O FNYDIAAMUCQQDE-UHFFFAOYSA-N 0.000 description 2
- ZBCATMYQYDCTIZ-UHFFFAOYSA-N 4-methylcatechol Chemical compound CC1=CC=C(O)C(O)=C1 ZBCATMYQYDCTIZ-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical group C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 150000002432 hydroperoxides Chemical class 0.000 description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- YNPNZTXNASCQKK-UHFFFAOYSA-N phenanthrene Chemical compound C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 239000004476 plant protection product Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- YKYONYBAUNKHLG-UHFFFAOYSA-N propyl acetate Chemical compound CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- SNDGLCYYBKJSOT-UHFFFAOYSA-N 1,1,3,3-tetrabutylurea Chemical compound CCCCN(CCCC)C(=O)N(CCCC)CCCC SNDGLCYYBKJSOT-UHFFFAOYSA-N 0.000 description 1
- 150000005207 1,3-dihydroxybenzenes Chemical class 0.000 description 1
- GJYCVCVHRSWLNY-UHFFFAOYSA-N 2-butylphenol Chemical class CCCCC1=CC=CC=C1O GJYCVCVHRSWLNY-UHFFFAOYSA-N 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 150000001639 boron compounds Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 229910001429 cobalt ion Inorganic materials 0.000 description 1
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229940042400 direct acting antivirals phosphonic acid derivative Drugs 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- LRMHFDNWKCSEQU-UHFFFAOYSA-N ethoxyethane;phenol Chemical class CCOCC.OC1=CC=CC=C1 LRMHFDNWKCSEQU-UHFFFAOYSA-N 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- UQSQSQZYBQSBJZ-UHFFFAOYSA-N fluorosulfonic acid Chemical compound OS(F)(=O)=O UQSQSQZYBQSBJZ-UHFFFAOYSA-N 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003007 phosphonic acid derivatives Chemical class 0.000 description 1
- 150000003008 phosphonic acid esters Chemical class 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 150000003021 phthalic acid derivatives Chemical class 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 150000003151 propanoic acid esters Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- RXJKFRMDXUJTEX-UHFFFAOYSA-N triethylphosphine Chemical compound CCP(CC)CC RXJKFRMDXUJTEX-UHFFFAOYSA-N 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/60—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by oxidation reactions introducing directly hydroxy groups on a =CH-group belonging to a six-membered aromatic ring with the aid of other oxidants than molecular oxygen or their mixtures with molecular oxygen
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/582—Recycling of unreacted starting or intermediate materials
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Compounds Of Alkaline-Earth Elements, Aluminum Or Rare-Earth Metals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3308726A DE3308726C2 (de) | 1983-03-11 | 1983-03-11 | Verfahren zur Herstellung von Dihydroxybenzolen |
| DE3308726 | 1983-03-11 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI840692A0 FI840692A0 (fi) | 1984-02-20 |
| FI840692L FI840692L (fi) | 1984-09-12 |
| FI79292B FI79292B (fi) | 1989-08-31 |
| FI79292C true FI79292C (fi) | 1989-12-11 |
Family
ID=6193214
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI840692A FI79292C (fi) | 1983-03-11 | 1984-02-20 | Foerfarande foer framstaellning av ringhydroxileringsprodukter av fenoler eller fenoletrar. |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US4628126A (enExample) |
| EP (1) | EP0121671B2 (enExample) |
| JP (1) | JPS59170028A (enExample) |
| AT (1) | ATE27263T1 (enExample) |
| BR (1) | BR8400900A (enExample) |
| CA (1) | CA1201451A (enExample) |
| DE (2) | DE3308726C2 (enExample) |
| ES (1) | ES529730A0 (enExample) |
| FI (1) | FI79292C (enExample) |
| IL (1) | IL71038A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3308737C2 (de) * | 1983-03-11 | 1985-01-24 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Brenzcatechin und Hydrochinon |
| DE3334854A1 (de) * | 1983-09-27 | 1985-04-11 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung nichtwaessriger wasserstoffperoxidloesungen und deren verwendung |
| US4782071A (en) * | 1986-11-03 | 1988-11-01 | Warner-Lambert Company | Tetrasubstituted urea cholinergic agents |
| JPS63119432A (ja) * | 1986-11-07 | 1988-05-24 | Kureha Chem Ind Co Ltd | 4,4′−ジヒドロキシビフエニルの製造方法 |
| DE3643206C1 (de) * | 1986-12-18 | 1988-03-24 | Degussa | Verfahren zur Herstellung von substituierten Dihydroxybenzolen |
| FR2611711B1 (fr) * | 1987-03-06 | 1989-06-09 | Interox Sa | Procede pour la fabrication d'une 2,3-dihydroxyquinoxaline et 2,3-dihydroxyquinoxalines ainsi obtenues |
| JPH07108866B2 (ja) * | 1987-03-27 | 1995-11-22 | 三井石油化学工業株式会社 | ヒドロキシベンゼン類の製法 |
| DE69314365T2 (de) * | 1992-02-26 | 1998-04-02 | Rhone Poulenc Chimie | Verfahren zur Monohydroxylierung von Phenolverbindungen |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2616791A (en) * | 1950-09-30 | 1952-11-04 | Glidden Co | Process for preparing selenium dioxide |
| FR1479354A (fr) * | 1966-03-15 | 1967-05-05 | Rhone Poulenc Sa | Procédé d'obtention de polyphénols |
| FR2071464A5 (enExample) * | 1969-12-30 | 1971-09-17 | Rhone Poulenc Sa | |
| JPS5111103B1 (enExample) * | 1970-12-30 | 1976-04-08 | ||
| DE2138735A1 (de) * | 1971-08-03 | 1973-03-01 | Haarmann & Reimer Gmbh | Verfahren zur herstellung von polyhydroxybenzolen |
| IT964049B (it) * | 1972-08-18 | 1974-01-21 | Brichima Spa | Processo per la preparazione di difenoli |
| FR2201279B1 (enExample) * | 1972-09-28 | 1975-03-14 | Rhone Poulenc Ind | |
| DE2304602C3 (de) * | 1973-01-31 | 1978-10-26 | Quarzwerke Gmbh, 5020 Frechen | Verfahren zum Beschichten von Partikeln eines aus kristallinen siliciumhaltigen Mineralien durch Mahlen hergestellten Mehls mit siliciumorganischen Verbindungen und Vorrichtung zur Durchführung des Verfahrens |
| IT979201B (it) * | 1973-02-16 | 1974-09-30 | Brichima Spa | Processo per la preparazione di difenoli |
| DE2410742C3 (de) * | 1974-03-06 | 1981-01-08 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon durch Kernhydroxylierung von Phenol |
| US4174460A (en) * | 1974-03-06 | 1979-11-13 | Bayer Aktiengesellschaft | Process for the hydroxylation of phenols and phenol ethers in the nucleus |
| DE2410758C3 (de) * | 1974-03-06 | 1981-01-08 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von mehrwertigen substituierten Phenolen bzw. Monoäthern mehrwertiger Phenole durch Kernhydroxylierung von Phenolen oder Phenoläthern |
| DE2658943C3 (de) * | 1976-12-24 | 1982-02-18 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon |
| DE3437624C1 (de) * | 1984-10-13 | 1986-01-23 | Degussa Ag, 6000 Frankfurt | Verfahren und Vorrichtung zur Bestimmung und Überwachung von Wasserstoffperoxid-Konzentrationen in Schwefelsäure-Wasserstoffperoxidgemischen |
| DE3602180A1 (de) * | 1986-01-25 | 1987-07-30 | Degussa | Verfahren zur herstellung von brenzkatechin und hydrochinon |
-
1983
- 1983-03-11 DE DE3308726A patent/DE3308726C2/de not_active Expired - Lifetime
-
1984
- 1984-02-06 EP EP84101170A patent/EP0121671B2/de not_active Expired - Lifetime
- 1984-02-06 AT AT84101170T patent/ATE27263T1/de not_active IP Right Cessation
- 1984-02-06 DE DE8484101170T patent/DE3463759D1/de not_active Expired
- 1984-02-15 ES ES529730A patent/ES529730A0/es active Granted
- 1984-02-20 FI FI840692A patent/FI79292C/fi not_active IP Right Cessation
- 1984-02-22 IL IL71038A patent/IL71038A/xx unknown
- 1984-02-27 BR BR8400900A patent/BR8400900A/pt not_active IP Right Cessation
- 1984-03-09 CA CA000449202A patent/CA1201451A/en not_active Expired
- 1984-03-09 JP JP59044225A patent/JPS59170028A/ja active Granted
- 1984-03-12 US US06/588,847 patent/US4628126A/en not_active Expired - Fee Related
- 1984-03-13 US US06/588,999 patent/US4551562A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| FI840692A0 (fi) | 1984-02-20 |
| JPS59170028A (ja) | 1984-09-26 |
| ES8502074A1 (es) | 1984-12-16 |
| ES529730A0 (es) | 1984-12-16 |
| EP0121671A3 (en) | 1985-12-27 |
| BR8400900A (pt) | 1984-10-16 |
| ATE27263T1 (de) | 1987-06-15 |
| CA1201451A (en) | 1986-03-04 |
| DE3463759D1 (en) | 1987-06-25 |
| FI79292B (fi) | 1989-08-31 |
| IL71038A (en) | 1987-10-20 |
| IL71038A0 (en) | 1984-05-31 |
| EP0121671B1 (de) | 1987-05-20 |
| US4551562A (en) | 1985-11-05 |
| FI840692L (fi) | 1984-09-12 |
| JPH0414657B2 (enExample) | 1992-03-13 |
| EP0121671A2 (de) | 1984-10-17 |
| DE3308726C2 (de) | 1991-01-24 |
| EP0121671B2 (de) | 1991-11-06 |
| US4628126A (en) | 1986-12-09 |
| DE3308726A1 (de) | 1984-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Brackman et al. | The oxidation of phenols with copper‐amine catalysts and its relation to the mode of action of tyrosinase: I. The catalytic oxidation of monohydric phenols to orthoquinone derivatives | |
| Sheldon et al. | Cycloaddition of group VIII metal-dioxygen complexes to electrophilic olefins | |
| FI79292C (fi) | Foerfarande foer framstaellning av ringhydroxileringsprodukter av fenoler eller fenoletrar. | |
| CA2056411A1 (en) | Peroxyacid manufacture | |
| US4308406A (en) | Method for preventing the discoloration of dihydric phenols | |
| EP0066992B1 (en) | Process for the production of a peroxy compound | |
| Alibrandi et al. | A new reaction pathway for the geometrical isomerization of monoalkyl complexes of platinum (II): kinetic behavior of cis-[Pt (PEt3) 2 (neopentyl) Cl] | |
| US4208536A (en) | Hydroxylation of aromatic compounds | |
| Anderson et al. | Reactivity of platinum diolefin complexes. Roles of trans influence and chelate effect | |
| CA1201449A (en) | Process for producing dihydroxy benzenes | |
| US3943179A (en) | Hydroxylation of aromatic compounds | |
| Bakker et al. | Sulfonation of alkenes with sulfur trioxide; stereospecific β-sultone formation | |
| US4278615A (en) | Process for the production of aromatic peroxycarboxylic acids | |
| CA1198126A (en) | Process for selectively producing dihydroxy benzenes | |
| US4092367A (en) | Alkylation of phenols | |
| KR20110122757A (ko) | 페놀 및 페놀 에테르의 히드록실화 방법 | |
| US4346236A (en) | Method of oxidizing tertiary-alkyl phosphines | |
| PL85551B1 (enExample) | ||
| US5026925A (en) | Method of producing catechol and hydroquinone | |
| US3978141A (en) | Process for splitting alkylaromatic hydroperoxides into phenolic compounds | |
| CN102083778A (zh) | 苯酚的羟基化方法 | |
| Müller | Hydride Abstraction from Benzocyclopropene. Preliminary communication | |
| US4154768A (en) | Production of hydroperoxides from olefins | |
| US3649662A (en) | Process for the production of triorganolead compounds and compounds and mixtures formed thereby | |
| CA2152086A1 (en) | Selective hydroxylation of phenol or phenolic ethers |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: DEGUSSA AKTIENGESELLSCHAFT |