FI69367C - Kula foer finkalibrigt vapen - Google Patents
Kula foer finkalibrigt vapen Download PDFInfo
- Publication number
- FI69367C FI69367C FI762268A FI762268A FI69367C FI 69367 C FI69367 C FI 69367C FI 762268 A FI762268 A FI 762268A FI 762268 A FI762268 A FI 762268A FI 69367 C FI69367 C FI 69367C
- Authority
- FI
- Finland
- Prior art keywords
- ball
- ball according
- tip
- projectile
- edge
- Prior art date
Links
- 239000000463 material Substances 0.000 claims description 12
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 6
- 229910052802 copper Inorganic materials 0.000 claims description 6
- 239000010949 copper Substances 0.000 claims description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 239000003708 ampul Substances 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 241000208125 Nicotiana Species 0.000 claims 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 claims 1
- 238000005452 bending Methods 0.000 claims 1
- 230000000694 effects Effects 0.000 description 14
- 230000035939 shock Effects 0.000 description 6
- 239000011248 coating agent Substances 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 230000006378 damage Effects 0.000 description 4
- 238000010304 firing Methods 0.000 description 4
- 210000000056 organ Anatomy 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229910000831 Steel Inorganic materials 0.000 description 2
- 208000027418 Wounds and injury Diseases 0.000 description 2
- 208000014674 injury Diseases 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 230000000630 rising effect Effects 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 208000023329 Gun shot wound Diseases 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 238000013467 fragmentation Methods 0.000 description 1
- 238000006062 fragmentation reaction Methods 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 210000005036 nerve Anatomy 0.000 description 1
- 210000004126 nerve fiber Anatomy 0.000 description 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B12/00—Projectiles, missiles or mines characterised by the warhead, the intended effect, or the material
- F42B12/02—Projectiles, missiles or mines characterised by the warhead, the intended effect, or the material characterised by the warhead or the intended effect
- F42B12/34—Projectiles, missiles or mines characterised by the warhead, the intended effect, or the material characterised by the warhead or the intended effect expanding before or on impact, i.e. of dumdum or mushroom type
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B5/00—Cartridge ammunition, e.g. separately-loaded propellant charges
- F42B5/02—Cartridges, i.e. cases with charge and missile
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Combustion & Propulsion (AREA)
- Toys (AREA)
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752535704 DE2535704A1 (de) | 1975-08-09 | 1975-08-09 | Patrone fuer faust- und schulterwaffen |
| DE2535704 | 1975-08-09 | ||
| DE2541632 | 1975-09-18 | ||
| DE19752541632 DE2541632A1 (de) | 1975-09-18 | 1975-09-18 | Patrone fuer faust- und schulterwaffen |
| DE19752556744 DE2556744A1 (de) | 1975-12-17 | 1975-12-17 | Patrone fuer faust- und schulterwaffen |
| DE2556744 | 1975-12-17 | ||
| DE2626219 | 1976-06-11 | ||
| DE19762626219 DE2626219A1 (de) | 1976-06-11 | 1976-06-11 | Patrone fuer faust- und schulterwaffen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI762268A7 FI762268A7 (en:Method) | 1977-02-10 |
| FI69367B FI69367B (fi) | 1985-09-30 |
| FI69367C true FI69367C (fi) | 1986-01-10 |
Family
ID=27432009
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI762268A FI69367C (fi) | 1975-08-09 | 1976-08-06 | Kula foer finkalibrigt vapen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4136616A (en:Method) |
| AT (1) | AT351970B (en:Method) |
| FI (1) | FI69367C (en:Method) |
| FR (2) | FR2321108A1 (en:Method) |
| GB (1) | GB1561743A (en:Method) |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3064795D1 (en) * | 1979-03-10 | 1983-10-20 | Schirnecker Hans Ludwig | Projectile, e.g. for hunting, and method of manufacturing same |
| FR2513369A1 (fr) * | 1981-09-24 | 1983-03-25 | Robert Antoine | Projectiles pour armes de poing et d'epaule a canon lisse ou raye a tres hautes vitesses initiales, conformes aux conventions de la haye et produisant les memes effets neutralisants que les projectiles a pointe creuse ou explosive. revendication : deux dispositifs, une utilisation. |
| GB2135029B (en) * | 1983-02-11 | 1987-03-25 | Alan Cecil Morton | Anti-riot bullet |
| DE3510343A1 (de) * | 1985-03-22 | 1986-09-25 | Hans-Ludwig 4773 Möhnesee Schirneker | Bleifreies jagdgeschoss |
| US4756254A (en) * | 1986-05-27 | 1988-07-12 | Motorola, Inc. | Penetrating projectile |
| FR2599828B1 (fr) * | 1986-06-05 | 1990-08-24 | Sauvestre Jean Claude | Munition de petit ou moyen calibre a efficacite amelioree et portee limitee, en particulier pour la chasse |
| IL85079A (en) * | 1988-01-11 | 1993-04-04 | Oded Grinberg Mazkeret Batya A | Target impact apparatus |
| AT393559B (de) * | 1988-08-02 | 1991-11-11 | Winter Udo Mag | Geschoss |
| DE3838584A1 (de) * | 1988-11-14 | 1990-05-23 | Karl Klaus Mayer | Geschoss der deformations-klasse, fuer jagd - buechsenpatronen |
| US5149913A (en) * | 1990-09-05 | 1992-09-22 | Arakaki Steven Y | Forced expanding bullet |
| FR2671620A1 (fr) * | 1991-01-10 | 1992-07-17 | Kaladgew Andre | Balle a expansion controlee pour arme a canon lisse ou raye. |
| US5127332A (en) * | 1991-10-07 | 1992-07-07 | Olin Corporation | Hunting bullet with reduced environmental lead exposure |
| DE4207373A1 (de) * | 1992-03-09 | 1993-09-16 | Jakob E Bollier | Daumendolch als abwehrwaffe |
| US5185495A (en) * | 1992-04-13 | 1993-02-09 | Petrovich Robert M | Projective with improved flowering |
| USD363335S (en) | 1993-10-29 | 1995-10-17 | E. I. Du Pont De Nemours And Company | Bullet |
| AT405977B (de) * | 1996-04-24 | 2000-01-25 | Winter Udo Mag Ing | Expansionsgeschoss |
| US6070532A (en) * | 1998-04-28 | 2000-06-06 | Olin Corporation | High accuracy projectile |
| US20050257711A1 (en) * | 1999-01-15 | 2005-11-24 | Natec, Inc. | A Cartridge Casing Body And An Ammunition Article Having A Cartridge Casing Body Wherein The Cartridge Casing Body Is Plastic, Ceramic, Or A Composite Material |
| US6240849B1 (en) | 1999-06-10 | 2001-06-05 | Christopher A. Holler | Projectile with expanding members |
| US6244186B1 (en) * | 1999-07-26 | 2001-06-12 | Joseph F. L. John Pichard | Air gun pellet |
| WO2001020244A1 (de) * | 1999-09-10 | 2001-03-22 | Dynamit Nobel Gmbh Explosivstoff- Und Systemtechnik | Deformationsgeschoss mit penetrator im geschossbug |
| AU7281800A (en) * | 1999-09-10 | 2001-04-17 | Dynamit Nobel Gmbh Explosivstoff- Und Systemtechnik | Partial fragmentation projectile with a penetrator in the tail of the projectile |
| DE10010500A1 (de) * | 2000-03-07 | 2001-09-13 | Dynamit Nobel Ag | Schadstoffreduziertes Deformationsgeschoß,vorzugsweise für Faustfeuerwaffen |
| EP1156297A1 (de) | 2000-05-15 | 2001-11-21 | SM Schweizerische Munitionsunternehmung AG | Kleinkaliber-Deformationsgeschoss und Verfahren zu dessen Herstellung |
| DE10109720B4 (de) * | 2001-02-28 | 2010-01-07 | Norbert Bork | Umformungsgeschoß. Geschoßkonstruktion für Pistolen-, Revolver- und Gewehrmunition usw. |
| US6837165B2 (en) * | 2001-11-09 | 2005-01-04 | Olin Corporation | Bullet with spherical nose portion |
| AU2003233202B2 (en) * | 2002-04-30 | 2009-04-23 | Ruag Ammotec Gmbh | Partial fragmentation and deformation bullets having an identical point of impact |
| FR2846410B1 (fr) * | 2002-10-23 | 2007-01-05 | Jean Pierre Denis | Projectile pour arme rayee ou lisse |
| BE1015436A3 (fr) * | 2003-03-24 | 2005-04-05 | Denis Jean Paul Louis | Projectile d'arme a feu. |
| FR2859523B1 (fr) * | 2003-09-10 | 2005-12-02 | Jean Claude Sauvestre | Balle de chasse a trainee aerodynamique reduite |
| RU2251657C1 (ru) * | 2003-09-11 | 2005-05-10 | Федеральное государственное унитарное предприятие "Центральный научно-исследовательский институт точного машиностроения" | Пуля |
| US7178462B2 (en) * | 2004-03-31 | 2007-02-20 | Beasley Joseph S | Projectile with members that deploy upon impact |
| US7222573B2 (en) * | 2005-04-01 | 2007-05-29 | Pontieri James M | Aerodynamic air gun projectile |
| US7966937B1 (en) | 2006-07-01 | 2011-06-28 | Jason Stewart Jackson | Non-newtonian projectile |
| SE533168C2 (sv) * | 2008-06-11 | 2010-07-13 | Norma Prec Ab | Projektil för skjutvapen |
| DE102009011093A1 (de) * | 2009-03-03 | 2010-09-09 | Brenneke Gmbh | Teilzerlegungsgeschoss für Jagdzwecke |
| US8434410B2 (en) | 2010-12-15 | 2013-05-07 | Salem A. S. AlSalem | Deformable high volocity bullet |
| DE102012015475A1 (de) * | 2011-08-08 | 2013-02-14 | Ruag Ammotec Gmbh | Hohlkanal-Geschossspitze und Ausformung eines Geschosskörpers im Spitzenbereich |
| US8881654B2 (en) * | 2011-10-14 | 2014-11-11 | Lws Ammunition Llc | Bullets with lateral damage stopping power |
| US9200877B1 (en) * | 2012-05-02 | 2015-12-01 | Darren Rubin | Biological active bullets, systems, and methods |
| USD707785S1 (en) | 2012-09-28 | 2014-06-24 | Lws Ammunition Llc | Pistol cartridge |
| US8997653B1 (en) | 2014-06-06 | 2015-04-07 | SIB Associates | Stroke inducing bullet |
| US10690464B2 (en) | 2017-04-28 | 2020-06-23 | Vista Outdoor Operations Llc | Cartridge with combined effects projectile |
| US10443990B2 (en) * | 2017-06-08 | 2019-10-15 | Connor Yadon | Fragmenting shotgun projectile with radially-disposed segments |
| EP3724594B1 (en) * | 2017-12-14 | 2023-11-29 | Quantum Ammunition, LLC | Projectiles for ammunition and methods of making and using the same |
| USD849874S1 (en) | 2018-01-21 | 2019-05-28 | Vista Outdoor Operations Llc | Muzzleloader propellant cartridge |
| US11226185B2 (en) * | 2018-06-05 | 2022-01-18 | Wayne B. Norris | Projectile having adaptive expansion characteristics |
| WO2020106401A2 (en) * | 2018-10-30 | 2020-05-28 | Olin Corporation | Hollow point bullet |
| USD980376S1 (en) * | 2018-12-13 | 2023-03-07 | Jennifer R. Hossack | Pellet |
| US10921104B1 (en) * | 2019-10-28 | 2021-02-16 | Kyle Pittman | Rotation inhibited projectile tip |
| US12181263B2 (en) * | 2022-01-17 | 2024-12-31 | Seismic Ammunition, Inc. | Firearm projectile |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE583097C (de) * | 1933-08-28 | Wilhelm Brenneke | Jagdgeschoss | |
| GB189814659A (en) * | 1898-07-04 | 1899-04-29 | Leslie Bown Taylor | Improvements in Bullets. |
| FR373597A (fr) * | 1907-01-15 | 1907-05-18 | Gilbert Hamilton Hoxie | Projectile |
| US914992A (en) * | 1907-08-23 | 1909-03-09 | Leslie Bown Taylor | Bullet. |
| US1512026A (en) * | 1922-08-17 | 1924-10-21 | Peters Cartridge Company | Bullet |
| US1556160A (en) * | 1924-06-20 | 1925-10-06 | Western Cartridge Co | Game bullet |
| DE648039C (de) * | 1934-12-14 | 1937-07-20 | Waffen Und Munitionsfabriken A | Mantelgeschoss fuer Handfeuerwaffen mit geringer Geschossgeschwindigkeit, z. B. Faustfeuerwaffen |
| US2321344A (en) * | 1939-03-04 | 1943-06-08 | Remington Arms Co Inc | Projectile |
| US2482132A (en) * | 1943-03-10 | 1949-09-20 | Rene R Studler | Cartridge |
| BE505316A (en:Method) * | 1950-08-18 | |||
| US3003420A (en) * | 1956-10-01 | 1961-10-10 | Nosler Partition Bullet Compan | Partition bullets |
| US3138102A (en) * | 1962-11-13 | 1964-06-23 | Earl J Meyer | Shotgun projectile having slits |
| US3157137A (en) * | 1963-04-01 | 1964-11-17 | Olin Mathieson | Expanding point bullet |
| US3173371A (en) * | 1963-05-06 | 1965-03-16 | Jack C Manshel | Expanding bullet with spreader disk |
| US3282214A (en) * | 1964-12-14 | 1966-11-01 | Madison H Briscoe | Projectile |
| DE1453831A1 (de) * | 1965-08-19 | 1969-04-30 | Dynamit Nobel Ag | Jagdgeschoss |
| CH532240A (de) * | 1970-12-08 | 1972-12-31 | Oerlikon Buehrle Ag | Kurzbahngeschoss |
| DE2223212A1 (de) * | 1972-05-12 | 1973-11-22 | Hans Rehse | Geschoss, insbesondere fuer jagdzwecke |
| US3881421A (en) * | 1974-02-14 | 1975-05-06 | Thomas J Burczynski | Bullet |
| US3948180A (en) * | 1975-03-17 | 1976-04-06 | The United States Of America As Represented By The Secretary Of The Navy | Non-explosive shaped-charge follow-through projectile |
-
1976
- 1976-08-06 AT AT584476A patent/AT351970B/de not_active IP Right Cessation
- 1976-08-06 FI FI762268A patent/FI69367C/fi not_active IP Right Cessation
- 1976-08-09 US US05/712,665 patent/US4136616A/en not_active Expired - Lifetime
- 1976-08-09 GB GB33026/76A patent/GB1561743A/en not_active Expired
- 1976-08-09 FR FR7624285A patent/FR2321108A1/fr active Granted
-
1982
- 1982-11-03 FR FR8218405A patent/FR2513368B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FI762268A7 (en:Method) | 1977-02-10 |
| FR2321108B1 (en:Method) | 1983-08-26 |
| FR2513368B1 (fr) | 1985-11-08 |
| GB1561743A (en) | 1980-02-27 |
| ATA584476A (de) | 1979-01-15 |
| FI69367B (fi) | 1985-09-30 |
| US4136616A (en) | 1979-01-30 |
| FR2321108A1 (fr) | 1977-03-11 |
| FR2513368A1 (fr) | 1983-03-25 |
| AT351970B (de) | 1979-08-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI69367C (fi) | Kula foer finkalibrigt vapen | |
| US9200878B2 (en) | Bullets with lateral damage stopping power | |
| ES2393490T3 (es) | Bala para la caza con anillo de expansión | |
| CA2285738C (en) | Air gun pellet | |
| HUP0700068A2 (en) | Polymer ballistic tip pellets | |
| US20130263754A1 (en) | Ammunition Rounds for Observance of Religious Beliefs and a Method of Hunting | |
| RU2150077C1 (ru) | Бронебойная пуля | |
| RU2413169C1 (ru) | Легкая высокоскоростная пуля | |
| RU2072507C1 (ru) | Пуля для патронов стрелкового оружия | |
| RU2117905C1 (ru) | Патрон с нелетально поражающим элементом | |
| US20230341217A1 (en) | Bullet | |
| RU2427787C1 (ru) | Патрон нелетального поражающего действия (варианты) | |
| RU2168695C2 (ru) | Бронебойная пуля | |
| KR100939661B1 (ko) | 권총용 비독성 탄환 | |
| RU2349869C1 (ru) | Пулевой снаряд для охотничьих ружей с гладкими стволами и "парадоксами" | |
| RU2166173C1 (ru) | Пуля охотничьего патрона для нарезного оружия | |
| RU2251067C1 (ru) | Многопульный патрон | |
| WO2017171692A2 (en) | Projectile | |
| SU1799457A3 (en) | Bullet for smooth-bore guns | |
| RU2009445C1 (ru) | Пуля охотничьего патрона для нарезного оружия | |
| RU2334939C1 (ru) | Пуля для патронов стрелкового оружия | |
| RU13696U1 (ru) | Бронебойная пуля 1 | |
| RU73469U1 (ru) | Пулевой снаряд для охотничьих ружей с гладкими стволами и "парадоксами" | |
| RU2219477C1 (ru) | Патрон пистолетный | |
| RU2235278C1 (ru) | Пуля охотничьего патрона |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: SCHIRNEKER, HANS-LUDWIG |