FI68438C - Finpapper innehaollande rikligt mineraler - Google Patents
Finpapper innehaollande rikligt mineraler Download PDFInfo
- Publication number
- FI68438C FI68438C FI812448A FI812448A FI68438C FI 68438 C FI68438 C FI 68438C FI 812448 A FI812448 A FI 812448A FI 812448 A FI812448 A FI 812448A FI 68438 C FI68438 C FI 68438C
- Authority
- FI
- Finland
- Prior art keywords
- paper
- filler
- latex
- mineral filler
- suspension
- Prior art date
Links
- 239000000123 paper Substances 0.000 claims description 139
- 229920000126 latex Polymers 0.000 claims description 108
- 239000004816 latex Substances 0.000 claims description 105
- 239000000945 filler Substances 0.000 claims description 96
- 239000000725 suspension Substances 0.000 claims description 44
- 239000004927 clay Substances 0.000 claims description 40
- 230000014759 maintenance of location Effects 0.000 claims description 39
- 239000012764 mineral filler Substances 0.000 claims description 37
- 125000002091 cationic group Chemical group 0.000 claims description 36
- 239000000835 fiber Substances 0.000 claims description 26
- 238000004519 manufacturing process Methods 0.000 claims description 25
- 238000000034 method Methods 0.000 claims description 25
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 20
- 229920006317 cationic polymer Polymers 0.000 claims description 19
- 239000005995 Aluminium silicate Substances 0.000 claims description 18
- 235000012211 aluminium silicate Nutrition 0.000 claims description 18
- 229940037003 alum Drugs 0.000 claims description 17
- 229920005989 resin Polymers 0.000 claims description 17
- 239000011347 resin Substances 0.000 claims description 17
- 239000002174 Styrene-butadiene Substances 0.000 claims description 12
- 230000002378 acidificating effect Effects 0.000 claims description 12
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical group C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 claims description 12
- 239000011115 styrene butadiene Substances 0.000 claims description 12
- 229920003048 styrene butadiene rubber Polymers 0.000 claims description 12
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 11
- 238000007639 printing Methods 0.000 claims description 10
- 239000002245 particle Substances 0.000 claims description 9
- 230000008569 process Effects 0.000 claims description 9
- 239000007787 solid Substances 0.000 claims description 9
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 6
- 238000007645 offset printing Methods 0.000 claims description 5
- 239000003292 glue Substances 0.000 claims description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 3
- 239000011707 mineral Substances 0.000 claims description 3
- 229920002689 polyvinyl acetate Polymers 0.000 claims description 3
- 239000011118 polyvinyl acetate Substances 0.000 claims description 3
- 239000004408 titanium dioxide Substances 0.000 claims description 3
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 claims description 2
- 229910052570 clay Inorganic materials 0.000 claims description 2
- 238000010586 diagram Methods 0.000 claims description 2
- 238000007646 gravure printing Methods 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 2
- 241000251730 Chondrichthyes Species 0.000 claims 1
- 239000004615 ingredient Substances 0.000 claims 1
- 239000002557 mineral fiber Substances 0.000 claims 1
- 239000000377 silicon dioxide Substances 0.000 claims 1
- 229920001909 styrene-acrylic polymer Polymers 0.000 claims 1
- 125000000129 anionic group Chemical group 0.000 description 32
- 239000000454 talc Substances 0.000 description 27
- 229910052623 talc Inorganic materials 0.000 description 27
- 238000002474 experimental method Methods 0.000 description 22
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 20
- 239000011248 coating agent Substances 0.000 description 15
- 238000000576 coating method Methods 0.000 description 15
- 229920002472 Starch Polymers 0.000 description 13
- 235000019698 starch Nutrition 0.000 description 13
- 239000008107 starch Substances 0.000 description 11
- 238000012360 testing method Methods 0.000 description 11
- 229910000019 calcium carbonate Inorganic materials 0.000 description 10
- 239000011121 hardwood Substances 0.000 description 10
- 239000011122 softwood Substances 0.000 description 10
- 239000000853 adhesive Substances 0.000 description 9
- 230000001070 adhesive effect Effects 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 238000001035 drying Methods 0.000 description 6
- 238000005189 flocculation Methods 0.000 description 6
- 230000016615 flocculation Effects 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 229920000642 polymer Polymers 0.000 description 6
- 230000002195 synergetic effect Effects 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 229910021653 sulphate ion Inorganic materials 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 4
- 229920001131 Pulp (paper) Polymers 0.000 description 4
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- 239000011575 calcium Substances 0.000 description 4
- 229910052791 calcium Inorganic materials 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- RSWGJHLUYNHPMX-ONCXSQPRSA-N abietic acid Chemical compound C([C@@H]12)CC(C(C)C)=CC1=CC[C@@H]1[C@]2(C)CCC[C@@]1(C)C(O)=O RSWGJHLUYNHPMX-ONCXSQPRSA-N 0.000 description 3
- 238000005187 foaming Methods 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000000049 pigment Substances 0.000 description 3
- 229920002401 polyacrylamide Polymers 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 239000002023 wood Substances 0.000 description 3
- 244000215068 Acacia senegal Species 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229920006318 anionic polymer Polymers 0.000 description 2
- 238000005452 bending Methods 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 230000035699 permeability Effects 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 230000009885 systemic effect Effects 0.000 description 2
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 229920000715 Mucilage Polymers 0.000 description 1
- MOMWFXLCFJOAFX-UHFFFAOYSA-N OOOOOOOO Chemical compound OOOOOOOO MOMWFXLCFJOAFX-UHFFFAOYSA-N 0.000 description 1
- OZBZONOEYUBXTD-UHFFFAOYSA-N OOOOOOOOO Chemical compound OOOOOOOOO OZBZONOEYUBXTD-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229920002873 Polyethylenimine Polymers 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 229920002522 Wood fibre Polymers 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 229920006320 anionic starch Polymers 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000011362 coarse particle Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical class O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000003487 electrochemical reaction Methods 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 244000144992 flock Species 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 230000009477 glass transition Effects 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 229920000831 ionic polymer Polymers 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000011087 paperboard Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 238000004537 pulping Methods 0.000 description 1
- 239000012744 reinforcing agent Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 239000004552 water soluble powder Substances 0.000 description 1
- 239000002025 wood fiber Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M1/00—Inking and printing with a printer's forme
- B41M1/26—Printing on other surfaces than ordinary paper
- B41M1/36—Printing on other surfaces than ordinary paper on pretreated paper, e.g. parchment, oiled paper, paper for registration purposes
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21F—PAPER-MAKING MACHINES; METHODS OF PRODUCING PAPER THEREON
- D21F11/00—Processes for making continuous lengths of paper, or of cardboard, or of wet web for fibre board production, on paper-making machines
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
- D21H17/00—Non-fibrous material added to the pulp, characterised by its constitution; Paper-impregnating material characterised by its constitution
- D21H17/20—Macromolecular organic compounds
- D21H17/33—Synthetic macromolecular compounds
- D21H17/34—Synthetic macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
- D21H17/00—Non-fibrous material added to the pulp, characterised by its constitution; Paper-impregnating material characterised by its constitution
- D21H17/20—Macromolecular organic compounds
- D21H17/33—Synthetic macromolecular compounds
- D21H17/34—Synthetic macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- D21H17/41—Synthetic macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds containing ionic groups
- D21H17/44—Synthetic macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds containing ionic groups cationic
- D21H17/45—Nitrogen-containing groups
- D21H17/455—Nitrogen-containing groups comprising tertiary amine or being at least partially quaternised
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
- D21H17/00—Non-fibrous material added to the pulp, characterised by its constitution; Paper-impregnating material characterised by its constitution
- D21H17/62—Rosin; Derivatives thereof
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
- D21H17/00—Non-fibrous material added to the pulp, characterised by its constitution; Paper-impregnating material characterised by its constitution
- D21H17/63—Inorganic compounds
- D21H17/67—Water-insoluble compounds, e.g. fillers, pigments
- D21H17/68—Water-insoluble compounds, e.g. fillers, pigments siliceous, e.g. clays
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Dispersion Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Paper (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US19916580A | 1980-10-22 | 1980-10-22 | |
| US19916580 | 1980-10-22 | ||
| US06/267,941 US4445970A (en) | 1980-10-22 | 1981-06-01 | High mineral composite fine paper |
| US26794181 | 1981-06-01 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI812448L FI812448L (fi) | 1982-04-23 |
| FI68438B FI68438B (fi) | 1985-05-31 |
| FI68438C true FI68438C (fi) | 1985-09-10 |
Family
ID=26894526
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI812448A FI68438C (fi) | 1980-10-22 | 1981-08-07 | Finpapper innehaollande rikligt mineraler |
Country Status (9)
Families Citing this family (73)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU628285B2 (en) * | 1982-12-23 | 1992-09-17 | Dow Chemical Company, The | Sheets having improved stiffness from fiber, latex and coalescing agent |
| US4707221A (en) * | 1982-12-23 | 1987-11-17 | The Dow Chemical Company | Sheets having improved stiffness from fiber, latex and coalescing agent |
| US4609431A (en) * | 1984-07-26 | 1986-09-02 | Congoleum Corporation | Non-woven fibrous composite materials and method for the preparation thereof |
| EP0174859A3 (en) * | 1984-09-13 | 1987-08-19 | Canon Kabushiki Kaisha | Ink-jet recording medium and method |
| FR2578870B1 (fr) * | 1985-03-18 | 1988-07-29 | Gascogne Papeteries | Procede de preparation d'une feuille fibreuse par voie papetiere pour ameliorer la retention et en particulier l'opacite. |
| US4820554A (en) * | 1985-11-27 | 1989-04-11 | E.C.C. America Inc. | Coated paper and process |
| GB8531558D0 (en) * | 1985-12-21 | 1986-02-05 | Wiggins Teape Group Ltd | Loaded paper |
| US4795531A (en) * | 1987-09-22 | 1989-01-03 | Nalco Chemical Company | Method for dewatering paper |
| WO1989003863A1 (en) * | 1987-10-19 | 1989-05-05 | J.M. Huber Corporation | Cationic clays and uses in paper and paints |
| US4964955A (en) * | 1988-12-21 | 1990-10-23 | Cyprus Mines Corporation | Method of reducing pitch in pulping and papermaking operations |
| US5274055A (en) * | 1990-06-11 | 1993-12-28 | American Cyanamid Company | Charged organic polymer microbeads in paper-making process |
| US5032227A (en) * | 1990-07-03 | 1991-07-16 | Vinings Industries Inc. | Production of paper or paperboard |
| US5336311A (en) * | 1992-07-07 | 1994-08-09 | Nord Kaolin Company | Cationic pigments |
| US5709827A (en) * | 1992-08-11 | 1998-01-20 | E. Khashoggi Industries | Methods for manufacturing articles having a starch-bound cellular matrix |
| US5662731A (en) * | 1992-08-11 | 1997-09-02 | E. Khashoggi Industries | Compositions for manufacturing fiber-reinforced, starch-bound articles having a foamed cellular matrix |
| US5453310A (en) | 1992-08-11 | 1995-09-26 | E. Khashoggi Industries | Cementitious materials for use in packaging containers and their methods of manufacture |
| US5928741A (en) | 1992-08-11 | 1999-07-27 | E. Khashoggi Industries, Llc | Laminated articles of manufacture fashioned from sheets having a highly inorganically filled organic polymer matrix |
| NZ255666A (en) | 1992-08-11 | 1997-04-24 | Khashoggi E Ind | Food/drink containers formed from a hydraulically settable binder, water and a rheology-modifying agent |
| US5800647A (en) | 1992-08-11 | 1998-09-01 | E. Khashoggi Industries, Llc | Methods for manufacturing articles from sheets having a highly inorganically filled organic polymer matrix |
| US5851634A (en) | 1992-08-11 | 1998-12-22 | E. Khashoggi Industries | Hinges for highly inorganically filled composite materials |
| US5830305A (en) * | 1992-08-11 | 1998-11-03 | E. Khashoggi Industries, Llc | Methods of molding articles having an inorganically filled organic polymer matrix |
| US5508072A (en) | 1992-08-11 | 1996-04-16 | E. Khashoggi Industries | Sheets having a highly inorganically filled organic polymer matrix |
| US5506046A (en) * | 1992-08-11 | 1996-04-09 | E. Khashoggi Industries | Articles of manufacture fashioned from sheets having a highly inorganically filled organic polymer matrix |
| US5641584A (en) | 1992-08-11 | 1997-06-24 | E. Khashoggi Industries | Highly insulative cementitious matrices and methods for their manufacture |
| US5783126A (en) * | 1992-08-11 | 1998-07-21 | E. Khashoggi Industries | Method for manufacturing articles having inorganically filled, starch-bound cellular matrix |
| US5618341A (en) * | 1992-08-11 | 1997-04-08 | E. Khashoggi Industries | Methods for uniformly dispersing fibers within starch-based compositions |
| US5545450A (en) * | 1992-08-11 | 1996-08-13 | E. Khashoggi Industries | Molded articles having an inorganically filled organic polymer matrix |
| US5679145A (en) * | 1992-08-11 | 1997-10-21 | E. Khashoggi Industries | Starch-based compositions having uniformly dispersed fibers used to manufacture high strength articles having a fiber-reinforced, starch-bound cellular matrix |
| US5631097A (en) | 1992-08-11 | 1997-05-20 | E. Khashoggi Industries | Laminate insulation barriers having a cementitious structural matrix and methods for their manufacture |
| US5830548A (en) | 1992-08-11 | 1998-11-03 | E. Khashoggi Industries, Llc | Articles of manufacture and methods for manufacturing laminate structures including inorganically filled sheets |
| US5683772A (en) * | 1992-08-11 | 1997-11-04 | E. Khashoggi Industries | Articles having a starch-bound cellular matrix reinforced with uniformly dispersed fibers |
| US5580624A (en) | 1992-08-11 | 1996-12-03 | E. Khashoggi Industries | Food and beverage containers made from inorganic aggregates and polysaccharide, protein, or synthetic organic binders, and the methods of manufacturing such containers |
| US5660903A (en) | 1992-08-11 | 1997-08-26 | E. Khashoggi Industries | Sheets having a highly inorganically filled organic polymer matrix |
| US5582670A (en) | 1992-08-11 | 1996-12-10 | E. Khashoggi Industries | Methods for the manufacture of sheets having a highly inorganically filled organic polymer matrix |
| US5658603A (en) | 1992-08-11 | 1997-08-19 | E. Khashoggi Industries | Systems for molding articles having an inorganically filled organic polymer matrix |
| US5810961A (en) * | 1993-11-19 | 1998-09-22 | E. Khashoggi Industries, Llc | Methods for manufacturing molded sheets having a high starch content |
| US5716675A (en) * | 1992-11-25 | 1998-02-10 | E. Khashoggi Industries | Methods for treating the surface of starch-based articles with glycerin |
| NZ259123A (en) * | 1992-11-25 | 1997-02-24 | Khashoggi E Ind | Sheets having an inorganically filled matrix with a water dispersible organic polymer binder, fibrous material and an aggregate material |
| GB9301451D0 (en) * | 1993-01-26 | 1993-03-17 | Allied Colloids Ltd | Production of filled paper |
| DK169728B1 (da) | 1993-02-02 | 1995-01-23 | Stein Gaasland | Fremgangsmåde til frigørelse af cellulosebaserede fibre fra hinanden i vand og støbemasse til plastisk formning af celluloseholdige fiberprodukter |
| US5736008A (en) * | 1993-04-08 | 1998-04-07 | Congoleum Corporation | Fibrous-reinforced sheet |
| RU2143341C1 (ru) * | 1993-07-21 | 1999-12-27 | Э.Хашогги Индастриз | Изделие, изготовленное из неорганически наполненного материала, способ его изготовления и устройство для его осуществления (варианты) |
| US5738921A (en) | 1993-08-10 | 1998-04-14 | E. Khashoggi Industries, Llc | Compositions and methods for manufacturing sealable, liquid-tight containers comprising an inorganically filled matrix |
| US6083586A (en) * | 1993-11-19 | 2000-07-04 | E. Khashoggi Industries, Llc | Sheets having a starch-based binding matrix |
| US5736209A (en) * | 1993-11-19 | 1998-04-07 | E. Kashoggi, Industries, Llc | Compositions having a high ungelatinized starch content and sheets molded therefrom |
| US5843544A (en) * | 1994-02-07 | 1998-12-01 | E. Khashoggi Industries | Articles which include a hinged starch-bound cellular matrix |
| US5705203A (en) * | 1994-02-07 | 1998-01-06 | E. Khashoggi Industries | Systems for molding articles which include a hinged starch-bound cellular matrix |
| US5776388A (en) * | 1994-02-07 | 1998-07-07 | E. Khashoggi Industries, Llc | Methods for molding articles which include a hinged starch-bound cellular matrix |
| EP0754801A3 (en) * | 1995-07-17 | 1997-09-03 | Westvaco Corp | Packaging structure based on fibrous material containing a colloidal copolymer to improve the yield |
| US5902453A (en) | 1995-09-29 | 1999-05-11 | Mohawk Paper Mills, Inc. | Text and cover printing paper and process for making the same |
| DE19601245A1 (de) * | 1996-01-16 | 1997-07-17 | Haindl Papier Gmbh | Rollendruckpapier mit Coldset-Eignung und Verfahren zu dessen Herstellung |
| US6168857B1 (en) | 1996-04-09 | 2001-01-02 | E. Khashoggi Industries, Llc | Compositions and methods for manufacturing starch-based compositions |
| US5912071A (en) * | 1996-04-24 | 1999-06-15 | Asahi Glass Company Ltd. | Recording medium and method for its production |
| AU6464698A (en) | 1997-03-21 | 1998-10-20 | Kimberly-Clark Worldwide, Inc. | Dual-zoned absorbent webs |
| US5990377A (en) * | 1997-03-21 | 1999-11-23 | Kimberly-Clark Worldwide, Inc. | Dual-zoned absorbent webs |
| US6017991A (en) * | 1997-09-22 | 2000-01-25 | Minerals Technologies Inc. | Polyolefin film composition and resins useable therefore and related making method |
| GB9722395D0 (en) * | 1997-10-24 | 1997-12-24 | Zeneca Ltd | Process |
| FI108950B (fi) * | 1998-03-13 | 2002-04-30 | M Real Oyj | Menetelmä päällystetyn puuvapaan paperin valmistamiseksi |
| GB0030132D0 (en) * | 2000-12-09 | 2001-01-24 | Arjo Wiggins Fine Papers Ltd | Security paper |
| RU2252203C1 (ru) * | 2003-09-24 | 2005-05-20 | Пирязев Эдуард Валентинович | Сырьевая смесь для изготовления фиброцементных изделий |
| FR2862668B1 (fr) * | 2003-11-24 | 2006-08-25 | Honnorat Rech S & Services | Papier non couche apte a une impression jet d'encre de qualite renforcee |
| KR100717930B1 (ko) * | 2004-10-26 | 2007-05-11 | 주식회사 엘지화학 | 종이를 포함하여 표면층을 구성한 장척 바닥장식재 |
| US20060183816A1 (en) * | 2005-02-11 | 2006-08-17 | Gelman Robert A | Additive system for use in paper making and process of using the same |
| WO2006102101A2 (en) * | 2005-03-17 | 2006-09-28 | Luzenac America, Inc. | Cellulosic inorganic-filled plastic composite |
| US20070207333A1 (en) * | 2006-03-01 | 2007-09-06 | Jerry Surber | Award decoration and method |
| EP2158359B1 (en) | 2007-06-08 | 2013-09-04 | FPInnovations | Latex-treated filler slurries for use in papermaking |
| US8613833B2 (en) * | 2008-07-03 | 2013-12-24 | Basf Se | Aqueous suspensions of fine-particulate fillers, method for the manufacture thereof and use thereof for the manufacture of filler-containing papers |
| FI20085760A7 (fi) * | 2008-08-04 | 2010-03-17 | Upm Kymmene Corp | Muunnettu komposiittituote ja menetelmä sen valmistamiseksi |
| CA2750671A1 (en) * | 2009-02-05 | 2010-08-12 | Basf Se | Method for producing paper, card and board with high dry strength |
| JP5559303B2 (ja) * | 2009-03-17 | 2014-07-23 | スティロン ヨーロッパ ゲゼルシャフト ミット ベシュレンクテル ハフツング | バインダー/充填剤集塊を用いた製紙方法 |
| FI20125569A7 (fi) | 2012-05-28 | 2013-11-29 | Nordkalk Oy Ab | Saostettua karbonaattia sisältävän komposiittirakenteen valmistus ja käyttö |
| CN116163154A (zh) * | 2022-11-14 | 2023-05-26 | 青阳县凯德超微钙业有限公司 | 环保型复合无机矿物纤维增强剂 |
| CN119266018B (zh) * | 2024-10-24 | 2025-06-27 | 五洲特种纸业(江西)有限公司 | 一种数码热转印纸高效生产方法 |
Family Cites Families (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA619559A (en) * | 1961-05-02 | B. Holly Richard | Sheets containing inorganic mineral filler | |
| CA627550A (en) * | 1961-09-19 | The Dow Chemical Company | Paper treating agents incorporation | |
| US2375245A (en) * | 1941-08-25 | 1945-05-08 | Paul W Pretzel | Manufacture of rubberized fibers and sheets |
| US2676099A (en) * | 1948-09-25 | 1954-04-20 | Farnam Co F D | Process of coating fibers with gas agitation |
| US2657991A (en) * | 1948-11-27 | 1953-11-03 | Du Pont | Method of incorporating polychloroprene in paper |
| US2868641A (en) * | 1956-07-20 | 1959-01-13 | Armstrong Cork Co | Beater saturated sheets having increased strength |
| US2943013A (en) * | 1956-07-27 | 1960-06-28 | Hurlbut Paper Company | High ash content absorbent paper for the decorative laminating industry and a process for preparing the same |
| US2904267A (en) * | 1957-09-16 | 1959-09-15 | Georgia Kaolin Co | Method of treating kaolinitic clay |
| US2971879A (en) * | 1957-11-12 | 1961-02-14 | Armstrong Cork Co | Water-laid fibrous sheets |
| DE1222781B (de) * | 1959-03-16 | 1966-08-11 | Gessner & Co G M B H | Quarzgefuelltes Papier |
| BE608996A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1960-11-04 | |||
| US3184373A (en) * | 1961-07-05 | 1965-05-18 | Mead Corp | Filled paper containing a mixture of resin and mucilaginous material as a retention aid and process for producing said paper |
| US3477809A (en) * | 1966-12-30 | 1969-11-11 | Georgia Kaolin Co | Kaolin treatment |
| CA958508A (en) * | 1970-01-20 | 1974-12-03 | Martyn Aartsen | Fibre treatment process |
| US3844880A (en) * | 1971-01-21 | 1974-10-29 | Scott Paper Co | Sequential addition of a cationic debonder, resin and deposition aid to a cellulosic fibrous slurry |
| JPS5343206B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1973-03-24 | 1978-11-17 | ||
| JPS5319684B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1973-06-18 | 1978-06-22 | ||
| GB1505641A (en) * | 1974-04-19 | 1978-03-30 | Grace W R & Co | Process of preparing a filler composition for paper |
| US4030941A (en) * | 1975-06-30 | 1977-06-21 | J. M. Huber Corporation | Method for reducing the viscosity and for refining kaolin clays |
| US4181567A (en) * | 1975-07-17 | 1980-01-01 | Martin Clark Riddell | Paper manufacture employing filler and acrylamide polymer conglomerates |
| US4178205A (en) * | 1977-08-17 | 1979-12-11 | The Dow Chemical Company | High strength non-woven fibrous material |
| US4187142A (en) * | 1977-08-17 | 1980-02-05 | The Dow Chemical Company | Method for forming high strength composites |
| US4189345A (en) * | 1977-08-17 | 1980-02-19 | The Dow Chemical Company | Fibrous compositions |
| US4225383A (en) * | 1978-02-02 | 1980-09-30 | The Dow Chemical Company | Highly filled sheets and method of preparation thereof |
| GR65316B (en) * | 1978-06-20 | 1980-08-02 | Arjomari Prioux | Method for the preparation of fibrous leaf |
-
1981
- 1981-06-01 US US06/267,941 patent/US4445970A/en not_active Expired - Lifetime
- 1981-08-05 CA CA000383202A patent/CA1168910A/en not_active Expired
- 1981-08-07 FI FI812448A patent/FI68438C/fi not_active IP Right Cessation
- 1981-08-07 SE SE8104734A patent/SE457269B/sv not_active IP Right Cessation
- 1981-08-11 GB GB8124475A patent/GB2085492B/en not_active Expired
- 1981-08-17 AU AU74248/81A patent/AU531334B2/en not_active Ceased
- 1981-08-19 DE DE19813132841 patent/DE3132841A1/de active Granted
- 1981-09-09 FR FR8117079A patent/FR2492426B1/fr not_active Expired
- 1981-10-22 KR KR1019810004002A patent/KR860000701B1/ko not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2492426B1 (fr) | 1985-07-19 |
| KR860000701B1 (ko) | 1986-06-07 |
| FR2492426A1 (fr) | 1982-04-23 |
| DE3132841A1 (de) | 1982-06-03 |
| US4445970A (en) | 1984-05-01 |
| DE3132841C2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1988-10-20 |
| AU7424881A (en) | 1982-07-15 |
| FI68438B (fi) | 1985-05-31 |
| CA1168910A (en) | 1984-06-12 |
| SE457269B (sv) | 1988-12-12 |
| KR830007956A (ko) | 1983-11-09 |
| GB2085492B (en) | 1984-07-11 |
| AU531334B2 (en) | 1983-08-18 |
| SE8104734L (sv) | 1982-04-23 |
| GB2085492A (en) | 1982-04-28 |
| FI812448L (fi) | 1982-04-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI68438C (fi) | Finpapper innehaollande rikligt mineraler | |
| EP2157237B1 (en) | Methods for producing coating base papers and coated papers | |
| US2943013A (en) | High ash content absorbent paper for the decorative laminating industry and a process for preparing the same | |
| FI57149C (fi) | Foerfarande foer framstaellning av en komposition laempad som fyllmedel i en pappersmassa | |
| EP2158359B1 (en) | Latex-treated filler slurries for use in papermaking | |
| US20080073049A1 (en) | Fibrous web and process for the preparation thereof | |
| US5972100A (en) | Pretreatment of filler with cationic ketene dimer | |
| EP3087223A1 (en) | Method for improving sizing efficiency of asa emulsion emulsified by a polymer emulsifier | |
| FI63954C (fi) | Ytmodifierat pigment av naturligt kaolinmaterial och saett attframstaella detta | |
| FI64675B (fi) | Drygt fyllmedel innehaollande fiberbanor och foerfarande foer framstaellning daerav | |
| AU2002247795A1 (en) | Fibrous web and process for the preparation thereof | |
| KR20180115744A (ko) | 종이의 제조방법 | |
| EP1095186B1 (en) | Surface modified fillers for sizing paper | |
| KR20010074692A (ko) | 제지 공정에서의 미립자 시스템 | |
| EP1047834B1 (en) | Silica-acid colloid blend in a microparticle system used in papermaking | |
| EP1831459B1 (de) | Verfahren zur herstellung von papier, pappe und karton | |
| JP6200245B2 (ja) | オフセット輪転印刷用塗工紙 | |
| AU673252B2 (en) | Cellulosic, modified lignin and cationic polymer composition and process for making improved paper or paperboard | |
| JPH03279482A (ja) | 紙の製造方法 | |
| SK14193A3 (sk) | Viaczložkový retenčný systém | |
| HK1183073A (en) | Process for manufacturing paper or board | |
| JP2001329487A (ja) | 非塗工紙の風合いを持つ微塗工紙 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: PENNTECH PAPERS, INC. |