FI66005C - Foerfarande foer framstaellning av antibakteriellt verkande 7-alfa alfa-disubstituerad-acetamido)-3-substituerad-3-cefe m--karboxylsyras syn-isomer - Google Patents
Foerfarande foer framstaellning av antibakteriellt verkande 7-alfa alfa-disubstituerad-acetamido)-3-substituerad-3-cefe m--karboxylsyras syn-isomer Download PDFInfo
- Publication number
- FI66005C FI66005C FI760256A FI760256A FI66005C FI 66005 C FI66005 C FI 66005C FI 760256 A FI760256 A FI 760256A FI 760256 A FI760256 A FI 760256A FI 66005 C FI66005 C FI 66005C
- Authority
- FI
- Finland
- Prior art keywords
- isomer
- syn
- acetamido
- cephem
- spectrum
- Prior art date
Links
- 230000000844 anti-bacterial effect Effects 0.000 title claims description 4
- 235000013399 edible fruits Nutrition 0.000 title 1
- 238000012795 verification Methods 0.000 title 1
- -1 carbamoyloxy, thiadiazolylthio, tetrazolylthio, tetrazolylthio Chemical group 0.000 claims description 134
- 150000001875 compounds Chemical class 0.000 claims description 89
- 238000006243 chemical reaction Methods 0.000 claims description 59
- 150000003839 salts Chemical class 0.000 claims description 44
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 34
- 125000002252 acyl group Chemical group 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 238000002360 preparation method Methods 0.000 claims description 18
- 125000001589 carboacyl group Chemical group 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 15
- 125000003545 alkoxy group Chemical group 0.000 claims description 13
- 150000002431 hydrogen Chemical class 0.000 claims description 11
- 125000005907 alkyl ester group Chemical group 0.000 claims description 10
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 125000004423 acyloxy group Chemical group 0.000 claims description 8
- 238000003379 elimination reaction Methods 0.000 claims description 8
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 6
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 6
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 6
- 125000004414 alkyl thio group Chemical group 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000000218 acetic acid group Chemical class C(C)(=O)* 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims 2
- 125000002071 phenylalkoxy group Chemical group 0.000 claims 2
- 125000005041 acyloxyalkyl group Chemical group 0.000 claims 1
- JDPQWHLMBJZURR-UHFFFAOYSA-N decan-5-one Chemical compound CCCCCC(=O)CCCC JDPQWHLMBJZURR-UHFFFAOYSA-N 0.000 claims 1
- ZAJNGDIORYACQU-UHFFFAOYSA-N methyl n-octyl ketone Natural products CCCCCCCCC(C)=O ZAJNGDIORYACQU-UHFFFAOYSA-N 0.000 claims 1
- NZARHKBYDXFVPP-UHFFFAOYSA-N tetrathiolane Chemical compound C1SSSS1 NZARHKBYDXFVPP-UHFFFAOYSA-N 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 123
- 238000002329 infrared spectrum Methods 0.000 description 111
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 96
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 82
- 239000000243 solution Substances 0.000 description 82
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 78
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 69
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 62
- 239000000203 mixture Substances 0.000 description 38
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 36
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 32
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 30
- 238000001816 cooling Methods 0.000 description 30
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 28
- 239000002904 solvent Substances 0.000 description 28
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 description 23
- 238000003756 stirring Methods 0.000 description 22
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 20
- 238000001914 filtration Methods 0.000 description 20
- 239000011541 reaction mixture Substances 0.000 description 18
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 16
- 239000000284 extract Substances 0.000 description 16
- 229910052708 sodium Inorganic materials 0.000 description 16
- 239000011734 sodium Substances 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 14
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 14
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 14
- 239000003208 petroleum Substances 0.000 description 14
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 14
- 235000017557 sodium bicarbonate Nutrition 0.000 description 14
- 239000007858 starting material Substances 0.000 description 14
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000002244 precipitate Substances 0.000 description 12
- 229910052783 alkali metal Inorganic materials 0.000 description 10
- 239000011780 sodium chloride Substances 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000005917 acylation reaction Methods 0.000 description 8
- FBCCMZVIWNDFMO-UHFFFAOYSA-N dichloroacetyl chloride Chemical compound ClC(Cl)C(Cl)=O FBCCMZVIWNDFMO-UHFFFAOYSA-N 0.000 description 8
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 8
- 238000001228 spectrum Methods 0.000 description 8
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 8
- SIOVKLKJSOKLIF-UHFFFAOYSA-N bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)OC(C)=N[Si](C)(C)C SIOVKLKJSOKLIF-UHFFFAOYSA-N 0.000 description 7
- 150000007529 inorganic bases Chemical class 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 150000007530 organic bases Chemical class 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- YNTPIKSPJIQDTM-UHFFFAOYSA-N 2-hydroxyimino-2-(3-hydroxyphenyl)acetic acid Chemical compound ON=C(C(O)=O)C1=CC=CC(O)=C1 YNTPIKSPJIQDTM-UHFFFAOYSA-N 0.000 description 5
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- NIGSPCOEBMYIBR-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-(3-hydroxyphenyl)acetic acid Chemical compound ClC(Cl)C(=O)ON=C(C(=O)O)C1=CC=CC(O)=C1 NIGSPCOEBMYIBR-UHFFFAOYSA-N 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- 229920001817 Agar Polymers 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 150000001242 acetic acid derivatives Chemical class 0.000 description 4
- 239000008272 agar Substances 0.000 description 4
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 4
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 4
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- OFEGBJUCNXTHSP-LWPABBACSA-M sodium (6R)-7-[[2-hydroxyimino-2-(3-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)[O-])C1=O)C1=CC(=CC=C1)O.[Na+] OFEGBJUCNXTHSP-LWPABBACSA-M 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 125000005270 trialkylamine group Chemical group 0.000 description 4
- XUTQHTOXGKVJPN-XCGJVMPOSA-N (6r)-7-amino-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 XUTQHTOXGKVJPN-XCGJVMPOSA-N 0.000 description 3
- NBDYDHVCTKPDRI-UHFFFAOYSA-N 2-(3-hydroxyphenyl)-2-oxoacetic acid Chemical compound OC(=O)C(=O)C1=CC=CC(O)=C1 NBDYDHVCTKPDRI-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- FWTDSRYPEAXBRI-UHFFFAOYSA-N 2-[4-(methanesulfonamido)phenyl]-2-oxoacetic acid Chemical compound CS(=O)(=O)NC1=CC=C(C(=O)C(O)=O)C=C1 FWTDSRYPEAXBRI-UHFFFAOYSA-N 0.000 description 3
- ZFQADUSHPKPJTR-UHFFFAOYSA-N 2-hydroxyimino-2-(2-methoxyphenyl)acetic acid Chemical compound ON=C(C(=O)O)C1=C(C=CC=C1)OC ZFQADUSHPKPJTR-UHFFFAOYSA-N 0.000 description 3
- MEZKYYGDPRNGAG-UHFFFAOYSA-N 2-hydroxyimino-2-[4-(methanesulfonamido)phenyl]acetic acid Chemical compound ON=C(C(=O)O)C1=CC=C(C=C1)NS(=O)(=O)C MEZKYYGDPRNGAG-UHFFFAOYSA-N 0.000 description 3
- ULGNNGRBOQYCDH-UHFFFAOYSA-N 2-hydroxyimino-2-[4-hydroxy-3-(methanesulfonamido)phenyl]acetic acid Chemical compound CS(=O)(=O)NC1=CC(C(=NO)C(O)=O)=CC=C1O ULGNNGRBOQYCDH-UHFFFAOYSA-N 0.000 description 3
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 241000894006 Bacteria Species 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 3
- 150000008041 alkali metal carbonates Chemical class 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 159000000003 magnesium salts Chemical class 0.000 description 3
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- ZKROCJZIKTUEAP-LMNIDFBRSA-N (6R)-7-[[2-(3-hydroxyphenyl)-2-(2-thiophen-2-ylacetyl)oxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)CC(=O)ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=CC=C1)O ZKROCJZIKTUEAP-LMNIDFBRSA-N 0.000 description 2
- DXSJUYSAIGOMOB-XPKAQORNSA-N (6R)-7-[[2-acetyloxyimino-2-(3-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C)(=O)ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=CC=C1)O DXSJUYSAIGOMOB-XPKAQORNSA-N 0.000 description 2
- OBZPELDGSNYFTD-XCGJVMPOSA-N (6r)-7-amino-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC1=NN=CS1 OBZPELDGSNYFTD-XCGJVMPOSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- REIGARMSUIDPOX-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-(4-hydroxyphenyl)acetic acid Chemical compound ClC(Cl)C(=O)ON=C(C(=O)O)C1=CC=C(O)C=C1 REIGARMSUIDPOX-UHFFFAOYSA-N 0.000 description 2
- CSYRYBHTQYCLAI-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-(4-methylsulfanylphenyl)acetic acid Chemical compound ClC(C(=O)ON=C(C(=O)O)C1=CC=C(C=C1)SC)Cl CSYRYBHTQYCLAI-UHFFFAOYSA-N 0.000 description 2
- DQQVEHHYEJVWFX-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-[4-(methanesulfonamido)phenyl]acetic acid Chemical compound ClC(C(=O)ON=C(C(=O)O)C1=CC=C(C=C1)NS(=O)(=O)C)Cl DQQVEHHYEJVWFX-UHFFFAOYSA-N 0.000 description 2
- NIVQTMCOFWYSQN-UHFFFAOYSA-N 2-(2,2-dimethylpropanoyloxyimino)-2-(3-hydroxyphenyl)acetic acid Chemical compound CC(C)(C)C(=O)ON=C(C(O)=O)C1=CC=CC(O)=C1 NIVQTMCOFWYSQN-UHFFFAOYSA-N 0.000 description 2
- BDKLKNJTMLIAFE-UHFFFAOYSA-N 2-(3-fluorophenyl)-1,3-oxazole-4-carbaldehyde Chemical compound FC1=CC=CC(C=2OC=C(C=O)N=2)=C1 BDKLKNJTMLIAFE-UHFFFAOYSA-N 0.000 description 2
- JNZGKTPLNIBLEW-UHFFFAOYSA-N 2-(3-hydroxyphenyl)-2-(2-thiophen-2-ylacetyl)oxyiminoacetic acid Chemical compound C=1C=CC(O)=CC=1C(C(=O)O)=NOC(=O)CC1=CC=CS1 JNZGKTPLNIBLEW-UHFFFAOYSA-N 0.000 description 2
- JOZCNWTTZMKMKP-UHFFFAOYSA-N 2-(3-nitro-4-phenylmethoxyphenyl)-2-oxoacetic acid Chemical compound [O-][N+](=O)C1=CC(C(=O)C(=O)O)=CC=C1OCC1=CC=CC=C1 JOZCNWTTZMKMKP-UHFFFAOYSA-N 0.000 description 2
- ABWSHWSJDKGYQN-UHFFFAOYSA-N 2-[3-(methanesulfonamido)phenyl]-2-oxoacetic acid Chemical compound CS(=O)(=O)NC1=CC=CC(C(=O)C(O)=O)=C1 ABWSHWSJDKGYQN-UHFFFAOYSA-N 0.000 description 2
- AJDQQGNUNIRWTE-UHFFFAOYSA-N 2-hydroxyimino-2-(3-methoxyphenyl)acetic acid Chemical compound ON=C(C(=O)O)C1=CC(=CC=C1)OC AJDQQGNUNIRWTE-UHFFFAOYSA-N 0.000 description 2
- NQZKNSCIXDWCRQ-UHFFFAOYSA-N 2-hydroxyimino-2-(3-sulfamoylphenyl)acetic acid Chemical compound ON=C(C(=O)O)C1=CC(=CC=C1)S(N)(=O)=O NQZKNSCIXDWCRQ-UHFFFAOYSA-N 0.000 description 2
- CQXXFDXFOYSHGN-UHFFFAOYSA-N 2-hydroxyimino-2-(4-hydroxy-3-nitrophenyl)acetic acid Chemical compound ON=C(C(O)=O)C1=CC=C(O)C([N+]([O-])=O)=C1 CQXXFDXFOYSHGN-UHFFFAOYSA-N 0.000 description 2
- OVBGBEMEEJPJQV-UHFFFAOYSA-N 2-hydroxyimino-2-(4-methylphenyl)acetic acid Chemical compound CC1=CC=C(C(=NO)C(O)=O)C=C1 OVBGBEMEEJPJQV-UHFFFAOYSA-N 0.000 description 2
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- DBJUEJCZPKMDPA-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O DBJUEJCZPKMDPA-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 230000000845 anti-microbial effect Effects 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 238000011033 desalting Methods 0.000 description 2
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- QKFJKGMPGYROCL-UHFFFAOYSA-N phenyl isothiocyanate Chemical compound S=C=NC1=CC=CC=C1 QKFJKGMPGYROCL-UHFFFAOYSA-N 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 229940087562 sodium acetate trihydrate Drugs 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- NYBWUHOMYZZKOR-UHFFFAOYSA-N tes-adt Chemical class C1=C2C(C#C[Si](CC)(CC)CC)=C(C=C3C(SC=C3)=C3)C3=C(C#C[Si](CC)(CC)CC)C2=CC2=C1SC=C2 NYBWUHOMYZZKOR-UHFFFAOYSA-N 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- CPVSGFYODKWOFC-JOPIAHFSSA-N (6R)-3-(carbamoyloxymethyl)-7-[[2-hydroxyimino-2-(3-hydroxyphenyl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(N)=O)C(=O)O)C1=O)C1=CC(=CC=C1)O CPVSGFYODKWOFC-JOPIAHFSSA-N 0.000 description 1
- ZZJNYZZMWBXNON-SSDOTTSWSA-N (6R)-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC=1CS[C@H]2N(C=1C(=O)O)C(C2)=O ZZJNYZZMWBXNON-SSDOTTSWSA-N 0.000 description 1
- UTJBVDHFYIVQOQ-XPKAQORNSA-N (6R)-7-[[2-ethoxycarbonyloxyimino-2-(3-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C)OC(=O)ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=CC=C1)O UTJBVDHFYIVQOQ-XPKAQORNSA-N 0.000 description 1
- OPQVNXDBBSJNBJ-PVQCJRHBSA-N (6R)-7-[[2-hydroxyimino-2-(3-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=CC=C1)O OPQVNXDBBSJNBJ-PVQCJRHBSA-N 0.000 description 1
- YKUOPPVELLXHBB-JOPIAHFSSA-N (6R)-7-[[2-hydroxyimino-2-(3-hydroxyphenyl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)C)C(=O)O)C1=O)C1=CC(=CC=C1)O YKUOPPVELLXHBB-JOPIAHFSSA-N 0.000 description 1
- TUPMJOKBBDUQNW-ZCFIWIBFSA-N (6r)-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)N)=C(C(O)=O)N2C(=O)C[C@H]21 TUPMJOKBBDUQNW-ZCFIWIBFSA-N 0.000 description 1
- NLZHNYNXJJFHRW-ZCFIWIBFSA-N (6r)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)C[C@H]21 NLZHNYNXJJFHRW-ZCFIWIBFSA-N 0.000 description 1
- QSRIABDFMFXWHM-HWZXHQHMSA-N (6r)-7-amino-8-oxo-3-[(2,2,2-trichloroacetyl)carbamoyloxymethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)NC(=O)C(Cl)(Cl)Cl)=C(C(O)=O)N2C(=O)C(N)[C@H]21 QSRIABDFMFXWHM-HWZXHQHMSA-N 0.000 description 1
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 description 1
- FZENGILVLUJGJX-NSCUHMNNSA-N (E)-acetaldehyde oxime Chemical compound C\C=N\O FZENGILVLUJGJX-NSCUHMNNSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- 125000004521 1,3,4-thiadiazol-2-yl group Chemical group S1C(=NN=C1)* 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- GMTSPBYBJKGPJF-UHFFFAOYSA-N 1-(3-chloro-4-hydroxyphenyl)ethanone Chemical compound CC(=O)C1=CC=C(O)C(Cl)=C1 GMTSPBYBJKGPJF-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- ABXGMGUHGLQMAW-UHFFFAOYSA-N 1-[3-(trifluoromethyl)phenyl]ethanone Chemical compound CC(=O)C1=CC=CC(C(F)(F)F)=C1 ABXGMGUHGLQMAW-UHFFFAOYSA-N 0.000 description 1
- SNUSZUYTMHKCPM-UHFFFAOYSA-N 1-hydroxypyridin-2-one Chemical compound ON1C=CC=CC1=O SNUSZUYTMHKCPM-UHFFFAOYSA-N 0.000 description 1
- XOHZHMUQBFJTNH-UHFFFAOYSA-N 1-methyl-2h-tetrazole-5-thione Chemical compound CN1N=NN=C1S XOHZHMUQBFJTNH-UHFFFAOYSA-N 0.000 description 1
- OMAFFHIGWTVZOH-UHFFFAOYSA-N 1-methyltetrazole Chemical compound CN1C=NN=N1 OMAFFHIGWTVZOH-UHFFFAOYSA-N 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- LNQHZQQSVFBJEF-XCWJXAQQSA-N 2,2-dimethylpropanoyloxymethyl (6R)-7-[[2-hydroxyimino-2-(3-hydroxyphenyl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)C)C(=O)OCOC(C(C)(C)C)=O)C1=O)C1=CC(=CC=C1)O LNQHZQQSVFBJEF-XCWJXAQQSA-N 0.000 description 1
- LZOMVUKEFVQHEK-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-(2-methoxyphenyl)acetic acid Chemical compound ClC(C(=O)ON=C(C(=O)O)C1=C(C=CC=C1)OC)Cl LZOMVUKEFVQHEK-UHFFFAOYSA-N 0.000 description 1
- KWKNEXCHGJFOOP-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-(3-methoxyphenyl)acetic acid Chemical compound ClC(C(=O)ON=C(C(=O)O)C1=CC(=CC=C1)OC)Cl KWKNEXCHGJFOOP-UHFFFAOYSA-N 0.000 description 1
- YAXOKAWRCKNXDQ-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-(3-methylphenyl)acetic acid Chemical compound ClC(C(=O)ON=C(C(=O)O)C=1C=C(C=CC=1)C)Cl YAXOKAWRCKNXDQ-UHFFFAOYSA-N 0.000 description 1
- GFDWQHGHXMNCER-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-(3-sulfamoylphenyl)acetic acid Chemical compound ClC(C(=O)ON=C(C(=O)O)C1=CC(=CC=C1)S(N)(=O)=O)Cl GFDWQHGHXMNCER-UHFFFAOYSA-N 0.000 description 1
- VNRMUMAGPAXDQZ-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-(4-hydroxy-3-methoxyphenyl)acetic acid Chemical compound COC1=CC(C(=NOC(=O)C(Cl)Cl)C(O)=O)=CC=C1O VNRMUMAGPAXDQZ-UHFFFAOYSA-N 0.000 description 1
- FVWOHZBMEMBGON-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-(4-hydroxy-3-nitrophenyl)acetic acid Chemical compound ClC(Cl)C(=O)ON=C(C(=O)O)C1=CC=C(O)C([N+]([O-])=O)=C1 FVWOHZBMEMBGON-UHFFFAOYSA-N 0.000 description 1
- FTZIIZXNUCHEMY-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-(4-methoxyphenyl)acetic acid Chemical compound ClC(C(=O)ON=C(C(=O)O)C1=CC=C(C=C1)OC)Cl FTZIIZXNUCHEMY-UHFFFAOYSA-N 0.000 description 1
- GPLDXMYJJHWWNZ-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-(4-methylphenyl)acetic acid Chemical compound ClC(C(=O)ON=C(C(=O)O)C1=CC=C(C=C1)C)Cl GPLDXMYJJHWWNZ-UHFFFAOYSA-N 0.000 description 1
- CIYXBPYTRNIRMN-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-(4-phenylmethoxyphenyl)acetic acid Chemical compound C1=CC(C(=NOC(=O)C(Cl)Cl)C(=O)O)=CC=C1OCC1=CC=CC=C1 CIYXBPYTRNIRMN-UHFFFAOYSA-N 0.000 description 1
- KMPVUUIJJHBKKO-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-(4-propan-2-ylphenyl)acetic acid Chemical compound ClC(C(=O)ON=C(C(=O)O)C1=CC=C(C=C1)C(C)C)Cl KMPVUUIJJHBKKO-UHFFFAOYSA-N 0.000 description 1
- IKDLAZVCHUZNSK-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-[3-(methanesulfonamido)phenyl]acetic acid Chemical compound ClC(C(=O)ON=C(C(=O)O)C1=CC(=CC=C1)NS(=O)(=O)C)Cl IKDLAZVCHUZNSK-UHFFFAOYSA-N 0.000 description 1
- JAMLILHZUNFSSW-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-[3-(trifluoromethyl)phenyl]acetic acid Chemical compound ClC(C(=O)ON=C(C(=O)O)C1=CC(=CC=C1)C(F)(F)F)Cl JAMLILHZUNFSSW-UHFFFAOYSA-N 0.000 description 1
- FTQGIKNITXCBAV-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-2-[4-hydroxy-3-(methanesulfonamido)phenyl]acetic acid Chemical compound CS(=O)(=O)NC1=CC(C(=NOC(=O)C(Cl)Cl)C(O)=O)=CC=C1O FTQGIKNITXCBAV-UHFFFAOYSA-N 0.000 description 1
- LDNMLJKWVYGITM-UHFFFAOYSA-N 2-(2,2-dichloroacetyl)oxyimino-3-phenylpropanoic acid Chemical compound ClC(C(=O)ON=C(C(=O)O)CC1=CC=CC=C1)Cl LDNMLJKWVYGITM-UHFFFAOYSA-N 0.000 description 1
- KCAQYACZOPLTNA-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-2-(2,2-dichloroacetyl)oxyiminoacetic acid Chemical compound ClC(Cl)C(=O)ON=C(C(=O)O)C1=CC=C(O)C(Cl)=C1 KCAQYACZOPLTNA-UHFFFAOYSA-N 0.000 description 1
- HGZZXAIQRPGHLO-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-2-oxoacetic acid Chemical compound OC(=O)C(=O)C1=CC=C(O)C(Cl)=C1 HGZZXAIQRPGHLO-UHFFFAOYSA-N 0.000 description 1
- MSKLUHOSYJHLTI-UHFFFAOYSA-N 2-(3-chloro-4-phenylmethoxyphenyl)-2-oxoacetic acid Chemical compound ClC1=CC(C(=O)C(=O)O)=CC=C1OCC1=CC=CC=C1 MSKLUHOSYJHLTI-UHFFFAOYSA-N 0.000 description 1
- CGXXIWFTHWCOPO-UHFFFAOYSA-N 2-(3-methoxyphenyl)-2-oxoacetic acid Chemical compound COC1=CC=CC(C(=O)C(O)=O)=C1 CGXXIWFTHWCOPO-UHFFFAOYSA-N 0.000 description 1
- GZXVAVNQNKCFFN-UHFFFAOYSA-N 2-(3-methylphenyl)-2-oxoacetic acid Chemical compound CC1=CC=CC(C(=O)C(O)=O)=C1 GZXVAVNQNKCFFN-UHFFFAOYSA-N 0.000 description 1
- WGAHPPCMFJHWPP-UHFFFAOYSA-N 2-(4-hydroxy-3-nitrophenyl)-2-oxoacetic acid Chemical compound OC(=O)C(=O)C1=CC=C(O)C([N+]([O-])=O)=C1 WGAHPPCMFJHWPP-UHFFFAOYSA-N 0.000 description 1
- UIIIPQVTXBPHTI-UHFFFAOYSA-N 2-(4-methylphenyl)-2-oxoacetic acid Chemical compound CC1=CC=C(C(=O)C(O)=O)C=C1 UIIIPQVTXBPHTI-UHFFFAOYSA-N 0.000 description 1
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- PWURXZPHZHSYPJ-UHFFFAOYSA-N 2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]-2-oxoacetic acid Chemical compound CS(=O)(=O)NC1=CC(C(=O)C(O)=O)=CC=C1OCC1=CC=CC=C1 PWURXZPHZHSYPJ-UHFFFAOYSA-N 0.000 description 1
- VVNFXLVZTCJWKX-UHFFFAOYSA-N 2-[4-hydroxy-3-(methanesulfonamido)phenyl]-2-oxoacetic acid Chemical compound CS(=O)(=O)NC1=CC(C(=O)C(O)=O)=CC=C1O VVNFXLVZTCJWKX-UHFFFAOYSA-N 0.000 description 1
- DWQONSPEUHUORD-UHFFFAOYSA-N 2-benzoyloxyimino-2-(3-hydroxyphenyl)acetic acid Chemical compound C=1C=CC(O)=CC=1C(C(=O)O)=NOC(=O)C1=CC=CC=C1 DWQONSPEUHUORD-UHFFFAOYSA-N 0.000 description 1
- PVMJVPDVPWEXTM-UHFFFAOYSA-N 2-benzoyloxyimino-2-(4-hydroxyphenyl)acetic acid Chemical compound C=1C=C(O)C=CC=1C(C(=O)O)=NOC(=O)C1=CC=CC=C1 PVMJVPDVPWEXTM-UHFFFAOYSA-N 0.000 description 1
- FPYUJUBAXZAQNL-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O FPYUJUBAXZAQNL-UHFFFAOYSA-N 0.000 description 1
- NTCCNERMXRIPTR-UHFFFAOYSA-N 2-hydroxy-1-naphthaldehyde Chemical compound C1=CC=CC2=C(C=O)C(O)=CC=C21 NTCCNERMXRIPTR-UHFFFAOYSA-N 0.000 description 1
- SSWCBBFARUNCCR-UHFFFAOYSA-N 2-hydroxyimino-2-(4-methoxyphenyl)acetic acid Chemical compound ON=C(C(=O)O)C1=CC=C(C=C1)OC SSWCBBFARUNCCR-UHFFFAOYSA-N 0.000 description 1
- MTWMOXVOZINGCS-UHFFFAOYSA-N 2-hydroxyimino-2-(4-methylsulfanylphenyl)acetic acid Chemical compound ON=C(C(=O)O)C1=CC=C(C=C1)SC MTWMOXVOZINGCS-UHFFFAOYSA-N 0.000 description 1
- CJKPOFMKEAGKCQ-UHFFFAOYSA-N 2-hydroxyimino-2-(4-phenylmethoxyphenyl)acetic acid Chemical compound ON=C(C(=O)O)C1=CC=C(C=C1)OCC1=CC=CC=C1 CJKPOFMKEAGKCQ-UHFFFAOYSA-N 0.000 description 1
- PQKZTNVNVKANRC-UHFFFAOYSA-N 2-hydroxyimino-2-(4-propan-2-ylphenyl)acetic acid Chemical compound ON=C(C(=O)O)C1=CC=C(C=C1)C(C)C PQKZTNVNVKANRC-UHFFFAOYSA-N 0.000 description 1
- CLYYOVUTTDQWED-UHFFFAOYSA-N 2-hydroxyimino-2-(4-propoxyphenyl)acetic acid Chemical compound ON=C(C(=O)O)C1=CC=C(C=C1)OCCC CLYYOVUTTDQWED-UHFFFAOYSA-N 0.000 description 1
- IFIZGBTXHKTYDM-UHFFFAOYSA-N 2-hydroxyimino-2-[3-(methanesulfonamido)phenyl]acetic acid Chemical compound ON=C(C(=O)O)C1=CC(=CC=C1)NS(=O)(=O)C IFIZGBTXHKTYDM-UHFFFAOYSA-N 0.000 description 1
- UFVAOSVIVZFWFN-UHFFFAOYSA-N 2-hydroxyimino-2-[3-(trifluoromethyl)phenyl]acetic acid Chemical compound ON=C(C(O)=O)C1=CC=CC(C(F)(F)F)=C1 UFVAOSVIVZFWFN-UHFFFAOYSA-N 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 1
- IQCFXSPOUDTJGL-UHFFFAOYSA-N 2-oxo-2-(3-sulfamoylphenyl)acetic acid Chemical compound S(N)(=O)(=O)C=1C=C(C=CC=1)C(C(=O)O)=O IQCFXSPOUDTJGL-UHFFFAOYSA-N 0.000 description 1
- KMHQQYBBGOYOIF-UHFFFAOYSA-N 2-oxo-2-(4-propan-2-ylphenyl)acetic acid Chemical compound CC(C)C1=CC=C(C(=O)C(O)=O)C=C1 KMHQQYBBGOYOIF-UHFFFAOYSA-N 0.000 description 1
- JNFOOEYPNCGZRV-UHFFFAOYSA-N 2-oxo-2-(4-propoxyphenyl)acetic acid Chemical compound CCCOC1=CC=C(C(=O)C(O)=O)C=C1 JNFOOEYPNCGZRV-UHFFFAOYSA-N 0.000 description 1
- APJFBBHXNCTOGI-UHFFFAOYSA-N 2-oxo-2-[3-(trifluoromethyl)phenyl]acetic acid Chemical compound OC(=O)C(=O)C1=CC=CC(C(F)(F)F)=C1 APJFBBHXNCTOGI-UHFFFAOYSA-N 0.000 description 1
- AJYXPNIENRLELY-UHFFFAOYSA-N 2-thiophen-2-ylacetyl chloride Chemical compound ClC(=O)CC1=CC=CS1 AJYXPNIENRLELY-UHFFFAOYSA-N 0.000 description 1
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 1
- LEGPZHPSIPPYIO-UHFFFAOYSA-N 3-Methoxyphenylacetic acid Chemical compound COC1=CC=CC(CC(O)=O)=C1 LEGPZHPSIPPYIO-UHFFFAOYSA-N 0.000 description 1
- IGIJSFNBEUBMGB-UHFFFAOYSA-N 4-(cyclohexyliminomethylideneamino)-n,n-diethylcyclohexan-1-amine Chemical compound C1CC(N(CC)CC)CCC1N=C=NC1CCCCC1 IGIJSFNBEUBMGB-UHFFFAOYSA-N 0.000 description 1
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 1
- TZCYLJGNWDVJRA-UHFFFAOYSA-N 6-chloro-1-hydroxybenzotriazole Chemical compound C1=C(Cl)C=C2N(O)N=NC2=C1 TZCYLJGNWDVJRA-UHFFFAOYSA-N 0.000 description 1
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- XMOONTKUPUZKFM-UHFFFAOYSA-N C1=CC(=CC(=C1)NS(=O)(=O)C=N)C(C(=O)O)OC(=O)C(Cl)Cl Chemical compound C1=CC(=CC(=C1)NS(=O)(=O)C=N)C(C(=O)O)OC(=O)C(Cl)Cl XMOONTKUPUZKFM-UHFFFAOYSA-N 0.000 description 1
- YVYIIUZRLDPELN-ZRKZCGFPSA-N C1[C@@H]2N(C1=O)C(=C(C(S2)NC(=O)C(=NO)C3=CC(=C(C=C3)O)Cl)COC(=O)N)C(=O)O Chemical compound C1[C@@H]2N(C1=O)C(=C(C(S2)NC(=O)C(=NO)C3=CC(=C(C=C3)O)Cl)COC(=O)N)C(=O)O YVYIIUZRLDPELN-ZRKZCGFPSA-N 0.000 description 1
- POYBAEOOCLHALV-UUXVJNKCSA-N CC1C=C(N2[C@H](S1)C(C2=O)NC(=O)C(=NO)C3=CC(=CC=C3)O)C(=O)O Chemical compound CC1C=C(N2[C@H](S1)C(C2=O)NC(=O)C(=NO)C3=CC(=CC=C3)O)C(=O)O POYBAEOOCLHALV-UUXVJNKCSA-N 0.000 description 1
- DHWJMEUXGLCULZ-UHFFFAOYSA-N CCCOC1=CC=CC=C1C(=NOC(=O)C(Cl)Cl)C(=O)O Chemical compound CCCOC1=CC=CC=C1C(=NOC(=O)C(Cl)Cl)C(=O)O DHWJMEUXGLCULZ-UHFFFAOYSA-N 0.000 description 1
- ZUWVTLVMLIVAAI-UHFFFAOYSA-N COC1=CC(C(=NO)C(O)=O)=CC=C1O Chemical compound COC1=CC(C(=NO)C(O)=O)=CC=C1O ZUWVTLVMLIVAAI-UHFFFAOYSA-N 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- NGAXQLMYGAGZAX-WVQRXBFSSA-N ClC(C(=O)ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(NC(C(Cl)(Cl)Cl)=O)=O)C(=O)O)C1=O)C1=CC(=CC=C1)O)Cl Chemical compound ClC(C(=O)ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(NC(C(Cl)(Cl)Cl)=O)=O)C(=O)O)C1=O)C1=CC(=CC=C1)O)Cl NGAXQLMYGAGZAX-WVQRXBFSSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- MBHWVNRVDPINFX-NEIGUCDHSA-M ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(N)=O)C(=O)[O-])C1=O)C1=CC(=CC=C1)O.[Na+] Chemical compound ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(N)=O)C(=O)[O-])C1=O)C1=CC(=CC=C1)O.[Na+] MBHWVNRVDPINFX-NEIGUCDHSA-M 0.000 description 1
- OFFJPZUUCPNHSX-UHFFFAOYSA-N ON=C(C(O)=O)C1=CC=C(O)C(Cl)=C1 Chemical compound ON=C(C(O)=O)C1=CC=C(O)C(Cl)=C1 OFFJPZUUCPNHSX-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-N acetoacetic acid Chemical compound CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-N anhydrous cyanic acid Natural products OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003433 contraceptive agent Substances 0.000 description 1
- 230000002254 contraceptive effect Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- CNUDBTRUORMMPA-UHFFFAOYSA-N formylthiophene Chemical compound O=CC1=CC=CS1 CNUDBTRUORMMPA-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 210000002837 heart atrium Anatomy 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- NZDJTVSTIFYISQ-UHFFFAOYSA-N iodomethyl acetate Chemical compound CC(=O)OCI NZDJTVSTIFYISQ-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- XOXVAVXJAXUAFD-UHFFFAOYSA-N n,n-dimethylformamide;zinc Chemical compound [Zn].CN(C)C=O XOXVAVXJAXUAFD-UHFFFAOYSA-N 0.000 description 1
- JVHPKYBRJQNPAT-UHFFFAOYSA-N n-cyclohexyl-2,2-diphenylethenimine Chemical compound C1CCCCC1N=C=C(C=1C=CC=CC=1)C1=CC=CC=C1 JVHPKYBRJQNPAT-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- PNTMGOUAICFJQK-UHFFFAOYSA-N phenyl pyruvic acid oxime Natural products ON=C(C(O)=O)CC1=CC=CC=C1 PNTMGOUAICFJQK-UHFFFAOYSA-N 0.000 description 1
- 229940117953 phenylisothiocyanate Drugs 0.000 description 1
- PNTMGOUAICFJQK-NTMALXAHSA-N phenylpyruvic acid oxime Chemical compound O\N=C(C(O)=O)\CC1=CC=CC=C1 PNTMGOUAICFJQK-NTMALXAHSA-N 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000001974 tryptic soy broth Substances 0.000 description 1
- 108010050327 trypticase-soy broth Proteins 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/56—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups bound to carbon atoms of six-membered aromatic rings and carboxyl groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/84—Unsaturated compounds containing keto groups containing six membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/88—Unsaturated compounds containing keto groups containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/90—Unsaturated compounds containing keto groups containing singly bound oxygen-containing groups
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP50015191A JPS5191284A (en) | 1975-02-04 | 1975-02-04 | 77 chikanarukanamido 33 chikan 33 sefuemu 44 karubonsanruioseizosuruhoho |
| JP1519175 | 1975-02-04 | ||
| JP3764775 | 1975-03-27 | ||
| JP50037647A JPS51113891A (en) | 1975-03-27 | 1975-03-27 | Method for preparing 7-substituted alkaneamido-3-substituted thiomethy l-3-cephem-4-carboxylic acids |
| JP4883375 | 1975-04-21 | ||
| JP50048833A JPS51125398A (en) | 1975-04-21 | 1975-04-21 | A process for preparing 7-substituted alkanamide-3-substituted thiomet hyl-3-cephem-4-carboxylic acids |
| JP7829475 | 1975-06-23 | ||
| JP50078294A JPS523092A (en) | 1975-06-23 | 1975-06-23 | Preparation of 7-substituted alkanamido-3-substituted thiomethyl-3-cep hem-4- carboxylic acids |
| JP50083867A JPS527988A (en) | 1975-07-07 | 1975-07-07 | Process for preparing 7-substituted acetamide-3-alkanoyloxymethyl-3-ce phem- 4-carboxylic acids |
| JP8386775 | 1975-07-07 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI760256A7 FI760256A7 (sr) | 1976-08-05 |
| FI66005B FI66005B (fi) | 1984-04-30 |
| FI66005C true FI66005C (fi) | 1984-08-10 |
Family
ID=27519683
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI760256A FI66005C (fi) | 1975-02-04 | 1976-02-03 | Foerfarande foer framstaellning av antibakteriellt verkande 7-alfa alfa-disubstituerad-acetamido)-3-substituerad-3-cefe m--karboxylsyras syn-isomer |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4143166A (sr) |
| AR (2) | AR218616A1 (sr) |
| AU (1) | AU506584B2 (sr) |
| CA (1) | CA1086717A (sr) |
| CH (1) | CH631716A5 (sr) |
| DE (1) | DE2604207A1 (sr) |
| DK (1) | DK43476A (sr) |
| FI (1) | FI66005C (sr) |
| FR (1) | FR2299869A1 (sr) |
| GB (1) | GB1533491A (sr) |
| GR (1) | GR60360B (sr) |
| IE (1) | IE43346B1 (sr) |
| MX (1) | MX4483E (sr) |
| NL (1) | NL7601121A (sr) |
| NO (1) | NO760358L (sr) |
| NZ (1) | NZ179914A (sr) |
| OA (1) | OA05233A (sr) |
| PH (1) | PH15487A (sr) |
| PT (1) | PT64773B (sr) |
| SE (1) | SE432254B (sr) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK162391C (da) * | 1976-04-12 | 1992-03-09 | Fujisawa Pharmaceutical Co | Analogifremgangsmaade til fremstilling af syn-isomerer af 3,7-disubstituerede 3-cephem-4-carboxylsyreforbindelser |
| DK225179A (da) * | 1978-06-22 | 1979-12-23 | Chugai Pharmaceutical Co Ltd | Fremgangsmaade til fremstilling af cephalosporinderivater |
| EP0013768B1 (en) | 1979-01-12 | 1984-02-01 | Sandoz Ag | New pleuromutilin derivatives, their production and pharmaceutical compositions containing them |
| NZ198350A (en) * | 1980-09-25 | 1985-02-28 | Toyama Chemical Co Ltd | Cephalosporins and intermediates;pharmaceutical compositions |
| DE19719054A1 (de) * | 1997-05-06 | 1998-11-12 | Bayer Ag | Verfahren zur Herstellung von Acetophenonen, die am aromatischen Kern mit Fluoralkyl substituiert sind |
| US6211413B1 (en) | 1998-01-13 | 2001-04-03 | Bayer Aktiengesellschaft | Process for the preparation of phenyl alkyl ketones and benzaldehydes |
| EP1617835B1 (en) * | 2003-04-30 | 2011-09-28 | Wellstat Therapeutics Corporation | Compounds for the treatment of metabolic disorders |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3641021A (en) * | 1969-04-18 | 1972-02-08 | Lilly Co Eli | 3 7-(ring-substituted) cephalosporin compounds |
| US3867380A (en) * | 1971-02-18 | 1975-02-18 | Smithkline Corp | 3-Heterocyclic thiomethylcephalosporins |
| US4024134A (en) * | 1971-01-29 | 1977-05-17 | Glaxo Laboratories Limited | Syn isomers of cephalosporins having α-hydroximino- or α-acyloxyiminoacylamido groups at position-7 |
| GB1389194A (en) * | 1971-01-29 | 1975-04-03 | Glaxo Lab Ltd | Antibiotics |
| IE36041B1 (en) * | 1971-01-29 | 1976-08-04 | Glaxo Lab Ltd | Improvements in or relating to antibiotics |
| GB1399086A (en) * | 1971-05-14 | 1975-06-25 | Glaxo Lab Ltd | Cephalosporin compounds |
| US3947413A (en) * | 1972-11-13 | 1976-03-30 | Merck & Co., Inc. | 3-α-Substituted cephalosporins |
| GB1496757A (en) * | 1973-12-21 | 1978-01-05 | Glaxo Lab Ltd | Cephalosporin derivatives |
| GB1476981A (en) * | 1974-06-05 | 1977-06-16 | Bristol Myers Co | Substituted penicillanic acids |
| US4083975A (en) * | 1976-09-24 | 1978-04-11 | Smithkline Corporation | 7-Acylamino-3-(3-sulfomethyl-1,2,4-triazol-5-ylthiomethyl)-3-cephem-4-carboxylic acids |
-
1976
- 1976-02-03 PH PH18042A patent/PH15487A/en unknown
- 1976-02-03 NO NO760358A patent/NO760358L/no unknown
- 1976-02-03 DK DK43476*#A patent/DK43476A/da not_active Application Discontinuation
- 1976-02-03 OA OA55727A patent/OA05233A/xx unknown
- 1976-02-03 SE SE7601151A patent/SE432254B/xx unknown
- 1976-02-03 FI FI760256A patent/FI66005C/fi not_active IP Right Cessation
- 1976-02-03 US US05/654,804 patent/US4143166A/en not_active Expired - Lifetime
- 1976-02-04 IE IE224/76A patent/IE43346B1/en unknown
- 1976-02-04 MX MX761647U patent/MX4483E/es unknown
- 1976-02-04 GB GB4466/76A patent/GB1533491A/en not_active Expired
- 1976-02-04 NL NL7601121A patent/NL7601121A/xx not_active Application Discontinuation
- 1976-02-04 PT PT64773A patent/PT64773B/pt unknown
- 1976-02-04 NZ NZ179914A patent/NZ179914A/xx unknown
- 1976-02-04 CH CH136276A patent/CH631716A5/de not_active IP Right Cessation
- 1976-02-04 FR FR7603117A patent/FR2299869A1/fr active Granted
- 1976-02-04 AU AU10824/76A patent/AU506584B2/en not_active Expired
- 1976-02-04 GR GR49956A patent/GR60360B/el unknown
- 1976-02-04 CA CA245,155A patent/CA1086717A/en not_active Expired
- 1976-02-04 DE DE2604207A patent/DE2604207A1/de not_active Withdrawn
- 1976-10-18 AR AR265134A patent/AR218616A1/es active
-
1979
- 1979-01-01 AR AR21497279A patent/AR214972A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| CH631716A5 (de) | 1982-08-31 |
| NZ179914A (en) | 1978-03-06 |
| MX4483E (es) | 1982-05-21 |
| GR60360B (en) | 1978-05-19 |
| PH15487A (en) | 1983-01-31 |
| IE43346L (en) | 1976-08-04 |
| PT64773A (en) | 1976-03-01 |
| NL7601121A (nl) | 1976-08-06 |
| FI66005B (fi) | 1984-04-30 |
| DK43476A (da) | 1976-08-05 |
| GB1533491A (en) | 1978-11-29 |
| OA05233A (fr) | 1981-02-28 |
| AR218616A1 (es) | 1980-06-30 |
| US4143166A (en) | 1979-03-06 |
| CA1086717A (en) | 1980-09-30 |
| AR214972A1 (es) | 1979-08-31 |
| FR2299869A1 (fr) | 1976-09-03 |
| PT64773B (en) | 1977-07-06 |
| NO760358L (sr) | 1976-08-05 |
| FI760256A7 (sr) | 1976-08-05 |
| AU506584B2 (en) | 1980-01-10 |
| IE43346B1 (en) | 1981-02-11 |
| SE432254B (sv) | 1984-03-26 |
| AU1082476A (en) | 1977-08-11 |
| FR2299869B1 (sr) | 1978-11-10 |
| DE2604207A1 (de) | 1976-08-05 |
| SE7601151L (sv) | 1976-08-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI73440B (fi) | Foerfarande foer framstaellning av som laekemedel anvaendbara alkyl-(eller alkoxi-)karbonyloxialkyl-7-/2- (aminotiazol-4-yl)-2-metoxi-(eller etoxi-)iminoacetamido/- 3-metoxi-metyl-3-cefem-4-karboxylat. | |
| FI66618C (fi) | Foerfarande foer framstaellning av terapeutiskt verkande 7-(2-(2-aminotiazol-4-yl)-2-(syn)-metoxi-iminoacetamido-cefalosporinderivat | |
| US4264595A (en) | 7-[2-(2-Imino-4-thiazolin-4-yl)-2-(syn)-hydroxy-iminoacetamido]-cephalosporins | |
| FI67705C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara (6,7r)-7-((z)-2-(2-aminotiazol-4-yl)-2-(substituerad oxiimi noacetamido)-(eventuellt substituerat pyridiniummetyl)cef-3 -e-4-karboxylatfoereningar | |
| US4486586A (en) | Cephalosporin derivatives | |
| HU177441B (en) | Process for preparing syn isomers of 3,7-disubstituted 3-cephem-4-carboxylic acid derivatives | |
| EP1221446B1 (en) | Antibacterial cephalosporins | |
| US4012382A (en) | α-Amino and α-formyl-α-(p-acyloxyphenyl)acetamidocephalosporanic acid derivatives | |
| FI66007B (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara cefalosporinderivat | |
| FI66005C (fi) | Foerfarande foer framstaellning av antibakteriellt verkande 7-alfa alfa-disubstituerad-acetamido)-3-substituerad-3-cefe m--karboxylsyras syn-isomer | |
| US4172892A (en) | Heteromonocyclic and heterobicyclic derivatives of unsaturated 7-acylamido-3-cephem-4-carboxylic acid | |
| HU193750B (en) | Process for preparing 7-/2-(5-amino-1,2,4-thiadiazol-3-yl)-2-imino-acetamido/-3-/3-(quaternary-ammonio)-1-propen-1-yl/-ceph-3-em-4-carboxylates and pharmaceutics comprising such active substances | |
| HU192449B (en) | New process for producing cepheme-carboxylic acid derivatives | |
| US4331666A (en) | 3-[(8-Carboxy-6-tetrazolo[1,5-b]pyridazinyl)-thiomethyl]-7-[2-(2-amino-4-thiazolyl)-2-methoxyimino-acetamido]-3-cephem-4-carboxylic acid | |
| FI74020C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 7- -/ -syn-metoxiimino- -(2-aminotiazol-4-yl) acetamido/-3-/(1,2,3-tiadiazol-5-yltio)metyl/-3-cefem-4-karboxylsyraderivat | |
| US5292733A (en) | Cephalosporin compounds | |
| EP0238061B1 (en) | Cephalosporin derivatives, processes for their preparation and antibacterial agents | |
| US4439433A (en) | Oximes | |
| US5084453A (en) | 1-carboxy-1-vinyloxyimino aminothiazole cephalosporin derivatives | |
| EP0048954B1 (en) | Beta-lactam compounds, process for the preparation thereof and intermediate products for the preparation thereof | |
| JPS628436B2 (sr) | ||
| US4791197A (en) | Cephalosporin compounds | |
| US4497811A (en) | 1-Oxadethiacephalosporin compound and antibacterial agent containing the _same | |
| WO1998058933A1 (en) | Cephalosporin compounds, use thereof and intermediate compounds of the same | |
| KR840000407B1 (ko) | 세팔로스포린의 제조방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: FUJISAWA PHARMACEUTICAL CO., LTD |