FI62285C - Foerfarande foer framstaellning av nya terapeutiskt anvaendbara bensocykloalkylen-1-karboxiamidoximderivat - Google Patents
Foerfarande foer framstaellning av nya terapeutiskt anvaendbara bensocykloalkylen-1-karboxiamidoximderivat Download PDFInfo
- Publication number
- FI62285C FI62285C FI2306/74A FI230674A FI62285C FI 62285 C FI62285 C FI 62285C FI 2306/74 A FI2306/74 A FI 2306/74A FI 230674 A FI230674 A FI 230674A FI 62285 C FI62285 C FI 62285C
- Authority
- FI
- Finland
- Prior art keywords
- alkyl
- formula
- phenyl
- hydroxylamine
- acid addition
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 10
- 230000001225 therapeutic effect Effects 0.000 title 2
- 150000001875 compounds Chemical class 0.000 claims description 40
- 125000000217 alkyl group Chemical group 0.000 claims description 27
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 25
- 150000003839 salts Chemical class 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 23
- -1 carbon atoms carboxylic acid Chemical class 0.000 claims description 23
- 239000001257 hydrogen Substances 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 125000002252 acyl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 5
- 229910052717 sulfur Chemical group 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 4
- 229910021529 ammonia Inorganic materials 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 150000002443 hydroxylamines Chemical class 0.000 claims description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 3
- 150000001408 amides Chemical class 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 150000002825 nitriles Chemical class 0.000 claims description 3
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 3
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 2
- 239000005977 Ethylene Substances 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims 2
- 229910002651 NO3 Inorganic materials 0.000 claims 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 125000000962 organic group Chemical group 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 76
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 44
- 239000000243 solution Substances 0.000 description 43
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 36
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 28
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- 239000000203 mixture Substances 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 238000001704 evaporation Methods 0.000 description 11
- 239000002244 precipitate Substances 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- 229910004298 SiO 2 Inorganic materials 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- UIUXCCMQXONJNW-UHFFFAOYSA-N n'-hydroxybicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboximidamide Chemical compound C1=CC=C2C(C(=NO)N)=CC2=C1 UIUXCCMQXONJNW-UHFFFAOYSA-N 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- UFEJKYYYVXYMMS-UHFFFAOYSA-N methylcarbamic acid Chemical compound CNC(O)=O UFEJKYYYVXYMMS-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 230000008020 evaporation Effects 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- XLJMAIOERFSOGZ-UHFFFAOYSA-N cyanic acid Chemical compound OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 6
- 239000012458 free base Substances 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 230000003276 anti-hypertensive effect Effects 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- 241000233866 Fungi Species 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 4
- 150000002431 hydrogen Chemical group 0.000 description 4
- YGJNLDZJNDNWEW-UHFFFAOYSA-N n-hydroxy-n'-methylbicyclo[4.2.0]octa-1(8),2,4,6-tetraene-7-carboximidamide;hydrochloride Chemical compound Cl.C1=CC=C2C(C(=NO)NC)=CC2=C1 YGJNLDZJNDNWEW-UHFFFAOYSA-N 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- 108090000190 Thrombin Proteins 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000009825 accumulation Methods 0.000 description 3
- QCSDFLWFDHCEOJ-UHFFFAOYSA-N bicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carbaldehyde Chemical compound C1=CC=C2C(C=O)=CC2=C1 QCSDFLWFDHCEOJ-UHFFFAOYSA-N 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 3
- SFZULDYEOVSIKM-UHFFFAOYSA-N chembl321317 Chemical compound C1=CC(C(=N)NO)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=N)NO)O1 SFZULDYEOVSIKM-UHFFFAOYSA-N 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000006482 condensation reaction Methods 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 239000012948 isocyanate Substances 0.000 description 3
- 210000004623 platelet-rich plasma Anatomy 0.000 description 3
- 238000003419 tautomerization reaction Methods 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- MUEXQGUXCJGOGC-UHFFFAOYSA-N 3,5-dimethylbicyclo[4.2.0]octa-1,3,5-triene-7-carbonitrile Chemical compound CC1=CC(C)=CC2=C1C(C#N)C2 MUEXQGUXCJGOGC-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Natural products OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- QJFJSLSRUBPSQY-UHFFFAOYSA-N C1=CC=CC2=CC(CC(N)=NO)=C21 Chemical compound C1=CC=CC2=CC(CC(N)=NO)=C21 QJFJSLSRUBPSQY-UHFFFAOYSA-N 0.000 description 2
- 102000008186 Collagen Human genes 0.000 description 2
- 108010035532 Collagen Proteins 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 230000002785 anti-thrombosis Effects 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- HZTDUTYUVZYCSB-UHFFFAOYSA-N bicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carbonitrile Chemical compound C1=CC=C2C(C#N)=CC2=C1 HZTDUTYUVZYCSB-UHFFFAOYSA-N 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 229920001436 collagen Polymers 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- DZGCGKFAPXFTNM-UHFFFAOYSA-N ethanol;hydron;chloride Chemical compound Cl.CCO DZGCGKFAPXFTNM-UHFFFAOYSA-N 0.000 description 2
- 239000002035 hexane extract Substances 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- QULVMMAUXWYTRJ-UHFFFAOYSA-N n'-hydroxy-3,5-dimethylbicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboximidamide Chemical compound CC1=CC(C)=CC2=C1C(C(N)=NO)=C2 QULVMMAUXWYTRJ-UHFFFAOYSA-N 0.000 description 2
- CPQCSJYYDADLCZ-UHFFFAOYSA-N n-methylhydroxylamine Chemical compound CNO CPQCSJYYDADLCZ-UHFFFAOYSA-N 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 229960004072 thrombin Drugs 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- JAUFWTSSYRTLLB-UHFFFAOYSA-N (2-phenylacetyl) 2-phenylacetate Chemical compound C=1C=CC=CC=1CC(=O)OC(=O)CC1=CC=CC=C1 JAUFWTSSYRTLLB-UHFFFAOYSA-N 0.000 description 1
- FZENGILVLUJGJX-NSCUHMNNSA-N (E)-acetaldehyde oxime Chemical compound C\C=N\O FZENGILVLUJGJX-NSCUHMNNSA-N 0.000 description 1
- IWYDHOAUDWTVEP-SSDOTTSWSA-N (R)-mandelic acid Chemical compound OC(=O)[C@H](O)C1=CC=CC=C1 IWYDHOAUDWTVEP-SSDOTTSWSA-N 0.000 description 1
- HMRIXHRQNXHLSL-UHFFFAOYSA-N 1,2,3,4-tetrahydronaphthalene-1-carbonitrile Chemical compound C1=CC=C2C(C#N)CCCC2=C1 HMRIXHRQNXHLSL-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DGJZYHXYYAMVNB-UHFFFAOYSA-N 1-chloro-3,3-dimethyl-1,2-dihydroindene Chemical compound C1=CC=C2C(C)(C)CC(Cl)C2=C1 DGJZYHXYYAMVNB-UHFFFAOYSA-N 0.000 description 1
- QXQAPNSHUJORMC-UHFFFAOYSA-N 1-chloro-4-propylbenzene Chemical compound CCCC1=CC=C(Cl)C=C1 QXQAPNSHUJORMC-UHFFFAOYSA-N 0.000 description 1
- CAFXXESJSIBJBZ-UHFFFAOYSA-N 2,3-dihydro-1h-indene-1-carbonitrile Chemical compound C1=CC=C2C(C#N)CCC2=C1 CAFXXESJSIBJBZ-UHFFFAOYSA-N 0.000 description 1
- ZBPBTLRUNVTPAJ-UHFFFAOYSA-N 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)acetonitrile Chemical compound C1=CC=C2C(CC#N)CC2=C1 ZBPBTLRUNVTPAJ-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- SHNOXFOQLGKCFJ-UHFFFAOYSA-N 3,3-dimethyl-1,2-dihydroindene-1-carbonitrile Chemical compound C1=CC=C2C(C)(C)CC(C#N)C2=C1 SHNOXFOQLGKCFJ-UHFFFAOYSA-N 0.000 description 1
- AITOIXUPYQMXBH-UHFFFAOYSA-N 3-chloro-n'-hydroxy-5-methylbicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboximidamide Chemical compound CC1=CC(Cl)=CC2=C1C(C(N)=NO)=C2 AITOIXUPYQMXBH-UHFFFAOYSA-N 0.000 description 1
- MFEILWXBDBCWKF-UHFFFAOYSA-N 3-phenylpropanoyl chloride Chemical compound ClC(=O)CCC1=CC=CC=C1 MFEILWXBDBCWKF-UHFFFAOYSA-N 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-M 3-phenylpropionate Chemical compound [O-]C(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-M 0.000 description 1
- XOXPGVHNFZGKAT-UHFFFAOYSA-N 4-chloro-n'-hydroxybicyclo[4.2.0]octa-1(6),2,4,7-tetraene-7-carboximidamide Chemical compound C1=C(Cl)C=C2C(C(=NO)N)=CC2=C1 XOXPGVHNFZGKAT-UHFFFAOYSA-N 0.000 description 1
- XTWYTFMLZFPYCI-KQYNXXCUSA-N 5'-adenylphosphoric acid Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O XTWYTFMLZFPYCI-KQYNXXCUSA-N 0.000 description 1
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 1
- KSMPIARQVZZZOS-UHFFFAOYSA-N 7-benzyl-n'-hydroxybicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide Chemical compound C1C2=CC=CC=C2C1(C(=NO)N)CC1=CC=CC=C1 KSMPIARQVZZZOS-UHFFFAOYSA-N 0.000 description 1
- XTYPHDQEHSGGOY-UHFFFAOYSA-N 7-bicyclo[4.2.0]octa-1,3,5-trienylmethanol;4-methylbenzenesulfonic acid Chemical compound C1=CC=C2C(CO)CC2=C1.CC1=CC=C(S(O)(=O)=O)C=C1 XTYPHDQEHSGGOY-UHFFFAOYSA-N 0.000 description 1
- XRQHTAZEJKYHSD-UHFFFAOYSA-N 7-chloro-3,5-dimethylbicyclo[4.2.0]octa-1,3,5-triene Chemical compound CC1=CC(C)=CC2=C1C(Cl)C2 XRQHTAZEJKYHSD-UHFFFAOYSA-N 0.000 description 1
- LMTJMIOWPAYZJC-UHFFFAOYSA-N 7-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carbonitrile Chemical compound C1=CC=C2C(C)(C#N)CC2=C1 LMTJMIOWPAYZJC-UHFFFAOYSA-N 0.000 description 1
- XTWYTFMLZFPYCI-UHFFFAOYSA-N Adenosine diphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(O)=O)C(O)C1O XTWYTFMLZFPYCI-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LFQZEEDYILPNTG-UHFFFAOYSA-N C1=CC=C2C(=C1)C(C2=S)C(=O)N Chemical compound C1=CC=C2C(=C1)C(C2=S)C(=O)N LFQZEEDYILPNTG-UHFFFAOYSA-N 0.000 description 1
- 101100294115 Caenorhabditis elegans nhr-4 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 244000248349 Citrus limon Species 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- UDMBCSSLTHHNCD-UHFFFAOYSA-N Coenzym Q(11) Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(O)=O)C(O)C1O UDMBCSSLTHHNCD-UHFFFAOYSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- 238000006824 Eschweiler-Clarke methylation reaction Methods 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- IEMKQNASBBGWDR-UHFFFAOYSA-N N',4-dihydroxybicyclo[4.2.0]octa-1(6),2,4,7-tetraene-7-carboximidamide Chemical compound C1=C(O)C=C2C(C(=NO)N)=CC2=C1 IEMKQNASBBGWDR-UHFFFAOYSA-N 0.000 description 1
- NOFZQFSYAMJEGP-UHFFFAOYSA-N N'-hydroxy-9,11-dioxatricyclo[6.3.0.03,6]undeca-1(8),2,4,6-tetraene-4-carboximidamide Chemical compound C1=C2C(C(=NO)N)=CC2=CC2=C1OCO2 NOFZQFSYAMJEGP-UHFFFAOYSA-N 0.000 description 1
- GFRROZIJVHUSKZ-FXGMSQOLSA-N OS I Natural products C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](OC[C@@H](O)[C@@H](O)[C@@H](O)CO)[C@@H]2NC(=O)C)[C@H](O)[C@H](O)[C@H]1O GFRROZIJVHUSKZ-FXGMSQOLSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Natural products OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- UDMBCSSLTHHNCD-KQYNXXCUSA-N adenosine 5'-monophosphate Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O UDMBCSSLTHHNCD-KQYNXXCUSA-N 0.000 description 1
- 229950006790 adenosine phosphate Drugs 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229960004365 benzoic acid Drugs 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-N beta-phenylpropanoic acid Natural products OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- IRXBNHGNHKNOJI-UHFFFAOYSA-N butanedioyl dichloride Chemical compound ClC(=O)CCC(Cl)=O IRXBNHGNHKNOJI-UHFFFAOYSA-N 0.000 description 1
- QAWBXZYPFCFQLA-UHFFFAOYSA-N butanoyl bromide Chemical compound CCCC(Br)=O QAWBXZYPFCFQLA-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001715 carbamic acids Chemical class 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 125000005392 carboxamide group Chemical group NC(=O)* 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 235000013365 dairy product Nutrition 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- WLXALCKAKGDNAT-UHFFFAOYSA-N diazoethane Chemical compound CC=[N+]=[N-] WLXALCKAKGDNAT-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- AINBZKYUNWUTRE-UHFFFAOYSA-N ethanol;propan-2-ol Chemical compound CCO.CC(C)O AINBZKYUNWUTRE-UHFFFAOYSA-N 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000000411 inducer Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N mandelic acid Chemical compound OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- RUSXNPLGSMCQDZ-UHFFFAOYSA-N n'-hydroxy-1,2,3,4-tetrahydronaphthalene-1-carboximidamide;hydrochloride Chemical compound Cl.C1=CC=C2C(C(=NO)N)CCCC2=C1 RUSXNPLGSMCQDZ-UHFFFAOYSA-N 0.000 description 1
- VIBPUMLBNZQXRI-UHFFFAOYSA-N n'-hydroxy-2,3-dihydro-1h-indene-1-carboximidamide;hydrochloride Chemical compound Cl.C1=CC=C2C(C(=NO)N)CCC2=C1 VIBPUMLBNZQXRI-UHFFFAOYSA-N 0.000 description 1
- QZHIEUGQQMZBNO-UHFFFAOYSA-N n'-hydroxy-3,3-dimethyl-1,2-dihydroindene-1-carboximidamide;hydrochloride Chemical compound Cl.C1=CC=C2C(C)(C)CC(C(N)=NO)C2=C1 QZHIEUGQQMZBNO-UHFFFAOYSA-N 0.000 description 1
- VWXXVBQODCWHFI-UHFFFAOYSA-N n'-hydroxy-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5,7-tetraene-7-carboximidamide Chemical compound C1=C(OC)C(OC)=CC2=C1C(C(N)=NO)=C2 VWXXVBQODCWHFI-UHFFFAOYSA-N 0.000 description 1
- YIIUSPWNRHNSJL-UHFFFAOYSA-N n'-hydroxy-4-methoxybicyclo[4.2.0]octa-1(6),2,4,7-tetraene-7-carboximidamide;hydrochloride Chemical compound Cl.COC1=CC=C2C=C(C(N)=NO)C2=C1 YIIUSPWNRHNSJL-UHFFFAOYSA-N 0.000 description 1
- GMSZDNCXVHICNP-UHFFFAOYSA-N n'-hydroxy-4-nitrobicyclo[4.2.0]octa-1(6),2,4,7-tetraene-7-carboximidamide Chemical compound C1=C([N+]([O-])=O)C=C2C(C(=NO)N)=CC2=C1 GMSZDNCXVHICNP-UHFFFAOYSA-N 0.000 description 1
- PGAKHEUYEXFWQM-UHFFFAOYSA-N n'-hydroxy-7-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride Chemical compound Cl.C1=CC=C2C(C)(C(N)=NO)CC2=C1 PGAKHEUYEXFWQM-UHFFFAOYSA-N 0.000 description 1
- RZKMOFNYIRQERJ-UHFFFAOYSA-N n'-hydroxy-7-propan-2-ylbicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide Chemical compound C1=CC=C2C(C(C)C)(C(N)=NO)CC2=C1 RZKMOFNYIRQERJ-UHFFFAOYSA-N 0.000 description 1
- VQICBYVQNUXJAZ-UHFFFAOYSA-N n-hydroxy-n-methylbicyclo[4.2.0]octa-1(8),2,4,6-tetraene-7-carboximidamide Chemical compound C1=CC=C2C(C(=N)N(O)C)=CC2=C1 VQICBYVQNUXJAZ-UHFFFAOYSA-N 0.000 description 1
- NFRNCFLOQYQWOT-UHFFFAOYSA-N n-methylbicyclo[4.2.0]octa-1(8),2,4,6-tetraene-7-carboxamide Chemical compound C1=CC=C2C(C(=O)NC)=CC2=C1 NFRNCFLOQYQWOT-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- VPCDQGACGWYTMC-UHFFFAOYSA-N nitrosyl chloride Chemical compound ClN=O VPCDQGACGWYTMC-UHFFFAOYSA-N 0.000 description 1
- 235000019392 nitrosyl chloride Nutrition 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000006201 parenteral dosage form Substances 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000003140 primary amides Chemical class 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- XYKIUTSFQGXHOW-UHFFFAOYSA-N propan-2-one;toluene Chemical compound CC(C)=O.CC1=CC=CC=C1 XYKIUTSFQGXHOW-UHFFFAOYSA-N 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 150000003334 secondary amides Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000012086 standard solution Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- 239000006208 topical dosage form Substances 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000304 vasodilatating effect Effects 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
- 235000014101 wine Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/70—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with ring systems containing two or more relevant rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/06—Phosphorus compounds without P—C bonds
- C07F9/16—Esters of thiophosphoric acids or thiophosphorous acids
- C07F9/165—Esters of thiophosphoric acids
- C07F9/1651—Esters of thiophosphoric acids with hydroxyalkyl compounds with further substituents on alkyl
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7310741 | 1973-08-03 | ||
| NL7310741A NL7310741A (nl) | 1973-08-03 | 1973-08-03 | Nieuwe n-hydroxy-amidine verbindingen. |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI230674A FI230674A (xx) | 1975-02-04 |
| FI62285B FI62285B (fi) | 1982-08-31 |
| FI62285C true FI62285C (fi) | 1982-12-10 |
Family
ID=19819367
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI2306/74A FI62285C (fi) | 1973-08-03 | 1974-08-01 | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara bensocykloalkylen-1-karboxiamidoximderivat |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3978126A (xx) |
| JP (1) | JPS5082047A (xx) |
| BE (1) | BE818443A (xx) |
| CA (1) | CA1051009A (xx) |
| CH (1) | CH605707A5 (xx) |
| DE (1) | DE2437117A1 (xx) |
| DK (1) | DK142054B (xx) |
| ES (1) | ES428897A1 (xx) |
| FI (1) | FI62285C (xx) |
| FR (1) | FR2239997B1 (xx) |
| GB (1) | GB1475586A (xx) |
| HU (1) | HU168584B (xx) |
| IE (1) | IE39875B1 (xx) |
| NL (1) | NL7310741A (xx) |
| SE (1) | SE419540B (xx) |
| ZA (1) | ZA744584B (xx) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0024306B1 (de) * | 1979-08-10 | 1986-12-03 | L. Givaudan & Cie Société Anonyme | Neue substituierte Tetraline und Indane (I), Verwendung von (I) als Riech- und/oder Geschmackstoffe sowie Riech- und/oder Geschmackstoffkompositionen mit einem Gehalt an (I) |
| NL7908922A (nl) * | 1979-12-12 | 1981-07-16 | Akzo Nv | Carboximidamide derivaten. |
| DE3583900D1 (de) * | 1984-06-06 | 1991-10-02 | Abbott Lab | Adrenergische verbindungen. |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE328274B (xx) * | 1963-05-02 | 1970-09-14 | Parke Davis & Co | |
| US3356684A (en) * | 1966-07-28 | 1967-12-05 | Lilly Co Eli | Novel compositions for the treatment of helminthiasis |
| US3742056A (en) * | 1971-04-20 | 1973-06-26 | Du Pont | Aromatic acet amidoxime-o-carbamates |
-
1973
- 1973-08-03 NL NL7310741A patent/NL7310741A/xx not_active Application Discontinuation
-
1974
- 1974-07-15 US US05/488,648 patent/US3978126A/en not_active Expired - Lifetime
- 1974-07-16 IE IE1511/74A patent/IE39875B1/xx unknown
- 1974-07-17 ZA ZA00744584A patent/ZA744584B/xx unknown
- 1974-07-17 GB GB3174574A patent/GB1475586A/en not_active Expired
- 1974-07-25 CH CH1027474A patent/CH605707A5/xx not_active IP Right Cessation
- 1974-08-01 FI FI2306/74A patent/FI62285C/fi active
- 1974-08-01 DE DE2437117A patent/DE2437117A1/de not_active Withdrawn
- 1974-08-01 HU HUAO387A patent/HU168584B/hu unknown
- 1974-08-02 SE SE7409976A patent/SE419540B/xx unknown
- 1974-08-02 FR FR7426909A patent/FR2239997B1/fr not_active Expired
- 1974-08-02 CA CA206,192A patent/CA1051009A/en not_active Expired
- 1974-08-02 DK DK413674AA patent/DK142054B/da unknown
- 1974-08-02 JP JP49088919A patent/JPS5082047A/ja active Pending
- 1974-08-02 BE BE147246A patent/BE818443A/xx unknown
- 1974-08-02 ES ES428897A patent/ES428897A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ZA744584B (en) | 1975-10-29 |
| IE39875B1 (en) | 1979-01-17 |
| BE818443A (fr) | 1975-02-03 |
| GB1475586A (en) | 1977-06-01 |
| HU168584B (xx) | 1976-06-28 |
| FI230674A (xx) | 1975-02-04 |
| SE419540B (sv) | 1981-08-10 |
| CA1051009A (en) | 1979-03-20 |
| US3978126A (en) | 1976-08-31 |
| FR2239997A1 (xx) | 1975-03-07 |
| NL7310741A (nl) | 1975-02-05 |
| DK142054B (da) | 1980-08-18 |
| FI62285B (fi) | 1982-08-31 |
| JPS5082047A (xx) | 1975-07-03 |
| ES428897A1 (es) | 1976-08-16 |
| SE7409976L (xx) | 1975-02-04 |
| CH605707A5 (xx) | 1978-10-13 |
| DE2437117A1 (de) | 1975-02-20 |
| FR2239997B1 (xx) | 1978-07-28 |
| DK413674A (xx) | 1975-04-07 |
| IE39875L (en) | 1975-02-03 |
| DK142054C (xx) | 1981-01-12 |
| AU7150274A (en) | 1976-01-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Iwanami et al. | Synthesis and neuroleptic activity of benzamides. Cis-N-(1-benzyl-2-methylpyrrolidin-3-yl)-5-chloro-2-methoxy-4-(methylamino) benzamide and related compounds | |
| CA1057767A (en) | Amino acid esters | |
| SK151699A3 (en) | Process for the preparation of pharmacologically active racemic or optically active compounds | |
| FR2471968A1 (fr) | Ethers basiques, leur procede de preparation et compositions pharmaceutiques les contenant | |
| AU638413B2 (en) | Pharmaceutical composition having relaxing activity which contains a nitrate ester as active substance | |
| FI62285C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara bensocykloalkylen-1-karboxiamidoximderivat | |
| JPS599540B2 (ja) | 薬剤としての有効な新活性インダン誘導体の製法 | |
| PL82184B1 (xx) | ||
| HU226421B1 (en) | Process for racemizing optically active 2-(2-chlorophenyl)-2-(2-(2-thienyl)-ethylamino)-acetamides | |
| US3988464A (en) | Cyclopropylamines as pharmaceuticals | |
| US2446192A (en) | Preparation of threonine and derivatives thereof | |
| US2784182A (en) | Nx o ohs | |
| FI66601B (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva 1,3-disubstituerade urinaemnen eller 2-tiourinaemnen | |
| US4013682A (en) | N-hydroxy-amidine compounds | |
| US4499105A (en) | Carboxyimidamide derivatives | |
| US3121074A (en) | Nitro substituted jh-l | |
| DE69315841T2 (de) | Indolinyl n-hydroxyharnstoffe und n-hydroxamsäure derivate als lipoxygenese inhibitoren | |
| CA2065086A1 (en) | Cycloalkylurea compounds | |
| US4123531A (en) | Anti-convulsant N-ethanolamine diphenyl acetamides | |
| US3509211A (en) | Sulfamides | |
| US3300480A (en) | Certain adamantane aziridides | |
| US5110946A (en) | Preparation of 4-chloro-3-sulphamoyl-n-(2,3-dihydro-2-methyl-1h-indol-1-yl)-benzamide from 2,3-dihydro-2-methyl-1h-indole and hydroxylamine-o-sulphonic acid | |
| CA2111460C (en) | Tetrahydrobenzazepine derivatives which inhibit lipoxygenase | |
| Peet et al. | Synthesis of 1, 2, 3‐thiadiazoles | |
| US3226379A (en) | Novel 1,3-bis(polyhydroxyalkyl)-2-imidazolidinones and 1,3-bis(polyhydroxyalkyl)-imidazolidine-2-thiones |