FI56831C - Foerfarande foer framstaellning av terapeutiskt anvaendbara pyrrolidyliden- piperidyliden- och hexahydroazepinyliden-urinaemnen - Google Patents
Foerfarande foer framstaellning av terapeutiskt anvaendbara pyrrolidyliden- piperidyliden- och hexahydroazepinyliden-urinaemnen Download PDFInfo
- Publication number
- FI56831C FI56831C FI819/73A FI81973A FI56831C FI 56831 C FI56831 C FI 56831C FI 819/73 A FI819/73 A FI 819/73A FI 81973 A FI81973 A FI 81973A FI 56831 C FI56831 C FI 56831C
- Authority
- FI
- Finland
- Prior art keywords
- formula
- benzene
- urea
- methyl
- pyrrolidylidene
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 22
- 238000002360 preparation method Methods 0.000 title claims description 7
- 241001465754 Metazoa Species 0.000 title description 4
- 230000001225 therapeutic effect Effects 0.000 title 1
- -1 pyrrolidylidene, piperidylidene Chemical group 0.000 claims description 49
- 150000001875 compounds Chemical class 0.000 claims description 34
- 150000003839 salts Chemical class 0.000 claims description 23
- 235000013877 carbamide Nutrition 0.000 claims description 18
- 239000002904 solvent Substances 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 230000008569 process Effects 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 239000012454 non-polar solvent Substances 0.000 claims description 3
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 125000004802 cyanophenyl group Chemical group 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 174
- 239000000243 solution Substances 0.000 description 40
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 34
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 33
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- 239000000047 product Substances 0.000 description 21
- 239000000203 mixture Substances 0.000 description 20
- 229910000027 potassium carbonate Inorganic materials 0.000 description 17
- 238000006243 chemical reaction Methods 0.000 description 16
- 235000011181 potassium carbonates Nutrition 0.000 description 16
- 239000011541 reaction mixture Substances 0.000 description 16
- 239000012458 free base Substances 0.000 description 15
- 238000001953 recrystallisation Methods 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 14
- 239000002585 base Substances 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000007787 solid Substances 0.000 description 12
- 238000002474 experimental method Methods 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 10
- 239000004202 carbamide Substances 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 9
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical class O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 9
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 8
- 238000001035 drying Methods 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- KGVDKNYFTLFECV-UHFFFAOYSA-N 1-methylpyrrolidin-2-imine Chemical compound CN1CCCC1=N KGVDKNYFTLFECV-UHFFFAOYSA-N 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 241000700159 Rattus Species 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 239000012948 isocyanate Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- QMGVPVSNSZLJIA-FVWCLLPLSA-N strychnine Chemical compound O([C@H]1CC(N([C@H]2[C@H]1[C@H]1C3)C=4C5=CC=CC=4)=O)CC=C1CN1[C@@H]3[C@]25CC1 QMGVPVSNSZLJIA-FVWCLLPLSA-N 0.000 description 6
- HHIRBXHEYVDUAM-UHFFFAOYSA-N 1-chloro-3-isocyanatobenzene Chemical compound ClC1=CC=CC(N=C=O)=C1 HHIRBXHEYVDUAM-UHFFFAOYSA-N 0.000 description 5
- 239000005909 Kieselgur Substances 0.000 description 5
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical class OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000008267 milk Substances 0.000 description 5
- 210000004080 milk Anatomy 0.000 description 5
- 235000013336 milk Nutrition 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- YQLRKXVEALTVCZ-UHFFFAOYSA-N 2-isocyanato-1,3-dimethylbenzene Chemical compound CC1=CC=CC(C)=C1N=C=O YQLRKXVEALTVCZ-UHFFFAOYSA-N 0.000 description 4
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 230000037396 body weight Effects 0.000 description 4
- QSACPWSIIRFHHR-UHFFFAOYSA-N dimethylphenyl isocyanide Natural products CC1=CC=CC(C)=C1C#N QSACPWSIIRFHHR-UHFFFAOYSA-N 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- CMGOHTWSBXCVDE-UHFFFAOYSA-N 1-butylpyrrolidin-2-imine Chemical compound CCCCN1CCCC1=N CMGOHTWSBXCVDE-UHFFFAOYSA-N 0.000 description 3
- NJBMZYSKLWQXLJ-UHFFFAOYSA-N 3,4-dihydro-2h-pyrrol-5-amine Chemical compound NC1=NCCC1 NJBMZYSKLWQXLJ-UHFFFAOYSA-N 0.000 description 3
- QMGVPVSNSZLJIA-UHFFFAOYSA-N Nux Vomica Natural products C1C2C3C4N(C=5C6=CC=CC=5)C(=O)CC3OCC=C2CN2C1C46CC2 QMGVPVSNSZLJIA-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 241001279009 Strychnos toxifera Species 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- MHGNMFDITHQPFG-UHFFFAOYSA-N cyclohexylsulfamic acid;1-methylazepan-2-imine Chemical compound CN1CCCCCC1=N.OS(=O)(=O)NC1CCCCC1 MHGNMFDITHQPFG-UHFFFAOYSA-N 0.000 description 3
- 239000002274 desiccant Substances 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 150000003840 hydrochlorides Chemical class 0.000 description 3
- 150000002513 isocyanates Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 229960005453 strychnine Drugs 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- ASEPHGOCQCYMTN-UHFFFAOYSA-N 1,5-dimethylpyrrolidin-2-imine Chemical compound CC1CCC(=N)N1C ASEPHGOCQCYMTN-UHFFFAOYSA-N 0.000 description 2
- IRECNTZCOKMDSS-UHFFFAOYSA-N 1-(1-benzylpyrrolidin-2-ylidene)-3-(3-chlorophenyl)urea Chemical compound ClC1=CC=CC(NC(=O)N=C2N(CCC2)CC=2C=CC=CC=2)=C1 IRECNTZCOKMDSS-UHFFFAOYSA-N 0.000 description 2
- DHXXNASEMJOAIX-UHFFFAOYSA-N 1-(1-butylpyrrolidin-2-ylidene)-3-(2,6-dimethylphenyl)urea Chemical compound CCCCN1CCCC1=NC(=O)NC1=C(C)C=CC=C1C DHXXNASEMJOAIX-UHFFFAOYSA-N 0.000 description 2
- MMNUVEJHPQKMEN-UHFFFAOYSA-N 1-(1-methylpiperidin-2-ylidene)-3-phenylurea Chemical compound CN1CCCCC1=NC(=O)NC1=CC=CC=C1 MMNUVEJHPQKMEN-UHFFFAOYSA-N 0.000 description 2
- VAODBZOYKXWEQR-UHFFFAOYSA-N 1-(1-methylpyrrolidin-2-ylidene)-3-(4-nitrophenyl)urea Chemical compound CN1CCCC1=NC(=O)NC1=CC=C([N+]([O-])=O)C=C1 VAODBZOYKXWEQR-UHFFFAOYSA-N 0.000 description 2
- YKFUDSVNZVOAOG-UHFFFAOYSA-N 1-(1-methylpyrrolidin-2-ylidene)-3-naphthalen-1-ylurea Chemical compound CN1CCCC1=NC(=O)NC1=CC=CC2=CC=CC=C12 YKFUDSVNZVOAOG-UHFFFAOYSA-N 0.000 description 2
- PVNGOCNXOPJFAM-UHFFFAOYSA-N 1-(2,6-dimethylphenyl)-3-(1-ethylpyrrolidin-2-ylidene)urea Chemical compound CCN1CCCC1=NC(=O)NC1=C(C)C=CC=C1C PVNGOCNXOPJFAM-UHFFFAOYSA-N 0.000 description 2
- PAXRPWSXCPTPCA-UHFFFAOYSA-N 1-(2,6-dimethylphenyl)-3-(1-methylpyrrolidin-2-ylidene)urea Chemical compound CN1CCCC1=NC(=O)NC1=C(C)C=CC=C1C PAXRPWSXCPTPCA-UHFFFAOYSA-N 0.000 description 2
- SINSISHOQIDCEP-UHFFFAOYSA-N 1-(3-chlorophenyl)-3-(1-methylpyrrolidin-2-ylidene)urea Chemical compound CN1CCCC1=NC(=O)NC1=CC=CC(Cl)=C1 SINSISHOQIDCEP-UHFFFAOYSA-N 0.000 description 2
- JASTZOAHAWBRLM-UHFFFAOYSA-N 1-(3-isocyanatophenyl)ethanone Chemical compound CC(=O)C1=CC=CC(N=C=O)=C1 JASTZOAHAWBRLM-UHFFFAOYSA-N 0.000 description 2
- GFNKTLQTQSALEJ-UHFFFAOYSA-N 1-isocyanato-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(N=C=O)C=C1 GFNKTLQTQSALEJ-UHFFFAOYSA-N 0.000 description 2
- BDQNKCYCTYYMAA-UHFFFAOYSA-N 1-isocyanatonaphthalene Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1 BDQNKCYCTYYMAA-UHFFFAOYSA-N 0.000 description 2
- AZAASTRTUORENE-UHFFFAOYSA-N 1-methyl-3-(1-methylpyrrolidin-2-ylidene)-1-phenylurea Chemical compound C=1C=CC=CC=1N(C)C(=O)N=C1CCCN1C AZAASTRTUORENE-UHFFFAOYSA-N 0.000 description 2
- WRGPBVKOBLWDSC-UHFFFAOYSA-N 1-methylpyrrolidin-2-imine;hydrochloride Chemical compound Cl.CN1CCCC1=N WRGPBVKOBLWDSC-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical group C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 241000906446 Theraps Species 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- XUWHAWMETYGRKB-UHFFFAOYSA-N piperidin-2-one Chemical compound O=C1CCCCN1 XUWHAWMETYGRKB-UHFFFAOYSA-N 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 210000002700 urine Anatomy 0.000 description 2
- JNWNVDGZXMDDCZ-UHFFFAOYSA-N (2,6-dimethylphenyl)urea Chemical compound CC1=CC=CC(C)=C1NC(N)=O JNWNVDGZXMDDCZ-UHFFFAOYSA-N 0.000 description 1
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 1
- WLRTWKLFJILMSU-UHFFFAOYSA-N (3-chloro-2-methylphenyl)urea Chemical compound CC1=C(Cl)C=CC=C1NC(N)=O WLRTWKLFJILMSU-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- QTBHXTLIDANIFS-UHFFFAOYSA-N 1-(1-butylpyrrolidin-2-ylidene)-3-(3-chloro-2-methylphenyl)urea Chemical compound CCCCN1CCCC1=NC(=O)NC1=CC=CC(Cl)=C1C QTBHXTLIDANIFS-UHFFFAOYSA-N 0.000 description 1
- PSQJVEVKDLZJQK-UHFFFAOYSA-N 1-(1-butylpyrrolidin-2-ylidene)-3-(3-chloro-2-methylphenyl)urea;hydrate;hydrochloride Chemical compound O.Cl.CCCCN1CCCC1=NC(=O)NC1=CC=CC(Cl)=C1C PSQJVEVKDLZJQK-UHFFFAOYSA-N 0.000 description 1
- ZFVGJPJHQLLUCF-UHFFFAOYSA-N 1-(1-butylpyrrolidin-2-ylidene)-3-(3-chlorophenyl)urea Chemical compound CCCCN1CCCC1=NC(=O)NC1=CC=CC(Cl)=C1 ZFVGJPJHQLLUCF-UHFFFAOYSA-N 0.000 description 1
- TUQITYZEHOZKBO-UHFFFAOYSA-N 1-(1-butylpyrrolidin-2-ylidene)-3-[2-chloro-5-(trifluoromethyl)phenyl]urea;hydrochloride Chemical compound Cl.CCCCN1CCCC1=NC(=O)NC1=CC(C(F)(F)F)=CC=C1Cl TUQITYZEHOZKBO-UHFFFAOYSA-N 0.000 description 1
- KJMVNLKAOWEYRF-UHFFFAOYSA-N 1-(1-methylpyrrolidin-2-ylidene)-3-phenylurea Chemical compound CN1CCCC1=NC(=O)NC1=CC=CC=C1 KJMVNLKAOWEYRF-UHFFFAOYSA-N 0.000 description 1
- HNCXTPKGUNGIIJ-UHFFFAOYSA-N 1-(2,6-dichlorophenyl)-3-(1-methylazepan-2-ylidene)urea Chemical compound CN1CCCCCC1=NC(=O)NC1=C(Cl)C=CC=C1Cl HNCXTPKGUNGIIJ-UHFFFAOYSA-N 0.000 description 1
- ZMRXHCWGDDGDRQ-UHFFFAOYSA-N 1-(2,6-dimethylphenyl)-3-(1,5-dimethylpyrrolidin-2-ylidene)urea Chemical compound CN1C(C)CCC1=NC(=O)NC1=C(C)C=CC=C1C ZMRXHCWGDDGDRQ-UHFFFAOYSA-N 0.000 description 1
- IAWONRHGYXMFIU-UHFFFAOYSA-N 1-(2,6-dimethylphenyl)-3-(1-methylazepan-2-ylidene)urea Chemical compound CN1CCCCCC1=NC(=O)NC1=C(C)C=CC=C1C IAWONRHGYXMFIU-UHFFFAOYSA-N 0.000 description 1
- XIBORKBMOQNCTL-UHFFFAOYSA-N 1-(3-acetylphenyl)-3-(1-methylpyrrolidin-2-ylidene)urea Chemical compound CN1CCCC1=NC(=O)NC1=CC=CC(C(C)=O)=C1 XIBORKBMOQNCTL-UHFFFAOYSA-N 0.000 description 1
- FGRVKUUZWATAPG-UHFFFAOYSA-N 1-(3-chlorophenyl)-3-(1,5-dimethylpyrrolidin-2-ylidene)urea Chemical compound CN1C(C)CCC1=NC(=O)NC1=CC=CC(Cl)=C1 FGRVKUUZWATAPG-UHFFFAOYSA-N 0.000 description 1
- HHLZNCAJWUTDFB-UHFFFAOYSA-N 1-(3-chlorophenyl)-3-(1-ethylpyrrolidin-2-ylidene)urea Chemical compound CCN1CCCC1=NC(=O)NC1=CC=CC(Cl)=C1 HHLZNCAJWUTDFB-UHFFFAOYSA-N 0.000 description 1
- IVHXGNYBEYPWDW-UHFFFAOYSA-N 1-benzylpyrrolidin-2-imine Chemical compound N=C1CCCN1CC1=CC=CC=C1 IVHXGNYBEYPWDW-UHFFFAOYSA-N 0.000 description 1
- WEPYOPYMWSHRIW-UHFFFAOYSA-N 1-chloro-2-isocyanato-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(Cl)C(N=C=O)=C1 WEPYOPYMWSHRIW-UHFFFAOYSA-N 0.000 description 1
- NGQMCUWZGVMILT-UHFFFAOYSA-N 1-chloro-3-isocyanato-2-methylbenzene Chemical compound CC1=C(Cl)C=CC=C1N=C=O NGQMCUWZGVMILT-UHFFFAOYSA-N 0.000 description 1
- ZCUYVEBZFQMKFJ-UHFFFAOYSA-N 1-ethylpyrrolidin-2-imine Chemical compound CCN1CCCC1=N ZCUYVEBZFQMKFJ-UHFFFAOYSA-N 0.000 description 1
- BXARMMIBOXKFEV-UHFFFAOYSA-N 1-ethylpyrrolidin-2-imine;hydrochloride Chemical compound Cl.CCN1CCCC1=N BXARMMIBOXKFEV-UHFFFAOYSA-N 0.000 description 1
- BKJABLMNBSVKCV-UHFFFAOYSA-N 1-isocyanato-3-methylsulfanylbenzene Chemical compound CSC1=CC=CC(N=C=O)=C1 BKJABLMNBSVKCV-UHFFFAOYSA-N 0.000 description 1
- SPUOAGXTYHGYSF-UHFFFAOYSA-N 1-methylpiperidin-2-imine Chemical compound CN1CCCCC1=N SPUOAGXTYHGYSF-UHFFFAOYSA-N 0.000 description 1
- DHGUMNJVFYRSIG-UHFFFAOYSA-N 2,3,4,5-tetrahydropyridin-6-amine Chemical compound NC1=NCCCC1 DHGUMNJVFYRSIG-UHFFFAOYSA-N 0.000 description 1
- ITDOBWWRWYKLQJ-UHFFFAOYSA-N 2,3,4,5-tetrahydropyridin-6-ylurea Chemical compound NC(=O)NC1=NCCCC1 ITDOBWWRWYKLQJ-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- CKQHAYFOPRIUOM-UHFFFAOYSA-N 3'-Aminoacetophenone Chemical compound CC(=O)C1=CC=CC(N)=C1 CKQHAYFOPRIUOM-UHFFFAOYSA-N 0.000 description 1
- GTLJSJNKRLFVSJ-UHFFFAOYSA-N 3,4,5,6-tetrahydro-2h-azepin-7-amine Chemical compound N=C1CCCCCN1 GTLJSJNKRLFVSJ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- KCHLDNLIJVSRPK-UHFFFAOYSA-N 3-methylsulfanylaniline Chemical compound CSC1=CC=CC(N)=C1 KCHLDNLIJVSRPK-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 206010017472 Fumbling Diseases 0.000 description 1
- 229910004039 HBF4 Inorganic materials 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 238000007192 Meerwein reaction reaction Methods 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 208000007101 Muscle Cramp Diseases 0.000 description 1
- 206010049816 Muscle tightness Diseases 0.000 description 1
- ZWXPDGCFMMFNRW-UHFFFAOYSA-N N-methylcaprolactam Chemical compound CN1CCCCCC1=O ZWXPDGCFMMFNRW-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000030360 Peromyscus truei Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 208000005392 Spasm Diseases 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 108010021119 Trichosanthin Proteins 0.000 description 1
- VYWQTJWGWLKBQA-UHFFFAOYSA-N [amino(hydroxy)methylidene]azanium;chloride Chemical compound Cl.NC(N)=O VYWQTJWGWLKBQA-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 230000036592 analgesia Effects 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 230000003542 behavioural effect Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000005323 carbonate salts Chemical class 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003874 central nervous system depressant Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229940126208 compound 22 Drugs 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000009533 lab test Methods 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- PSGAAPLEWMOORI-PEINSRQWSA-N medroxyprogesterone acetate Chemical compound C([C@@]12C)CC(=O)C=C1[C@@H](C)C[C@@H]1[C@@H]2CC[C@]2(C)[C@@](OC(C)=O)(C(C)=O)CC[C@H]21 PSGAAPLEWMOORI-PEINSRQWSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 230000037023 motor activity Effects 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- CPGWSLFYXMRNDV-UHFFFAOYSA-N n-methyl-n-phenylcarbamoyl chloride Chemical compound ClC(=O)N(C)C1=CC=CC=C1 CPGWSLFYXMRNDV-UHFFFAOYSA-N 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- 230000035764 nutrition Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- FERZDALKDCSVRX-UHFFFAOYSA-M potassium;carbamate Chemical compound [K+].NC([O-])=O FERZDALKDCSVRX-UHFFFAOYSA-M 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 210000001635 urinary tract Anatomy 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C247/00—Compounds containing azido groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C265/00—Derivatives of isocyanic acid
- C07C265/12—Derivatives of isocyanic acid having isocyanate groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US23581672A | 1972-03-17 | 1972-03-17 | |
| US23581672 | 1972-03-17 | ||
| US33584573A | 1973-02-26 | 1973-02-26 | |
| US33584573 | 1973-02-26 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI56831B FI56831B (fi) | 1979-12-31 |
| FI56831C true FI56831C (fi) | 1980-04-10 |
Family
ID=26929245
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI819/73A FI56831C (fi) | 1972-03-17 | 1973-03-16 | Foerfarande foer framstaellning av terapeutiskt anvaendbara pyrrolidyliden- piperidyliden- och hexahydroazepinyliden-urinaemnen |
Country Status (12)
| Country | Link |
|---|---|
| AT (2) | AT323194B (https=) |
| CA (1) | CA950464A (https=) |
| CH (1) | CH578539A5 (https=) |
| CS (2) | CS179412B2 (https=) |
| DE (1) | DE2313257A1 (https=) |
| DK (1) | DK136715B (https=) |
| FI (1) | FI56831C (https=) |
| FR (1) | FR2181826B1 (https=) |
| GB (1) | GB1414048A (https=) |
| IL (1) | IL41798A (https=) |
| NL (1) | NL7303723A (https=) |
| NO (1) | NO140136C (https=) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ183570A (en) * | 1976-03-19 | 1979-06-08 | Mcneilab Inc | Heterocyclic guanidine derivatives, having anti-secretory and hypogliycaemic activity |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3717648A (en) * | 1970-10-21 | 1973-02-20 | Sterling Drug Inc | 1-phenyl-azacarbocyclic-2-imines |
-
1973
- 1973-03-15 GB GB1259773A patent/GB1414048A/en not_active Expired
- 1973-03-15 CH CH380773A patent/CH578539A5/xx not_active IP Right Cessation
- 1973-03-16 IL IL7341798A patent/IL41798A/en unknown
- 1973-03-16 AT AT521774A patent/AT323194B/de not_active IP Right Cessation
- 1973-03-16 FI FI819/73A patent/FI56831C/fi active
- 1973-03-16 CA CA166,285,A patent/CA950464A/en not_active Expired
- 1973-03-16 FR FR7309562A patent/FR2181826B1/fr not_active Expired
- 1973-03-16 NL NL7303723A patent/NL7303723A/xx not_active Application Discontinuation
- 1973-03-16 DE DE2313257A patent/DE2313257A1/de not_active Withdrawn
- 1973-03-16 AT AT235973A patent/AT323191B/de not_active IP Right Cessation
- 1973-03-16 DK DK143773AA patent/DK136715B/da unknown
- 1973-03-16 NO NO1067/73A patent/NO140136C/no unknown
- 1973-03-19 CS CS7300001976A patent/CS179412B2/cs unknown
- 1973-03-19 CS CS7500004295A patent/CS179444B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2313257A1 (de) | 1973-10-04 |
| CH578539A5 (https=) | 1976-08-13 |
| FR2181826B1 (https=) | 1976-04-09 |
| CS179412B2 (en) | 1977-10-31 |
| FR2181826A1 (https=) | 1973-12-07 |
| CS179444B2 (en) | 1977-10-31 |
| AT323191B (de) | 1975-06-25 |
| AT323194B (de) | 1975-06-25 |
| IL41798A0 (en) | 1973-05-31 |
| FI56831B (fi) | 1979-12-31 |
| DK136715B (da) | 1977-11-14 |
| NO140136C (no) | 1979-07-11 |
| GB1414048A (en) | 1975-11-12 |
| DK136715C (https=) | 1978-04-24 |
| IL41798A (en) | 1976-04-30 |
| CA950464A (en) | 1974-07-02 |
| NL7303723A (https=) | 1973-09-19 |
| NO140136B (no) | 1979-04-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4233302A (en) | Amine derivatives and pharmaceutical compositions containing them | |
| PL116532B1 (en) | Process for preparing novel derivatives of amides of 2-methoxy-4-amino-5-alkylsulfonylbenzoic acid | |
| IE62229B1 (en) | 3-(4(1-Substituted-4-piperazinyl)butyl)-4-thiazoli dinones, a process for their preparation and their use as medicaments | |
| US4324787A (en) | 2-Oxo-1-pyrrolidineacetic acid compounds and their medicinal use | |
| CH641757A5 (en) | O-Alkylated hydroxylamines and process for the preparation thereof | |
| JPS6039678B2 (ja) | 新規インド−ル誘導体の製法 | |
| US5519025A (en) | 4-indolylpiperazinyl derivatives | |
| FI56831C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara pyrrolidyliden- piperidyliden- och hexahydroazepinyliden-urinaemnen | |
| SU1402251A3 (ru) | Способ получени производных 3-фенил-2-пропенамина в виде геометрических изомеров или их смесей, а также фармакологически приемлемых солей | |
| US4395409A (en) | Carbamoyloxyamino-1,4-benzodiazepines and medicaments containing these compounds | |
| SU1222191A3 (ru) | Способ получени соединений гуанидина или их фармакологически совместимых солей | |
| FI66601B (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva 1,3-disubstituerade urinaemnen eller 2-tiourinaemnen | |
| US3933836A (en) | Pyridinylidene guanidines | |
| US4221798A (en) | Hypotensive 2-heterocycloamino-imidazolines | |
| IE45782B1 (en) | 1-(n-acylcarbamoyl)-2-cyanoziridines | |
| US3803165A (en) | N-(2-(2-nitro-1-imidazolyl)ethyl)-2',2',2'-trichloroethyl carbamate | |
| US4559358A (en) | 5-Oxo-2-pyrrolidinepropanoic acid and derivatives for reversing electroshock amnesia | |
| DE69223422T2 (de) | Benzothiadiazinderivate | |
| US4742068A (en) | Dihydropyridine compounds having 1,4,4-trisubstitution useful as antihypertensive agents | |
| KR880002709B1 (ko) | 이미다졸 카복스아미드 유도체 및 그의 제조방법 | |
| US3432491A (en) | Benzene sulfonyl semicarbazides | |
| CA1060446A (en) | Piperazine compounds | |
| US3247202A (en) | 3-hydrocarbon-4-aminoalkylene-5-mono-carbocyclic aryl-1, 2, 4-triazoles | |
| US4153702A (en) | Basically alkylated dithiosalicyclic acid amides and their use as medicaments | |
| HU204795B (en) | Process for producing calcium antagonist cyclic quanidine derivatives and pharmaceutical compositions comprising same |