FI56532C - Foerfarande foer framstaellning av nya psykotropiskt verkande 3-karbamoyl-1-tiaisokroman-1,1-dioxid-derivat - Google Patents
Foerfarande foer framstaellning av nya psykotropiskt verkande 3-karbamoyl-1-tiaisokroman-1,1-dioxid-derivat Download PDFInfo
- Publication number
- FI56532C FI56532C FI1301/74A FI130174A FI56532C FI 56532 C FI56532 C FI 56532C FI 1301/74 A FI1301/74 A FI 1301/74A FI 130174 A FI130174 A FI 130174A FI 56532 C FI56532 C FI 56532C
- Authority
- FI
- Finland
- Prior art keywords
- dioxide
- dimethoxy
- carbamoyl
- thia
- general formula
- Prior art date
Links
- 235000013399 edible fruits Nutrition 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 9
- 150000001412 amines Chemical class 0.000 claims description 9
- DMHRVJJBVONOCS-UHFFFAOYSA-N 1,1-dioxo-3,4-dihydro-2,1lambda6-benzoxathiine-3-carboxamide Chemical class C(N)(=O)C1OS(C2=CC=CC=C2C1)(=O)=O DMHRVJJBVONOCS-UHFFFAOYSA-N 0.000 claims description 7
- -1 β-phenylethyl Chemical group 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 150000007522 mineralic acids Chemical class 0.000 claims description 6
- 150000007524 organic acids Chemical class 0.000 claims description 6
- 235000005985 organic acids Nutrition 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 235000020357 syrup Nutrition 0.000 claims 1
- 239000006188 syrup Substances 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 69
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 30
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 20
- FAZVYQPQIRUWRJ-UHFFFAOYSA-N 6,7-dimethoxy-1,1-dioxo-3,4-dihydro-2,1lambda6-benzoxathiine-3-carbonyl chloride Chemical compound COC1=C(OC)C=C2C(CC(OS2(=O)=O)C(Cl)=O)=C1 FAZVYQPQIRUWRJ-UHFFFAOYSA-N 0.000 description 17
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 10
- SAKGOYVQTSICKT-UHFFFAOYSA-N 2-n,2-dimethylpentane-2,4-diamine Chemical compound CNC(C)(C)CC(C)N SAKGOYVQTSICKT-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 7
- AFABGHUZZDYHJO-UHFFFAOYSA-N 2-Methylpentane Chemical compound CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 6
- FEEURYUFJUETLW-UHFFFAOYSA-N 6,7-dimethoxy-3-methyl-1,1-dioxo-4H-2,1lambda6-benzoxathiine-3-carbonyl chloride Chemical compound ClC(=O)C1(OS(C2=CC(=C(C=C2C1)OC)OC)(=O)=O)C FEEURYUFJUETLW-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 5
- 150000001408 amides Chemical class 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 229940093915 gynecological organic acid Drugs 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- JAOZSXMVXGUJFX-UHFFFAOYSA-N 2-methyl-2-n-(2-methylpropyl)pentane-2,4-diamine Chemical compound CC(C)CNC(C)(C)CC(C)N JAOZSXMVXGUJFX-UHFFFAOYSA-N 0.000 description 3
- WDMGFORRILPKQD-UHFFFAOYSA-N 4-methyl-n-[4-methyl-1-oxo-1-(1,4,7-trioxa-10-azacyclododec-10-yl)pentan-2-yl]benzenesulfonamide Chemical compound C1COCCOCCOCCN1C(=O)C(CC(C)C)NS(=O)(=O)C1=CC=C(C)C=C1 WDMGFORRILPKQD-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 206010049816 Muscle tightness Diseases 0.000 description 3
- 229910002651 NO3 Inorganic materials 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 230000000202 analgesic effect Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000001530 fumaric acid Substances 0.000 description 3
- 235000011087 fumaric acid Nutrition 0.000 description 3
- ITZPOSYADVYECJ-UHFFFAOYSA-N n'-cyclohexylpropane-1,3-diamine Chemical compound NCCCNC1CCCCC1 ITZPOSYADVYECJ-UHFFFAOYSA-N 0.000 description 3
- 229940074355 nitric acid Drugs 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 230000000506 psychotropic effect Effects 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 230000001603 reducing effect Effects 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- DNXIKVLOVZVMQF-UHFFFAOYSA-N (3beta,16beta,17alpha,18beta,20alpha)-17-hydroxy-11-methoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-yohimban-16-carboxylic acid, methyl ester Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(C(=O)OC)C(O)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 DNXIKVLOVZVMQF-UHFFFAOYSA-N 0.000 description 2
- YXBPGEDCLHNGHJ-UHFFFAOYSA-N 2-N-benzyl-2-methylpentane-2,4-diamine Chemical compound C(C1=CC=CC=C1)NC(C)(CC(C)N)C YXBPGEDCLHNGHJ-UHFFFAOYSA-N 0.000 description 2
- ZSXVXTYIYICOIO-UHFFFAOYSA-N 2-methyl-2-N-propylpentane-2,4-diamine Chemical compound C(CC)NC(C)(CC(C)N)C ZSXVXTYIYICOIO-UHFFFAOYSA-N 0.000 description 2
- FAXMAGSAFLZSNW-UHFFFAOYSA-N 2-methyl-2-n-propan-2-ylpentane-2,4-diamine Chemical compound CC(C)NC(C)(C)CC(C)N FAXMAGSAFLZSNW-UHFFFAOYSA-N 0.000 description 2
- GNBARLLWIAIBIR-UHFFFAOYSA-N 2-n-butyl-2-methylpentane-2,4-diamine Chemical compound CCCCNC(C)(C)CC(C)N GNBARLLWIAIBIR-UHFFFAOYSA-N 0.000 description 2
- ZKRSEUBKYMIMQG-UHFFFAOYSA-N 2-n-cyclohexyl-2-methylpentane-2,4-diamine Chemical compound CC(N)CC(C)(C)NC1CCCCC1 ZKRSEUBKYMIMQG-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- LCQMZZCPPSWADO-UHFFFAOYSA-N Reserpilin Natural products COC(=O)C1COCC2CN3CCc4c([nH]c5cc(OC)c(OC)cc45)C3CC12 LCQMZZCPPSWADO-UHFFFAOYSA-N 0.000 description 2
- QEVHRUUCFGRFIF-SFWBKIHZSA-N Reserpine Natural products O=C(OC)[C@@H]1[C@H](OC)[C@H](OC(=O)c2cc(OC)c(OC)c(OC)c2)C[C@H]2[C@@H]1C[C@H]1N(C2)CCc2c3c([nH]c12)cc(OC)cc3 QEVHRUUCFGRFIF-SFWBKIHZSA-N 0.000 description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 2
- 235000011054 acetic acid Nutrition 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000002903 catalepsic effect Effects 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 229940013688 formic acid Drugs 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 230000002631 hypothermal effect Effects 0.000 description 2
- UTFXIZBAVFFUGU-UHFFFAOYSA-N methyl 6,7-dimethoxy-1,1-dioxo-3,4-dihydro-2,1lambda6-benzoxathiine-3-carboxylate Chemical compound COC(=O)C1OS(C2=CC(=C(C=C2C1)OC)OC)(=O)=O UTFXIZBAVFFUGU-UHFFFAOYSA-N 0.000 description 2
- OWKYZAGJTTTXOK-UHFFFAOYSA-N n'-propylpropane-1,3-diamine Chemical compound CCCNCCCN OWKYZAGJTTTXOK-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- QEVHRUUCFGRFIF-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C(C5=CC=C(OC)C=C5N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 QEVHRUUCFGRFIF-MDEJGZGSSA-N 0.000 description 2
- 229960003147 reserpine Drugs 0.000 description 2
- MDMGHDFNKNZPAU-UHFFFAOYSA-N roserpine Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(OC(C)=O)C(OC)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 MDMGHDFNKNZPAU-UHFFFAOYSA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 238000000967 suction filtration Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- RIHGEIMDTCIVNX-UHFFFAOYSA-N 2-N-butan-2-yl-2-methylpentane-2,4-diamine Chemical compound CCC(C)NC(C)(C)CC(C)N RIHGEIMDTCIVNX-UHFFFAOYSA-N 0.000 description 1
- TXTDUELHKFMSAN-UHFFFAOYSA-N 2-N-hexyl-2-methylpentane-2,4-diamine Chemical compound C(CCCCC)NC(C)(CC(C)N)C TXTDUELHKFMSAN-UHFFFAOYSA-N 0.000 description 1
- KBWKTWRJUCKQME-UHFFFAOYSA-N 2-n-propylpropane-1,2-diamine Chemical compound CCCNC(C)CN KBWKTWRJUCKQME-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- IPTNDSWMMPPODL-UHFFFAOYSA-N 6,7-dimethoxy-3,4-dihydro-2,1$l^{6}-benzoxathiine 1,1-dioxide Chemical compound C1COS(=O)(=O)C2=C1C=C(OC)C(OC)=C2 IPTNDSWMMPPODL-UHFFFAOYSA-N 0.000 description 1
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Natural products OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 208000009132 Catalepsy Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 206010047853 Waxy flexibility Diseases 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000000891 anti-reserpine Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 229960004365 benzoic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 230000001054 cortical effect Effects 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 230000002996 emotional effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- TYQCGQRIZGCHNB-JLAZNSOCSA-N l-ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(O)=C(O)C1=O TYQCGQRIZGCHNB-JLAZNSOCSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- VUZPPFZMUPKLLV-UHFFFAOYSA-N methane;hydrate Chemical compound C.O VUZPPFZMUPKLLV-UHFFFAOYSA-N 0.000 description 1
- RTKMLLZVUPKLMY-UHFFFAOYSA-N n-[2-(3,4-dimethoxyphenyl)ethyl]-1-(2-methoxy-5-methylphenyl)sulfonylpiperidine-3-carboxamide Chemical compound C1=C(OC)C(OC)=CC=C1CCNC(=O)C1CN(S(=O)(=O)C=2C(=CC=C(C)C=2)OC)CCC1 RTKMLLZVUPKLMY-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229940116315 oxalic acid Drugs 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229960004838 phosphoric acid Drugs 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Inorganic materials [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 229940032330 sulfuric acid Drugs 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000012345 traction test Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D327/00—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms
- C07D327/02—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms one oxygen atom and one sulfur atom
- C07D327/06—Six-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DD170664A DD109389A1 (ro) | 1973-05-02 | 1973-05-02 | |
| DD17066473 | 1973-05-02 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI56532B FI56532B (fi) | 1979-10-31 |
| FI56532C true FI56532C (fi) | 1980-02-11 |
Family
ID=5491127
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI1301/74A FI56532C (fi) | 1973-05-02 | 1974-04-29 | Foerfarande foer framstaellning av nya psykotropiskt verkande 3-karbamoyl-1-tiaisokroman-1,1-dioxid-derivat |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS5519221B2 (ro) |
| AT (1) | AT330196B (ro) |
| BE (1) | BE814031A (ro) |
| CH (1) | CH592650A5 (ro) |
| CS (1) | CS171495B1 (ro) |
| DD (1) | DD109389A1 (ro) |
| DE (1) | DE2403060C3 (ro) |
| DK (1) | DK133948B (ro) |
| FI (1) | FI56532C (ro) |
| FR (1) | FR2227871B1 (ro) |
| GB (1) | GB1407193A (ro) |
| HU (1) | HU167082B (ro) |
| NL (1) | NL7402317A (ro) |
| PL (1) | PL90399B1 (ro) |
| RO (2) | RO66098A (ro) |
| SE (1) | SE406469B (ro) |
| SU (1) | SU559923A1 (ro) |
-
1973
- 1973-05-02 DD DD170664A patent/DD109389A1/xx unknown
-
1974
- 1974-01-22 AT AT51674*#A patent/AT330196B/de not_active IP Right Cessation
- 1974-01-23 DE DE2403060A patent/DE2403060C3/de not_active Expired
- 1974-02-20 NL NL7402317A patent/NL7402317A/xx not_active Application Discontinuation
- 1974-03-14 JP JP2866274A patent/JPS5519221B2/ja not_active Expired
- 1974-03-22 CH CH406674A patent/CH592650A5/xx not_active IP Right Cessation
- 1974-04-19 GB GB1728874A patent/GB1407193A/en not_active Expired
- 1974-04-22 BE BE143478A patent/BE814031A/xx unknown
- 1974-04-29 FI FI1301/74A patent/FI56532C/fi active
- 1974-04-30 SU SU2020216A patent/SU559923A1/ru active
- 1974-04-30 PL PL1974170731A patent/PL90399B1/pl unknown
- 1974-04-30 SE SE747405825A patent/SE406469B/xx unknown
- 1974-05-01 RO RO7478636A patent/RO66098A/ro unknown
- 1974-05-01 RO RO7491543A patent/RO71551A/ro unknown
- 1974-05-01 DK DK237274AA patent/DK133948B/da unknown
- 1974-05-02 CS CS3135A patent/CS171495B1/cs unknown
- 1974-05-02 FR FR7415301A patent/FR2227871B1/fr not_active Expired
- 1974-05-02 HU HUAE415A patent/HU167082B/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DD109389A1 (ro) | 1974-11-05 |
| RO71551A (ro) | 1982-02-26 |
| RO66098A (ro) | 1981-07-30 |
| FI56532B (fi) | 1979-10-31 |
| CS171495B1 (ro) | 1976-10-29 |
| PL90399B1 (ro) | 1977-01-31 |
| HU167082B (ro) | 1975-08-28 |
| SU559923A1 (ru) | 1977-05-30 |
| GB1407193A (en) | 1975-09-24 |
| DK133948C (ro) | 1977-01-24 |
| DE2403060C3 (de) | 1981-04-02 |
| AT330196B (de) | 1976-06-25 |
| DE2403060B2 (de) | 1980-07-03 |
| JPS49135978A (ro) | 1974-12-27 |
| DE2403060A1 (de) | 1974-11-21 |
| DK133948B (da) | 1976-08-16 |
| NL7402317A (ro) | 1974-11-05 |
| SE406469B (sv) | 1979-02-12 |
| ATA51674A (de) | 1975-09-15 |
| JPS5519221B2 (ro) | 1980-05-24 |
| CH592650A5 (ro) | 1977-10-31 |
| FR2227871B1 (ro) | 1978-02-03 |
| BE814031A (fr) | 1974-10-22 |
| FR2227871A1 (ro) | 1974-11-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69329067T2 (de) | Pyridmidin-derivate | |
| DE2122991C2 (de) | Verfahren zur Herstellung von Cytosin- und 6-Azacytosinnucleosiden | |
| Sommer et al. | Alkylation of amines. New method for the synthesis of quaternary ammonium compounds from primary and secondary amines | |
| Matteson et al. | A Practical Synthesis of Thieno [3, 2-b] pyrrole | |
| NO762661L (ro) | ||
| Markovac et al. | Synthesis of oximes. III. Iodine dimethyl sulfoxide reaction with methylpyridines | |
| DE69527787T2 (de) | Verfahren und zwischenprodukte zur herstellung von piperazinderivaten | |
| Hyatt | Neber rearrangement of amidoxime sulfonates. Synthesis of 2-amino-1-azirines | |
| Piyamongkol et al. | Novel synthetic approach to 2-(1′-hydroxyalkyl)-and 2-amido-3-hydroxypyridin-4-ones | |
| LaMattina | The Synthesis of 2‐Amino‐4‐(4‐imidazolyl) pyridines | |
| FI56532C (fi) | Foerfarande foer framstaellning av nya psykotropiskt verkande 3-karbamoyl-1-tiaisokroman-1,1-dioxid-derivat | |
| Beak et al. | Equilibration studies. 2-(Methylthio) pyridine 1-methyl-2 (1H)-pyridinethione | |
| CH412889A (de) | Verfahren zur Herstellung von 2-Methyl-3-oxypyridinen | |
| US2748142A (en) | - process of production | |
| US3201406A (en) | Pyridylcoumarins | |
| JPS598260B2 (ja) | １０−アミノ−９、１０−ジヒドロフエナントレン誘導体およびその製造法 | |
| Norris et al. | 2-Guanidino-4 (5)-p-chlorophenylimidazoles | |
| Ukhin et al. | Reactions of Bunte salts with carbocations of isobenzofuranone and isoindolone | |
| US3280120A (en) | Substituted benzoxazines, process therefor and intermediates | |
| FI67370B (fi) | Mellanprodukt foer framstaellning av 4-(4-disubstituerade piperidinylmetyl)-3,3-difenyl-2-pyrrolidinoner och foerfarande foer framstaellning av mellanprodukten | |
| US4178450A (en) | 2,5-Dimethyl-benzo(b) thiene (3,2-f) morphan and precursor thereof | |
| Chapman et al. | 473. Emetine and related compounds. Part I. The synthesis of tetrahydroisoquinolyl ketones | |
| Koperniku et al. | The Reaction of N-Trimethylsilyl-Substituted Heteroarylamines with Esters and Thioesters: An Efficient Protocol To Access Diheteroarylamides | |
| Hirota et al. | Pyrimidine derivatives and related compounds. Part 37. Novel nucleophilic substitutions of 5-bromo-6-methyluracils or 5-bromo-6-bromomethyluracils with aromatic amines | |
| US3347866A (en) | 4-(indol-3-yl)-hexahydro-1h-azepines and their method of preparation |