FI52712C - Menetelmä d- tai 1-2-(6'-substituoitu-2'-naftyyli)propionihapon valmis tamiseksi. - Google Patents
Menetelmä d- tai 1-2-(6'-substituoitu-2'-naftyyli)propionihapon valmis tamiseksi.Info
- Publication number
- FI52712C FI52712C FI700556A FI55670A FI52712C FI 52712 C FI52712 C FI 52712C FI 700556 A FI700556 A FI 700556A FI 55670 A FI55670 A FI 55670A FI 52712 C FI52712 C FI 52712C
- Authority
- FI
- Finland
- Prior art keywords
- naphthyl
- substituted
- preparation
- propionic acid
- propionic
- Prior art date
Links
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 title 2
- 235000019260 propionic acid Nutrition 0.000 title 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/30—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings
- C07C57/38—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings polycyclic
- C07C57/40—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings polycyclic containing condensed ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/42—Unsaturated compounds containing hydroxy or O-metal groups
- C07C59/56—Unsaturated compounds containing hydroxy or O-metal groups containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C63/00—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings
- C07C63/33—Polycyclic acids
- C07C63/337—Polycyclic acids with carboxyl groups bound to condensed ring systems
- C07C63/34—Polycyclic acids with carboxyl groups bound to condensed ring systems containing two condensed rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Drying Of Solid Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US80995769A | 1969-03-24 | 1969-03-24 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI52712B FI52712B (OSRAM) | 1977-08-01 |
| FI52712C true FI52712C (fi) | 1977-11-10 |
Family
ID=25202591
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI700556A FI52712C (fi) | 1969-03-24 | 1970-03-02 | Menetelmä d- tai 1-2-(6'-substituoitu-2'-naftyyli)propionihapon valmis tamiseksi. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3686183A (OSRAM) |
| JP (1) | JPS4931981B1 (OSRAM) |
| BE (1) | BE747864A (OSRAM) |
| CH (1) | CH545263A (OSRAM) |
| DK (1) | DK153136C (OSRAM) |
| ES (1) | ES377842A1 (OSRAM) |
| FI (1) | FI52712C (OSRAM) |
| FR (1) | FR2037244B1 (OSRAM) |
| GB (1) | GB1296493A (OSRAM) |
| IL (1) | IL33847A (OSRAM) |
| NL (1) | NL147116B (OSRAM) |
| NO (1) | NO128606B (OSRAM) |
| SE (1) | SE385868B (OSRAM) |
| ZA (1) | ZA70810B (OSRAM) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3904683A (en) * | 1972-08-10 | 1975-09-09 | Syntex Corp | Process for the resolution of d- and 1-2-(6-methoxy-2-naphthyl) propionic acid |
| US4033816A (en) * | 1973-06-18 | 1977-07-05 | The Upjohn Company | Process for inhibiting platelet aggregation |
| GB1497044A (en) * | 1974-03-07 | 1978-01-05 | Prodotti Antibiotici Spa | Salts of phenyl-alkanoic acids |
| JPS535134A (en) * | 1976-06-30 | 1978-01-18 | Sumitomo Chem Co Ltd | Racemization of optical active 2-(4)chlorophenyl)-3-methylbutylic acid |
| US4209638A (en) * | 1977-03-08 | 1980-06-24 | The Boots Company Limited | Preparation of therapeutic agents |
| PT67743A (en) * | 1977-03-08 | 1978-04-01 | Boots Co Ltd | Preparation of therapeutic agents |
| DE2733425C2 (de) * | 1977-07-23 | 1982-08-26 | Riedel-De Haen Ag, 3016 Seelze | Verfahren zur Herstellung von D(-)-Mandelsäure aus DL-Mandelsäure durch racemische Spaltung |
| JPS54151912A (en) * | 1978-05-18 | 1979-11-29 | Santen Pharmaceutical Co Ltd | Manufacture of photoactive sulfur contained carboxylic acid |
| CH641432A5 (de) * | 1978-07-19 | 1984-02-29 | Syntex Pharma Int | Verfahren zur aufspaltung von racemischer 6-methoxy-alpha-methyl-2-naphthalinessigsaeure in die optischen antipoden. |
| PH15674A (en) * | 1979-07-06 | 1983-03-11 | Syntex Corp | Process for the resolution of d,1 2-(6-methoxy-2-naphthyl)propionic acid |
| US4260815A (en) * | 1979-10-09 | 1981-04-07 | American Cyanamid Company | Process for preparing a solution of DL-mandelic acid |
| US4259521A (en) * | 1979-10-09 | 1981-03-31 | American Cyanamid Company | Process for resolving DL-mandelic acid |
| IT1154663B (it) * | 1980-07-30 | 1987-01-21 | Alfa Chimica Italiana Spa | Procedimento per la risoluzione in antipodi ottici di miscele di acidi d- e l-2-(6-metossi-2-naftil)-propionico |
| IT1168387B (it) * | 1981-04-01 | 1987-05-20 | Alfa Farmaceutici Spa | Procedimento per la preparazione dell'acido 2-(6-metossi-2-naftil)-propionico |
| IT1164319B (it) * | 1983-07-27 | 1987-04-08 | Blaschim Spa | Procedimento per la risoluzione dell'acido (+-)2-(6'-metossi-2'-naftil)-propionico |
| IT1208109B (it) * | 1983-11-23 | 1989-06-06 | Alfa Chem Ital | Procedimento per la risoluzione ottica di acidi arilpropionici |
| IT1196332B (it) * | 1984-11-20 | 1988-11-16 | Secifarma Spa | Procedimento per la risoluzione dell'acido (+)-6-metossi-alfa-metil-2-naftalen acetico nei corrispondenti antipodi ottici |
| IT1203605B (it) * | 1985-04-18 | 1989-02-15 | Alfa Chem Ital | Processo per la risoluzione ottica di miscigli racemi di acidi e naftilpropionici |
| NL8602767A (nl) * | 1986-10-31 | 1988-05-16 | Gantax Nv | Organisch zuuranhydride, alsmede farmaceutisch preparaat op basis van een prodrug. |
| US5266723A (en) * | 1989-05-16 | 1993-11-30 | Medice, Ltd., Chem.-Pharm. Fabrik Putter Gmbh & Co. Kg | Process for the preparation of optically active 2-aryl-alkanoic acids, especially 2-aryl-propionic acids |
| NL9001703A (nl) * | 1990-07-27 | 1992-02-17 | Westspur Investment Ltd | Werkwijze voor de bereiding van s(+)-6-methoxy-alfa-methyl-2-naftaleen-azijnzuur. |
| EP0925267A1 (en) * | 1996-06-10 | 1999-06-30 | Albemarle Corporation | Racemization process for optically active carboxylic acids or salts or esters thereof |
| US5792886A (en) * | 1997-01-08 | 1998-08-11 | Albemarle Corporation | Production of racemic 2-(6-methoxy-2-naphthyl) propionic acid of precursors thereof |
| US6080888A (en) * | 1997-01-08 | 2000-06-27 | Albemarle Corporation | Preparation of olefinic compounds and carboxylic derivatives thereof |
| US6096920A (en) * | 1997-01-08 | 2000-08-01 | Albemarle Corporation | Preparation of carboxylic compounds and their derivatives |
| US5859292A (en) * | 1997-12-11 | 1999-01-12 | Albemarle Corporation | Preparation of high purity sodium (S)-2(6-methoxy-2-naphthyl)propionate |
| US5874614A (en) * | 1997-12-11 | 1999-02-23 | Albemarle Corporation | Sodium (S)-2-(6-methoxy-2-naphthyl)propionate monohydrate |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK140007B (da) * | 1969-07-09 | 1979-06-05 | Syntex Corp | Fremgangsmåde til fremstilling af 2-(6'-methoxynapht-2'-yl)propionsyre. |
-
1969
- 1969-03-24 US US809957A patent/US3686183A/en not_active Expired - Lifetime
-
1970
- 1970-02-05 ZA ZA700810A patent/ZA70810B/xx unknown
- 1970-02-05 IL IL33847A patent/IL33847A/xx unknown
- 1970-02-24 GB GB1296493D patent/GB1296493A/en not_active Expired
- 1970-02-26 CH CH285870A patent/CH545263A/de not_active IP Right Cessation
- 1970-03-02 FI FI700556A patent/FI52712C/fi active
- 1970-03-03 NO NO00749/70*[A patent/NO128606B/no unknown
- 1970-03-23 FR FR7010419A patent/FR2037244B1/fr not_active Expired
- 1970-03-23 ES ES377842A patent/ES377842A1/es not_active Expired
- 1970-03-23 SE SE7003931A patent/SE385868B/xx unknown
- 1970-03-24 NL NL707004197A patent/NL147116B/xx not_active IP Right Cessation
- 1970-03-24 BE BE747864D patent/BE747864A/xx not_active IP Right Cessation
- 1970-03-24 JP JP45024794A patent/JPS4931981B1/ja active Pending
- 1970-03-24 DK DK149770A patent/DK153136C/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DK153136B (da) | 1988-06-20 |
| FR2037244A1 (OSRAM) | 1970-12-31 |
| JPS4931981B1 (OSRAM) | 1974-08-27 |
| DK153136C (da) | 1988-10-31 |
| ES377842A1 (es) | 1973-01-01 |
| FI52712B (OSRAM) | 1977-08-01 |
| FR2037244B1 (OSRAM) | 1974-10-11 |
| NL147116B (nl) | 1975-09-15 |
| GB1296493A (OSRAM) | 1972-11-15 |
| US3686183A (en) | 1972-08-22 |
| NL7004197A (OSRAM) | 1970-09-28 |
| DE2008272B2 (de) | 1977-06-02 |
| IL33847A (en) | 1974-06-30 |
| NO128606B (OSRAM) | 1973-12-17 |
| IL33847A0 (en) | 1970-04-20 |
| CH545263A (de) | 1973-12-15 |
| ZA70810B (en) | 1971-09-29 |
| BE747864A (fr) | 1970-08-31 |
| DE2008272A1 (de) | 1970-10-15 |
| SE385868B (sv) | 1976-07-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI52712C (fi) | Menetelmä d- tai 1-2-(6'-substituoitu-2'-naftyyli)propionihapon valmis tamiseksi. | |
| DK139962B (da) | Fremgangsmåde til fremstilling af 2-(6'-metoksy-2'-naftyl)propionsyre. | |
| NL158498B (nl) | Werkwijze ter bereiding van 7 beta-acylamido-3-methylcef-3-em-4-carbonzuuresters. | |
| DK129581B (da) | Analogifremgangsmåde til fremstilling af substituerede N-allyl-2-arylamino-imidazolin-(2)-forbindelser eller syreadditionssalte deraf. | |
| CH550757A (fr) | Procede de preparation d'acides cyclopropylmethylphenylacetiques. | |
| CH550176A (de) | Verfahren zur herstellung von substituierten n-aminoalkylarylamino-imidazolinen-(2). | |
| CH553181A (de) | Verfahren zur herstellung von 4-heterosubstituierten azetidinonen-(2). | |
| CH552633A (de) | Verfahren zur herstellung von 2-halogenaethylphosphonsaeuren. | |
| CH532566A (de) | Verfahren zur Herstellung von 4.20.22-Bufatrienolidrhamnosid-äthern | |
| CH542849A (de) | Verfahren zur Herstellung von 3,5-Diphenyl-4-pyrazolessigsäure | |
| FI51183C (fi) | Menetelmä 2-hydroksimetyyli-3-karbonihappoamido-kinoksaliini-di-N-oksi de-(1,4)-yhdisteiden valmistamiseksi. | |
| NL166696C (nl) | Werkwijze ter bereiding van digoxine-3'''-monomethyl- ether. | |
| CH550131A (de) | Verfahren zur herstellung substituierter alkencarbonsaeuren. | |
| FI49832C (fi) | Menetelmä ortopiinihappotetrametyyliesterin valmistamiseksi. | |
| CH510639A (de) | Verfahren zur Herstellung von 4-Aminomethylbicyclo(2,2,2)oct-2-en-1-carbonsäure | |
| BE759526A (fr) | Procede de preparation de l'aldehyde propionique | |
| CH551358A (de) | Verfahren zur herstellung von 5,9-dioxodecansaeuren. | |
| IL34687A0 (en) | Compounds of alpha-hydrazino-alpha substituted-beta-(3,4-dihydroxyphenyl)propionic acid | |
| NL165750C (nl) | Werkwijze ter bereiding van gesubstitueerde 7 amino delta&002-cefem 4-carbonzuur esters. | |
| CH547249A (de) | Verfahren zur herstellung von monoaethern des 1,2-dihydroxybenzols. | |
| AT319269B (de) | Verfahren zur Herstellung von O,O-Dialky-O-(2,2-dichlorvinyl)-thionophosphorsäureestern | |
| FI45756C (fi) | Menetelmä kard-20(22)enolidien 3beta-tridesoksipyranosidien valmistami seksi. | |
| AT296246B (de) | Verfahren zur Herstellung von Hexanal-(6)-säure | |
| CH549545A (de) | Verfahren zur herstellung von 2-(6-methoxy-2-naphthyl)1-propanol. | |
| CH558813A (de) | Verfahren zur herstellung von 2-chloraethylthiophosphonsaeuren. |