FI52712C - Menetelmä d- tai 1-2-(6'-substituoitu-2'-naftyyli)propionihapon valmis tamiseksi. - Google Patents
Menetelmä d- tai 1-2-(6'-substituoitu-2'-naftyyli)propionihapon valmis tamiseksi.Info
- Publication number
- FI52712C FI52712C FI700556A FI55670A FI52712C FI 52712 C FI52712 C FI 52712C FI 700556 A FI700556 A FI 700556A FI 55670 A FI55670 A FI 55670A FI 52712 C FI52712 C FI 52712C
- Authority
- FI
- Finland
- Prior art keywords
- naphthyl
- substituted
- preparation
- propionic acid
- propionic
- Prior art date
Links
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 title 2
- 235000019260 propionic acid Nutrition 0.000 title 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/30—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings
- C07C57/38—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings polycyclic
- C07C57/40—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings polycyclic containing condensed ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/42—Unsaturated compounds containing hydroxy or O-metal groups
- C07C59/56—Unsaturated compounds containing hydroxy or O-metal groups containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C63/00—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings
- C07C63/33—Polycyclic acids
- C07C63/337—Polycyclic acids with carboxyl groups bound to condensed ring systems
- C07C63/34—Polycyclic acids with carboxyl groups bound to condensed ring systems containing two condensed rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Drying Of Solid Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US80995769A | 1969-03-24 | 1969-03-24 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI52712B FI52712B (OSRAM) | 1977-08-01 |
| FI52712C true FI52712C (fi) | 1977-11-10 |
Family
ID=25202591
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI700556A FI52712C (fi) | 1969-03-24 | 1970-03-02 | Menetelmä d- tai 1-2-(6'-substituoitu-2'-naftyyli)propionihapon valmis tamiseksi. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3686183A (OSRAM) |
| JP (1) | JPS4931981B1 (OSRAM) |
| BE (1) | BE747864A (OSRAM) |
| CH (1) | CH545263A (OSRAM) |
| DK (1) | DK153136C (OSRAM) |
| ES (1) | ES377842A1 (OSRAM) |
| FI (1) | FI52712C (OSRAM) |
| FR (1) | FR2037244B1 (OSRAM) |
| GB (1) | GB1296493A (OSRAM) |
| IL (1) | IL33847A (OSRAM) |
| NL (1) | NL147116B (OSRAM) |
| NO (1) | NO128606B (OSRAM) |
| SE (1) | SE385868B (OSRAM) |
| ZA (1) | ZA70810B (OSRAM) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3904683A (en) * | 1972-08-10 | 1975-09-09 | Syntex Corp | Process for the resolution of d- and 1-2-(6-methoxy-2-naphthyl) propionic acid |
| US4033816A (en) * | 1973-06-18 | 1977-07-05 | The Upjohn Company | Process for inhibiting platelet aggregation |
| GB1497044A (en) * | 1974-03-07 | 1978-01-05 | Prodotti Antibiotici Spa | Salts of phenyl-alkanoic acids |
| JPS535134A (en) * | 1976-06-30 | 1978-01-18 | Sumitomo Chem Co Ltd | Racemization of optical active 2-(4)chlorophenyl)-3-methylbutylic acid |
| US4209638A (en) * | 1977-03-08 | 1980-06-24 | The Boots Company Limited | Preparation of therapeutic agents |
| PT67743A (en) * | 1977-03-08 | 1978-04-01 | Boots Co Ltd | Preparation of therapeutic agents |
| DE2733425C2 (de) * | 1977-07-23 | 1982-08-26 | Riedel-De Haen Ag, 3016 Seelze | Verfahren zur Herstellung von D(-)-Mandelsäure aus DL-Mandelsäure durch racemische Spaltung |
| JPS54151912A (en) * | 1978-05-18 | 1979-11-29 | Santen Pharmaceutical Co Ltd | Manufacture of photoactive sulfur contained carboxylic acid |
| CH641432A5 (de) * | 1978-07-19 | 1984-02-29 | Syntex Pharma Int | Verfahren zur aufspaltung von racemischer 6-methoxy-alpha-methyl-2-naphthalinessigsaeure in die optischen antipoden. |
| PH15674A (en) * | 1979-07-06 | 1983-03-11 | Syntex Corp | Process for the resolution of d,1 2-(6-methoxy-2-naphthyl)propionic acid |
| US4259521A (en) * | 1979-10-09 | 1981-03-31 | American Cyanamid Company | Process for resolving DL-mandelic acid |
| US4260815A (en) * | 1979-10-09 | 1981-04-07 | American Cyanamid Company | Process for preparing a solution of DL-mandelic acid |
| IT1154663B (it) * | 1980-07-30 | 1987-01-21 | Alfa Chimica Italiana Spa | Procedimento per la risoluzione in antipodi ottici di miscele di acidi d- e l-2-(6-metossi-2-naftil)-propionico |
| IT1168387B (it) * | 1981-04-01 | 1987-05-20 | Alfa Farmaceutici Spa | Procedimento per la preparazione dell'acido 2-(6-metossi-2-naftil)-propionico |
| IT1164319B (it) * | 1983-07-27 | 1987-04-08 | Blaschim Spa | Procedimento per la risoluzione dell'acido (+-)2-(6'-metossi-2'-naftil)-propionico |
| IT1208109B (it) * | 1983-11-23 | 1989-06-06 | Alfa Chem Ital | Procedimento per la risoluzione ottica di acidi arilpropionici |
| IT1196332B (it) * | 1984-11-20 | 1988-11-16 | Secifarma Spa | Procedimento per la risoluzione dell'acido (+)-6-metossi-alfa-metil-2-naftalen acetico nei corrispondenti antipodi ottici |
| IT1203605B (it) * | 1985-04-18 | 1989-02-15 | Alfa Chem Ital | Processo per la risoluzione ottica di miscigli racemi di acidi e naftilpropionici |
| NL8602767A (nl) * | 1986-10-31 | 1988-05-16 | Gantax Nv | Organisch zuuranhydride, alsmede farmaceutisch preparaat op basis van een prodrug. |
| US5266723A (en) * | 1989-05-16 | 1993-11-30 | Medice, Ltd., Chem.-Pharm. Fabrik Putter Gmbh & Co. Kg | Process for the preparation of optically active 2-aryl-alkanoic acids, especially 2-aryl-propionic acids |
| NL9001703A (nl) * | 1990-07-27 | 1992-02-17 | Westspur Investment Ltd | Werkwijze voor de bereiding van s(+)-6-methoxy-alfa-methyl-2-naftaleen-azijnzuur. |
| JP2000512638A (ja) * | 1996-06-10 | 2000-09-26 | アルベマール・コーポレーシヨン | 光学活性カルボン酸またはその塩もしくはエステルのラセミ化方法 |
| US6080888A (en) * | 1997-01-08 | 2000-06-27 | Albemarle Corporation | Preparation of olefinic compounds and carboxylic derivatives thereof |
| US6096920A (en) * | 1997-01-08 | 2000-08-01 | Albemarle Corporation | Preparation of carboxylic compounds and their derivatives |
| US5792886A (en) * | 1997-01-08 | 1998-08-11 | Albemarle Corporation | Production of racemic 2-(6-methoxy-2-naphthyl) propionic acid of precursors thereof |
| US5874614A (en) * | 1997-12-11 | 1999-02-23 | Albemarle Corporation | Sodium (S)-2-(6-methoxy-2-naphthyl)propionate monohydrate |
| US5859292A (en) * | 1997-12-11 | 1999-01-12 | Albemarle Corporation | Preparation of high purity sodium (S)-2(6-methoxy-2-naphthyl)propionate |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK140007B (da) * | 1969-07-09 | 1979-06-05 | Syntex Corp | Fremgangsmåde til fremstilling af 2-(6'-methoxynapht-2'-yl)propionsyre. |
-
1969
- 1969-03-24 US US809957A patent/US3686183A/en not_active Expired - Lifetime
-
1970
- 1970-02-05 IL IL33847A patent/IL33847A/xx unknown
- 1970-02-05 ZA ZA700810A patent/ZA70810B/xx unknown
- 1970-02-24 GB GB1296493D patent/GB1296493A/en not_active Expired
- 1970-02-26 CH CH285870A patent/CH545263A/de not_active IP Right Cessation
- 1970-03-02 FI FI700556A patent/FI52712C/fi active
- 1970-03-03 NO NO00749/70*[A patent/NO128606B/no unknown
- 1970-03-23 ES ES377842A patent/ES377842A1/es not_active Expired
- 1970-03-23 FR FR7010419A patent/FR2037244B1/fr not_active Expired
- 1970-03-23 SE SE7003931A patent/SE385868B/xx unknown
- 1970-03-24 DK DK149770A patent/DK153136C/da not_active IP Right Cessation
- 1970-03-24 NL NL707004197A patent/NL147116B/xx not_active IP Right Cessation
- 1970-03-24 JP JP45024794A patent/JPS4931981B1/ja active Pending
- 1970-03-24 BE BE747864D patent/BE747864A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NL147116B (nl) | 1975-09-15 |
| IL33847A0 (en) | 1970-04-20 |
| ES377842A1 (es) | 1973-01-01 |
| IL33847A (en) | 1974-06-30 |
| JPS4931981B1 (OSRAM) | 1974-08-27 |
| US3686183A (en) | 1972-08-22 |
| ZA70810B (en) | 1971-09-29 |
| FR2037244B1 (OSRAM) | 1974-10-11 |
| GB1296493A (OSRAM) | 1972-11-15 |
| DK153136B (da) | 1988-06-20 |
| DE2008272A1 (de) | 1970-10-15 |
| CH545263A (de) | 1973-12-15 |
| DK153136C (da) | 1988-10-31 |
| SE385868B (sv) | 1976-07-26 |
| DE2008272B2 (de) | 1977-06-02 |
| NO128606B (OSRAM) | 1973-12-17 |
| FR2037244A1 (OSRAM) | 1970-12-31 |
| FI52712B (OSRAM) | 1977-08-01 |
| BE747864A (fr) | 1970-08-31 |
| NL7004197A (OSRAM) | 1970-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI52712C (fi) | Menetelmä d- tai 1-2-(6'-substituoitu-2'-naftyyli)propionihapon valmis tamiseksi. | |
| DK139962B (da) | Fremgangsmåde til fremstilling af 2-(6'-metoksy-2'-naftyl)propionsyre. | |
| NL158498B (nl) | Werkwijze ter bereiding van 7 beta-acylamido-3-methylcef-3-em-4-carbonzuuresters. | |
| DK129581B (da) | Analogifremgangsmåde til fremstilling af substituerede N-allyl-2-arylamino-imidazolin-(2)-forbindelser eller syreadditionssalte deraf. | |
| CH550757A (fr) | Procede de preparation d'acides cyclopropylmethylphenylacetiques. | |
| CH550177A (de) | Verfahren zur herstellung von substituierten n-aminoalkyl-arylamino-imidazolinen-(2). | |
| CH551437A (fr) | Procede de preparation d'acides chromone-carboxyliques. | |
| CH552633A (de) | Verfahren zur herstellung von 2-halogenaethylphosphonsaeuren. | |
| CH532566A (de) | Verfahren zur Herstellung von 4.20.22-Bufatrienolidrhamnosid-äthern | |
| CH542849A (de) | Verfahren zur Herstellung von 3,5-Diphenyl-4-pyrazolessigsäure | |
| FI51183C (fi) | Menetelmä 2-hydroksimetyyli-3-karbonihappoamido-kinoksaliini-di-N-oksi de-(1,4)-yhdisteiden valmistamiseksi. | |
| NL166696C (nl) | Werkwijze ter bereiding van digoxine-3'''-monomethyl- ether. | |
| CH550131A (de) | Verfahren zur herstellung substituierter alkencarbonsaeuren. | |
| FI49832C (fi) | Menetelmä ortopiinihappotetrametyyliesterin valmistamiseksi. | |
| CH537366A (de) | Verfahren zur Herstellung von 4-Aminoalkyl-bicyclo-(2,2,2)-octan-1-carbonsäuren | |
| CH551358A (de) | Verfahren zur herstellung von 5,9-dioxodecansaeuren. | |
| IL34687A0 (en) | Compounds of alpha-hydrazino-alpha substituted-beta-(3,4-dihydroxyphenyl)propionic acid | |
| BE760555A (fr) | Procede d'hydroformylation | |
| NL165750C (nl) | Werkwijze ter bereiding van gesubstitueerde 7 amino delta&002-cefem 4-carbonzuur esters. | |
| CH547249A (de) | Verfahren zur herstellung von monoaethern des 1,2-dihydroxybenzols. | |
| AT319269B (de) | Verfahren zur Herstellung von O,O-Dialky-O-(2,2-dichlorvinyl)-thionophosphorsäureestern | |
| FI45756C (fi) | Menetelmä kard-20(22)enolidien 3beta-tridesoksipyranosidien valmistami seksi. | |
| CH502990A (de) | Verfahren zur Herstellung von N-Kohlensäurederivaten von 1,2-Dicarbonyl-phenylhydrazonen | |
| AT296246B (de) | Verfahren zur Herstellung von Hexanal-(6)-säure | |
| CH547248A (de) | Verfahren zur herstellung von 2-(6-methoxy-2-naphthyl)1-propanol. |